using for loop to install conda package

.CondaPkg/env/Lib/site-packages/scipy/special/__init__.py

@@ -0,0 +1,710 @@
+"""
+========================================
+Special functions (:mod:`scipy.special`)
+========================================
+
+.. currentmodule:: scipy.special
+
+Almost all of the functions below accept NumPy arrays as input
+arguments as well as single numbers. This means they follow
+broadcasting and automatic array-looping rules. Technically,
+they are `NumPy universal functions
+<https://numpy.org/doc/stable/user/basics.ufuncs.html#ufuncs-basics>`_.
+Functions which do not accept NumPy arrays are marked by a warning
+in the section description.
+
+.. seealso::
+
+   `scipy.special.cython_special` -- Typed Cython versions of special functions
+
+
+Error handling
+==============
+
+Errors are handled by returning NaNs or other appropriate values.
+Some of the special function routines can emit warnings or raise
+exceptions when an error occurs. By default this is disabled; to
+query and control the current error handling state the following
+functions are provided.
+
+.. autosummary::
+   :toctree: generated/
+
+   geterr                 -- Get the current way of handling special-function errors.
+   seterr                 -- Set how special-function errors are handled.
+   errstate               -- Context manager for special-function error handling.
+   SpecialFunctionWarning -- Warning that can be emitted by special functions.
+   SpecialFunctionError   -- Exception that can be raised by special functions.
+
+Available functions
+===================
+
+Airy functions
+--------------
+
+.. autosummary::
+   :toctree: generated/
+
+   airy     -- Airy functions and their derivatives.
+   airye    -- Exponentially scaled Airy functions and their derivatives.
+   ai_zeros -- Compute `nt` zeros and values of the Airy function Ai and its derivative.
+   bi_zeros -- Compute `nt` zeros and values of the Airy function Bi and its derivative.
+   itairy   -- Integrals of Airy functions
+
+
+Elliptic functions and integrals
+--------------------------------
+
+.. autosummary::
+   :toctree: generated/
+
+   ellipj    -- Jacobian elliptic functions.
+   ellipk    -- Complete elliptic integral of the first kind.
+   ellipkm1  -- Complete elliptic integral of the first kind around `m` = 1.
+   ellipkinc -- Incomplete elliptic integral of the first kind.
+   ellipe    -- Complete elliptic integral of the second kind.
+   ellipeinc -- Incomplete elliptic integral of the second kind.
+   elliprc   -- Degenerate symmetric integral RC.
+   elliprd   -- Symmetric elliptic integral of the second kind.
+   elliprf   -- Completely-symmetric elliptic integral of the first kind.
+   elliprg   -- Completely-symmetric elliptic integral of the second kind.
+   elliprj   -- Symmetric elliptic integral of the third kind.
+
+Bessel functions
+----------------
+
+.. autosummary::
+   :toctree: generated/
+
+   jv            -- Bessel function of the first kind of real order and \
+                    complex argument.
+   jve           -- Exponentially scaled Bessel function of order `v`.
+   yn            -- Bessel function of the second kind of integer order and \
+                    real argument.
+   yv            -- Bessel function of the second kind of real order and \
+                    complex argument.
+   yve           -- Exponentially scaled Bessel function of the second kind \
+                    of real order.
+   kn            -- Modified Bessel function of the second kind of integer \
+                    order `n`
+   kv            -- Modified Bessel function of the second kind of real order \
+                    `v`
+   kve           -- Exponentially scaled modified Bessel function of the \
+                    second kind.
+   iv            -- Modified Bessel function of the first kind of real order.
+   ive           -- Exponentially scaled modified Bessel function of the \
+                    first kind.
+   hankel1       -- Hankel function of the first kind.
+   hankel1e      -- Exponentially scaled Hankel function of the first kind.
+   hankel2       -- Hankel function of the second kind.
+   hankel2e      -- Exponentially scaled Hankel function of the second kind.
+   wright_bessel -- Wright's generalized Bessel function.
+
+The following function does not accept NumPy arrays (it is not a
+universal function):
+
+.. autosummary::
+   :toctree: generated/
+
+   lmbda -- Jahnke-Emden Lambda function, Lambdav(x).
+
+Zeros of Bessel functions
+^^^^^^^^^^^^^^^^^^^^^^^^^
+
+The following functions do not accept NumPy arrays (they are not
+universal functions):
+
+.. autosummary::
+   :toctree: generated/
+
+   jnjnp_zeros -- Compute zeros of integer-order Bessel functions Jn and Jn'.
+   jnyn_zeros  -- Compute nt zeros of Bessel functions Jn(x), Jn'(x), Yn(x), and Yn'(x).
+   jn_zeros    -- Compute zeros of integer-order Bessel function Jn(x).
+   jnp_zeros   -- Compute zeros of integer-order Bessel function derivative Jn'(x).
+   yn_zeros    -- Compute zeros of integer-order Bessel function Yn(x).
+   ynp_zeros   -- Compute zeros of integer-order Bessel function derivative Yn'(x).
+   y0_zeros    -- Compute nt zeros of Bessel function Y0(z), and derivative at each zero.
+   y1_zeros    -- Compute nt zeros of Bessel function Y1(z), and derivative at each zero.
+   y1p_zeros   -- Compute nt zeros of Bessel derivative Y1'(z), and value at each zero.
+
+Faster versions of common Bessel functions
+^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^
+
+.. autosummary::
+   :toctree: generated/
+
+   j0  -- Bessel function of the first kind of order 0.
+   j1  -- Bessel function of the first kind of order 1.
+   y0  -- Bessel function of the second kind of order 0.
+   y1  -- Bessel function of the second kind of order 1.
+   i0  -- Modified Bessel function of order 0.
+   i0e -- Exponentially scaled modified Bessel function of order 0.
+   i1  -- Modified Bessel function of order 1.
+   i1e -- Exponentially scaled modified Bessel function of order 1.
+   k0  -- Modified Bessel function of the second kind of order 0, :math:`K_0`.
+   k0e -- Exponentially scaled modified Bessel function K of order 0
+   k1  -- Modified Bessel function of the second kind of order 1, :math:`K_1(x)`.
+   k1e -- Exponentially scaled modified Bessel function K of order 1.
+
+Integrals of Bessel functions
+^^^^^^^^^^^^^^^^^^^^^^^^^^^^^
+
+.. autosummary::
+   :toctree: generated/
+
+   itj0y0     -- Integrals of Bessel functions of order 0.
+   it2j0y0    -- Integrals related to Bessel functions of order 0.
+   iti0k0     -- Integrals of modified Bessel functions of order 0.
+   it2i0k0    -- Integrals related to modified Bessel functions of order 0.
+   besselpoly -- Weighted integral of a Bessel function.
+
+Derivatives of Bessel functions
+^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^
+
+.. autosummary::
+   :toctree: generated/
+
+   jvp  -- Compute nth derivative of Bessel function Jv(z) with respect to `z`.
+   yvp  -- Compute nth derivative of Bessel function Yv(z) with respect to `z`.
+   kvp  -- Compute nth derivative of real-order modified Bessel function Kv(z)
+   ivp  -- Compute nth derivative of modified Bessel function Iv(z) with respect to `z`.
+   h1vp -- Compute nth derivative of Hankel function H1v(z) with respect to `z`.
+   h2vp -- Compute nth derivative of Hankel function H2v(z) with respect to `z`.
+
+Spherical Bessel functions
+^^^^^^^^^^^^^^^^^^^^^^^^^^
+
+.. autosummary::
+   :toctree: generated/
+
+   spherical_jn -- Spherical Bessel function of the first kind or its derivative.
+   spherical_yn -- Spherical Bessel function of the second kind or its derivative.
+   spherical_in -- Modified spherical Bessel function of the first kind or its derivative.
+   spherical_kn -- Modified spherical Bessel function of the second kind or its derivative.
+
+Riccati-Bessel functions
+^^^^^^^^^^^^^^^^^^^^^^^^
+
+The following functions do not accept NumPy arrays (they are not
+universal functions):
+
+.. autosummary::
+   :toctree: generated/
+
+   riccati_jn -- Compute Ricatti-Bessel function of the first kind and its derivative.
+   riccati_yn -- Compute Ricatti-Bessel function of the second kind and its derivative.
+
+Struve functions
+----------------
+
+.. autosummary::
+   :toctree: generated/
+
+   struve       -- Struve function.
+   modstruve    -- Modified Struve function.
+   itstruve0    -- Integral of the Struve function of order 0.
+   it2struve0   -- Integral related to the Struve function of order 0.
+   itmodstruve0 -- Integral of the modified Struve function of order 0.
+
+
+Raw statistical functions
+-------------------------
+
+.. seealso:: :mod:`scipy.stats`: Friendly versions of these functions.
+
+.. autosummary::
+   :toctree: generated/
+
+   bdtr         -- Binomial distribution cumulative distribution function.
+   bdtrc        -- Binomial distribution survival function.
+   bdtri        -- Inverse function to `bdtr` with respect to `p`.
+   bdtrik       -- Inverse function to `bdtr` with respect to `k`.
+   bdtrin       -- Inverse function to `bdtr` with respect to `n`.
+   btdtr        -- Cumulative distribution function of the beta distribution.
+   btdtri       -- The `p`-th quantile of the beta distribution.
+   btdtria      -- Inverse of `btdtr` with respect to `a`.
+   btdtrib      -- btdtria(a, p, x).
+   fdtr         -- F cumulative distribution function.
+   fdtrc        -- F survival function.
+   fdtri        -- The `p`-th quantile of the F-distribution.
+   fdtridfd     -- Inverse to `fdtr` vs dfd.
+   gdtr         -- Gamma distribution cumulative distribution function.
+   gdtrc        -- Gamma distribution survival function.
+   gdtria       -- Inverse of `gdtr` vs a.
+   gdtrib       -- Inverse of `gdtr` vs b.
+   gdtrix       -- Inverse of `gdtr` vs x.
+   nbdtr        -- Negative binomial cumulative distribution function.
+   nbdtrc       -- Negative binomial survival function.
+   nbdtri       -- Inverse of `nbdtr` vs `p`.
+   nbdtrik      -- Inverse of `nbdtr` vs `k`.
+   nbdtrin      -- Inverse of `nbdtr` vs `n`.
+   ncfdtr       -- Cumulative distribution function of the non-central F distribution.
+   ncfdtridfd   -- Calculate degrees of freedom (denominator) for the noncentral F-distribution.
+   ncfdtridfn   -- Calculate degrees of freedom (numerator) for the noncentral F-distribution.
+   ncfdtri      -- Inverse cumulative distribution function of the non-central F distribution.
+   ncfdtrinc    -- Calculate non-centrality parameter for non-central F distribution.
+   nctdtr       -- Cumulative distribution function of the non-central `t` distribution.
+   nctdtridf    -- Calculate degrees of freedom for non-central t distribution.
+   nctdtrit     -- Inverse cumulative distribution function of the non-central t distribution.
+   nctdtrinc    -- Calculate non-centrality parameter for non-central t distribution.
+   nrdtrimn     -- Calculate mean of normal distribution given other params.
+   nrdtrisd     -- Calculate standard deviation of normal distribution given other params.
+   pdtr         -- Poisson cumulative distribution function.
+   pdtrc        -- Poisson survival function.
+   pdtri        -- Inverse to `pdtr` vs m.
+   pdtrik       -- Inverse to `pdtr` vs k.
+   stdtr        -- Student t distribution cumulative distribution function.
+   stdtridf     -- Inverse of `stdtr` vs df.
+   stdtrit      -- Inverse of `stdtr` vs `t`.
+   chdtr        -- Chi square cumulative distribution function.
+   chdtrc       -- Chi square survival function.
+   chdtri       -- Inverse to `chdtrc`.
+   chdtriv      -- Inverse to `chdtr` vs `v`.
+   ndtr         -- Gaussian cumulative distribution function.
+   log_ndtr     -- Logarithm of Gaussian cumulative distribution function.
+   ndtri        -- Inverse of `ndtr` vs x.
+   ndtri_exp    -- Inverse of `log_ndtr` vs x.
+   chndtr       -- Non-central chi square cumulative distribution function.
+   chndtridf    -- Inverse to `chndtr` vs `df`.
+   chndtrinc    -- Inverse to `chndtr` vs `nc`.
+   chndtrix     -- Inverse to `chndtr` vs `x`.
+   smirnov      -- Kolmogorov-Smirnov complementary cumulative distribution function.
+   smirnovi     -- Inverse to `smirnov`.
+   kolmogorov   -- Complementary cumulative distribution function of Kolmogorov distribution.
+   kolmogi      -- Inverse function to `kolmogorov`.
+   tklmbda      -- Tukey-Lambda cumulative distribution function.
+   logit        -- Logit ufunc for ndarrays.
+   expit        -- Logistic sigmoid function.
+   log_expit    -- Logarithm of the logistic sigmoid function.
+   boxcox       -- Compute the Box-Cox transformation.
+   boxcox1p     -- Compute the Box-Cox transformation of 1 + `x`.
+   inv_boxcox   -- Compute the inverse of the Box-Cox transformation.
+   inv_boxcox1p -- Compute the inverse of the Box-Cox transformation.
+   owens_t      -- Owen's T Function.
+
+
+Information Theory functions
+----------------------------
+
+.. autosummary::
+   :toctree: generated/
+
+   entr         -- Elementwise function for computing entropy.
+   rel_entr     -- Elementwise function for computing relative entropy.
+   kl_div       -- Elementwise function for computing Kullback-Leibler divergence.
+   huber        -- Huber loss function.
+   pseudo_huber -- Pseudo-Huber loss function.
+
+
+Gamma and related functions
+---------------------------
+
+.. autosummary::
+   :toctree: generated/
+
+   gamma        -- Gamma function.
+   gammaln      -- Logarithm of the absolute value of the Gamma function for real inputs.
+   loggamma     -- Principal branch of the logarithm of the Gamma function.
+   gammasgn     -- Sign of the gamma function.
+   gammainc     -- Regularized lower incomplete gamma function.
+   gammaincinv  -- Inverse to `gammainc`.
+   gammaincc    -- Regularized upper incomplete gamma function.
+   gammainccinv -- Inverse to `gammaincc`.
+   beta         -- Beta function.
+   betaln       -- Natural logarithm of absolute value of beta function.
+   betainc      -- Incomplete beta integral.
+   betaincinv   -- Inverse function to beta integral.
+   psi          -- The digamma function.
+   rgamma       -- Gamma function inverted.
+   polygamma    -- Polygamma function n.
+   multigammaln -- Returns the log of multivariate gamma, also sometimes called the generalized gamma.
+   digamma      -- psi(x[, out]).
+   poch         -- Rising factorial (z)_m.
+
+
+Error function and Fresnel integrals
+------------------------------------
+
+.. autosummary::
+   :toctree: generated/
+
+   erf           -- Returns the error function of complex argument.
+   erfc          -- Complementary error function, ``1 - erf(x)``.
+   erfcx         -- Scaled complementary error function, ``exp(x**2) * erfc(x)``.
+   erfi          -- Imaginary error function, ``-i erf(i z)``.
+   erfinv        -- Inverse function for erf.
+   erfcinv       -- Inverse function for erfc.
+   wofz          -- Faddeeva function.
+   dawsn         -- Dawson's integral.
+   fresnel       -- Fresnel sin and cos integrals.
+   fresnel_zeros -- Compute nt complex zeros of sine and cosine Fresnel integrals S(z) and C(z).
+   modfresnelp   -- Modified Fresnel positive integrals.
+   modfresnelm   -- Modified Fresnel negative integrals.
+   voigt_profile -- Voigt profile.
+
+The following functions do not accept NumPy arrays (they are not
+universal functions):
+
+.. autosummary::
+   :toctree: generated/
+
+   erf_zeros      -- Compute nt complex zeros of error function erf(z).
+   fresnelc_zeros -- Compute nt complex zeros of cosine Fresnel integral C(z).
+   fresnels_zeros -- Compute nt complex zeros of sine Fresnel integral S(z).
+
+Legendre functions
+------------------
+
+.. autosummary::
+   :toctree: generated/
+
+   lpmv     -- Associated Legendre function of integer order and real degree.
+   sph_harm -- Compute spherical harmonics.
+
+The following functions do not accept NumPy arrays (they are not
+universal functions):
+
+.. autosummary::
+   :toctree: generated/
+
+   clpmn -- Associated Legendre function of the first kind for complex arguments.
+   lpn   -- Legendre function of the first kind.
+   lqn   -- Legendre function of the second kind.
+   lpmn  -- Sequence of associated Legendre functions of the first kind.
+   lqmn  -- Sequence of associated Legendre functions of the second kind.
+
+Ellipsoidal harmonics
+---------------------
+
+.. autosummary::
+   :toctree: generated/
+
+   ellip_harm   -- Ellipsoidal harmonic functions E^p_n(l).
+   ellip_harm_2 -- Ellipsoidal harmonic functions F^p_n(l).
+   ellip_normal -- Ellipsoidal harmonic normalization constants gamma^p_n.
+
+Orthogonal polynomials
+----------------------
+
+The following functions evaluate values of orthogonal polynomials:
+
+.. autosummary::
+   :toctree: generated/
+
+   assoc_laguerre   -- Compute the generalized (associated) Laguerre polynomial of degree n and order k.
+   eval_legendre    -- Evaluate Legendre polynomial at a point.
+   eval_chebyt      -- Evaluate Chebyshev polynomial of the first kind at a point.
+   eval_chebyu      -- Evaluate Chebyshev polynomial of the second kind at a point.
+   eval_chebyc      -- Evaluate Chebyshev polynomial of the first kind on [-2, 2] at a point.
+   eval_chebys      -- Evaluate Chebyshev polynomial of the second kind on [-2, 2] at a point.
+   eval_jacobi      -- Evaluate Jacobi polynomial at a point.
+   eval_laguerre    -- Evaluate Laguerre polynomial at a point.
+   eval_genlaguerre -- Evaluate generalized Laguerre polynomial at a point.
+   eval_hermite     -- Evaluate physicist's Hermite polynomial at a point.
+   eval_hermitenorm -- Evaluate probabilist's (normalized) Hermite polynomial at a point.
+   eval_gegenbauer  -- Evaluate Gegenbauer polynomial at a point.
+   eval_sh_legendre -- Evaluate shifted Legendre polynomial at a point.
+   eval_sh_chebyt   -- Evaluate shifted Chebyshev polynomial of the first kind at a point.
+   eval_sh_chebyu   -- Evaluate shifted Chebyshev polynomial of the second kind at a point.
+   eval_sh_jacobi   -- Evaluate shifted Jacobi polynomial at a point.
+
+The following functions compute roots and quadrature weights for
+orthogonal polynomials:
+
+.. autosummary::
+   :toctree: generated/
+
+   roots_legendre    -- Gauss-Legendre quadrature.
+   roots_chebyt      -- Gauss-Chebyshev (first kind) quadrature.
+   roots_chebyu      -- Gauss-Chebyshev (second kind) quadrature.
+   roots_chebyc      -- Gauss-Chebyshev (first kind) quadrature.
+   roots_chebys      -- Gauss-Chebyshev (second kind) quadrature.
+   roots_jacobi      -- Gauss-Jacobi quadrature.
+   roots_laguerre    -- Gauss-Laguerre quadrature.
+   roots_genlaguerre -- Gauss-generalized Laguerre quadrature.
+   roots_hermite     -- Gauss-Hermite (physicst's) quadrature.
+   roots_hermitenorm -- Gauss-Hermite (statistician's) quadrature.
+   roots_gegenbauer  -- Gauss-Gegenbauer quadrature.
+   roots_sh_legendre -- Gauss-Legendre (shifted) quadrature.
+   roots_sh_chebyt   -- Gauss-Chebyshev (first kind, shifted) quadrature.
+   roots_sh_chebyu   -- Gauss-Chebyshev (second kind, shifted) quadrature.
+   roots_sh_jacobi   -- Gauss-Jacobi (shifted) quadrature.
+
+The functions below, in turn, return the polynomial coefficients in
+``orthopoly1d`` objects, which function similarly as `numpy.poly1d`.
+The ``orthopoly1d`` class also has an attribute ``weights``, which returns
+the roots, weights, and total weights for the appropriate form of Gaussian
+quadrature. These are returned in an ``n x 3`` array with roots in the first
+column, weights in the second column, and total weights in the final column.
+Note that ``orthopoly1d`` objects are converted to `~numpy.poly1d` when doing
+arithmetic, and lose information of the original orthogonal polynomial.
+
+.. autosummary::
+   :toctree: generated/
+
+   legendre    -- Legendre polynomial.
+   chebyt      -- Chebyshev polynomial of the first kind.
+   chebyu      -- Chebyshev polynomial of the second kind.
+   chebyc      -- Chebyshev polynomial of the first kind on :math:`[-2, 2]`.
+   chebys      -- Chebyshev polynomial of the second kind on :math:`[-2, 2]`.
+   jacobi      -- Jacobi polynomial.
+   laguerre    -- Laguerre polynomial.
+   genlaguerre -- Generalized (associated) Laguerre polynomial.
+   hermite     -- Physicist's Hermite polynomial.
+   hermitenorm -- Normalized (probabilist's) Hermite polynomial.
+   gegenbauer  -- Gegenbauer (ultraspherical) polynomial.
+   sh_legendre -- Shifted Legendre polynomial.
+   sh_chebyt   -- Shifted Chebyshev polynomial of the first kind.
+   sh_chebyu   -- Shifted Chebyshev polynomial of the second kind.
+   sh_jacobi   -- Shifted Jacobi polynomial.
+
+.. warning::
+
+   Computing values of high-order polynomials (around ``order > 20``) using
+   polynomial coefficients is numerically unstable. To evaluate polynomial
+   values, the ``eval_*`` functions should be used instead.
+
+
+Hypergeometric functions
+------------------------
+
+.. autosummary::
+   :toctree: generated/
+
+   hyp2f1 -- Gauss hypergeometric function 2F1(a, b; c; z).
+   hyp1f1 -- Confluent hypergeometric function 1F1(a, b; x).
+   hyperu -- Confluent hypergeometric function U(a, b, x) of the second kind.
+   hyp0f1 -- Confluent hypergeometric limit function 0F1.
+
+
+Parabolic cylinder functions
+----------------------------
+
+.. autosummary::
+   :toctree: generated/
+
+   pbdv -- Parabolic cylinder function D.
+   pbvv -- Parabolic cylinder function V.
+   pbwa -- Parabolic cylinder function W.
+
+The following functions do not accept NumPy arrays (they are not
+universal functions):
+
+.. autosummary::
+   :toctree: generated/
+
+   pbdv_seq -- Parabolic cylinder functions Dv(x) and derivatives.
+   pbvv_seq -- Parabolic cylinder functions Vv(x) and derivatives.
+   pbdn_seq -- Parabolic cylinder functions Dn(z) and derivatives.
+
+Mathieu and related functions
+-----------------------------
+
+.. autosummary::
+   :toctree: generated/
+
+   mathieu_a -- Characteristic value of even Mathieu functions.
+   mathieu_b -- Characteristic value of odd Mathieu functions.
+
+The following functions do not accept NumPy arrays (they are not
+universal functions):
+
+.. autosummary::
+   :toctree: generated/
+
+   mathieu_even_coef -- Fourier coefficients for even Mathieu and modified Mathieu functions.
+   mathieu_odd_coef  -- Fourier coefficients for even Mathieu and modified Mathieu functions.
+
+The following return both function and first derivative:
+
+.. autosummary::
+   :toctree: generated/
+
+   mathieu_cem     -- Even Mathieu function and its derivative.
+   mathieu_sem     -- Odd Mathieu function and its derivative.
+   mathieu_modcem1 -- Even modified Mathieu function of the first kind and its derivative.
+   mathieu_modcem2 -- Even modified Mathieu function of the second kind and its derivative.
+   mathieu_modsem1 -- Odd modified Mathieu function of the first kind and its derivative.
+   mathieu_modsem2 -- Odd modified Mathieu function of the second kind and its derivative.
+
+Spheroidal wave functions
+-------------------------
+
+.. autosummary::
+   :toctree: generated/
+
+   pro_ang1   -- Prolate spheroidal angular function of the first kind and its derivative.
+   pro_rad1   -- Prolate spheroidal radial function of the first kind and its derivative.
+   pro_rad2   -- Prolate spheroidal radial function of the secon kind and its derivative.
+   obl_ang1   -- Oblate spheroidal angular function of the first kind and its derivative.
+   obl_rad1   -- Oblate spheroidal radial function of the first kind and its derivative.
+   obl_rad2   -- Oblate spheroidal radial function of the second kind and its derivative.
+   pro_cv     -- Characteristic value of prolate spheroidal function.
+   obl_cv     -- Characteristic value of oblate spheroidal function.
+   pro_cv_seq -- Characteristic values for prolate spheroidal wave functions.
+   obl_cv_seq -- Characteristic values for oblate spheroidal wave functions.
+
+The following functions require pre-computed characteristic value:
+
+.. autosummary::
+   :toctree: generated/
+
+   pro_ang1_cv -- Prolate spheroidal angular function pro_ang1 for precomputed characteristic value.
+   pro_rad1_cv -- Prolate spheroidal radial function pro_rad1 for precomputed characteristic value.
+   pro_rad2_cv -- Prolate spheroidal radial function pro_rad2 for precomputed characteristic value.
+   obl_ang1_cv -- Oblate spheroidal angular function obl_ang1 for precomputed characteristic value.
+   obl_rad1_cv -- Oblate spheroidal radial function obl_rad1 for precomputed characteristic value.
+   obl_rad2_cv -- Oblate spheroidal radial function obl_rad2 for precomputed characteristic value.
+
+Kelvin functions
+----------------
+
+.. autosummary::
+   :toctree: generated/
+
+   kelvin       -- Kelvin functions as complex numbers.
+   kelvin_zeros -- Compute nt zeros of all Kelvin functions.
+   ber          -- Kelvin function ber.
+   bei          -- Kelvin function bei
+   berp         -- Derivative of the Kelvin function `ber`.
+   beip         -- Derivative of the Kelvin function `bei`.
+   ker          -- Kelvin function ker.
+   kei          -- Kelvin function ker.
+   kerp         -- Derivative of the Kelvin function ker.
+   keip         -- Derivative of the Kelvin function kei.
+
+The following functions do not accept NumPy arrays (they are not
+universal functions):
+
+.. autosummary::
+   :toctree: generated/
+
+   ber_zeros  -- Compute nt zeros of the Kelvin function ber(x).
+   bei_zeros  -- Compute nt zeros of the Kelvin function bei(x).
+   berp_zeros -- Compute nt zeros of the Kelvin function ber'(x).
+   beip_zeros -- Compute nt zeros of the Kelvin function bei'(x).
+   ker_zeros  -- Compute nt zeros of the Kelvin function ker(x).
+   kei_zeros  -- Compute nt zeros of the Kelvin function kei(x).
+   kerp_zeros -- Compute nt zeros of the Kelvin function ker'(x).
+   keip_zeros -- Compute nt zeros of the Kelvin function kei'(x).
+
+Combinatorics
+-------------
+
+.. autosummary::
+   :toctree: generated/
+
+   comb -- The number of combinations of N things taken k at a time.
+   perm -- Permutations of N things taken k at a time, i.e., k-permutations of N.
+
+Lambert W and related functions
+-------------------------------
+
+.. autosummary::
+   :toctree: generated/
+
+   lambertw    -- Lambert W function.
+   wrightomega -- Wright Omega function.
+
+Other special functions
+-----------------------
+
+.. autosummary::
+   :toctree: generated/
+
+   agm         -- Arithmetic, Geometric Mean.
+   bernoulli   -- Bernoulli numbers B0..Bn (inclusive).
+   binom       -- Binomial coefficient
+   diric       -- Periodic sinc function, also called the Dirichlet function.
+   euler       -- Euler numbers E0..En (inclusive).
+   expn        -- Exponential integral E_n.
+   exp1        -- Exponential integral E_1 of complex argument z.
+   expi        -- Exponential integral Ei.
+   factorial   -- The factorial of a number or array of numbers.
+   factorial2  -- Double factorial.
+   factorialk  -- Multifactorial of n of order k, n(!!...!).
+   shichi      -- Hyperbolic sine and cosine integrals.
+   sici        -- Sine and cosine integrals.
+   softmax     -- Softmax function.
+   log_softmax -- Logarithm of softmax function.
+   spence      -- Spence's function, also known as the dilogarithm.
+   zeta        -- Riemann zeta function.
+   zetac       -- Riemann zeta function minus 1.
+
+Convenience functions
+---------------------
+
+.. autosummary::
+   :toctree: generated/
+
+   cbrt      -- Cube root of `x`.
+   exp10     -- 10**x.
+   exp2      -- 2**x.
+   radian    -- Convert from degrees to radians.
+   cosdg     -- Cosine of the angle `x` given in degrees.
+   sindg     -- Sine of angle given in degrees.
+   tandg     -- Tangent of angle x given in degrees.
+   cotdg     -- Cotangent of the angle `x` given in degrees.
+   log1p     -- Calculates log(1+x) for use when `x` is near zero.
+   expm1     -- ``exp(x) - 1`` for use when `x` is near zero.
+   cosm1     -- ``cos(x) - 1`` for use when `x` is near zero.
+   powm1     -- ``x**y - 1`` for use when `y` is near zero or `x` is near 1.
+   round     -- Round to nearest integer.
+   xlogy     -- Compute ``x*log(y)`` so that the result is 0 if ``x = 0``.
+   xlog1py   -- Compute ``x*log1p(y)`` so that the result is 0 if ``x = 0``.
+   logsumexp -- Compute the log of the sum of exponentials of input elements.
+   exprel    -- Relative error exponential, (exp(x)-1)/x, for use when `x` is near zero.
+   sinc      -- Return the sinc function.
+
+"""
+
+from ._sf_error import SpecialFunctionWarning, SpecialFunctionError
+
+from . import _ufuncs
+from ._ufuncs import *
+
+from . import _basic
+from ._basic import *
+
+from ._logsumexp import logsumexp, softmax, log_softmax
+
+from . import _orthogonal
+from ._orthogonal import *
+
+from ._spfun_stats import multigammaln
+from ._ellip_harm import (
+    ellip_harm,
+    ellip_harm_2,
+    ellip_normal
+)
+from ._lambertw import lambertw
+from ._spherical_bessel import (
+    spherical_jn,
+    spherical_yn,
+    spherical_in,
+    spherical_kn
+)
+
+# Deprecated namespaces, to be removed in v2.0.0
+from . import add_newdocs, basic, orthogonal, specfun, sf_error, spfun_stats
+
+__all__ = _ufuncs.__all__ + _basic.__all__ + _orthogonal.__all__ + [
+    'SpecialFunctionWarning',
+    'SpecialFunctionError',
+    'logsumexp',
+    'softmax',
+    'log_softmax',
+    'multigammaln',
+    'ellip_harm',
+    'ellip_harm_2',
+    'ellip_normal',
+    'lambertw',
+    'spherical_jn',
+    'spherical_yn',
+    'spherical_in',
+    'spherical_kn',
+]
+
+from scipy._lib._testutils import PytestTester
+test = PytestTester(__name__)
+del PytestTester

.CondaPkg/env/Lib/site-packages/scipy/special/_ellip_harm.py

@@ -0,0 +1,208 @@
+import numpy as np
+
+from ._ufuncs import _ellip_harm
+from ._ellip_harm_2 import _ellipsoid, _ellipsoid_norm
+
+
+def ellip_harm(h2, k2, n, p, s, signm=1, signn=1):
+    r"""
+    Ellipsoidal harmonic functions E^p_n(l)
+
+    These are also known as Lame functions of the first kind, and are
+    solutions to the Lame equation:
+
+    .. math:: (s^2 - h^2)(s^2 - k^2)E''(s) + s(2s^2 - h^2 - k^2)E'(s) + (a - q s^2)E(s) = 0
+
+    where :math:`q = (n+1)n` and :math:`a` is the eigenvalue (not
+    returned) corresponding to the solutions.
+
+    Parameters
+    ----------
+    h2 : float
+        ``h**2``
+    k2 : float
+        ``k**2``; should be larger than ``h**2``
+    n : int
+        Degree
+    s : float
+        Coordinate
+    p : int
+        Order, can range between [1,2n+1]
+    signm : {1, -1}, optional
+        Sign of prefactor of functions. Can be +/-1. See Notes.
+    signn : {1, -1}, optional
+        Sign of prefactor of functions. Can be +/-1. See Notes.
+
+    Returns
+    -------
+    E : float
+        the harmonic :math:`E^p_n(s)`
+
+    See Also
+    --------
+    ellip_harm_2, ellip_normal
+
+    Notes
+    -----
+    The geometric interpretation of the ellipsoidal functions is
+    explained in [2]_, [3]_, [4]_. The `signm` and `signn` arguments control the
+    sign of prefactors for functions according to their type::
+
+        K : +1
+        L : signm
+        M : signn
+        N : signm*signn
+
+    .. versionadded:: 0.15.0
+
+    References
+    ----------
+    .. [1] Digital Library of Mathematical Functions 29.12
+       https://dlmf.nist.gov/29.12
+    .. [2] Bardhan and Knepley, "Computational science and
+       re-discovery: open-source implementations of
+       ellipsoidal harmonics for problems in potential theory",
+       Comput. Sci. Disc. 5, 014006 (2012)
+       :doi:`10.1088/1749-4699/5/1/014006`.
+    .. [3] David J.and Dechambre P, "Computation of Ellipsoidal
+       Gravity Field Harmonics for small solar system bodies"
+       pp. 30-36, 2000
+    .. [4] George Dassios, "Ellipsoidal Harmonics: Theory and Applications"
+       pp. 418, 2012
+
+    Examples
+    --------
+    >>> from scipy.special import ellip_harm
+    >>> w = ellip_harm(5,8,1,1,2.5)
+    >>> w
+    2.5
+
+    Check that the functions indeed are solutions to the Lame equation:
+
+    >>> import numpy as np
+    >>> from scipy.interpolate import UnivariateSpline
+    >>> def eigenvalue(f, df, ddf):
+    ...     r = ((s**2 - h**2)*(s**2 - k**2)*ddf + s*(2*s**2 - h**2 - k**2)*df - n*(n+1)*s**2*f)/f
+    ...     return -r.mean(), r.std()
+    >>> s = np.linspace(0.1, 10, 200)
+    >>> k, h, n, p = 8.0, 2.2, 3, 2
+    >>> E = ellip_harm(h**2, k**2, n, p, s)
+    >>> E_spl = UnivariateSpline(s, E)
+    >>> a, a_err = eigenvalue(E_spl(s), E_spl(s,1), E_spl(s,2))
+    >>> a, a_err
+    (583.44366156701483, 6.4580890640310646e-11)
+
+    """
+    return _ellip_harm(h2, k2, n, p, s, signm, signn)
+
+
+_ellip_harm_2_vec = np.vectorize(_ellipsoid, otypes='d')
+
+
+def ellip_harm_2(h2, k2, n, p, s):
+    r"""
+    Ellipsoidal harmonic functions F^p_n(l)
+
+    These are also known as Lame functions of the second kind, and are
+    solutions to the Lame equation:
+
+    .. math:: (s^2 - h^2)(s^2 - k^2)F''(s) + s(2s^2 - h^2 - k^2)F'(s) + (a - q s^2)F(s) = 0
+
+    where :math:`q = (n+1)n` and :math:`a` is the eigenvalue (not
+    returned) corresponding to the solutions.
+
+    Parameters
+    ----------
+    h2 : float
+        ``h**2``
+    k2 : float
+        ``k**2``; should be larger than ``h**2``
+    n : int
+        Degree.
+    p : int
+        Order, can range between [1,2n+1].
+    s : float
+        Coordinate
+
+    Returns
+    -------
+    F : float
+        The harmonic :math:`F^p_n(s)`
+
+    Notes
+    -----
+    Lame functions of the second kind are related to the functions of the first kind:
+
+    .. math::
+
+       F^p_n(s)=(2n + 1)E^p_n(s)\int_{0}^{1/s}\frac{du}{(E^p_n(1/u))^2\sqrt{(1-u^2k^2)(1-u^2h^2)}}
+
+    .. versionadded:: 0.15.0
+
+    See Also
+    --------
+    ellip_harm, ellip_normal
+
+    Examples
+    --------
+    >>> from scipy.special import ellip_harm_2
+    >>> w = ellip_harm_2(5,8,2,1,10)
+    >>> w
+    0.00108056853382
+
+    """
+    with np.errstate(all='ignore'):
+        return _ellip_harm_2_vec(h2, k2, n, p, s)
+
+
+def _ellip_normal_vec(h2, k2, n, p):
+    return _ellipsoid_norm(h2, k2, n, p)
+
+
+_ellip_normal_vec = np.vectorize(_ellip_normal_vec, otypes='d')
+
+
+def ellip_normal(h2, k2, n, p):
+    r"""
+    Ellipsoidal harmonic normalization constants gamma^p_n
+
+    The normalization constant is defined as
+
+    .. math::
+
+       \gamma^p_n=8\int_{0}^{h}dx\int_{h}^{k}dy\frac{(y^2-x^2)(E^p_n(y)E^p_n(x))^2}{\sqrt((k^2-y^2)(y^2-h^2)(h^2-x^2)(k^2-x^2)}
+
+    Parameters
+    ----------
+    h2 : float
+        ``h**2``
+    k2 : float
+        ``k**2``; should be larger than ``h**2``
+    n : int
+        Degree.
+    p : int
+        Order, can range between [1,2n+1].
+
+    Returns
+    -------
+    gamma : float
+        The normalization constant :math:`\gamma^p_n`
+
+    See Also
+    --------
+    ellip_harm, ellip_harm_2
+
+    Notes
+    -----
+    .. versionadded:: 0.15.0
+
+    Examples
+    --------
+    >>> from scipy.special import ellip_normal
+    >>> w = ellip_normal(5,8,3,7)
+    >>> w
+    1723.38796997
+
+    """
+    with np.errstate(all='ignore'):
+        return _ellip_normal_vec(h2, k2, n, p)

.CondaPkg/env/Lib/site-packages/scipy/special/_lambertw.py

@@ -0,0 +1,106 @@
+from ._ufuncs import _lambertw
+
+
+def lambertw(z, k=0, tol=1e-8):
+    r"""
+    lambertw(z, k=0, tol=1e-8)
+
+    Lambert W function.
+
+    The Lambert W function `W(z)` is defined as the inverse function
+    of ``w * exp(w)``. In other words, the value of ``W(z)`` is
+    such that ``z = W(z) * exp(W(z))`` for any complex number
+    ``z``.
+
+    The Lambert W function is a multivalued function with infinitely
+    many branches. Each branch gives a separate solution of the
+    equation ``z = w exp(w)``. Here, the branches are indexed by the
+    integer `k`.
+
+    Parameters
+    ----------
+    z : array_like
+        Input argument.
+    k : int, optional
+        Branch index.
+    tol : float, optional
+        Evaluation tolerance.
+
+    Returns
+    -------
+    w : array
+        `w` will have the same shape as `z`.
+
+    Notes
+    -----
+    All branches are supported by `lambertw`:
+
+    * ``lambertw(z)`` gives the principal solution (branch 0)
+    * ``lambertw(z, k)`` gives the solution on branch `k`
+
+    The Lambert W function has two partially real branches: the
+    principal branch (`k = 0`) is real for real ``z > -1/e``, and the
+    ``k = -1`` branch is real for ``-1/e < z < 0``. All branches except
+    ``k = 0`` have a logarithmic singularity at ``z = 0``.
+
+    **Possible issues**
+
+    The evaluation can become inaccurate very close to the branch point
+    at ``-1/e``. In some corner cases, `lambertw` might currently
+    fail to converge, or can end up on the wrong branch.
+
+    **Algorithm**
+
+    Halley's iteration is used to invert ``w * exp(w)``, using a first-order
+    asymptotic approximation (O(log(w)) or `O(w)`) as the initial estimate.
+
+    The definition, implementation and choice of branches is based on [2]_.
+
+    See Also
+    --------
+    wrightomega : the Wright Omega function
+
+    References
+    ----------
+    .. [1] https://en.wikipedia.org/wiki/Lambert_W_function
+    .. [2] Corless et al, "On the Lambert W function", Adv. Comp. Math. 5
+       (1996) 329-359.
+       https://cs.uwaterloo.ca/research/tr/1993/03/W.pdf
+
+    Examples
+    --------
+    The Lambert W function is the inverse of ``w exp(w)``:
+
+    >>> import numpy as np
+    >>> from scipy.special import lambertw
+    >>> w = lambertw(1)
+    >>> w
+    (0.56714329040978384+0j)
+    >>> w * np.exp(w)
+    (1.0+0j)
+
+    Any branch gives a valid inverse:
+
+    >>> w = lambertw(1, k=3)
+    >>> w
+    (-2.8535817554090377+17.113535539412148j)
+    >>> w*np.exp(w)
+    (1.0000000000000002+1.609823385706477e-15j)
+
+    **Applications to equation-solving**
+
+    The Lambert W function may be used to solve various kinds of
+    equations, such as finding the value of the infinite power
+    tower :math:`z^{z^{z^{\ldots}}}`:
+
+    >>> def tower(z, n):
+    ...     if n == 0:
+    ...         return z
+    ...     return z ** tower(z, n-1)
+    ...
+    >>> tower(0.5, 100)
+    0.641185744504986
+    >>> -lambertw(-np.log(0.5)) / np.log(0.5)
+    (0.64118574450498589+0j)
+    """
+    return _lambertw(z, k, tol)

.CondaPkg/env/Lib/site-packages/scipy/special/_logsumexp.py

@@ -0,0 +1,298 @@
+import numpy as np
+from scipy._lib._util import _asarray_validated
+
+__all__ = ["logsumexp", "softmax", "log_softmax"]
+
+
+def logsumexp(a, axis=None, b=None, keepdims=False, return_sign=False):
+    """Compute the log of the sum of exponentials of input elements.
+
+    Parameters
+    ----------
+    a : array_like
+        Input array.
+    axis : None or int or tuple of ints, optional
+        Axis or axes over which the sum is taken. By default `axis` is None,
+        and all elements are summed.
+
+        .. versionadded:: 0.11.0
+    b : array-like, optional
+        Scaling factor for exp(`a`) must be of the same shape as `a` or
+        broadcastable to `a`. These values may be negative in order to
+        implement subtraction.
+
+        .. versionadded:: 0.12.0
+    keepdims : bool, optional
+        If this is set to True, the axes which are reduced are left in the
+        result as dimensions with size one. With this option, the result
+        will broadcast correctly against the original array.
+
+        .. versionadded:: 0.15.0
+    return_sign : bool, optional
+        If this is set to True, the result will be a pair containing sign
+        information; if False, results that are negative will be returned
+        as NaN. Default is False (no sign information).
+
+        .. versionadded:: 0.16.0
+
+    Returns
+    -------
+    res : ndarray
+        The result, ``np.log(np.sum(np.exp(a)))`` calculated in a numerically
+        more stable way. If `b` is given then ``np.log(np.sum(b*np.exp(a)))``
+        is returned.
+    sgn : ndarray
+        If return_sign is True, this will be an array of floating-point
+        numbers matching res and +1, 0, or -1 depending on the sign
+        of the result. If False, only one result is returned.
+
+    See Also
+    --------
+    numpy.logaddexp, numpy.logaddexp2
+
+    Notes
+    -----
+    NumPy has a logaddexp function which is very similar to `logsumexp`, but
+    only handles two arguments. `logaddexp.reduce` is similar to this
+    function, but may be less stable.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> from scipy.special import logsumexp
+    >>> a = np.arange(10)
+    >>> logsumexp(a)
+    9.4586297444267107
+    >>> np.log(np.sum(np.exp(a)))
+    9.4586297444267107
+
+    With weights
+
+    >>> a = np.arange(10)
+    >>> b = np.arange(10, 0, -1)
+    >>> logsumexp(a, b=b)
+    9.9170178533034665
+    >>> np.log(np.sum(b*np.exp(a)))
+    9.9170178533034647
+
+    Returning a sign flag
+
+    >>> logsumexp([1,2],b=[1,-1],return_sign=True)
+    (1.5413248546129181, -1.0)
+
+    Notice that `logsumexp` does not directly support masked arrays. To use it
+    on a masked array, convert the mask into zero weights:
+
+    >>> a = np.ma.array([np.log(2), 2, np.log(3)],
+    ...                  mask=[False, True, False])
+    >>> b = (~a.mask).astype(int)
+    >>> logsumexp(a.data, b=b), np.log(5)
+    1.6094379124341005, 1.6094379124341005
+
+    """
+    a = _asarray_validated(a, check_finite=False)
+    if b is not None:
+        a, b = np.broadcast_arrays(a, b)
+        if np.any(b == 0):
+            a = a + 0.  # promote to at least float
+            a[b == 0] = -np.inf
+
+    a_max = np.amax(a, axis=axis, keepdims=True)
+
+    if a_max.ndim > 0:
+        a_max[~np.isfinite(a_max)] = 0
+    elif not np.isfinite(a_max):
+        a_max = 0
+
+    if b is not None:
+        b = np.asarray(b)
+        tmp = b * np.exp(a - a_max)
+    else:
+        tmp = np.exp(a - a_max)
+
+    # suppress warnings about log of zero
+    with np.errstate(divide='ignore'):
+        s = np.sum(tmp, axis=axis, keepdims=keepdims)
+        if return_sign:
+            sgn = np.sign(s)
+            s *= sgn  # /= makes more sense but we need zero -> zero
+        out = np.log(s)
+
+    if not keepdims:
+        a_max = np.squeeze(a_max, axis=axis)
+    out += a_max
+
+    if return_sign:
+        return out, sgn
+    else:
+        return out
+
+
+def softmax(x, axis=None):
+    r"""Compute the softmax function.
+
+    The softmax function transforms each element of a collection by
+    computing the exponential of each element divided by the sum of the
+    exponentials of all the elements. That is, if `x` is a one-dimensional
+    numpy array::
+
+        softmax(x) = np.exp(x)/sum(np.exp(x))
+
+    Parameters
+    ----------
+    x : array_like
+        Input array.
+    axis : int or tuple of ints, optional
+        Axis to compute values along. Default is None and softmax will be
+        computed over the entire array `x`.
+
+    Returns
+    -------
+    s : ndarray
+        An array the same shape as `x`. The result will sum to 1 along the
+        specified axis.
+
+    Notes
+    -----
+    The formula for the softmax function :math:`\sigma(x)` for a vector
+    :math:`x = \{x_0, x_1, ..., x_{n-1}\}` is
+
+    .. math:: \sigma(x)_j = \frac{e^{x_j}}{\sum_k e^{x_k}}
+
+    The `softmax` function is the gradient of `logsumexp`.
+
+    The implementation uses shifting to avoid overflow. See [1]_ for more
+    details.
+
+    .. versionadded:: 1.2.0
+
+    References
+    ----------
+    .. [1] P. Blanchard, D.J. Higham, N.J. Higham, "Accurately computing the
+       log-sum-exp and softmax functions", IMA Journal of Numerical Analysis,
+       Vol.41(4), :doi:`10.1093/imanum/draa038`.
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> from scipy.special import softmax
+    >>> np.set_printoptions(precision=5)
+
+    >>> x = np.array([[1, 0.5, 0.2, 3],
+    ...               [1,  -1,   7, 3],
+    ...               [2,  12,  13, 3]])
+    ...
+
+    Compute the softmax transformation over the entire array.
+
+    >>> m = softmax(x)
+    >>> m
+    array([[  4.48309e-06,   2.71913e-06,   2.01438e-06,   3.31258e-05],
+           [  4.48309e-06,   6.06720e-07,   1.80861e-03,   3.31258e-05],
+           [  1.21863e-05,   2.68421e-01,   7.29644e-01,   3.31258e-05]])
+
+    >>> m.sum()
+    1.0
+
+    Compute the softmax transformation along the first axis (i.e., the
+    columns).
+
+    >>> m = softmax(x, axis=0)
+
+    >>> m
+    array([[  2.11942e-01,   1.01300e-05,   2.75394e-06,   3.33333e-01],
+           [  2.11942e-01,   2.26030e-06,   2.47262e-03,   3.33333e-01],
+           [  5.76117e-01,   9.99988e-01,   9.97525e-01,   3.33333e-01]])
+
+    >>> m.sum(axis=0)
+    array([ 1.,  1.,  1.,  1.])
+
+    Compute the softmax transformation along the second axis (i.e., the rows).
+
+    >>> m = softmax(x, axis=1)
+    >>> m
+    array([[  1.05877e-01,   6.42177e-02,   4.75736e-02,   7.82332e-01],
+           [  2.42746e-03,   3.28521e-04,   9.79307e-01,   1.79366e-02],
+           [  1.22094e-05,   2.68929e-01,   7.31025e-01,   3.31885e-05]])
+
+    >>> m.sum(axis=1)
+    array([ 1.,  1.,  1.])
+
+    """
+    x = _asarray_validated(x, check_finite=False)
+    x_max = np.amax(x, axis=axis, keepdims=True)
+    exp_x_shifted = np.exp(x - x_max)
+    return exp_x_shifted / np.sum(exp_x_shifted, axis=axis, keepdims=True)
+
+
+def log_softmax(x, axis=None):
+    r"""Compute the logarithm of the softmax function.
+
+    In principle::
+
+        log_softmax(x) = log(softmax(x))
+
+    but using a more accurate implementation.
+
+    Parameters
+    ----------
+    x : array_like
+        Input array.
+    axis : int or tuple of ints, optional
+        Axis to compute values along. Default is None and softmax will be
+        computed over the entire array `x`.
+
+    Returns
+    -------
+    s : ndarray or scalar
+        An array with the same shape as `x`. Exponential of the result will
+        sum to 1 along the specified axis. If `x` is a scalar, a scalar is
+        returned.
+
+    Notes
+    -----
+    `log_softmax` is more accurate than ``np.log(softmax(x))`` with inputs that
+    make `softmax` saturate (see examples below).
+
+    .. versionadded:: 1.5.0
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> from scipy.special import log_softmax
+    >>> from scipy.special import softmax
+    >>> np.set_printoptions(precision=5)
+
+    >>> x = np.array([1000.0, 1.0])
+
+    >>> y = log_softmax(x)
+    >>> y
+    array([   0., -999.])
+
+    >>> with np.errstate(divide='ignore'):
+    ...   y = np.log(softmax(x))
+    ...
+    >>> y
+    array([  0., -inf])
+
+    """
+
+    x = _asarray_validated(x, check_finite=False)
+
+    x_max = np.amax(x, axis=axis, keepdims=True)
+
+    if x_max.ndim > 0:
+        x_max[~np.isfinite(x_max)] = 0
+    elif not np.isfinite(x_max):
+        x_max = 0
+
+    tmp = x - x_max
+    exp_tmp = np.exp(tmp)
+
+    # suppress warnings about log of zero
+    with np.errstate(divide='ignore'):
+        s = np.sum(exp_tmp, axis=axis, keepdims=True)
+        out = np.log(s)
+
+    out = tmp - out
+    return out

.CondaPkg/env/Lib/site-packages/scipy/special/_mptestutils.py

@@ -0,0 +1,447 @@
+import os
+import sys
+import time
+from itertools import zip_longest
+
+import numpy as np
+from numpy.testing import assert_
+import pytest
+
+from scipy.special._testutils import assert_func_equal
+
+try:
+    import mpmath
+except ImportError:
+    pass
+
+
+# ------------------------------------------------------------------------------
+# Machinery for systematic tests with mpmath
+# ------------------------------------------------------------------------------
+
+class Arg:
+    """Generate a set of numbers on the real axis, concentrating on
+    'interesting' regions and covering all orders of magnitude.
+
+    """
+
+    def __init__(self, a=-np.inf, b=np.inf, inclusive_a=True, inclusive_b=True):
+        if a > b:
+            raise ValueError("a should be less than or equal to b")
+        if a == -np.inf:
+            a = -0.5*np.finfo(float).max
+        if b == np.inf:
+            b = 0.5*np.finfo(float).max
+        self.a, self.b = a, b
+
+        self.inclusive_a, self.inclusive_b = inclusive_a, inclusive_b
+
+    def _positive_values(self, a, b, n):
+        if a < 0:
+            raise ValueError("a should be positive")
+
+        # Try to put half of the points into a linspace between a and
+        # 10 the other half in a logspace.
+        if n % 2 == 0:
+            nlogpts = n//2
+            nlinpts = nlogpts
+        else:
+            nlogpts = n//2
+            nlinpts = nlogpts + 1
+
+        if a >= 10:
+            # Outside of linspace range; just return a logspace.
+            pts = np.logspace(np.log10(a), np.log10(b), n)
+        elif a > 0 and b < 10:
+            # Outside of logspace range; just return a linspace
+            pts = np.linspace(a, b, n)
+        elif a > 0:
+            # Linspace between a and 10 and a logspace between 10 and
+            # b.
+            linpts = np.linspace(a, 10, nlinpts, endpoint=False)
+            logpts = np.logspace(1, np.log10(b), nlogpts)
+            pts = np.hstack((linpts, logpts))
+        elif a == 0 and b <= 10:
+            # Linspace between 0 and b and a logspace between 0 and
+            # the smallest positive point of the linspace
+            linpts = np.linspace(0, b, nlinpts)
+            if linpts.size > 1:
+                right = np.log10(linpts[1])
+            else:
+                right = -30
+            logpts = np.logspace(-30, right, nlogpts, endpoint=False)
+            pts = np.hstack((logpts, linpts))
+        else:
+            # Linspace between 0 and 10, logspace between 0 and the
+            # smallest positive point of the linspace, and a logspace
+            # between 10 and b.
+            if nlogpts % 2 == 0:
+                nlogpts1 = nlogpts//2
+                nlogpts2 = nlogpts1
+            else:
+                nlogpts1 = nlogpts//2
+                nlogpts2 = nlogpts1 + 1
+            linpts = np.linspace(0, 10, nlinpts, endpoint=False)
+            if linpts.size > 1:
+                right = np.log10(linpts[1])
+            else:
+                right = -30
+            logpts1 = np.logspace(-30, right, nlogpts1, endpoint=False)
+            logpts2 = np.logspace(1, np.log10(b), nlogpts2)
+            pts = np.hstack((logpts1, linpts, logpts2))
+
+        return np.sort(pts)
+
+    def values(self, n):
+        """Return an array containing n numbers."""
+        a, b = self.a, self.b
+        if a == b:
+            return np.zeros(n)
+
+        if not self.inclusive_a:
+            n += 1
+        if not self.inclusive_b:
+            n += 1
+
+        if n % 2 == 0:
+            n1 = n//2
+            n2 = n1
+        else:
+            n1 = n//2
+            n2 = n1 + 1
+
+        if a >= 0:
+            pospts = self._positive_values(a, b, n)
+            negpts = []
+        elif b <= 0:
+            pospts = []
+            negpts = -self._positive_values(-b, -a, n)
+        else:
+            pospts = self._positive_values(0, b, n1)
+            negpts = -self._positive_values(0, -a, n2 + 1)
+            # Don't want to get zero twice
+            negpts = negpts[1:]
+        pts = np.hstack((negpts[::-1], pospts))
+
+        if not self.inclusive_a:
+            pts = pts[1:]
+        if not self.inclusive_b:
+            pts = pts[:-1]
+        return pts
+
+
+class FixedArg:
+    def __init__(self, values):
+        self._values = np.asarray(values)
+
+    def values(self, n):
+        return self._values
+
+
+class ComplexArg:
+    def __init__(self, a=complex(-np.inf, -np.inf), b=complex(np.inf, np.inf)):
+        self.real = Arg(a.real, b.real)
+        self.imag = Arg(a.imag, b.imag)
+
+    def values(self, n):
+        m = int(np.floor(np.sqrt(n)))
+        x = self.real.values(m)
+        y = self.imag.values(m + 1)
+        return (x[:,None] + 1j*y[None,:]).ravel()
+
+
+class IntArg:
+    def __init__(self, a=-1000, b=1000):
+        self.a = a
+        self.b = b
+
+    def values(self, n):
+        v1 = Arg(self.a, self.b).values(max(1 + n//2, n-5)).astype(int)
+        v2 = np.arange(-5, 5)
+        v = np.unique(np.r_[v1, v2])
+        v = v[(v >= self.a) & (v < self.b)]
+        return v
+
+
+def get_args(argspec, n):
+    if isinstance(argspec, np.ndarray):
+        args = argspec.copy()
+    else:
+        nargs = len(argspec)
+        ms = np.asarray([1.5 if isinstance(spec, ComplexArg) else 1.0 for spec in argspec])
+        ms = (n**(ms/sum(ms))).astype(int) + 1
+
+        args = [spec.values(m) for spec, m in zip(argspec, ms)]
+        args = np.array(np.broadcast_arrays(*np.ix_(*args))).reshape(nargs, -1).T
+
+    return args
+
+
+class MpmathData:
+    def __init__(self, scipy_func, mpmath_func, arg_spec, name=None,
+                 dps=None, prec=None, n=None, rtol=1e-7, atol=1e-300,
+                 ignore_inf_sign=False, distinguish_nan_and_inf=True,
+                 nan_ok=True, param_filter=None):
+
+        # mpmath tests are really slow (see gh-6989).  Use a small number of
+        # points by default, increase back to 5000 (old default) if XSLOW is
+        # set
+        if n is None:
+            try:
+                is_xslow = int(os.environ.get('SCIPY_XSLOW', '0'))
+            except ValueError:
+                is_xslow = False
+
+            n = 5000 if is_xslow else 500
+
+        self.scipy_func = scipy_func
+        self.mpmath_func = mpmath_func
+        self.arg_spec = arg_spec
+        self.dps = dps
+        self.prec = prec
+        self.n = n
+        self.rtol = rtol
+        self.atol = atol
+        self.ignore_inf_sign = ignore_inf_sign
+        self.nan_ok = nan_ok
+        if isinstance(self.arg_spec, np.ndarray):
+            self.is_complex = np.issubdtype(self.arg_spec.dtype, np.complexfloating)
+        else:
+            self.is_complex = any([isinstance(arg, ComplexArg) for arg in self.arg_spec])
+        self.ignore_inf_sign = ignore_inf_sign
+        self.distinguish_nan_and_inf = distinguish_nan_and_inf
+        if not name or name == '<lambda>':
+            name = getattr(scipy_func, '__name__', None)
+        if not name or name == '<lambda>':
+            name = getattr(mpmath_func, '__name__', None)
+        self.name = name
+        self.param_filter = param_filter
+
+    def check(self):
+        np.random.seed(1234)
+
+        # Generate values for the arguments
+        argarr = get_args(self.arg_spec, self.n)
+
+        # Check
+        old_dps, old_prec = mpmath.mp.dps, mpmath.mp.prec
+        try:
+            if self.dps is not None:
+                dps_list = [self.dps]
+            else:
+                dps_list = [20]
+            if self.prec is not None:
+                mpmath.mp.prec = self.prec
+
+            # Proper casting of mpmath input and output types. Using
+            # native mpmath types as inputs gives improved precision
+            # in some cases.
+            if np.issubdtype(argarr.dtype, np.complexfloating):
+                pytype = mpc2complex
+
+                def mptype(x):
+                    return mpmath.mpc(complex(x))
+            else:
+                def mptype(x):
+                    return mpmath.mpf(float(x))
+
+                def pytype(x):
+                    if abs(x.imag) > 1e-16*(1 + abs(x.real)):
+                        return np.nan
+                    else:
+                        return mpf2float(x.real)
+
+            # Try out different dps until one (or none) works
+            for j, dps in enumerate(dps_list):
+                mpmath.mp.dps = dps
+
+                try:
+                    assert_func_equal(self.scipy_func,
+                                      lambda *a: pytype(self.mpmath_func(*map(mptype, a))),
+                                      argarr,
+                                      vectorized=False,
+                                      rtol=self.rtol, atol=self.atol,
+                                      ignore_inf_sign=self.ignore_inf_sign,
+                                      distinguish_nan_and_inf=self.distinguish_nan_and_inf,
+                                      nan_ok=self.nan_ok,
+                                      param_filter=self.param_filter)
+                    break
+                except AssertionError:
+                    if j >= len(dps_list)-1:
+                        # reraise the Exception
+                        tp, value, tb = sys.exc_info()
+                        if value.__traceback__ is not tb:
+                            raise value.with_traceback(tb)
+                        raise value
+        finally:
+            mpmath.mp.dps, mpmath.mp.prec = old_dps, old_prec
+
+    def __repr__(self):
+        if self.is_complex:
+            return "<MpmathData: %s (complex)>" % (self.name,)
+        else:
+            return "<MpmathData: %s>" % (self.name,)
+
+
+def assert_mpmath_equal(*a, **kw):
+    d = MpmathData(*a, **kw)
+    d.check()
+
+
+def nonfunctional_tooslow(func):
+    return pytest.mark.skip(reason="    Test not yet functional (too slow), needs more work.")(func)
+
+
+# ------------------------------------------------------------------------------
+# Tools for dealing with mpmath quirks
+# ------------------------------------------------------------------------------
+
+def mpf2float(x):
+    """
+    Convert an mpf to the nearest floating point number. Just using
+    float directly doesn't work because of results like this:
+
+    with mp.workdps(50):
+        float(mpf("0.99999999999999999")) = 0.9999999999999999
+
+    """
+    return float(mpmath.nstr(x, 17, min_fixed=0, max_fixed=0))
+
+
+def mpc2complex(x):
+    return complex(mpf2float(x.real), mpf2float(x.imag))
+
+
+def trace_args(func):
+    def tofloat(x):
+        if isinstance(x, mpmath.mpc):
+            return complex(x)
+        else:
+            return float(x)
+
+    def wrap(*a, **kw):
+        sys.stderr.write("%r: " % (tuple(map(tofloat, a)),))
+        sys.stderr.flush()
+        try:
+            r = func(*a, **kw)
+            sys.stderr.write("-> %r" % r)
+        finally:
+            sys.stderr.write("\n")
+            sys.stderr.flush()
+        return r
+    return wrap
+
+
+try:
+    import posix
+    import signal
+    POSIX = ('setitimer' in dir(signal))
+except ImportError:
+    POSIX = False
+
+
+class TimeoutError(Exception):
+    pass
+
+
+def time_limited(timeout=0.5, return_val=np.nan, use_sigalrm=True):
+    """
+    Decorator for setting a timeout for pure-Python functions.
+
+    If the function does not return within `timeout` seconds, the
+    value `return_val` is returned instead.
+
+    On POSIX this uses SIGALRM by default. On non-POSIX, settrace is
+    used. Do not use this with threads: the SIGALRM implementation
+    does probably not work well. The settrace implementation only
+    traces the current thread.
+
+    The settrace implementation slows down execution speed. Slowdown
+    by a factor around 10 is probably typical.
+    """
+    if POSIX and use_sigalrm:
+        def sigalrm_handler(signum, frame):
+            raise TimeoutError()
+
+        def deco(func):
+            def wrap(*a, **kw):
+                old_handler = signal.signal(signal.SIGALRM, sigalrm_handler)
+                signal.setitimer(signal.ITIMER_REAL, timeout)
+                try:
+                    return func(*a, **kw)
+                except TimeoutError:
+                    return return_val
+                finally:
+                    signal.setitimer(signal.ITIMER_REAL, 0)
+                    signal.signal(signal.SIGALRM, old_handler)
+            return wrap
+    else:
+        def deco(func):
+            def wrap(*a, **kw):
+                start_time = time.time()
+
+                def trace(frame, event, arg):
+                    if time.time() - start_time > timeout:
+                        raise TimeoutError()
+                    return trace
+                sys.settrace(trace)
+                try:
+                    return func(*a, **kw)
+                except TimeoutError:
+                    sys.settrace(None)
+                    return return_val
+                finally:
+                    sys.settrace(None)
+            return wrap
+    return deco
+
+
+def exception_to_nan(func):
+    """Decorate function to return nan if it raises an exception"""
+    def wrap(*a, **kw):
+        try:
+            return func(*a, **kw)
+        except Exception:
+            return np.nan
+    return wrap
+
+
+def inf_to_nan(func):
+    """Decorate function to return nan if it returns inf"""
+    def wrap(*a, **kw):
+        v = func(*a, **kw)
+        if not np.isfinite(v):
+            return np.nan
+        return v
+    return wrap
+
+
+def mp_assert_allclose(res, std, atol=0, rtol=1e-17):
+    """
+    Compare lists of mpmath.mpf's or mpmath.mpc's directly so that it
+    can be done to higher precision than double.
+    """
+    failures = []
+    for k, (resval, stdval) in enumerate(zip_longest(res, std)):
+        if resval is None or stdval is None:
+            raise ValueError('Lengths of inputs res and std are not equal.')
+        if mpmath.fabs(resval - stdval) > atol + rtol*mpmath.fabs(stdval):
+            failures.append((k, resval, stdval))
+
+    nfail = len(failures)
+    if nfail > 0:
+        ndigits = int(abs(np.log10(rtol)))
+        msg = [""]
+        msg.append("Bad results ({} out of {}) for the following points:"
+                   .format(nfail, k + 1))
+        for k, resval, stdval in failures:
+            resrep = mpmath.nstr(resval, ndigits, min_fixed=0, max_fixed=0)
+            stdrep = mpmath.nstr(stdval, ndigits, min_fixed=0, max_fixed=0)
+            if stdval == 0:
+                rdiff = "inf"
+            else:
+                rdiff = mpmath.fabs((resval - stdval)/stdval)
+                rdiff = mpmath.nstr(rdiff, 3)
+            msg.append("{}: {} != {} (rdiff {})".format(k, resrep, stdrep,
+                                                        rdiff))
+        assert_(False, "\n".join(msg))

.CondaPkg/env/Lib/site-packages/scipy/special/_orthogonal.pyi

@@ -0,0 +1,341 @@
+from typing import (
+    Any,
+    Callable,
+    List,
+    Literal,
+    Optional,
+    overload,
+    Tuple,
+    Union,
+)
+
+import numpy
+
+_IntegerType = Union[int, numpy.integer]
+_FloatingType = Union[float, numpy.floating]
+_PointsAndWeights = Tuple[numpy.ndarray, numpy.ndarray]
+_PointsAndWeightsAndMu = Tuple[numpy.ndarray, numpy.ndarray, float]
+
+_ArrayLike0D = Union[
+    bool,
+    int,
+    float,
+    complex,
+    str,
+    bytes,
+    numpy.generic,
+]
+
+__all__ = [
+    'legendre',
+    'chebyt',
+    'chebyu',
+    'chebyc',
+    'chebys',
+    'jacobi',
+    'laguerre',
+    'genlaguerre',
+    'hermite',
+    'hermitenorm',
+    'gegenbauer',
+    'sh_legendre',
+    'sh_chebyt',
+    'sh_chebyu',
+    'sh_jacobi',
+    'roots_legendre',
+    'roots_chebyt',
+    'roots_chebyu',
+    'roots_chebyc',
+    'roots_chebys',
+    'roots_jacobi',
+    'roots_laguerre',
+    'roots_genlaguerre',
+    'roots_hermite',
+    'roots_hermitenorm',
+    'roots_gegenbauer',
+    'roots_sh_legendre',
+    'roots_sh_chebyt',
+    'roots_sh_chebyu',
+    'roots_sh_jacobi',
+]
+
+@overload
+def roots_jacobi(
+        n: _IntegerType,
+        alpha: _FloatingType,
+        beta: _FloatingType,
+) -> _PointsAndWeights: ...
+@overload
+def roots_jacobi(
+        n: _IntegerType,
+        alpha: _FloatingType,
+        beta: _FloatingType,
+        mu: Literal[False],
+) -> _PointsAndWeights: ...
+@overload
+def roots_jacobi(
+        n: _IntegerType,
+        alpha: _FloatingType,
+        beta: _FloatingType,
+        mu: Literal[True],
+) -> _PointsAndWeightsAndMu: ...
+
+@overload
+def roots_sh_jacobi(
+        n: _IntegerType,
+        p1: _FloatingType,
+        q1: _FloatingType,
+) -> _PointsAndWeights: ...
+@overload
+def roots_sh_jacobi(
+        n: _IntegerType,
+        p1: _FloatingType,
+        q1: _FloatingType,
+        mu: Literal[False],
+) -> _PointsAndWeights: ...
+@overload
+def roots_sh_jacobi(
+        n: _IntegerType,
+        p1: _FloatingType,
+        q1: _FloatingType,
+        mu: Literal[True],
+) -> _PointsAndWeightsAndMu: ...
+
+@overload
+def roots_genlaguerre(
+        n: _IntegerType,
+        alpha: _FloatingType,
+) -> _PointsAndWeights: ...
+@overload
+def roots_genlaguerre(
+        n: _IntegerType,
+        alpha: _FloatingType,
+        mu: Literal[False],
+) -> _PointsAndWeights: ...
+@overload
+def roots_genlaguerre(
+        n: _IntegerType,
+        alpha: _FloatingType,
+        mu: Literal[True],
+) -> _PointsAndWeightsAndMu: ...
+
+@overload
+def roots_laguerre(n: _IntegerType) -> _PointsAndWeights: ...
+@overload
+def roots_laguerre(
+        n: _IntegerType,
+        mu: Literal[False],
+) -> _PointsAndWeights: ...
+@overload
+def roots_laguerre(
+        n: _IntegerType,
+        mu: Literal[True],
+) -> _PointsAndWeightsAndMu: ...
+
+@overload
+def roots_hermite(n: _IntegerType) -> _PointsAndWeights: ...
+@overload
+def roots_hermite(
+        n: _IntegerType,
+        mu: Literal[False],
+) -> _PointsAndWeights: ...
+@overload
+def roots_hermite(
+        n: _IntegerType,
+        mu: Literal[True],
+) -> _PointsAndWeightsAndMu: ...
+
+@overload
+def roots_hermitenorm(n: _IntegerType) -> _PointsAndWeights: ...
+@overload
+def roots_hermitenorm(
+        n: _IntegerType,
+        mu: Literal[False],
+) -> _PointsAndWeights: ...
+@overload
+def roots_hermitenorm(
+        n: _IntegerType,
+        mu: Literal[True],
+) -> _PointsAndWeightsAndMu: ...
+
+@overload
+def roots_gegenbauer(
+        n: _IntegerType,
+        alpha: _FloatingType,
+) -> _PointsAndWeights: ...
+@overload
+def roots_gegenbauer(
+        n: _IntegerType,
+        alpha: _FloatingType,
+        mu: Literal[False],
+) -> _PointsAndWeights: ...
+@overload
+def roots_gegenbauer(
+        n: _IntegerType,
+        alpha: _FloatingType,
+        mu: Literal[True],
+) -> _PointsAndWeightsAndMu: ...
+
+@overload
+def roots_chebyt(n: _IntegerType) -> _PointsAndWeights: ...
+@overload
+def roots_chebyt(
+        n: _IntegerType,
+        mu: Literal[False],
+) -> _PointsAndWeights: ...
+@overload
+def roots_chebyt(
+        n: _IntegerType,
+        mu: Literal[True],
+) -> _PointsAndWeightsAndMu: ...
+
+@overload
+def roots_chebyu(n: _IntegerType) -> _PointsAndWeights: ...
+@overload
+def roots_chebyu(
+        n: _IntegerType,
+        mu: Literal[False],
+) -> _PointsAndWeights: ...
+@overload
+def roots_chebyu(
+        n: _IntegerType,
+        mu: Literal[True],
+) -> _PointsAndWeightsAndMu: ...
+
+@overload
+def roots_chebyc(n: _IntegerType) -> _PointsAndWeights: ...
+@overload
+def roots_chebyc(
+        n: _IntegerType,
+        mu: Literal[False],
+) -> _PointsAndWeights: ...
+@overload
+def roots_chebyc(
+        n: _IntegerType,
+        mu: Literal[True],
+) -> _PointsAndWeightsAndMu: ...
+
+@overload
+def roots_chebys(n: _IntegerType) -> _PointsAndWeights: ...
+@overload
+def roots_chebys(
+        n: _IntegerType,
+        mu: Literal[False],
+) -> _PointsAndWeights: ...
+@overload
+def roots_chebys(
+        n: _IntegerType,
+        mu: Literal[True],
+) -> _PointsAndWeightsAndMu: ...
+
+@overload
+def roots_sh_chebyt(n: _IntegerType) -> _PointsAndWeights: ...
+@overload
+def roots_sh_chebyt(
+        n: _IntegerType,
+        mu: Literal[False],
+) -> _PointsAndWeights: ...
+@overload
+def roots_sh_chebyt(
+        n: _IntegerType,
+        mu: Literal[True],
+) -> _PointsAndWeightsAndMu: ...
+
+@overload
+def roots_sh_chebyu(n: _IntegerType) -> _PointsAndWeights: ...
+@overload
+def roots_sh_chebyu(
+        n: _IntegerType,
+        mu: Literal[False],
+) -> _PointsAndWeights: ...
+@overload
+def roots_sh_chebyu(
+        n: _IntegerType,
+        mu: Literal[True],
+) -> _PointsAndWeightsAndMu: ...
+
+@overload
+def roots_legendre(n: _IntegerType) -> _PointsAndWeights: ...
+@overload
+def roots_legendre(
+        n: _IntegerType,
+        mu: Literal[False],
+) -> _PointsAndWeights: ...
+@overload
+def roots_legendre(
+        n: _IntegerType,
+        mu: Literal[True],
+) -> _PointsAndWeightsAndMu: ...
+
+@overload
+def roots_sh_legendre(n: _IntegerType) -> _PointsAndWeights: ...
+@overload
+def roots_sh_legendre(
+        n: _IntegerType,
+        mu: Literal[False],
+) -> _PointsAndWeights: ...
+@overload
+def roots_sh_legendre(
+        n: _IntegerType,
+        mu: Literal[True],
+) -> _PointsAndWeightsAndMu: ...
+
+class orthopoly1d(numpy.poly1d):
+    def __init__(
+            self,
+            roots: numpy.typing.ArrayLike,
+            weights: Optional[numpy.typing.ArrayLike],
+            hn: float = ...,
+            kn: float = ...,
+            wfunc = Optional[Callable[[float], float]],
+            limits = Optional[Tuple[float, float]],
+            monic: bool = ...,
+            eval_func: numpy.ufunc = ...,
+    ) -> None: ...
+    @property
+    def limits(self) -> Tuple[float, float]: ...
+    def weight_func(self, x: float) -> float: ...
+    @overload
+    def __call__(self, x: _ArrayLike0D) -> Any: ...
+    @overload
+    def __call__(self, x: numpy.poly1d) -> numpy.poly1d: ...  # type: ignore[misc]
+    @overload
+    def __call__(self, x: numpy.typing.ArrayLike) -> numpy.ndarray: ...
+
+def legendre(n: _IntegerType, monic: bool = ...) -> orthopoly1d: ...
+def chebyt(n: _IntegerType, monic: bool = ...) -> orthopoly1d: ...
+def chebyu(n: _IntegerType, monic: bool = ...) -> orthopoly1d: ...
+def chebyc(n: _IntegerType, monic: bool = ...) -> orthopoly1d: ...
+def chebys(n: _IntegerType, monic: bool = ...) -> orthopoly1d: ...
+def jacobi(
+        n: _IntegerType,
+        alpha: _FloatingType,
+        beta: _FloatingType,
+        monic: bool = ...,
+) -> orthopoly1d: ...
+def laguerre(n: _IntegerType, monic: bool = ...) -> orthopoly1d: ...
+def genlaguerre(
+        n: _IntegerType,
+        alpha: _FloatingType,
+        monic: bool = ...,
+) -> orthopoly1d: ...
+def hermite(n: _IntegerType, monic: bool = ...) -> orthopoly1d: ...
+def hermitenorm(n: _IntegerType, monic: bool = ...) -> orthopoly1d: ...
+def gegenbauer(
+        n: _IntegerType,
+        alpha: _FloatingType,
+        monic: bool = ...,
+) -> orthopoly1d: ...
+def sh_legendre(n: _IntegerType, monic: bool = ...) -> orthopoly1d: ...
+def sh_chebyt(n: _IntegerType, monic: bool = ...) -> orthopoly1d: ...
+def sh_chebyu(n: _IntegerType, monic: bool = ...) -> orthopoly1d: ...
+def sh_jacobi(
+        n: _IntegerType,
+        p: _FloatingType,
+        q: _FloatingType,
+        monic: bool = ...,
+) -> orthopoly1d: ...
+
+# These functions are not public, but still need stubs because they
+# get checked in the tests.
+def _roots_hermite_asy(n: _IntegerType) -> _PointsAndWeights: ...

.CondaPkg/env/Lib/site-packages/scipy/special/_precompute/cosine_cdf.py

@@ -0,0 +1,18 @@
+
+import mpmath
+
+
+def f(x):
+    return (mpmath.pi + x + mpmath.sin(x)) / (2*mpmath.pi)
+
+
+# Note: 40 digits might be overkill; a few more digits than the default
+# might be sufficient.
+mpmath.mp.dps = 40
+ts = mpmath.taylor(f, -mpmath.pi, 20)
+p, q = mpmath.pade(ts, 9, 10)
+
+p = [float(c) for c in p]
+q = [float(c) for c in q]
+print('p =', p)
+print('q =', q)

.CondaPkg/env/Lib/site-packages/scipy/special/_precompute/expn_asy.py

@@ -0,0 +1,54 @@
+"""Precompute the polynomials for the asymptotic expansion of the
+generalized exponential integral.
+
+Sources
+-------
+[1] NIST, Digital Library of Mathematical Functions,
+    https://dlmf.nist.gov/8.20#ii
+
+"""
+import os
+
+try:
+    import sympy
+    from sympy import Poly
+    x = sympy.symbols('x')
+except ImportError:
+    pass
+
+
+def generate_A(K):
+    A = [Poly(1, x)]
+    for k in range(K):
+        A.append(Poly(1 - 2*k*x, x)*A[k] + Poly(x*(x + 1))*A[k].diff())
+    return A
+
+
+WARNING = """\
+/* This file was automatically generated by _precompute/expn_asy.py.
+ * Do not edit it manually!
+ */
+"""
+
+
+def main():
+    print(__doc__)
+    fn = os.path.join('..', 'cephes', 'expn.h')
+
+    K = 12
+    A = generate_A(K)
+    with open(fn + '.new', 'w') as f:
+        f.write(WARNING)
+        f.write("#define nA {}\n".format(len(A)))
+        for k, Ak in enumerate(A):
+            tmp = ', '.join([str(x.evalf(18)) for x in Ak.coeffs()])
+            f.write("static const double A{}[] = {{{}}};\n".format(k, tmp))
+        tmp = ", ".join(["A{}".format(k) for k in range(K + 1)])
+        f.write("static const double *A[] = {{{}}};\n".format(tmp))
+        tmp = ", ".join([str(Ak.degree()) for Ak in A])
+        f.write("static const int Adegs[] = {{{}}};\n".format(tmp))
+    os.rename(fn + '.new', fn)
+
+
+if __name__ == "__main__":
+    main()

.CondaPkg/env/Lib/site-packages/scipy/special/_precompute/gammainc_asy.py

@@ -0,0 +1,116 @@
+"""
+Precompute coefficients of Temme's asymptotic expansion for gammainc.
+
+This takes about 8 hours to run on a 2.3 GHz Macbook Pro with 4GB ram.
+
+Sources:
+[1] NIST, "Digital Library of Mathematical Functions",
+    https://dlmf.nist.gov/
+
+"""
+import os
+from scipy.special._precompute.utils import lagrange_inversion
+
+try:
+    import mpmath as mp
+except ImportError:
+    pass
+
+
+def compute_a(n):
+    """a_k from DLMF 5.11.6"""
+    a = [mp.sqrt(2)/2]
+    for k in range(1, n):
+        ak = a[-1]/k
+        for j in range(1, len(a)):
+            ak -= a[j]*a[-j]/(j + 1)
+        ak /= a[0]*(1 + mp.mpf(1)/(k + 1))
+        a.append(ak)
+    return a
+
+
+def compute_g(n):
+    """g_k from DLMF 5.11.3/5.11.5"""
+    a = compute_a(2*n)
+    g = [mp.sqrt(2)*mp.rf(0.5, k)*a[2*k] for k in range(n)]
+    return g
+
+
+def eta(lam):
+    """Function from DLMF 8.12.1 shifted to be centered at 0."""
+    if lam > 0:
+        return mp.sqrt(2*(lam - mp.log(lam + 1)))
+    elif lam < 0:
+        return -mp.sqrt(2*(lam - mp.log(lam + 1)))
+    else:
+        return 0
+
+
+def compute_alpha(n):
+    """alpha_n from DLMF 8.12.13"""
+    coeffs = mp.taylor(eta, 0, n - 1)
+    return lagrange_inversion(coeffs)
+
+
+def compute_d(K, N):
+    """d_{k, n} from DLMF 8.12.12"""
+    M = N + 2*K
+    d0 = [-mp.mpf(1)/3]
+    alpha = compute_alpha(M + 2)
+    for n in range(1, M):
+        d0.append((n + 2)*alpha[n+2])
+    d = [d0]
+    g = compute_g(K)
+    for k in range(1, K):
+        dk = []
+        for n in range(M - 2*k):
+            dk.append((-1)**k*g[k]*d[0][n] + (n + 2)*d[k-1][n+2])
+        d.append(dk)
+    for k in range(K):
+        d[k] = d[k][:N]
+    return d
+
+
+header = \
+r"""/* This file was automatically generated by _precomp/gammainc.py.
+ * Do not edit it manually!
+ */
+
+#ifndef IGAM_H
+#define IGAM_H
+
+#define K {}
+#define N {}
+
+static const double d[K][N] =
+{{"""
+
+footer = \
+r"""
+#endif
+"""
+
+
+def main():
+    print(__doc__)
+    K = 25
+    N = 25
+    with mp.workdps(50):
+        d = compute_d(K, N)
+    fn = os.path.join(os.path.dirname(__file__), '..', 'cephes', 'igam.h')
+    with open(fn + '.new', 'w') as f:
+        f.write(header.format(K, N))
+        for k, row in enumerate(d):
+            row = [mp.nstr(x, 17, min_fixed=0, max_fixed=0) for x in row]
+            f.write('{')
+            f.write(", ".join(row))
+            if k < K - 1:
+                f.write('},\n')
+            else:
+                f.write('}};\n')
+        f.write(footer)
+    os.rename(fn + '.new', fn)
+
+
+if __name__ == "__main__":
+    main()

.CondaPkg/env/Lib/site-packages/scipy/special/_precompute/gammainc_data.py

@@ -0,0 +1,124 @@
+"""Compute gammainc and gammaincc for large arguments and parameters
+and save the values to data files for use in tests. We can't just
+compare to mpmath's gammainc in test_mpmath.TestSystematic because it
+would take too long.
+
+Note that mpmath's gammainc is computed using hypercomb, but since it
+doesn't allow the user to increase the maximum number of terms used in
+the series it doesn't converge for many arguments. To get around this
+we copy the mpmath implementation but use more terms.
+
+This takes about 17 minutes to run on a 2.3 GHz Macbook Pro with 4GB
+ram.
+
+Sources:
+[1] Fredrik Johansson and others. mpmath: a Python library for
+    arbitrary-precision floating-point arithmetic (version 0.19),
+    December 2013. http://mpmath.org/.
+
+"""
+import os
+from time import time
+import numpy as np
+from numpy import pi
+
+from scipy.special._mptestutils import mpf2float
+
+try:
+    import mpmath as mp
+except ImportError:
+    pass
+
+
+def gammainc(a, x, dps=50, maxterms=10**8):
+    """Compute gammainc exactly like mpmath does but allow for more
+    summands in hypercomb. See
+
+    mpmath/functions/expintegrals.py#L134
+
+    in the mpmath github repository.
+
+    """
+    with mp.workdps(dps):
+        z, a, b = mp.mpf(a), mp.mpf(x), mp.mpf(x)
+        G = [z]
+        negb = mp.fneg(b, exact=True)
+
+        def h(z):
+            T1 = [mp.exp(negb), b, z], [1, z, -1], [], G, [1], [1+z], b
+            return (T1,)
+
+        res = mp.hypercomb(h, [z], maxterms=maxterms)
+        return mpf2float(res)
+
+
+def gammaincc(a, x, dps=50, maxterms=10**8):
+    """Compute gammaincc exactly like mpmath does but allow for more
+    terms in hypercomb. See
+
+    mpmath/functions/expintegrals.py#L187
+
+    in the mpmath github repository.
+
+    """
+    with mp.workdps(dps):
+        z, a = a, x
+
+        if mp.isint(z):
+            try:
+                # mpmath has a fast integer path
+                return mpf2float(mp.gammainc(z, a=a, regularized=True))
+            except mp.libmp.NoConvergence:
+                pass
+        nega = mp.fneg(a, exact=True)
+        G = [z]
+        # Use 2F0 series when possible; fall back to lower gamma representation
+        try:
+            def h(z):
+                r = z-1
+                return [([mp.exp(nega), a], [1, r], [], G, [1, -r], [], 1/nega)]
+            return mpf2float(mp.hypercomb(h, [z], force_series=True))
+        except mp.libmp.NoConvergence:
+            def h(z):
+                T1 = [], [1, z-1], [z], G, [], [], 0
+                T2 = [-mp.exp(nega), a, z], [1, z, -1], [], G, [1], [1+z], a
+                return T1, T2
+            return mpf2float(mp.hypercomb(h, [z], maxterms=maxterms))
+
+
+def main():
+    t0 = time()
+    # It would be nice to have data for larger values, but either this
+    # requires prohibitively large precision (dps > 800) or mpmath has
+    # a bug. For example, gammainc(1e20, 1e20, dps=800) returns a
+    # value around 0.03, while the true value should be close to 0.5
+    # (DLMF 8.12.15).
+    print(__doc__)
+    pwd = os.path.dirname(__file__)
+    r = np.logspace(4, 14, 30)
+    ltheta = np.logspace(np.log10(pi/4), np.log10(np.arctan(0.6)), 30)
+    utheta = np.logspace(np.log10(pi/4), np.log10(np.arctan(1.4)), 30)
+
+    regimes = [(gammainc, ltheta), (gammaincc, utheta)]
+    for func, theta in regimes:
+        rg, thetag = np.meshgrid(r, theta)
+        a, x = rg*np.cos(thetag), rg*np.sin(thetag)
+        a, x = a.flatten(), x.flatten()
+        dataset = []
+        for i, (a0, x0) in enumerate(zip(a, x)):
+            if func == gammaincc:
+                # Exploit the fast integer path in gammaincc whenever
+                # possible so that the computation doesn't take too
+                # long
+                a0, x0 = np.floor(a0), np.floor(x0)
+            dataset.append((a0, x0, func(a0, x0)))
+        dataset = np.array(dataset)
+        filename = os.path.join(pwd, '..', 'tests', 'data', 'local',
+                                '{}.txt'.format(func.__name__))
+        np.savetxt(filename, dataset)
+
+    print("{} minutes elapsed".format((time() - t0)/60))
+
+
+if __name__ == "__main__":
+    main()

.CondaPkg/env/Lib/site-packages/scipy/special/_precompute/lambertw.py

@@ -0,0 +1,68 @@
+"""Compute a Pade approximation for the principal branch of the
+Lambert W function around 0 and compare it to various other
+approximations.
+
+"""
+import numpy as np
+
+try:
+    import mpmath
+    import matplotlib.pyplot as plt
+except ImportError:
+    pass
+
+
+def lambertw_pade():
+    derivs = [mpmath.diff(mpmath.lambertw, 0, n=n) for n in range(6)]
+    p, q = mpmath.pade(derivs, 3, 2)
+    return p, q
+
+
+def main():
+    print(__doc__)
+    with mpmath.workdps(50):
+        p, q = lambertw_pade()
+        p, q = p[::-1], q[::-1]
+        print("p = {}".format(p))
+        print("q = {}".format(q))
+
+    x, y = np.linspace(-1.5, 1.5, 75), np.linspace(-1.5, 1.5, 75)
+    x, y = np.meshgrid(x, y)
+    z = x + 1j*y
+    lambertw_std = []
+    for z0 in z.flatten():
+        lambertw_std.append(complex(mpmath.lambertw(z0)))
+    lambertw_std = np.array(lambertw_std).reshape(x.shape)
+
+    fig, axes = plt.subplots(nrows=3, ncols=1)
+    # Compare Pade approximation to true result
+    p = np.array([float(p0) for p0 in p])
+    q = np.array([float(q0) for q0 in q])
+    pade_approx = np.polyval(p, z)/np.polyval(q, z)
+    pade_err = abs(pade_approx - lambertw_std)
+    axes[0].pcolormesh(x, y, pade_err)
+    # Compare two terms of asymptotic series to true result
+    asy_approx = np.log(z) - np.log(np.log(z))
+    asy_err = abs(asy_approx - lambertw_std)
+    axes[1].pcolormesh(x, y, asy_err)
+    # Compare two terms of the series around the branch point to the
+    # true result
+    p = np.sqrt(2*(np.exp(1)*z + 1))
+    series_approx = -1 + p - p**2/3
+    series_err = abs(series_approx - lambertw_std)
+    im = axes[2].pcolormesh(x, y, series_err)
+
+    fig.colorbar(im, ax=axes.ravel().tolist())
+    plt.show()
+
+    fig, ax = plt.subplots(nrows=1, ncols=1)
+    pade_better = pade_err < asy_err
+    im = ax.pcolormesh(x, y, pade_better)
+    t = np.linspace(-0.3, 0.3)
+    ax.plot(-2.5*abs(t) - 0.2, t, 'r')
+    fig.colorbar(im, ax=ax)
+    plt.show()
+
+
+if __name__ == '__main__':
+    main()

.CondaPkg/env/Lib/site-packages/scipy/special/_precompute/loggamma.py

@@ -0,0 +1,43 @@
+"""Precompute series coefficients for log-Gamma."""
+
+try:
+    import mpmath
+except ImportError:
+    pass
+
+
+def stirling_series(N):
+    with mpmath.workdps(100):
+        coeffs = [mpmath.bernoulli(2*n)/(2*n*(2*n - 1))
+                  for n in range(1, N + 1)]
+    return coeffs
+
+
+def taylor_series_at_1(N):
+    coeffs = []
+    with mpmath.workdps(100):
+        coeffs.append(-mpmath.euler)
+        for n in range(2, N + 1):
+            coeffs.append((-1)**n*mpmath.zeta(n)/n)
+    return coeffs
+
+
+def main():
+    print(__doc__)
+    print()
+    stirling_coeffs = [mpmath.nstr(x, 20, min_fixed=0, max_fixed=0)
+                       for x in stirling_series(8)[::-1]]
+    taylor_coeffs = [mpmath.nstr(x, 20, min_fixed=0, max_fixed=0)
+                     for x in taylor_series_at_1(23)[::-1]]
+    print("Stirling series coefficients")
+    print("----------------------------")
+    print("\n".join(stirling_coeffs))
+    print()
+    print("Taylor series coefficients")
+    print("--------------------------")
+    print("\n".join(taylor_coeffs))
+    print()
+
+
+if __name__ == '__main__':
+    main()

.CondaPkg/env/Lib/site-packages/scipy/special/_precompute/struve_convergence.py

@@ -0,0 +1,120 @@
+"""
+Convergence regions of the expansions used in ``struve.c``
+
+Note that for v >> z both functions tend rapidly to 0,
+and for v << -z, they tend to infinity.
+
+The floating-point functions over/underflow in the lower left and right
+corners of the figure.
+
+
+Figure legend
+=============
+
+Red region
+    Power series is close (1e-12) to the mpmath result
+
+Blue region
+    Asymptotic series is close to the mpmath result
+
+Green region
+    Bessel series is close to the mpmath result
+
+Dotted colored lines
+    Boundaries of the regions
+
+Solid colored lines
+    Boundaries estimated by the routine itself. These will be used
+    for determining which of the results to use.
+
+Black dashed line
+    The line z = 0.7*|v| + 12
+
+"""
+import numpy as np
+import matplotlib.pyplot as plt
+
+import mpmath
+
+
+def err_metric(a, b, atol=1e-290):
+    m = abs(a - b) / (atol + abs(b))
+    m[np.isinf(b) & (a == b)] = 0
+    return m
+
+
+def do_plot(is_h=True):
+    from scipy.special._ufuncs import (_struve_power_series,
+                                       _struve_asymp_large_z,
+                                       _struve_bessel_series)
+
+    vs = np.linspace(-1000, 1000, 91)
+    zs = np.sort(np.r_[1e-5, 1.0, np.linspace(0, 700, 91)[1:]])
+
+    rp = _struve_power_series(vs[:,None], zs[None,:], is_h)
+    ra = _struve_asymp_large_z(vs[:,None], zs[None,:], is_h)
+    rb = _struve_bessel_series(vs[:,None], zs[None,:], is_h)
+
+    mpmath.mp.dps = 50
+    if is_h:
+        sh = lambda v, z: float(mpmath.struveh(mpmath.mpf(v), mpmath.mpf(z)))
+    else:
+        sh = lambda v, z: float(mpmath.struvel(mpmath.mpf(v), mpmath.mpf(z)))
+    ex = np.vectorize(sh, otypes='d')(vs[:,None], zs[None,:])
+
+    err_a = err_metric(ra[0], ex) + 1e-300
+    err_p = err_metric(rp[0], ex) + 1e-300
+    err_b = err_metric(rb[0], ex) + 1e-300
+
+    err_est_a = abs(ra[1]/ra[0])
+    err_est_p = abs(rp[1]/rp[0])
+    err_est_b = abs(rb[1]/rb[0])
+
+    z_cutoff = 0.7*abs(vs) + 12
+
+    levels = [-1000, -12]
+
+    plt.cla()
+
+    plt.hold(1)
+    plt.contourf(vs, zs, np.log10(err_p).T, levels=levels, colors=['r', 'r'], alpha=0.1)
+    plt.contourf(vs, zs, np.log10(err_a).T, levels=levels, colors=['b', 'b'], alpha=0.1)
+    plt.contourf(vs, zs, np.log10(err_b).T, levels=levels, colors=['g', 'g'], alpha=0.1)
+
+    plt.contour(vs, zs, np.log10(err_p).T, levels=levels, colors=['r', 'r'], linestyles=[':', ':'])
+    plt.contour(vs, zs, np.log10(err_a).T, levels=levels, colors=['b', 'b'], linestyles=[':', ':'])
+    plt.contour(vs, zs, np.log10(err_b).T, levels=levels, colors=['g', 'g'], linestyles=[':', ':'])
+
+    lp = plt.contour(vs, zs, np.log10(err_est_p).T, levels=levels, colors=['r', 'r'], linestyles=['-', '-'])
+    la = plt.contour(vs, zs, np.log10(err_est_a).T, levels=levels, colors=['b', 'b'], linestyles=['-', '-'])
+    lb = plt.contour(vs, zs, np.log10(err_est_b).T, levels=levels, colors=['g', 'g'], linestyles=['-', '-'])
+
+    plt.clabel(lp, fmt={-1000: 'P', -12: 'P'})
+    plt.clabel(la, fmt={-1000: 'A', -12: 'A'})
+    plt.clabel(lb, fmt={-1000: 'B', -12: 'B'})
+
+    plt.plot(vs, z_cutoff, 'k--')
+
+    plt.xlim(vs.min(), vs.max())
+    plt.ylim(zs.min(), zs.max())
+
+    plt.xlabel('v')
+    plt.ylabel('z')
+
+
+def main():
+    plt.clf()
+    plt.subplot(121)
+    do_plot(True)
+    plt.title('Struve H')
+
+    plt.subplot(122)
+    do_plot(False)
+    plt.title('Struve L')
+
+    plt.savefig('struve_convergence.png')
+    plt.show()
+
+
+if __name__ == "__main__":
+    main()

.CondaPkg/env/Lib/site-packages/scipy/special/_precompute/utils.py

@@ -0,0 +1,38 @@
+try:
+    import mpmath as mp
+except ImportError:
+    pass
+
+try:
+    from sympy.abc import x
+except ImportError:
+    pass
+
+
+def lagrange_inversion(a):
+    """Given a series
+
+    f(x) = a[1]*x + a[2]*x**2 + ... + a[n-1]*x**(n - 1),
+
+    use the Lagrange inversion formula to compute a series
+
+    g(x) = b[1]*x + b[2]*x**2 + ... + b[n-1]*x**(n - 1)
+
+    so that f(g(x)) = g(f(x)) = x mod x**n. We must have a[0] = 0, so
+    necessarily b[0] = 0 too.
+
+    The algorithm is naive and could be improved, but speed isn't an
+    issue here and it's easy to read.
+
+    """
+    n = len(a)
+    f = sum(a[i]*x**i for i in range(n))
+    h = (x/f).series(x, 0, n).removeO()
+    hpower = [h**0]
+    for k in range(n):
+        hpower.append((hpower[-1]*h).expand())
+    b = [mp.mpf(0)]
+    for k in range(1, n):
+        b.append(hpower[k].coeff(x, k - 1)/k)
+    b = [mp.mpf(x) for x in b]
+    return b

.CondaPkg/env/Lib/site-packages/scipy/special/_precompute/wright_bessel.py

@@ -0,0 +1,342 @@
+"""Precompute coefficients of several series expansions
+of Wright's generalized Bessel function Phi(a, b, x).
+
+See https://dlmf.nist.gov/10.46.E1 with rho=a, beta=b, z=x.
+"""
+from argparse import ArgumentParser, RawTextHelpFormatter
+import numpy as np
+from scipy.integrate import quad
+from scipy.optimize import minimize_scalar, curve_fit
+from time import time
+
+try:
+    import sympy
+    from sympy import EulerGamma, Rational, S, Sum, \
+        factorial, gamma, gammasimp, pi, polygamma, symbols, zeta
+    from sympy.polys.polyfuncs import horner
+except ImportError:
+    pass
+
+
+def series_small_a():
+    """Tylor series expansion of Phi(a, b, x) in a=0 up to order 5.
+    """
+    order = 5
+    a, b, x, k = symbols("a b x k")
+    A = []  # terms with a
+    X = []  # terms with x
+    B = []  # terms with b (polygammas)
+    # Phi(a, b, x) = exp(x)/gamma(b) * sum(A[i] * X[i] * B[i])
+    expression = Sum(x**k/factorial(k)/gamma(a*k+b), (k, 0, S.Infinity))
+    expression = gamma(b)/sympy.exp(x) * expression
+
+    # nth term of taylor series in a=0: a^n/n! * (d^n Phi(a, b, x)/da^n at a=0)
+    for n in range(0, order+1):
+        term = expression.diff(a, n).subs(a, 0).simplify().doit()
+        # set the whole bracket involving polygammas to 1
+        x_part = (term.subs(polygamma(0, b), 1)
+                  .replace(polygamma, lambda *args: 0))
+        # sign convetion: x part always positive
+        x_part *= (-1)**n
+
+        A.append(a**n/factorial(n))
+        X.append(horner(x_part))
+        B.append(horner((term/x_part).simplify()))
+
+    s = "Tylor series expansion of Phi(a, b, x) in a=0 up to order 5.\n"
+    s += "Phi(a, b, x) = exp(x)/gamma(b) * sum(A[i] * X[i] * B[i], i=0..5)\n"
+    for name, c in zip(['A', 'X', 'B'], [A, X, B]):
+        for i in range(len(c)):
+            s += f"\n{name}[{i}] = " + str(c[i])
+    return s
+
+
+# expansion of digamma
+def dg_series(z, n):
+    """Symbolic expansion of digamma(z) in z=0 to order n.
+
+    See https://dlmf.nist.gov/5.7.E4 and with https://dlmf.nist.gov/5.5.E2
+    """
+    k = symbols("k")
+    return -1/z - EulerGamma + \
+        sympy.summation((-1)**k * zeta(k) * z**(k-1), (k, 2, n+1))
+
+
+def pg_series(k, z, n):
+    """Symbolic expansion of polygamma(k, z) in z=0 to order n."""
+    return sympy.diff(dg_series(z, n+k), z, k)
+
+
+def series_small_a_small_b():
+    """Tylor series expansion of Phi(a, b, x) in a=0 and b=0 up to order 5.
+
+    Be aware of cancellation of poles in b=0 of digamma(b)/Gamma(b) and
+    polygamma functions.
+
+    digamma(b)/Gamma(b) = -1 - 2*M_EG*b + O(b^2)
+    digamma(b)^2/Gamma(b) = 1/b + 3*M_EG + b*(-5/12*PI^2+7/2*M_EG^2) + O(b^2)
+    polygamma(1, b)/Gamma(b) = 1/b + M_EG + b*(1/12*PI^2 + 1/2*M_EG^2) + O(b^2)
+    and so on.
+    """
+    order = 5
+    a, b, x, k = symbols("a b x k")
+    M_PI, M_EG, M_Z3 = symbols("M_PI M_EG M_Z3")
+    c_subs = {pi: M_PI, EulerGamma: M_EG, zeta(3): M_Z3}
+    A = []  # terms with a
+    X = []  # terms with x
+    B = []  # terms with b (polygammas expanded)
+    C = []  # terms that generate B
+    # Phi(a, b, x) = exp(x) * sum(A[i] * X[i] * B[i])
+    # B[0] = 1
+    # B[k] = sum(C[k] * b**k/k!, k=0..)
+    # Note: C[k] can be obtained from a series expansion of 1/gamma(b).
+    expression = gamma(b)/sympy.exp(x) * \
+        Sum(x**k/factorial(k)/gamma(a*k+b), (k, 0, S.Infinity))
+
+    # nth term of taylor series in a=0: a^n/n! * (d^n Phi(a, b, x)/da^n at a=0)
+    for n in range(0, order+1):
+        term = expression.diff(a, n).subs(a, 0).simplify().doit()
+        # set the whole bracket involving polygammas to 1
+        x_part = (term.subs(polygamma(0, b), 1)
+                  .replace(polygamma, lambda *args: 0))
+        # sign convetion: x part always positive
+        x_part *= (-1)**n
+        # expansion of polygamma part with 1/gamma(b)
+        pg_part = term/x_part/gamma(b)
+        if n >= 1:
+            # Note: highest term is digamma^n
+            pg_part = pg_part.replace(polygamma,
+                                      lambda k, x: pg_series(k, x, order+1+n))
+            pg_part = (pg_part.series(b, 0, n=order+1-n)
+                       .removeO()
+                       .subs(polygamma(2, 1), -2*zeta(3))
+                       .simplify()
+                       )
+
+        A.append(a**n/factorial(n))
+        X.append(horner(x_part))
+        B.append(pg_part)
+
+    # Calculate C and put in the k!
+    C = sympy.Poly(B[1].subs(c_subs), b).coeffs()
+    C.reverse()
+    for i in range(len(C)):
+        C[i] = (C[i] * factorial(i)).simplify()
+
+    s = "Tylor series expansion of Phi(a, b, x) in a=0 and b=0 up to order 5."
+    s += "\nPhi(a, b, x) = exp(x) * sum(A[i] * X[i] * B[i], i=0..5)\n"
+    s += "B[0] = 1\n"
+    s += "B[i] = sum(C[k+i-1] * b**k/k!, k=0..)\n"
+    s += "\nM_PI = pi"
+    s += "\nM_EG = EulerGamma"
+    s += "\nM_Z3 = zeta(3)"
+    for name, c in zip(['A', 'X'], [A, X]):
+        for i in range(len(c)):
+            s += f"\n{name}[{i}] = "
+            s += str(c[i])
+    # For C, do also compute the values numerically
+    for i in range(len(C)):
+        s += f"\n# C[{i}] = "
+        s += str(C[i])
+        s += f"\nC[{i}] = "
+        s += str(C[i].subs({M_EG: EulerGamma, M_PI: pi, M_Z3: zeta(3)})
+                 .evalf(17))
+
+    # Does B have the assumed structure?
+    s += "\n\nTest if B[i] does have the assumed structure."
+    s += "\nC[i] are derived from B[1] allone."
+    s += "\nTest B[2] == C[1] + b*C[2] + b^2/2*C[3] + b^3/6*C[4] + .."
+    test = sum([b**k/factorial(k) * C[k+1] for k in range(order-1)])
+    test = (test - B[2].subs(c_subs)).simplify()
+    s += f"\ntest successful = {test==S(0)}"
+    s += "\nTest B[3] == C[2] + b*C[3] + b^2/2*C[4] + .."
+    test = sum([b**k/factorial(k) * C[k+2] for k in range(order-2)])
+    test = (test - B[3].subs(c_subs)).simplify()
+    s += f"\ntest successful = {test==S(0)}"
+    return s
+
+
+def asymptotic_series():
+    """Asymptotic expansion for large x.
+
+    Phi(a, b, x) ~ Z^(1/2-b) * exp((1+a)/a * Z) * sum_k (-1)^k * C_k / Z^k
+    Z = (a*x)^(1/(1+a))
+
+    Wright (1935) lists the coefficients C_0 and C_1 (he calls them a_0 and
+    a_1). With slightly different notation, Paris (2017) lists coefficients
+    c_k up to order k=3.
+    Paris (2017) uses ZP = (1+a)/a * Z  (ZP = Z of Paris) and
+    C_k = C_0 * (-a/(1+a))^k * c_k
+    """
+    order = 8
+
+    class g(sympy.Function):
+        """Helper function g according to Wright (1935)
+
+        g(n, rho, v) = (1 + (rho+2)/3 * v + (rho+2)*(rho+3)/(2*3) * v^2 + ...)
+
+        Note: Wright (1935) uses square root of above definition.
+        """
+        nargs = 3
+
+        @classmethod
+        def eval(cls, n, rho, v):
+            if not n >= 0:
+                raise ValueError("must have n >= 0")
+            elif n == 0:
+                return 1
+            else:
+                return g(n-1, rho, v) \
+                    + gammasimp(gamma(rho+2+n)/gamma(rho+2)) \
+                    / gammasimp(gamma(3+n)/gamma(3))*v**n
+
+    class coef_C(sympy.Function):
+        """Calculate coefficients C_m for integer m.
+
+        C_m is the coefficient of v^(2*m) in the Taylor expansion in v=0 of
+        Gamma(m+1/2)/(2*pi) * (2/(rho+1))^(m+1/2) * (1-v)^(-b)
+            * g(rho, v)^(-m-1/2)
+        """
+        nargs = 3
+
+        @classmethod
+        def eval(cls, m, rho, beta):
+            if not m >= 0:
+                raise ValueError("must have m >= 0")
+
+            v = symbols("v")
+            expression = (1-v)**(-beta) * g(2*m, rho, v)**(-m-Rational(1, 2))
+            res = expression.diff(v, 2*m).subs(v, 0) / factorial(2*m)
+            res = res * (gamma(m + Rational(1, 2)) / (2*pi)
+                         * (2/(rho+1))**(m + Rational(1, 2)))
+            return res
+
+    # in order to have nice ordering/sorting of expressions, we set a = xa.
+    xa, b, xap1 = symbols("xa b xap1")
+    C0 = coef_C(0, xa, b)
+    # a1 = a(1, rho, beta)
+    s = "Asymptotic expansion for large x\n"
+    s += "Phi(a, b, x) = Z**(1/2-b) * exp((1+a)/a * Z) \n"
+    s += "               * sum((-1)**k * C[k]/Z**k, k=0..6)\n\n"
+    s += "Z      = pow(a * x, 1/(1+a))\n"
+    s += "A[k]   = pow(a, k)\n"
+    s += "B[k]   = pow(b, k)\n"
+    s += "Ap1[k] = pow(1+a, k)\n\n"
+    s += "C[0] = 1./sqrt(2. * M_PI * Ap1[1])\n"
+    for i in range(1, order+1):
+        expr = (coef_C(i, xa, b) / (C0/(1+xa)**i)).simplify()
+        factor = [x.denominator() for x in sympy.Poly(expr).coeffs()]
+        factor = sympy.lcm(factor)
+        expr = (expr * factor).simplify().collect(b, sympy.factor)
+        expr = expr.xreplace({xa+1: xap1})
+        s += f"C[{i}] = C[0] / ({factor} * Ap1[{i}])\n"
+        s += f"C[{i}] *= {str(expr)}\n\n"
+    import re
+    re_a = re.compile(r'xa\*\*(\d+)')
+    s = re_a.sub(r'A[\1]', s)
+    re_b = re.compile(r'b\*\*(\d+)')
+    s = re_b.sub(r'B[\1]', s)
+    s = s.replace('xap1', 'Ap1[1]')
+    s = s.replace('xa', 'a')
+    # max integer = 2^31-1 = 2,147,483,647. Solution: Put a point after 10
+    # or more digits.
+    re_digits = re.compile(r'(\d{10,})')
+    s = re_digits.sub(r'\1.', s)
+    return s
+
+
+def optimal_epsilon_integral():
+    """Fit optimal choice of epsilon for integral representation.
+
+    The integrand of
+        int_0^pi P(eps, a, b, x, phi) * dphi
+    can exhibit oscillatory behaviour. It stems from the cosine of P and can be
+    minimized by minimizing the arc length of the argument
+        f(phi) = eps * sin(phi) - x * eps^(-a) * sin(a * phi) + (1 - b) * phi
+    of cos(f(phi)).
+    We minimize the arc length in eps for a grid of values (a, b, x) and fit a
+    parametric function to it.
+    """
+    def fp(eps, a, b, x, phi):
+        """Derivative of f w.r.t. phi."""
+        eps_a = np.power(1. * eps, -a)
+        return eps * np.cos(phi) - a * x * eps_a * np.cos(a * phi) + 1 - b
+
+    def arclength(eps, a, b, x, epsrel=1e-2, limit=100):
+        """Compute Arc length of f.
+
+        Note that the arg length of a function f fro t0 to t1 is given by
+            int_t0^t1 sqrt(1 + f'(t)^2) dt
+        """
+        return quad(lambda phi: np.sqrt(1 + fp(eps, a, b, x, phi)**2),
+                    0, np.pi,
+                    epsrel=epsrel, limit=100)[0]
+
+    # grid of minimal arc length values
+    data_a = [1e-3, 0.1, 0.5, 0.9, 1, 2, 4, 5, 6, 8]
+    data_b = [0, 1, 4, 7, 10]
+    data_x = [1, 1.5, 2, 4, 10, 20, 50, 100, 200, 500, 1e3, 5e3, 1e4]
+    data_a, data_b, data_x = np.meshgrid(data_a, data_b, data_x)
+    data_a, data_b, data_x = (data_a.flatten(), data_b.flatten(),
+                              data_x.flatten())
+    best_eps = []
+    for i in range(data_x.size):
+        best_eps.append(
+            minimize_scalar(lambda eps: arclength(eps, data_a[i], data_b[i],
+                                                  data_x[i]),
+                            bounds=(1e-3, 1000),
+                            method='Bounded', options={'xatol': 1e-3}).x
+        )
+    best_eps = np.array(best_eps)
+    # pandas would be nice, but here a dictionary is enough
+    df = {'a': data_a,
+          'b': data_b,
+          'x': data_x,
+          'eps': best_eps,
+          }
+
+    def func(data, A0, A1, A2, A3, A4, A5):
+        """Compute parametric function to fit."""
+        a = data['a']
+        b = data['b']
+        x = data['x']
+        return (A0 * b * np.exp(-0.5 * a)
+                + np.exp(A1 + 1 / (1 + a) * np.log(x) - A2 * np.exp(-A3 * a)
+                         + A4 / (1 + np.exp(A5 * a))))
+
+    func_params = list(curve_fit(func, df, df['eps'], method='trf')[0])
+
+    s = "Fit optimal eps for integrand P via minimal arc length\n"
+    s += "with parametric function:\n"
+    s += "optimal_eps = (A0 * b * exp(-a/2) + exp(A1 + 1 / (1 + a) * log(x)\n"
+    s += "              - A2 * exp(-A3 * a) + A4 / (1 + exp(A5 * a)))\n\n"
+    s += "Fitted parameters A0 to A5 are:\n"
+    s += ', '.join(['{:.5g}'.format(x) for x in func_params])
+    return s
+
+
+def main():
+    t0 = time()
+    parser = ArgumentParser(description=__doc__,
+                            formatter_class=RawTextHelpFormatter)
+    parser.add_argument('action', type=int, choices=[1, 2, 3, 4],
+                        help='chose what expansion to precompute\n'
+                             '1 : Series for small a\n'
+                             '2 : Series for small a and small b\n'
+                             '3 : Asymptotic series for large x\n'
+                             '    This may take some time (>4h).\n'
+                             '4 : Fit optimal eps for integral representation.'
+                        )
+    args = parser.parse_args()
+
+    switch = {1: lambda: print(series_small_a()),
+              2: lambda: print(series_small_a_small_b()),
+              3: lambda: print(asymptotic_series()),
+              4: lambda: print(optimal_epsilon_integral())
+              }
+    switch.get(args.action, lambda: print("Invalid input."))()
+    print("\n{:.1f} minutes elapsed.\n".format((time() - t0)/60))
+
+
+if __name__ == '__main__':
+    main()

.CondaPkg/env/Lib/site-packages/scipy/special/_precompute/wright_bessel_data.py

@@ -0,0 +1,152 @@
+"""Compute a grid of values for Wright's generalized Bessel function
+and save the values to data files for use in tests. Using mpmath directly in
+tests would take too long.
+
+This takes about 10 minutes to run on a 2.7 GHz i7 Macbook Pro.
+"""
+from functools import lru_cache
+import os
+from time import time
+
+import numpy as np
+from scipy.special._mptestutils import mpf2float
+
+try:
+    import mpmath as mp
+except ImportError:
+    pass
+
+# exp_inf: smallest value x for which exp(x) == inf
+exp_inf = 709.78271289338403
+
+
+# 64 Byte per value
+@lru_cache(maxsize=100_000)
+def rgamma_cached(x, dps):
+    with mp.workdps(dps):
+        return mp.rgamma(x)
+
+
+def mp_wright_bessel(a, b, x, dps=50, maxterms=2000):
+    """Compute Wright's generalized Bessel function as Series with mpmath.
+    """
+    with mp.workdps(dps):
+        a, b, x = mp.mpf(a), mp.mpf(b), mp.mpf(x)
+        res = mp.nsum(lambda k: x**k / mp.fac(k)
+                      * rgamma_cached(a * k + b, dps=dps),
+                      [0, mp.inf],
+                      tol=dps, method='s', steps=[maxterms]
+                      )
+        return mpf2float(res)
+
+
+def main():
+    t0 = time()
+    print(__doc__)
+    pwd = os.path.dirname(__file__)
+    eps = np.finfo(float).eps * 100
+
+    a_range = np.array([eps,
+                        1e-4 * (1 - eps), 1e-4, 1e-4 * (1 + eps),
+                        1e-3 * (1 - eps), 1e-3, 1e-3 * (1 + eps),
+                        0.1, 0.5,
+                        1 * (1 - eps), 1, 1 * (1 + eps),
+                        1.5, 2, 4.999, 5, 10])
+    b_range = np.array([0, eps, 1e-10, 1e-5, 0.1, 1, 2, 10, 20, 100])
+    x_range = np.array([0, eps, 1 - eps, 1, 1 + eps,
+                        1.5,
+                        2 - eps, 2, 2 + eps,
+                        9 - eps, 9, 9 + eps,
+                        10 * (1 - eps), 10, 10 * (1 + eps),
+                        100 * (1 - eps), 100, 100 * (1 + eps),
+                        500, exp_inf, 1e3, 1e5, 1e10, 1e20])
+
+    a_range, b_range, x_range = np.meshgrid(a_range, b_range, x_range,
+                                            indexing='ij')
+    a_range = a_range.flatten()
+    b_range = b_range.flatten()
+    x_range = x_range.flatten()
+
+    # filter out some values, especially too large x
+    bool_filter = ~((a_range < 5e-3) & (x_range >= exp_inf))
+    bool_filter = bool_filter & ~((a_range < 0.2) & (x_range > exp_inf))
+    bool_filter = bool_filter & ~((a_range < 0.5) & (x_range > 1e3))
+    bool_filter = bool_filter & ~((a_range < 0.56) & (x_range > 5e3))
+    bool_filter = bool_filter & ~((a_range < 1) & (x_range > 1e4))
+    bool_filter = bool_filter & ~((a_range < 1.4) & (x_range > 1e5))
+    bool_filter = bool_filter & ~((a_range < 1.8) & (x_range > 1e6))
+    bool_filter = bool_filter & ~((a_range < 2.2) & (x_range > 1e7))
+    bool_filter = bool_filter & ~((a_range < 2.5) & (x_range > 1e8))
+    bool_filter = bool_filter & ~((a_range < 2.9) & (x_range > 1e9))
+    bool_filter = bool_filter & ~((a_range < 3.3) & (x_range > 1e10))
+    bool_filter = bool_filter & ~((a_range < 3.7) & (x_range > 1e11))
+    bool_filter = bool_filter & ~((a_range < 4) & (x_range > 1e12))
+    bool_filter = bool_filter & ~((a_range < 4.4) & (x_range > 1e13))
+    bool_filter = bool_filter & ~((a_range < 4.7) & (x_range > 1e14))
+    bool_filter = bool_filter & ~((a_range < 5.1) & (x_range > 1e15))
+    bool_filter = bool_filter & ~((a_range < 5.4) & (x_range > 1e16))
+    bool_filter = bool_filter & ~((a_range < 5.8) & (x_range > 1e17))
+    bool_filter = bool_filter & ~((a_range < 6.2) & (x_range > 1e18))
+    bool_filter = bool_filter & ~((a_range < 6.2) & (x_range > 1e18))
+    bool_filter = bool_filter & ~((a_range < 6.5) & (x_range > 1e19))
+    bool_filter = bool_filter & ~((a_range < 6.9) & (x_range > 1e20))
+
+    # filter out known values that do not meet the required numerical accuracy
+    # see test test_wright_data_grid_failures
+    failing = np.array([
+        [0.1, 100, 709.7827128933841],
+        [0.5, 10, 709.7827128933841],
+        [0.5, 10, 1000],
+        [0.5, 100, 1000],
+        [1, 20, 100000],
+        [1, 100, 100000],
+        [1.0000000000000222, 20, 100000],
+        [1.0000000000000222, 100, 100000],
+        [1.5, 0, 500],
+        [1.5, 2.220446049250313e-14, 500],
+        [1.5, 1.e-10, 500],
+        [1.5, 1.e-05, 500],
+        [1.5, 0.1, 500],
+        [1.5, 20, 100000],
+        [1.5, 100, 100000],
+        ]).tolist()
+
+    does_fail = np.full_like(a_range, False, dtype=bool)
+    for i in range(x_range.size):
+        if [a_range[i], b_range[i], x_range[i]] in failing:
+            does_fail[i] = True
+
+    # filter and flatten
+    a_range = a_range[bool_filter]
+    b_range = b_range[bool_filter]
+    x_range = x_range[bool_filter]
+    does_fail = does_fail[bool_filter]
+
+    dataset = []
+    print(f"Computing {x_range.size} single points.")
+    print("Tests will fail for the following data points:")
+    for i in range(x_range.size):
+        a = a_range[i]
+        b = b_range[i]
+        x = x_range[i]
+        # take care of difficult corner cases
+        maxterms = 1000
+        if a < 1e-6 and x >= exp_inf/10:
+            maxterms = 2000
+        f = mp_wright_bessel(a, b, x, maxterms=maxterms)
+        if does_fail[i]:
+            print("failing data point a, b, x, value = "
+                  f"[{a}, {b}, {x}, {f}]")
+        else:
+            dataset.append((a, b, x, f))
+    dataset = np.array(dataset)
+
+    filename = os.path.join(pwd, '..', 'tests', 'data', 'local',
+                            'wright_bessel.txt')
+    np.savetxt(filename, dataset)
+
+    print("{:.1f} minutes elapsed".format((time() - t0)/60))
+
+
+if __name__ == "__main__":
+    main()

.CondaPkg/env/Lib/site-packages/scipy/special/_precompute/wrightomega.py

@@ -0,0 +1,41 @@
+import numpy as np
+
+try:
+    import mpmath
+except ImportError:
+    pass
+
+
+def mpmath_wrightomega(x):
+    return mpmath.lambertw(mpmath.exp(x), mpmath.mpf('-0.5'))
+
+
+def wrightomega_series_error(x):
+    series = x
+    desired = mpmath_wrightomega(x)
+    return abs(series - desired) / desired
+
+
+def wrightomega_exp_error(x):
+    exponential_approx = mpmath.exp(x)
+    desired = mpmath_wrightomega(x)
+    return abs(exponential_approx - desired) / desired
+
+
+def main():
+    desired_error = 2 * np.finfo(float).eps
+    print('Series Error')
+    for x in [1e5, 1e10, 1e15, 1e20]:
+        with mpmath.workdps(100):
+            error = wrightomega_series_error(x)
+        print(x, error, error < desired_error)
+
+    print('Exp error')
+    for x in [-10, -25, -50, -100, -200, -400, -700, -740]:
+        with mpmath.workdps(100):
+            error = wrightomega_exp_error(x)
+        print(x, error, error < desired_error)
+
+
+if __name__ == '__main__':
+    main()

.CondaPkg/env/Lib/site-packages/scipy/special/_precompute/zetac.py

@@ -0,0 +1,27 @@
+"""Compute the Taylor series for zeta(x) - 1 around x = 0."""
+try:
+    import mpmath
+except ImportError:
+    pass
+
+
+def zetac_series(N):
+    coeffs = []
+    with mpmath.workdps(100):
+        coeffs.append(-1.5)
+        for n in range(1, N):
+            coeff = mpmath.diff(mpmath.zeta, 0, n)/mpmath.factorial(n)
+            coeffs.append(coeff)
+    return coeffs
+
+
+def main():
+    print(__doc__)
+    coeffs = zetac_series(10)
+    coeffs = [mpmath.nstr(x, 20, min_fixed=0, max_fixed=0)
+              for x in coeffs]
+    print("\n".join(coeffs[::-1]))
+
+
+if __name__ == '__main__':
+    main()

.CondaPkg/env/Lib/site-packages/scipy/special/_sf_error.py

@@ -0,0 +1,15 @@
+"""Warnings and Exceptions that can be raised by special functions."""
+import warnings
+
+
+class SpecialFunctionWarning(Warning):
+    """Warning that can be emitted by special functions."""
+    pass
+
+
+warnings.simplefilter("always", category=SpecialFunctionWarning)
+
+
+class SpecialFunctionError(Exception):
+    """Exception that can be raised by special functions."""
+    pass

.CondaPkg/env/Lib/site-packages/scipy/special/_spfun_stats.py

@@ -0,0 +1,107 @@
+# Last Change: Sat Mar 21 02:00 PM 2009 J
+
+# Copyright (c) 2001, 2002 Enthought, Inc.
+#
+# All rights reserved.
+#
+# Redistribution and use in source and binary forms, with or without
+# modification, are permitted provided that the following conditions are met:
+#
+#   a. Redistributions of source code must retain the above copyright notice,
+#      this list of conditions and the following disclaimer.
+#   b. Redistributions in binary form must reproduce the above copyright
+#      notice, this list of conditions and the following disclaimer in the
+#      documentation and/or other materials provided with the distribution.
+#   c. Neither the name of the Enthought nor the names of its contributors
+#      may be used to endorse or promote products derived from this software
+#      without specific prior written permission.
+#
+#
+# THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS"
+# AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE
+# IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE
+# ARE DISCLAIMED. IN NO EVENT SHALL THE REGENTS OR CONTRIBUTORS BE LIABLE FOR
+# ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL
+# DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR
+# SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER
+# CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT
+# LIABILITY, OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY
+# OUT OF THE USE OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH
+# DAMAGE.
+
+"""Some more special functions which may be useful for multivariate statistical
+analysis."""
+
+import numpy as np
+from scipy.special import gammaln as loggam
+
+
+__all__ = ['multigammaln']
+
+
+def multigammaln(a, d):
+    r"""Returns the log of multivariate gamma, also sometimes called the
+    generalized gamma.
+
+    Parameters
+    ----------
+    a : ndarray
+        The multivariate gamma is computed for each item of `a`.
+    d : int
+        The dimension of the space of integration.
+
+    Returns
+    -------
+    res : ndarray
+        The values of the log multivariate gamma at the given points `a`.
+
+    Notes
+    -----
+    The formal definition of the multivariate gamma of dimension d for a real
+    `a` is
+
+    .. math::
+
+        \Gamma_d(a) = \int_{A>0} e^{-tr(A)} |A|^{a - (d+1)/2} dA
+
+    with the condition :math:`a > (d-1)/2`, and :math:`A > 0` being the set of
+    all the positive definite matrices of dimension `d`.  Note that `a` is a
+    scalar: the integrand only is multivariate, the argument is not (the
+    function is defined over a subset of the real set).
+
+    This can be proven to be equal to the much friendlier equation
+
+    .. math::
+
+        \Gamma_d(a) = \pi^{d(d-1)/4} \prod_{i=1}^{d} \Gamma(a - (i-1)/2).
+
+    References
+    ----------
+    R. J. Muirhead, Aspects of multivariate statistical theory (Wiley Series in
+    probability and mathematical statistics).
+
+    Examples
+    --------
+    >>> import numpy as np
+    >>> from scipy.special import multigammaln, gammaln
+    >>> a = 23.5
+    >>> d = 10
+    >>> multigammaln(a, d)
+    454.1488605074416
+
+    Verify that the result agrees with the logarithm of the equation
+    shown above:
+
+    >>> d*(d-1)/4*np.log(np.pi) + gammaln(a - 0.5*np.arange(0, d)).sum()
+    454.1488605074416
+    """
+    a = np.asarray(a)
+    if not np.isscalar(d) or (np.floor(d) != d):
+        raise ValueError("d should be a positive integer (dimension)")
+    if np.any(a <= 0.5 * (d - 1)):
+        raise ValueError("condition a (%f) > 0.5 * (d-1) (%f) not met"
+                         % (a, 0.5 * (d-1)))
+
+    res = (d * (d-1) * 0.25) * np.log(np.pi)
+    res += np.sum(loggam([(a - (j - 1.)/2) for j in range(1, d+1)]), axis=0)
+    return res

.CondaPkg/env/Lib/site-packages/scipy/special/_spherical_bessel.py

@@ -0,0 +1,349 @@
+from ._ufuncs import (_spherical_jn, _spherical_yn, _spherical_in,
+                      _spherical_kn, _spherical_jn_d, _spherical_yn_d,
+                      _spherical_in_d, _spherical_kn_d)
+
+def spherical_jn(n, z, derivative=False):
+    r"""Spherical Bessel function of the first kind or its derivative.
+
+    Defined as [1]_,
+
+    .. math:: j_n(z) = \sqrt{\frac{\pi}{2z}} J_{n + 1/2}(z),
+
+    where :math:`J_n` is the Bessel function of the first kind.
+
+    Parameters
+    ----------
+    n : int, array_like
+        Order of the Bessel function (n >= 0).
+    z : complex or float, array_like
+        Argument of the Bessel function.
+    derivative : bool, optional
+        If True, the value of the derivative (rather than the function
+        itself) is returned.
+
+    Returns
+    -------
+    jn : ndarray
+
+    Notes
+    -----
+    For real arguments greater than the order, the function is computed
+    using the ascending recurrence [2]_. For small real or complex
+    arguments, the definitional relation to the cylindrical Bessel function
+    of the first kind is used.
+
+    The derivative is computed using the relations [3]_,
+
+    .. math::
+        j_n'(z) = j_{n-1}(z) - \frac{n + 1}{z} j_n(z).
+
+        j_0'(z) = -j_1(z)
+
+
+    .. versionadded:: 0.18.0
+
+    References
+    ----------
+    .. [1] https://dlmf.nist.gov/10.47.E3
+    .. [2] https://dlmf.nist.gov/10.51.E1
+    .. [3] https://dlmf.nist.gov/10.51.E2
+    .. [AS] Milton Abramowitz and Irene A. Stegun, eds.
+        Handbook of Mathematical Functions with Formulas,
+        Graphs, and Mathematical Tables. New York: Dover, 1972.
+
+    Examples
+    --------
+    The spherical Bessel functions of the first kind :math:`j_n` accept
+    both real and complex second argument. They can return a complex type:
+
+    >>> from scipy.special import spherical_jn
+    >>> spherical_jn(0, 3+5j)
+    (-9.878987731663194-8.021894345786002j)
+    >>> type(spherical_jn(0, 3+5j))
+    <class 'numpy.complex128'>
+
+    We can verify the relation for the derivative from the Notes
+    for :math:`n=3` in the interval :math:`[1, 2]`:
+
+    >>> import numpy as np
+    >>> x = np.arange(1.0, 2.0, 0.01)
+    >>> np.allclose(spherical_jn(3, x, True),
+    ...             spherical_jn(2, x) - 4/x * spherical_jn(3, x))
+    True
+
+    The first few :math:`j_n` with real argument:
+
+    >>> import matplotlib.pyplot as plt
+    >>> x = np.arange(0.0, 10.0, 0.01)
+    >>> fig, ax = plt.subplots()
+    >>> ax.set_ylim(-0.5, 1.5)
+    >>> ax.set_title(r'Spherical Bessel functions $j_n$')
+    >>> for n in np.arange(0, 4):
+    ...     ax.plot(x, spherical_jn(n, x), label=rf'$j_{n}$')
+    >>> plt.legend(loc='best')
+    >>> plt.show()
+
+    """
+    if derivative:
+        return _spherical_jn_d(n, z)
+    else:
+        return _spherical_jn(n, z)
+
+
+def spherical_yn(n, z, derivative=False):
+    r"""Spherical Bessel function of the second kind or its derivative.
+
+    Defined as [1]_,
+
+    .. math:: y_n(z) = \sqrt{\frac{\pi}{2z}} Y_{n + 1/2}(z),
+
+    where :math:`Y_n` is the Bessel function of the second kind.
+
+    Parameters
+    ----------
+    n : int, array_like
+        Order of the Bessel function (n >= 0).
+    z : complex or float, array_like
+        Argument of the Bessel function.
+    derivative : bool, optional
+        If True, the value of the derivative (rather than the function
+        itself) is returned.
+
+    Returns
+    -------
+    yn : ndarray
+
+    Notes
+    -----
+    For real arguments, the function is computed using the ascending
+    recurrence [2]_.  For complex arguments, the definitional relation to
+    the cylindrical Bessel function of the second kind is used.
+
+    The derivative is computed using the relations [3]_,
+
+    .. math::
+        y_n' = y_{n-1} - \frac{n + 1}{z} y_n.
+
+        y_0' = -y_1
+
+
+    .. versionadded:: 0.18.0
+
+    References
+    ----------
+    .. [1] https://dlmf.nist.gov/10.47.E4
+    .. [2] https://dlmf.nist.gov/10.51.E1
+    .. [3] https://dlmf.nist.gov/10.51.E2
+    .. [AS] Milton Abramowitz and Irene A. Stegun, eds.
+        Handbook of Mathematical Functions with Formulas,
+        Graphs, and Mathematical Tables. New York: Dover, 1972.
+
+    Examples
+    --------
+    The spherical Bessel functions of the second kind :math:`y_n` accept
+    both real and complex second argument. They can return a complex type:
+
+    >>> from scipy.special import spherical_yn
+    >>> spherical_yn(0, 3+5j)
+    (8.022343088587197-9.880052589376795j)
+    >>> type(spherical_yn(0, 3+5j))
+    <class 'numpy.complex128'>
+
+    We can verify the relation for the derivative from the Notes
+    for :math:`n=3` in the interval :math:`[1, 2]`:
+
+    >>> import numpy as np
+    >>> x = np.arange(1.0, 2.0, 0.01)
+    >>> np.allclose(spherical_yn(3, x, True),
+    ...             spherical_yn(2, x) - 4/x * spherical_yn(3, x))
+    True
+
+    The first few :math:`y_n` with real argument:
+
+    >>> import matplotlib.pyplot as plt
+    >>> x = np.arange(0.0, 10.0, 0.01)
+    >>> fig, ax = plt.subplots()
+    >>> ax.set_ylim(-2.0, 1.0)
+    >>> ax.set_title(r'Spherical Bessel functions $y_n$')
+    >>> for n in np.arange(0, 4):
+    ...     ax.plot(x, spherical_yn(n, x), label=rf'$y_{n}$')
+    >>> plt.legend(loc='best')
+    >>> plt.show()
+
+    """
+    if derivative:
+        return _spherical_yn_d(n, z)
+    else:
+        return _spherical_yn(n, z)
+
+
+def spherical_in(n, z, derivative=False):
+    r"""Modified spherical Bessel function of the first kind or its derivative.
+
+    Defined as [1]_,
+
+    .. math:: i_n(z) = \sqrt{\frac{\pi}{2z}} I_{n + 1/2}(z),
+
+    where :math:`I_n` is the modified Bessel function of the first kind.
+
+    Parameters
+    ----------
+    n : int, array_like
+        Order of the Bessel function (n >= 0).
+    z : complex or float, array_like
+        Argument of the Bessel function.
+    derivative : bool, optional
+        If True, the value of the derivative (rather than the function
+        itself) is returned.
+
+    Returns
+    -------
+    in : ndarray
+
+    Notes
+    -----
+    The function is computed using its definitional relation to the
+    modified cylindrical Bessel function of the first kind.
+
+    The derivative is computed using the relations [2]_,
+
+    .. math::
+        i_n' = i_{n-1} - \frac{n + 1}{z} i_n.
+
+        i_1' = i_0
+
+
+    .. versionadded:: 0.18.0
+
+    References
+    ----------
+    .. [1] https://dlmf.nist.gov/10.47.E7
+    .. [2] https://dlmf.nist.gov/10.51.E5
+    .. [AS] Milton Abramowitz and Irene A. Stegun, eds.
+        Handbook of Mathematical Functions with Formulas,
+        Graphs, and Mathematical Tables. New York: Dover, 1972.
+
+    Examples
+    --------
+    The modified spherical Bessel functions of the first kind :math:`i_n`
+    accept both real and complex second argument.
+    They can return a complex type:
+
+    >>> from scipy.special import spherical_in
+    >>> spherical_in(0, 3+5j)
+    (-1.1689867793369182-1.2697305267234222j)
+    >>> type(spherical_in(0, 3+5j))
+    <class 'numpy.complex128'>
+
+    We can verify the relation for the derivative from the Notes
+    for :math:`n=3` in the interval :math:`[1, 2]`:
+
+    >>> import numpy as np
+    >>> x = np.arange(1.0, 2.0, 0.01)
+    >>> np.allclose(spherical_in(3, x, True),
+    ...             spherical_in(2, x) - 4/x * spherical_in(3, x))
+    True
+
+    The first few :math:`i_n` with real argument:
+
+    >>> import matplotlib.pyplot as plt
+    >>> x = np.arange(0.0, 6.0, 0.01)
+    >>> fig, ax = plt.subplots()
+    >>> ax.set_ylim(-0.5, 5.0)
+    >>> ax.set_title(r'Modified spherical Bessel functions $i_n$')
+    >>> for n in np.arange(0, 4):
+    ...     ax.plot(x, spherical_in(n, x), label=rf'$i_{n}$')
+    >>> plt.legend(loc='best')
+    >>> plt.show()
+
+    """
+    if derivative:
+        return _spherical_in_d(n, z)
+    else:
+        return _spherical_in(n, z)
+
+
+def spherical_kn(n, z, derivative=False):
+    r"""Modified spherical Bessel function of the second kind or its derivative.
+
+    Defined as [1]_,
+
+    .. math:: k_n(z) = \sqrt{\frac{\pi}{2z}} K_{n + 1/2}(z),
+
+    where :math:`K_n` is the modified Bessel function of the second kind.
+
+    Parameters
+    ----------
+    n : int, array_like
+        Order of the Bessel function (n >= 0).
+    z : complex or float, array_like
+        Argument of the Bessel function.
+    derivative : bool, optional
+        If True, the value of the derivative (rather than the function
+        itself) is returned.
+
+    Returns
+    -------
+    kn : ndarray
+
+    Notes
+    -----
+    The function is computed using its definitional relation to the
+    modified cylindrical Bessel function of the second kind.
+
+    The derivative is computed using the relations [2]_,
+
+    .. math::
+        k_n' = -k_{n-1} - \frac{n + 1}{z} k_n.
+
+        k_0' = -k_1
+
+
+    .. versionadded:: 0.18.0
+
+    References
+    ----------
+    .. [1] https://dlmf.nist.gov/10.47.E9
+    .. [2] https://dlmf.nist.gov/10.51.E5
+    .. [AS] Milton Abramowitz and Irene A. Stegun, eds.
+        Handbook of Mathematical Functions with Formulas,
+        Graphs, and Mathematical Tables. New York: Dover, 1972.
+
+    Examples
+    --------
+    The modified spherical Bessel functions of the second kind :math:`k_n`
+    accept both real and complex second argument.
+    They can return a complex type:
+
+    >>> from scipy.special import spherical_kn
+    >>> spherical_kn(0, 3+5j)
+    (0.012985785614001561+0.003354691603137546j)
+    >>> type(spherical_kn(0, 3+5j))
+    <class 'numpy.complex128'>
+
+    We can verify the relation for the derivative from the Notes
+    for :math:`n=3` in the interval :math:`[1, 2]`:
+
+    >>> import numpy as np
+    >>> x = np.arange(1.0, 2.0, 0.01)
+    >>> np.allclose(spherical_kn(3, x, True),
+    ...             - 4/x * spherical_kn(3, x) - spherical_kn(2, x))
+    True
+
+    The first few :math:`k_n` with real argument:
+
+    >>> import matplotlib.pyplot as plt
+    >>> x = np.arange(0.0, 4.0, 0.01)
+    >>> fig, ax = plt.subplots()
+    >>> ax.set_ylim(0.0, 5.0)
+    >>> ax.set_title(r'Modified spherical Bessel functions $k_n$')
+    >>> for n in np.arange(0, 4):
+    ...     ax.plot(x, spherical_kn(n, x), label=rf'$k_{n}$')
+    >>> plt.legend(loc='best')
+    >>> plt.show()
+
+    """
+    if derivative:
+        return _spherical_kn_d(n, z)
+    else:
+        return _spherical_kn(n, z)

.CondaPkg/env/Lib/site-packages/scipy/special/_test_internal.pyi

@@ -0,0 +1,10 @@
+from typing import Tuple
+import numpy as np
+
+def have_fenv() -> bool: ...
+def random_double(size: int) -> np.float64: ...
+def test_add_round(size: int, mode: str): ...
+
+def _dd_exp(xhi: float, xlo: float) -> Tuple[float, float]: ...
+def _dd_log(xhi: float, xlo: float) -> Tuple[float, float]: ...
+def _dd_expm1(xhi: float, xlo: float) -> Tuple[float, float]: ...

.CondaPkg/env/Lib/site-packages/scipy/special/_testutils.py

@@ -0,0 +1,316 @@
+import os
+import functools
+import operator
+from scipy._lib import _pep440
+
+import numpy as np
+from numpy.testing import assert_
+import pytest
+
+import scipy.special as sc
+
+__all__ = ['with_special_errors', 'assert_func_equal', 'FuncData']
+
+
+#------------------------------------------------------------------------------
+# Check if a module is present to be used in tests
+#------------------------------------------------------------------------------
+
+class MissingModule:
+    def __init__(self, name):
+        self.name = name
+
+
+def check_version(module, min_ver):
+    if type(module) == MissingModule:
+        return pytest.mark.skip(reason="{} is not installed".format(module.name))
+    return pytest.mark.skipif(_pep440.parse(module.__version__) < _pep440.Version(min_ver),
+                              reason="{} version >= {} required".format(module.__name__, min_ver))
+
+
+#------------------------------------------------------------------------------
+# Enable convergence and loss of precision warnings -- turn off one by one
+#------------------------------------------------------------------------------
+
+def with_special_errors(func):
+    """
+    Enable special function errors (such as underflow, overflow,
+    loss of precision, etc.)
+    """
+    @functools.wraps(func)
+    def wrapper(*a, **kw):
+        with sc.errstate(all='raise'):
+            res = func(*a, **kw)
+        return res
+    return wrapper
+
+
+#------------------------------------------------------------------------------
+# Comparing function values at many data points at once, with helpful
+# error reports
+#------------------------------------------------------------------------------
+
+def assert_func_equal(func, results, points, rtol=None, atol=None,
+                      param_filter=None, knownfailure=None,
+                      vectorized=True, dtype=None, nan_ok=False,
+                      ignore_inf_sign=False, distinguish_nan_and_inf=True):
+    if hasattr(points, 'next'):
+        # it's a generator
+        points = list(points)
+
+    points = np.asarray(points)
+    if points.ndim == 1:
+        points = points[:,None]
+    nparams = points.shape[1]
+
+    if hasattr(results, '__name__'):
+        # function
+        data = points
+        result_columns = None
+        result_func = results
+    else:
+        # dataset
+        data = np.c_[points, results]
+        result_columns = list(range(nparams, data.shape[1]))
+        result_func = None
+
+    fdata = FuncData(func, data, list(range(nparams)),
+                     result_columns=result_columns, result_func=result_func,
+                     rtol=rtol, atol=atol, param_filter=param_filter,
+                     knownfailure=knownfailure, nan_ok=nan_ok, vectorized=vectorized,
+                     ignore_inf_sign=ignore_inf_sign,
+                     distinguish_nan_and_inf=distinguish_nan_and_inf)
+    fdata.check()
+
+
+class FuncData:
+    """
+    Data set for checking a special function.
+
+    Parameters
+    ----------
+    func : function
+        Function to test
+    data : numpy array
+        columnar data to use for testing
+    param_columns : int or tuple of ints
+        Columns indices in which the parameters to `func` lie.
+        Can be imaginary integers to indicate that the parameter
+        should be cast to complex.
+    result_columns : int or tuple of ints, optional
+        Column indices for expected results from `func`.
+    result_func : callable, optional
+        Function to call to obtain results.
+    rtol : float, optional
+        Required relative tolerance. Default is 5*eps.
+    atol : float, optional
+        Required absolute tolerance. Default is 5*tiny.
+    param_filter : function, or tuple of functions/Nones, optional
+        Filter functions to exclude some parameter ranges.
+        If omitted, no filtering is done.
+    knownfailure : str, optional
+        Known failure error message to raise when the test is run.
+        If omitted, no exception is raised.
+    nan_ok : bool, optional
+        If nan is always an accepted result.
+    vectorized : bool, optional
+        Whether all functions passed in are vectorized.
+    ignore_inf_sign : bool, optional
+        Whether to ignore signs of infinities.
+        (Doesn't matter for complex-valued functions.)
+    distinguish_nan_and_inf : bool, optional
+        If True, treat numbers which contain nans or infs as
+        equal. Sets ignore_inf_sign to be True.
+
+    """
+
+    def __init__(self, func, data, param_columns, result_columns=None,
+                 result_func=None, rtol=None, atol=None, param_filter=None,
+                 knownfailure=None, dataname=None, nan_ok=False, vectorized=True,
+                 ignore_inf_sign=False, distinguish_nan_and_inf=True):
+        self.func = func
+        self.data = data
+        self.dataname = dataname
+        if not hasattr(param_columns, '__len__'):
+            param_columns = (param_columns,)
+        self.param_columns = tuple(param_columns)
+        if result_columns is not None:
+            if not hasattr(result_columns, '__len__'):
+                result_columns = (result_columns,)
+            self.result_columns = tuple(result_columns)
+            if result_func is not None:
+                raise ValueError("Only result_func or result_columns should be provided")
+        elif result_func is not None:
+            self.result_columns = None
+        else:
+            raise ValueError("Either result_func or result_columns should be provided")
+        self.result_func = result_func
+        self.rtol = rtol
+        self.atol = atol
+        if not hasattr(param_filter, '__len__'):
+            param_filter = (param_filter,)
+        self.param_filter = param_filter
+        self.knownfailure = knownfailure
+        self.nan_ok = nan_ok
+        self.vectorized = vectorized
+        self.ignore_inf_sign = ignore_inf_sign
+        self.distinguish_nan_and_inf = distinguish_nan_and_inf
+        if not self.distinguish_nan_and_inf:
+            self.ignore_inf_sign = True
+
+    def get_tolerances(self, dtype):
+        if not np.issubdtype(dtype, np.inexact):
+            dtype = np.dtype(float)
+        info = np.finfo(dtype)
+        rtol, atol = self.rtol, self.atol
+        if rtol is None:
+            rtol = 5*info.eps
+        if atol is None:
+            atol = 5*info.tiny
+        return rtol, atol
+
+    def check(self, data=None, dtype=None, dtypes=None):
+        """Check the special function against the data."""
+        __tracebackhide__ = operator.methodcaller(
+            'errisinstance', AssertionError
+        )
+
+        if self.knownfailure:
+            pytest.xfail(reason=self.knownfailure)
+
+        if data is None:
+            data = self.data
+
+        if dtype is None:
+            dtype = data.dtype
+        else:
+            data = data.astype(dtype)
+
+        rtol, atol = self.get_tolerances(dtype)
+
+        # Apply given filter functions
+        if self.param_filter:
+            param_mask = np.ones((data.shape[0],), np.bool_)
+            for j, filter in zip(self.param_columns, self.param_filter):
+                if filter:
+                    param_mask &= list(filter(data[:,j]))
+            data = data[param_mask]
+
+        # Pick parameters from the correct columns
+        params = []
+        for idx, j in enumerate(self.param_columns):
+            if np.iscomplexobj(j):
+                j = int(j.imag)
+                params.append(data[:,j].astype(complex))
+            elif dtypes and idx < len(dtypes):
+                params.append(data[:, j].astype(dtypes[idx]))
+            else:
+                params.append(data[:,j])
+
+        # Helper for evaluating results
+        def eval_func_at_params(func, skip_mask=None):
+            if self.vectorized:
+                got = func(*params)
+            else:
+                got = []
+                for j in range(len(params[0])):
+                    if skip_mask is not None and skip_mask[j]:
+                        got.append(np.nan)
+                        continue
+                    got.append(func(*tuple([params[i][j] for i in range(len(params))])))
+                got = np.asarray(got)
+            if not isinstance(got, tuple):
+                got = (got,)
+            return got
+
+        # Evaluate function to be tested
+        got = eval_func_at_params(self.func)
+
+        # Grab the correct results
+        if self.result_columns is not None:
+            # Correct results passed in with the data
+            wanted = tuple([data[:,icol] for icol in self.result_columns])
+        else:
+            # Function producing correct results passed in
+            skip_mask = None
+            if self.nan_ok and len(got) == 1:
+                # Don't spend time evaluating what doesn't need to be evaluated
+                skip_mask = np.isnan(got[0])
+            wanted = eval_func_at_params(self.result_func, skip_mask=skip_mask)
+
+        # Check the validity of each output returned
+        assert_(len(got) == len(wanted))
+
+        for output_num, (x, y) in enumerate(zip(got, wanted)):
+            if np.issubdtype(x.dtype, np.complexfloating) or self.ignore_inf_sign:
+                pinf_x = np.isinf(x)
+                pinf_y = np.isinf(y)
+                minf_x = np.isinf(x)
+                minf_y = np.isinf(y)
+            else:
+                pinf_x = np.isposinf(x)
+                pinf_y = np.isposinf(y)
+                minf_x = np.isneginf(x)
+                minf_y = np.isneginf(y)
+            nan_x = np.isnan(x)
+            nan_y = np.isnan(y)
+
+            with np.errstate(all='ignore'):
+                abs_y = np.absolute(y)
+                abs_y[~np.isfinite(abs_y)] = 0
+                diff = np.absolute(x - y)
+                diff[~np.isfinite(diff)] = 0
+
+                rdiff = diff / np.absolute(y)
+                rdiff[~np.isfinite(rdiff)] = 0
+
+            tol_mask = (diff <= atol + rtol*abs_y)
+            pinf_mask = (pinf_x == pinf_y)
+            minf_mask = (minf_x == minf_y)
+
+            nan_mask = (nan_x == nan_y)
+
+            bad_j = ~(tol_mask & pinf_mask & minf_mask & nan_mask)
+
+            point_count = bad_j.size
+            if self.nan_ok:
+                bad_j &= ~nan_x
+                bad_j &= ~nan_y
+                point_count -= (nan_x | nan_y).sum()
+
+            if not self.distinguish_nan_and_inf and not self.nan_ok:
+                # If nan's are okay we've already covered all these cases
+                inf_x = np.isinf(x)
+                inf_y = np.isinf(y)
+                both_nonfinite = (inf_x & nan_y) | (nan_x & inf_y)
+                bad_j &= ~both_nonfinite
+                point_count -= both_nonfinite.sum()
+
+            if np.any(bad_j):
+                # Some bad results: inform what, where, and how bad
+                msg = [""]
+                msg.append("Max |adiff|: %g" % diff[bad_j].max())
+                msg.append("Max |rdiff|: %g" % rdiff[bad_j].max())
+                msg.append("Bad results (%d out of %d) for the following points (in output %d):"
+                           % (np.sum(bad_j), point_count, output_num,))
+                for j in np.nonzero(bad_j)[0]:
+                    j = int(j)
+                    fmt = lambda x: "%30s" % np.array2string(x[j], precision=18)
+                    a = "  ".join(map(fmt, params))
+                    b = "  ".join(map(fmt, got))
+                    c = "  ".join(map(fmt, wanted))
+                    d = fmt(rdiff)
+                    msg.append("%s => %s != %s  (rdiff %s)" % (a, b, c, d))
+                assert_(False, "\n".join(msg))
+
+    def __repr__(self):
+        """Pretty-printing, esp. for Nose output"""
+        if np.any(list(map(np.iscomplexobj, self.param_columns))):
+            is_complex = " (complex)"
+        else:
+            is_complex = ""
+        if self.dataname:
+            return "<Data for %s%s: %s>" % (self.func.__name__, is_complex,
+                                            os.path.basename(self.dataname))
+        else:
+            return "<Data for %s%s>" % (self.func.__name__, is_complex)

.CondaPkg/env/Lib/site-packages/scipy/special/_ufuncs.pyi

@@ -0,0 +1,520 @@
+# This file is automatically generated by _generate_pyx.py.
+# Do not edit manually!
+
+from typing import Any, Dict
+
+import numpy as np
+
+__all__ = [
+    'geterr',
+    'seterr',
+    'errstate',
+    'agm',
+    'airy',
+    'airye',
+    'bdtr',
+    'bdtrc',
+    'bdtri',
+    'bdtrik',
+    'bdtrin',
+    'bei',
+    'beip',
+    'ber',
+    'berp',
+    'besselpoly',
+    'beta',
+    'betainc',
+    'betaincinv',
+    'betaln',
+    'binom',
+    'boxcox',
+    'boxcox1p',
+    'btdtr',
+    'btdtri',
+    'btdtria',
+    'btdtrib',
+    'cbrt',
+    'chdtr',
+    'chdtrc',
+    'chdtri',
+    'chdtriv',
+    'chndtr',
+    'chndtridf',
+    'chndtrinc',
+    'chndtrix',
+    'cosdg',
+    'cosm1',
+    'cotdg',
+    'dawsn',
+    'ellipe',
+    'ellipeinc',
+    'ellipj',
+    'ellipk',
+    'ellipkinc',
+    'ellipkm1',
+    'elliprc',
+    'elliprd',
+    'elliprf',
+    'elliprg',
+    'elliprj',
+    'entr',
+    'erf',
+    'erfc',
+    'erfcinv',
+    'erfcx',
+    'erfi',
+    'erfinv',
+    'eval_chebyc',
+    'eval_chebys',
+    'eval_chebyt',
+    'eval_chebyu',
+    'eval_gegenbauer',
+    'eval_genlaguerre',
+    'eval_hermite',
+    'eval_hermitenorm',
+    'eval_jacobi',
+    'eval_laguerre',
+    'eval_legendre',
+    'eval_sh_chebyt',
+    'eval_sh_chebyu',
+    'eval_sh_jacobi',
+    'eval_sh_legendre',
+    'exp1',
+    'exp10',
+    'exp2',
+    'expi',
+    'expit',
+    'expm1',
+    'expn',
+    'exprel',
+    'fdtr',
+    'fdtrc',
+    'fdtri',
+    'fdtridfd',
+    'fresnel',
+    'gamma',
+    'gammainc',
+    'gammaincc',
+    'gammainccinv',
+    'gammaincinv',
+    'gammaln',
+    'gammasgn',
+    'gdtr',
+    'gdtrc',
+    'gdtria',
+    'gdtrib',
+    'gdtrix',
+    'hankel1',
+    'hankel1e',
+    'hankel2',
+    'hankel2e',
+    'huber',
+    'hyp0f1',
+    'hyp1f1',
+    'hyp2f1',
+    'hyperu',
+    'i0',
+    'i0e',
+    'i1',
+    'i1e',
+    'inv_boxcox',
+    'inv_boxcox1p',
+    'it2i0k0',
+    'it2j0y0',
+    'it2struve0',
+    'itairy',
+    'iti0k0',
+    'itj0y0',
+    'itmodstruve0',
+    'itstruve0',
+    'iv',
+    'ive',
+    'j0',
+    'j1',
+    'jn',
+    'jv',
+    'jve',
+    'k0',
+    'k0e',
+    'k1',
+    'k1e',
+    'kei',
+    'keip',
+    'kelvin',
+    'ker',
+    'kerp',
+    'kl_div',
+    'kn',
+    'kolmogi',
+    'kolmogorov',
+    'kv',
+    'kve',
+    'log1p',
+    'log_expit',
+    'log_ndtr',
+    'loggamma',
+    'logit',
+    'lpmv',
+    'mathieu_a',
+    'mathieu_b',
+    'mathieu_cem',
+    'mathieu_modcem1',
+    'mathieu_modcem2',
+    'mathieu_modsem1',
+    'mathieu_modsem2',
+    'mathieu_sem',
+    'modfresnelm',
+    'modfresnelp',
+    'modstruve',
+    'nbdtr',
+    'nbdtrc',
+    'nbdtri',
+    'nbdtrik',
+    'nbdtrin',
+    'ncfdtr',
+    'ncfdtri',
+    'ncfdtridfd',
+    'ncfdtridfn',
+    'ncfdtrinc',
+    'nctdtr',
+    'nctdtridf',
+    'nctdtrinc',
+    'nctdtrit',
+    'ndtr',
+    'ndtri',
+    'ndtri_exp',
+    'nrdtrimn',
+    'nrdtrisd',
+    'obl_ang1',
+    'obl_ang1_cv',
+    'obl_cv',
+    'obl_rad1',
+    'obl_rad1_cv',
+    'obl_rad2',
+    'obl_rad2_cv',
+    'owens_t',
+    'pbdv',
+    'pbvv',
+    'pbwa',
+    'pdtr',
+    'pdtrc',
+    'pdtri',
+    'pdtrik',
+    'poch',
+    'powm1',
+    'pro_ang1',
+    'pro_ang1_cv',
+    'pro_cv',
+    'pro_rad1',
+    'pro_rad1_cv',
+    'pro_rad2',
+    'pro_rad2_cv',
+    'pseudo_huber',
+    'psi',
+    'radian',
+    'rel_entr',
+    'rgamma',
+    'round',
+    'shichi',
+    'sici',
+    'sindg',
+    'smirnov',
+    'smirnovi',
+    'spence',
+    'sph_harm',
+    'stdtr',
+    'stdtridf',
+    'stdtrit',
+    'struve',
+    'tandg',
+    'tklmbda',
+    'voigt_profile',
+    'wofz',
+    'wright_bessel',
+    'wrightomega',
+    'xlog1py',
+    'xlogy',
+    'y0',
+    'y1',
+    'yn',
+    'yv',
+    'yve',
+    'zetac'
+]
+
+def geterr() -> Dict[str, str]: ...
+def seterr(**kwargs: str) -> Dict[str, str]: ...
+
+class errstate:
+    def __init__(self, **kargs: str) -> None: ...
+    def __enter__(self) -> None: ...
+    def __exit__(
+        self,
+        exc_type: Any,  # Unused
+        exc_value: Any,  # Unused
+        traceback: Any,  # Unused
+    ) -> None: ...
+
+_cosine_cdf: np.ufunc
+_cosine_invcdf: np.ufunc
+_cospi: np.ufunc
+_ellip_harm: np.ufunc
+_factorial: np.ufunc
+_igam_fac: np.ufunc
+_kolmogc: np.ufunc
+_kolmogci: np.ufunc
+_kolmogp: np.ufunc
+_lambertw: np.ufunc
+_lanczos_sum_expg_scaled: np.ufunc
+_lgam1p: np.ufunc
+_log1pmx: np.ufunc
+_riemann_zeta: np.ufunc
+_sf_error_test_function: np.ufunc
+_sinpi: np.ufunc
+_smirnovc: np.ufunc
+_smirnovci: np.ufunc
+_smirnovp: np.ufunc
+_spherical_in: np.ufunc
+_spherical_in_d: np.ufunc
+_spherical_jn: np.ufunc
+_spherical_jn_d: np.ufunc
+_spherical_kn: np.ufunc
+_spherical_kn_d: np.ufunc
+_spherical_yn: np.ufunc
+_spherical_yn_d: np.ufunc
+_struve_asymp_large_z: np.ufunc
+_struve_bessel_series: np.ufunc
+_struve_power_series: np.ufunc
+_zeta: np.ufunc
+agm: np.ufunc
+airy: np.ufunc
+airye: np.ufunc
+bdtr: np.ufunc
+bdtrc: np.ufunc
+bdtri: np.ufunc
+bdtrik: np.ufunc
+bdtrin: np.ufunc
+bei: np.ufunc
+beip: np.ufunc
+ber: np.ufunc
+berp: np.ufunc
+besselpoly: np.ufunc
+beta: np.ufunc
+betainc: np.ufunc
+betaincinv: np.ufunc
+betaln: np.ufunc
+binom: np.ufunc
+boxcox1p: np.ufunc
+boxcox: np.ufunc
+btdtr: np.ufunc
+btdtri: np.ufunc
+btdtria: np.ufunc
+btdtrib: np.ufunc
+cbrt: np.ufunc
+chdtr: np.ufunc
+chdtrc: np.ufunc
+chdtri: np.ufunc
+chdtriv: np.ufunc
+chndtr: np.ufunc
+chndtridf: np.ufunc
+chndtrinc: np.ufunc
+chndtrix: np.ufunc
+cosdg: np.ufunc
+cosm1: np.ufunc
+cotdg: np.ufunc
+dawsn: np.ufunc
+ellipe: np.ufunc
+ellipeinc: np.ufunc
+ellipj: np.ufunc
+ellipk: np.ufunc
+ellipkinc: np.ufunc
+ellipkm1: np.ufunc
+elliprc: np.ufunc
+elliprd: np.ufunc
+elliprf: np.ufunc
+elliprg: np.ufunc
+elliprj: np.ufunc
+entr: np.ufunc
+erf: np.ufunc
+erfc: np.ufunc
+erfcinv: np.ufunc
+erfcx: np.ufunc
+erfi: np.ufunc
+erfinv: np.ufunc
+eval_chebyc: np.ufunc
+eval_chebys: np.ufunc
+eval_chebyt: np.ufunc
+eval_chebyu: np.ufunc
+eval_gegenbauer: np.ufunc
+eval_genlaguerre: np.ufunc
+eval_hermite: np.ufunc
+eval_hermitenorm: np.ufunc
+eval_jacobi: np.ufunc
+eval_laguerre: np.ufunc
+eval_legendre: np.ufunc
+eval_sh_chebyt: np.ufunc
+eval_sh_chebyu: np.ufunc
+eval_sh_jacobi: np.ufunc
+eval_sh_legendre: np.ufunc
+exp10: np.ufunc
+exp1: np.ufunc
+exp2: np.ufunc
+expi: np.ufunc
+expit: np.ufunc
+expm1: np.ufunc
+expn: np.ufunc
+exprel: np.ufunc
+fdtr: np.ufunc
+fdtrc: np.ufunc
+fdtri: np.ufunc
+fdtridfd: np.ufunc
+fresnel: np.ufunc
+gamma: np.ufunc
+gammainc: np.ufunc
+gammaincc: np.ufunc
+gammainccinv: np.ufunc
+gammaincinv: np.ufunc
+gammaln: np.ufunc
+gammasgn: np.ufunc
+gdtr: np.ufunc
+gdtrc: np.ufunc
+gdtria: np.ufunc
+gdtrib: np.ufunc
+gdtrix: np.ufunc
+hankel1: np.ufunc
+hankel1e: np.ufunc
+hankel2: np.ufunc
+hankel2e: np.ufunc
+huber: np.ufunc
+hyp0f1: np.ufunc
+hyp1f1: np.ufunc
+hyp2f1: np.ufunc
+hyperu: np.ufunc
+i0: np.ufunc
+i0e: np.ufunc
+i1: np.ufunc
+i1e: np.ufunc
+inv_boxcox1p: np.ufunc
+inv_boxcox: np.ufunc
+it2i0k0: np.ufunc
+it2j0y0: np.ufunc
+it2struve0: np.ufunc
+itairy: np.ufunc
+iti0k0: np.ufunc
+itj0y0: np.ufunc
+itmodstruve0: np.ufunc
+itstruve0: np.ufunc
+iv: np.ufunc
+ive: np.ufunc
+j0: np.ufunc
+j1: np.ufunc
+jn: np.ufunc
+jv: np.ufunc
+jve: np.ufunc
+k0: np.ufunc
+k0e: np.ufunc
+k1: np.ufunc
+k1e: np.ufunc
+kei: np.ufunc
+keip: np.ufunc
+kelvin: np.ufunc
+ker: np.ufunc
+kerp: np.ufunc
+kl_div: np.ufunc
+kn: np.ufunc
+kolmogi: np.ufunc
+kolmogorov: np.ufunc
+kv: np.ufunc
+kve: np.ufunc
+log1p: np.ufunc
+log_expit: np.ufunc
+log_ndtr: np.ufunc
+loggamma: np.ufunc
+logit: np.ufunc
+lpmv: np.ufunc
+mathieu_a: np.ufunc
+mathieu_b: np.ufunc
+mathieu_cem: np.ufunc
+mathieu_modcem1: np.ufunc
+mathieu_modcem2: np.ufunc
+mathieu_modsem1: np.ufunc
+mathieu_modsem2: np.ufunc
+mathieu_sem: np.ufunc
+modfresnelm: np.ufunc
+modfresnelp: np.ufunc
+modstruve: np.ufunc
+nbdtr: np.ufunc
+nbdtrc: np.ufunc
+nbdtri: np.ufunc
+nbdtrik: np.ufunc
+nbdtrin: np.ufunc
+ncfdtr: np.ufunc
+ncfdtri: np.ufunc
+ncfdtridfd: np.ufunc
+ncfdtridfn: np.ufunc
+ncfdtrinc: np.ufunc
+nctdtr: np.ufunc
+nctdtridf: np.ufunc
+nctdtrinc: np.ufunc
+nctdtrit: np.ufunc
+ndtr: np.ufunc
+ndtri: np.ufunc
+ndtri_exp: np.ufunc
+nrdtrimn: np.ufunc
+nrdtrisd: np.ufunc
+obl_ang1: np.ufunc
+obl_ang1_cv: np.ufunc
+obl_cv: np.ufunc
+obl_rad1: np.ufunc
+obl_rad1_cv: np.ufunc
+obl_rad2: np.ufunc
+obl_rad2_cv: np.ufunc
+owens_t: np.ufunc
+pbdv: np.ufunc
+pbvv: np.ufunc
+pbwa: np.ufunc
+pdtr: np.ufunc
+pdtrc: np.ufunc
+pdtri: np.ufunc
+pdtrik: np.ufunc
+poch: np.ufunc
+powm1: np.ufunc
+pro_ang1: np.ufunc
+pro_ang1_cv: np.ufunc
+pro_cv: np.ufunc
+pro_rad1: np.ufunc
+pro_rad1_cv: np.ufunc
+pro_rad2: np.ufunc
+pro_rad2_cv: np.ufunc
+pseudo_huber: np.ufunc
+psi: np.ufunc
+radian: np.ufunc
+rel_entr: np.ufunc
+rgamma: np.ufunc
+round: np.ufunc
+shichi: np.ufunc
+sici: np.ufunc
+sindg: np.ufunc
+smirnov: np.ufunc
+smirnovi: np.ufunc
+spence: np.ufunc
+sph_harm: np.ufunc
+stdtr: np.ufunc
+stdtridf: np.ufunc
+stdtrit: np.ufunc
+struve: np.ufunc
+tandg: np.ufunc
+tklmbda: np.ufunc
+voigt_profile: np.ufunc
+wofz: np.ufunc
+wright_bessel: np.ufunc
+wrightomega: np.ufunc
+xlog1py: np.ufunc
+xlogy: np.ufunc
+y0: np.ufunc
+y1: np.ufunc
+yn: np.ufunc
+yv: np.ufunc
+yve: np.ufunc
+zetac: np.ufunc
+

.CondaPkg/env/Lib/site-packages/scipy/special/_ufuncs_cxx.pxd

@@ -0,0 +1,41 @@
+from . cimport sf_error
+cdef void _set_action(sf_error.sf_error_t, sf_error.sf_action_t) nogil
+cdef void *_export_faddeeva_dawsn
+cdef void *_export_faddeeva_dawsn_complex
+cdef void *_export_fellint_RC
+cdef void *_export_cellint_RC
+cdef void *_export_fellint_RD
+cdef void *_export_cellint_RD
+cdef void *_export_fellint_RF
+cdef void *_export_cellint_RF
+cdef void *_export_fellint_RG
+cdef void *_export_cellint_RG
+cdef void *_export_fellint_RJ
+cdef void *_export_cellint_RJ
+cdef void *_export_faddeeva_erf
+cdef void *_export_faddeeva_erfc_complex
+cdef void *_export_faddeeva_erfcx
+cdef void *_export_faddeeva_erfcx_complex
+cdef void *_export_faddeeva_erfi
+cdef void *_export_faddeeva_erfi_complex
+cdef void *_export_erfinv_float
+cdef void *_export_erfinv_double
+cdef void *_export_expit
+cdef void *_export_expitf
+cdef void *_export_expitl
+cdef void *_export_hyp1f1_double
+cdef void *_export_log_expit
+cdef void *_export_log_expitf
+cdef void *_export_log_expitl
+cdef void *_export_faddeeva_log_ndtr
+cdef void *_export_faddeeva_log_ndtr_complex
+cdef void *_export_logit
+cdef void *_export_logitf
+cdef void *_export_logitl
+cdef void *_export_faddeeva_ndtr
+cdef void *_export_powm1_float
+cdef void *_export_powm1_double
+cdef void *_export_faddeeva_voigt_profile
+cdef void *_export_faddeeva_w
+cdef void *_export_wrightomega
+cdef void *_export_wrightomega_real

.CondaPkg/env/Lib/site-packages/scipy/special/_ufuncs_cxx.pyx

@@ -0,0 +1,125 @@
+# This file is automatically generated by _generate_pyx.py.
+# Do not edit manually!
+
+from libc.math cimport NAN
+
+include "_ufuncs_extra_code_common.pxi"
+
+cdef extern from r"D:\a\scipy\scipy\.mesonpy-ruq6ojo8\build\scipy/special\_ufuncs_cxx_defs.h":
+    cdef double _func_faddeeva_dawsn "faddeeva_dawsn"(double) nogil
+cdef void *_export_faddeeva_dawsn = <void*>_func_faddeeva_dawsn
+cdef extern from r"D:\a\scipy\scipy\.mesonpy-ruq6ojo8\build\scipy/special\_ufuncs_cxx_defs.h":
+    cdef double complex _func_faddeeva_dawsn_complex "faddeeva_dawsn_complex"(double complex) nogil
+cdef void *_export_faddeeva_dawsn_complex = <void*>_func_faddeeva_dawsn_complex
+cdef extern from r"D:\a\scipy\scipy\.mesonpy-ruq6ojo8\build\scipy/special\_ufuncs_cxx_defs.h":
+    cdef double _func_fellint_RC "fellint_RC"(double, double) nogil
+cdef void *_export_fellint_RC = <void*>_func_fellint_RC
+cdef extern from r"D:\a\scipy\scipy\.mesonpy-ruq6ojo8\build\scipy/special\_ufuncs_cxx_defs.h":
+    cdef double complex _func_cellint_RC "cellint_RC"(double complex, double complex) nogil
+cdef void *_export_cellint_RC = <void*>_func_cellint_RC
+cdef extern from r"D:\a\scipy\scipy\.mesonpy-ruq6ojo8\build\scipy/special\_ufuncs_cxx_defs.h":
+    cdef double _func_fellint_RD "fellint_RD"(double, double, double) nogil
+cdef void *_export_fellint_RD = <void*>_func_fellint_RD
+cdef extern from r"D:\a\scipy\scipy\.mesonpy-ruq6ojo8\build\scipy/special\_ufuncs_cxx_defs.h":
+    cdef double complex _func_cellint_RD "cellint_RD"(double complex, double complex, double complex) nogil
+cdef void *_export_cellint_RD = <void*>_func_cellint_RD
+cdef extern from r"D:\a\scipy\scipy\.mesonpy-ruq6ojo8\build\scipy/special\_ufuncs_cxx_defs.h":
+    cdef double _func_fellint_RF "fellint_RF"(double, double, double) nogil
+cdef void *_export_fellint_RF = <void*>_func_fellint_RF
+cdef extern from r"D:\a\scipy\scipy\.mesonpy-ruq6ojo8\build\scipy/special\_ufuncs_cxx_defs.h":
+    cdef double complex _func_cellint_RF "cellint_RF"(double complex, double complex, double complex) nogil
+cdef void *_export_cellint_RF = <void*>_func_cellint_RF
+cdef extern from r"D:\a\scipy\scipy\.mesonpy-ruq6ojo8\build\scipy/special\_ufuncs_cxx_defs.h":
+    cdef double _func_fellint_RG "fellint_RG"(double, double, double) nogil
+cdef void *_export_fellint_RG = <void*>_func_fellint_RG
+cdef extern from r"D:\a\scipy\scipy\.mesonpy-ruq6ojo8\build\scipy/special\_ufuncs_cxx_defs.h":
+    cdef double complex _func_cellint_RG "cellint_RG"(double complex, double complex, double complex) nogil
+cdef void *_export_cellint_RG = <void*>_func_cellint_RG
+cdef extern from r"D:\a\scipy\scipy\.mesonpy-ruq6ojo8\build\scipy/special\_ufuncs_cxx_defs.h":
+    cdef double _func_fellint_RJ "fellint_RJ"(double, double, double, double) nogil
+cdef void *_export_fellint_RJ = <void*>_func_fellint_RJ
+cdef extern from r"D:\a\scipy\scipy\.mesonpy-ruq6ojo8\build\scipy/special\_ufuncs_cxx_defs.h":
+    cdef double complex _func_cellint_RJ "cellint_RJ"(double complex, double complex, double complex, double complex) nogil
+cdef void *_export_cellint_RJ = <void*>_func_cellint_RJ
+cdef extern from r"D:\a\scipy\scipy\.mesonpy-ruq6ojo8\build\scipy/special\_ufuncs_cxx_defs.h":
+    cdef double complex _func_faddeeva_erf "faddeeva_erf"(double complex) nogil
+cdef void *_export_faddeeva_erf = <void*>_func_faddeeva_erf
+cdef extern from r"D:\a\scipy\scipy\.mesonpy-ruq6ojo8\build\scipy/special\_ufuncs_cxx_defs.h":
+    cdef double complex _func_faddeeva_erfc_complex "faddeeva_erfc_complex"(double complex) nogil
+cdef void *_export_faddeeva_erfc_complex = <void*>_func_faddeeva_erfc_complex
+cdef extern from r"D:\a\scipy\scipy\.mesonpy-ruq6ojo8\build\scipy/special\_ufuncs_cxx_defs.h":
+    cdef double _func_faddeeva_erfcx "faddeeva_erfcx"(double) nogil
+cdef void *_export_faddeeva_erfcx = <void*>_func_faddeeva_erfcx
+cdef extern from r"D:\a\scipy\scipy\.mesonpy-ruq6ojo8\build\scipy/special\_ufuncs_cxx_defs.h":
+    cdef double complex _func_faddeeva_erfcx_complex "faddeeva_erfcx_complex"(double complex) nogil
+cdef void *_export_faddeeva_erfcx_complex = <void*>_func_faddeeva_erfcx_complex
+cdef extern from r"D:\a\scipy\scipy\.mesonpy-ruq6ojo8\build\scipy/special\_ufuncs_cxx_defs.h":
+    cdef double _func_faddeeva_erfi "faddeeva_erfi"(double) nogil
+cdef void *_export_faddeeva_erfi = <void*>_func_faddeeva_erfi
+cdef extern from r"D:\a\scipy\scipy\.mesonpy-ruq6ojo8\build\scipy/special\_ufuncs_cxx_defs.h":
+    cdef double complex _func_faddeeva_erfi_complex "faddeeva_erfi_complex"(double complex) nogil
+cdef void *_export_faddeeva_erfi_complex = <void*>_func_faddeeva_erfi_complex
+cdef extern from r"D:\a\scipy\scipy\.mesonpy-ruq6ojo8\build\scipy/special\_ufuncs_cxx_defs.h":
+    cdef float _func_erfinv_float "erfinv_float"(float) nogil
+cdef void *_export_erfinv_float = <void*>_func_erfinv_float
+cdef extern from r"D:\a\scipy\scipy\.mesonpy-ruq6ojo8\build\scipy/special\_ufuncs_cxx_defs.h":
+    cdef double _func_erfinv_double "erfinv_double"(double) nogil
+cdef void *_export_erfinv_double = <void*>_func_erfinv_double
+cdef extern from r"D:\a\scipy\scipy\.mesonpy-ruq6ojo8\build\scipy/special\_ufuncs_cxx_defs.h":
+    cdef double _func_expit "expit"(double) nogil
+cdef void *_export_expit = <void*>_func_expit
+cdef extern from r"D:\a\scipy\scipy\.mesonpy-ruq6ojo8\build\scipy/special\_ufuncs_cxx_defs.h":
+    cdef float _func_expitf "expitf"(float) nogil
+cdef void *_export_expitf = <void*>_func_expitf
+cdef extern from r"D:\a\scipy\scipy\.mesonpy-ruq6ojo8\build\scipy/special\_ufuncs_cxx_defs.h":
+    cdef long double _func_expitl "expitl"(long double) nogil
+cdef void *_export_expitl = <void*>_func_expitl
+cdef extern from r"D:\a\scipy\scipy\.mesonpy-ruq6ojo8\build\scipy/special\_ufuncs_cxx_defs.h":
+    cdef double _func_hyp1f1_double "hyp1f1_double"(double, double, double) nogil
+cdef void *_export_hyp1f1_double = <void*>_func_hyp1f1_double
+cdef extern from r"D:\a\scipy\scipy\.mesonpy-ruq6ojo8\build\scipy/special\_ufuncs_cxx_defs.h":
+    cdef double _func_log_expit "log_expit"(double) nogil
+cdef void *_export_log_expit = <void*>_func_log_expit
+cdef extern from r"D:\a\scipy\scipy\.mesonpy-ruq6ojo8\build\scipy/special\_ufuncs_cxx_defs.h":
+    cdef float _func_log_expitf "log_expitf"(float) nogil
+cdef void *_export_log_expitf = <void*>_func_log_expitf
+cdef extern from r"D:\a\scipy\scipy\.mesonpy-ruq6ojo8\build\scipy/special\_ufuncs_cxx_defs.h":
+    cdef long double _func_log_expitl "log_expitl"(long double) nogil
+cdef void *_export_log_expitl = <void*>_func_log_expitl
+cdef extern from r"D:\a\scipy\scipy\.mesonpy-ruq6ojo8\build\scipy/special\_ufuncs_cxx_defs.h":
+    cdef double _func_faddeeva_log_ndtr "faddeeva_log_ndtr"(double) nogil
+cdef void *_export_faddeeva_log_ndtr = <void*>_func_faddeeva_log_ndtr
+cdef extern from r"D:\a\scipy\scipy\.mesonpy-ruq6ojo8\build\scipy/special\_ufuncs_cxx_defs.h":
+    cdef double complex _func_faddeeva_log_ndtr_complex "faddeeva_log_ndtr_complex"(double complex) nogil
+cdef void *_export_faddeeva_log_ndtr_complex = <void*>_func_faddeeva_log_ndtr_complex
+cdef extern from r"D:\a\scipy\scipy\.mesonpy-ruq6ojo8\build\scipy/special\_ufuncs_cxx_defs.h":
+    cdef double _func_logit "logit"(double) nogil
+cdef void *_export_logit = <void*>_func_logit
+cdef extern from r"D:\a\scipy\scipy\.mesonpy-ruq6ojo8\build\scipy/special\_ufuncs_cxx_defs.h":
+    cdef float _func_logitf "logitf"(float) nogil
+cdef void *_export_logitf = <void*>_func_logitf
+cdef extern from r"D:\a\scipy\scipy\.mesonpy-ruq6ojo8\build\scipy/special\_ufuncs_cxx_defs.h":
+    cdef long double _func_logitl "logitl"(long double) nogil
+cdef void *_export_logitl = <void*>_func_logitl
+cdef extern from r"D:\a\scipy\scipy\.mesonpy-ruq6ojo8\build\scipy/special\_ufuncs_cxx_defs.h":
+    cdef double complex _func_faddeeva_ndtr "faddeeva_ndtr"(double complex) nogil
+cdef void *_export_faddeeva_ndtr = <void*>_func_faddeeva_ndtr
+cdef extern from r"D:\a\scipy\scipy\.mesonpy-ruq6ojo8\build\scipy/special\_ufuncs_cxx_defs.h":
+    cdef float _func_powm1_float "powm1_float"(float, float) nogil
+cdef void *_export_powm1_float = <void*>_func_powm1_float
+cdef extern from r"D:\a\scipy\scipy\.mesonpy-ruq6ojo8\build\scipy/special\_ufuncs_cxx_defs.h":
+    cdef double _func_powm1_double "powm1_double"(double, double) nogil
+cdef void *_export_powm1_double = <void*>_func_powm1_double
+cdef extern from r"D:\a\scipy\scipy\.mesonpy-ruq6ojo8\build\scipy/special\_ufuncs_cxx_defs.h":
+    cdef double _func_faddeeva_voigt_profile "faddeeva_voigt_profile"(double, double, double) nogil
+cdef void *_export_faddeeva_voigt_profile = <void*>_func_faddeeva_voigt_profile
+cdef extern from r"D:\a\scipy\scipy\.mesonpy-ruq6ojo8\build\scipy/special\_ufuncs_cxx_defs.h":
+    cdef double complex _func_faddeeva_w "faddeeva_w"(double complex) nogil
+cdef void *_export_faddeeva_w = <void*>_func_faddeeva_w
+cdef extern from r"D:\a\scipy\scipy\.mesonpy-ruq6ojo8\build\scipy/special\_ufuncs_cxx_defs.h":
+    cdef double complex _func_wrightomega "wrightomega"(double complex) nogil
+cdef void *_export_wrightomega = <void*>_func_wrightomega
+cdef extern from r"D:\a\scipy\scipy\.mesonpy-ruq6ojo8\build\scipy/special\_ufuncs_cxx_defs.h":
+    cdef double _func_wrightomega_real "wrightomega_real"(double) nogil
+cdef void *_export_wrightomega_real = <void*>_func_wrightomega_real
+# distutils: language = c++

.CondaPkg/env/Lib/site-packages/scipy/special/_ufuncs_cxx_defs.h

@@ -0,0 +1,47 @@
+#ifndef UFUNCS_PROTO_H
+#define UFUNCS_PROTO_H 1
+#include "_faddeeva.h"
+npy_double faddeeva_dawsn(npy_double);
+npy_cdouble faddeeva_dawsn_complex(npy_cdouble);
+#include "ellint_carlson_wrap.hh"
+npy_double fellint_RC(npy_double, npy_double);
+npy_cdouble cellint_RC(npy_cdouble, npy_cdouble);
+npy_double fellint_RD(npy_double, npy_double, npy_double);
+npy_cdouble cellint_RD(npy_cdouble, npy_cdouble, npy_cdouble);
+npy_double fellint_RF(npy_double, npy_double, npy_double);
+npy_cdouble cellint_RF(npy_cdouble, npy_cdouble, npy_cdouble);
+npy_double fellint_RG(npy_double, npy_double, npy_double);
+npy_cdouble cellint_RG(npy_cdouble, npy_cdouble, npy_cdouble);
+npy_double fellint_RJ(npy_double, npy_double, npy_double, npy_double);
+npy_cdouble cellint_RJ(npy_cdouble, npy_cdouble, npy_cdouble, npy_cdouble);
+npy_cdouble faddeeva_erf(npy_cdouble);
+npy_cdouble faddeeva_erfc_complex(npy_cdouble);
+npy_double faddeeva_erfcx(npy_double);
+npy_cdouble faddeeva_erfcx_complex(npy_cdouble);
+npy_double faddeeva_erfi(npy_double);
+npy_cdouble faddeeva_erfi_complex(npy_cdouble);
+#include "boost_special_functions.h"
+npy_float erfinv_float(npy_float);
+npy_double erfinv_double(npy_double);
+#include "_logit.h"
+npy_double expit(npy_double);
+npy_float expitf(npy_float);
+npy_longdouble expitl(npy_longdouble);
+npy_double hyp1f1_double(npy_double, npy_double, npy_double);
+npy_double log_expit(npy_double);
+npy_float log_expitf(npy_float);
+npy_longdouble log_expitl(npy_longdouble);
+npy_double faddeeva_log_ndtr(npy_double);
+npy_cdouble faddeeva_log_ndtr_complex(npy_cdouble);
+npy_double logit(npy_double);
+npy_float logitf(npy_float);
+npy_longdouble logitl(npy_longdouble);
+npy_cdouble faddeeva_ndtr(npy_cdouble);
+npy_float powm1_float(npy_float, npy_float);
+npy_double powm1_double(npy_double, npy_double);
+npy_double faddeeva_voigt_profile(npy_double, npy_double, npy_double);
+npy_cdouble faddeeva_w(npy_cdouble);
+#include "_wright.h"
+npy_cdouble wrightomega(npy_cdouble);
+npy_double wrightomega_real(npy_double);
+#endif

.CondaPkg/env/Lib/site-packages/scipy/special/_ufuncs_defs.h

@@ -0,0 +1,215 @@
+#ifndef UFUNCS_PROTO_H
+#define UFUNCS_PROTO_H 1
+#include "_cosine.h"
+npy_double cosine_cdf(npy_double);
+npy_double cosine_invcdf(npy_double);
+#include "cephes.h"
+npy_double cospi(npy_double);
+npy_double igam_fac(npy_double, npy_double);
+npy_double kolmogc(npy_double);
+npy_double kolmogci(npy_double);
+npy_double kolmogp(npy_double);
+npy_double lanczos_sum_expg_scaled(npy_double);
+npy_double lgam1p(npy_double);
+npy_double log1pmx(npy_double);
+npy_double riemann_zeta(npy_double);
+npy_double sinpi(npy_double);
+npy_double smirnovc(npy_int, npy_double);
+npy_double smirnovci(npy_int, npy_double);
+npy_double smirnovp(npy_int, npy_double);
+npy_double struve_asymp_large_z(npy_double, npy_double, npy_int, npy_double *);
+npy_double struve_bessel_series(npy_double, npy_double, npy_int, npy_double *);
+npy_double struve_power_series(npy_double, npy_double, npy_int, npy_double *);
+npy_double zeta(npy_double, npy_double);
+#include "amos_wrappers.h"
+npy_int airy_wrap(npy_double, npy_double *, npy_double *, npy_double *, npy_double *);
+npy_int cairy_wrap(npy_cdouble, npy_cdouble *, npy_cdouble *, npy_cdouble *, npy_cdouble *);
+npy_int cairy_wrap_e(npy_cdouble, npy_cdouble *, npy_cdouble *, npy_cdouble *, npy_cdouble *);
+npy_int cairy_wrap_e_real(npy_double, npy_double *, npy_double *, npy_double *, npy_double *);
+npy_double bdtr(npy_double, npy_int, npy_double);
+npy_double bdtrc(npy_double, npy_int, npy_double);
+npy_double bdtri(npy_double, npy_int, npy_double);
+#include "cdf_wrappers.h"
+npy_double cdfbin2_wrap(npy_double, npy_double, npy_double);
+npy_double cdfbin3_wrap(npy_double, npy_double, npy_double);
+#include "specfun_wrappers.h"
+npy_double bei_wrap(npy_double);
+npy_double beip_wrap(npy_double);
+npy_double ber_wrap(npy_double);
+npy_double berp_wrap(npy_double);
+npy_double besselpoly(npy_double, npy_double, npy_double);
+npy_double beta(npy_double, npy_double);
+npy_double incbet(npy_double, npy_double, npy_double);
+npy_double incbi(npy_double, npy_double, npy_double);
+npy_double lbeta(npy_double, npy_double);
+npy_double btdtr(npy_double, npy_double, npy_double);
+npy_double cdfbet3_wrap(npy_double, npy_double, npy_double);
+npy_double cdfbet4_wrap(npy_double, npy_double, npy_double);
+npy_double cbrt(npy_double);
+npy_double chdtr(npy_double, npy_double);
+npy_double chdtrc(npy_double, npy_double);
+npy_double chdtri(npy_double, npy_double);
+npy_double cdfchi3_wrap(npy_double, npy_double);
+npy_double cdfchn1_wrap(npy_double, npy_double, npy_double);
+npy_double cdfchn3_wrap(npy_double, npy_double, npy_double);
+npy_double cdfchn4_wrap(npy_double, npy_double, npy_double);
+npy_double cdfchn2_wrap(npy_double, npy_double, npy_double);
+npy_double cosdg(npy_double);
+npy_double cosm1(npy_double);
+npy_double cotdg(npy_double);
+npy_double ellpe(npy_double);
+npy_double ellie(npy_double, npy_double);
+npy_int ellpj(npy_double, npy_double, npy_double *, npy_double *, npy_double *, npy_double *);
+npy_double ellik(npy_double, npy_double);
+npy_double ellpk(npy_double);
+npy_double erf(npy_double);
+npy_double erfc(npy_double);
+npy_double erfcinv(npy_double);
+npy_cdouble cexp1_wrap(npy_cdouble);
+npy_double exp1_wrap(npy_double);
+npy_double exp10(npy_double);
+npy_double exp2(npy_double);
+npy_cdouble cexpi_wrap(npy_cdouble);
+npy_double expi_wrap(npy_double);
+npy_double expm1(npy_double);
+npy_double expn(npy_int, npy_double);
+npy_double fdtr(npy_double, npy_double, npy_double);
+npy_double fdtrc(npy_double, npy_double, npy_double);
+npy_double fdtri(npy_double, npy_double, npy_double);
+npy_double cdff4_wrap(npy_double, npy_double, npy_double);
+npy_int fresnl(npy_double, npy_double *, npy_double *);
+npy_int cfresnl_wrap(npy_cdouble, npy_cdouble *, npy_cdouble *);
+npy_double Gamma(npy_double);
+npy_double igam(npy_double, npy_double);
+npy_double igamc(npy_double, npy_double);
+npy_double igamci(npy_double, npy_double);
+npy_double igami(npy_double, npy_double);
+npy_double lgam(npy_double);
+npy_double gammasgn(npy_double);
+npy_double gdtr(npy_double, npy_double, npy_double);
+npy_double gdtrc(npy_double, npy_double, npy_double);
+npy_double cdfgam4_wrap(npy_double, npy_double, npy_double);
+npy_double cdfgam3_wrap(npy_double, npy_double, npy_double);
+npy_double cdfgam2_wrap(npy_double, npy_double, npy_double);
+npy_cdouble cbesh_wrap1(npy_double, npy_cdouble);
+npy_cdouble cbesh_wrap1_e(npy_double, npy_cdouble);
+npy_cdouble cbesh_wrap2(npy_double, npy_cdouble);
+npy_cdouble cbesh_wrap2_e(npy_double, npy_cdouble);
+npy_cdouble chyp1f1_wrap(npy_double, npy_double, npy_cdouble);
+npy_double hyp2f1(npy_double, npy_double, npy_double, npy_double);
+npy_double i0(npy_double);
+npy_double i0e(npy_double);
+npy_double i1(npy_double);
+npy_double i1e(npy_double);
+npy_int it2i0k0_wrap(npy_double, npy_double *, npy_double *);
+npy_int it2j0y0_wrap(npy_double, npy_double *, npy_double *);
+npy_double it2struve0_wrap(npy_double);
+npy_int itairy_wrap(npy_double, npy_double *, npy_double *, npy_double *, npy_double *);
+npy_int it1i0k0_wrap(npy_double, npy_double *, npy_double *);
+npy_int it1j0y0_wrap(npy_double, npy_double *, npy_double *);
+npy_double itmodstruve0_wrap(npy_double);
+npy_double itstruve0_wrap(npy_double);
+npy_cdouble cbesi_wrap(npy_double, npy_cdouble);
+npy_double iv(npy_double, npy_double);
+npy_cdouble cbesi_wrap_e(npy_double, npy_cdouble);
+npy_double cbesi_wrap_e_real(npy_double, npy_double);
+npy_double j0(npy_double);
+npy_double j1(npy_double);
+npy_cdouble cbesj_wrap(npy_double, npy_cdouble);
+npy_double cbesj_wrap_real(npy_double, npy_double);
+npy_cdouble cbesj_wrap_e(npy_double, npy_cdouble);
+npy_double cbesj_wrap_e_real(npy_double, npy_double);
+npy_double k0(npy_double);
+npy_double k0e(npy_double);
+npy_double k1(npy_double);
+npy_double k1e(npy_double);
+npy_double kei_wrap(npy_double);
+npy_double keip_wrap(npy_double);
+npy_int kelvin_wrap(npy_double, npy_cdouble *, npy_cdouble *, npy_cdouble *, npy_cdouble *);
+npy_double ker_wrap(npy_double);
+npy_double kerp_wrap(npy_double);
+npy_double cbesk_wrap_real_int(npy_int, npy_double);
+npy_double kolmogi(npy_double);
+npy_double kolmogorov(npy_double);
+npy_cdouble cbesk_wrap(npy_double, npy_cdouble);
+npy_double cbesk_wrap_real(npy_double, npy_double);
+npy_cdouble cbesk_wrap_e(npy_double, npy_cdouble);
+npy_double cbesk_wrap_e_real(npy_double, npy_double);
+npy_double log1p(npy_double);
+npy_double pmv_wrap(npy_double, npy_double, npy_double);
+npy_double cem_cva_wrap(npy_double, npy_double);
+npy_double sem_cva_wrap(npy_double, npy_double);
+npy_int cem_wrap(npy_double, npy_double, npy_double, npy_double *, npy_double *);
+npy_int mcm1_wrap(npy_double, npy_double, npy_double, npy_double *, npy_double *);
+npy_int mcm2_wrap(npy_double, npy_double, npy_double, npy_double *, npy_double *);
+npy_int msm1_wrap(npy_double, npy_double, npy_double, npy_double *, npy_double *);
+npy_int msm2_wrap(npy_double, npy_double, npy_double, npy_double *, npy_double *);
+npy_int sem_wrap(npy_double, npy_double, npy_double, npy_double *, npy_double *);
+npy_int modified_fresnel_minus_wrap(npy_double, npy_cdouble *, npy_cdouble *);
+npy_int modified_fresnel_plus_wrap(npy_double, npy_cdouble *, npy_cdouble *);
+npy_double struve_l(npy_double, npy_double);
+npy_double nbdtr(npy_int, npy_int, npy_double);
+npy_double nbdtrc(npy_int, npy_int, npy_double);
+npy_double nbdtri(npy_int, npy_int, npy_double);
+npy_double cdfnbn2_wrap(npy_double, npy_double, npy_double);
+npy_double cdfnbn3_wrap(npy_double, npy_double, npy_double);
+npy_double cdffnc1_wrap(npy_double, npy_double, npy_double, npy_double);
+npy_double cdffnc2_wrap(npy_double, npy_double, npy_double, npy_double);
+npy_double cdffnc4_wrap(npy_double, npy_double, npy_double, npy_double);
+npy_double cdffnc3_wrap(npy_double, npy_double, npy_double, npy_double);
+npy_double cdffnc5_wrap(npy_double, npy_double, npy_double, npy_double);
+npy_double cdftnc1_wrap(npy_double, npy_double, npy_double);
+npy_double cdftnc3_wrap(npy_double, npy_double, npy_double);
+npy_double cdftnc4_wrap(npy_double, npy_double, npy_double);
+npy_double cdftnc2_wrap(npy_double, npy_double, npy_double);
+npy_double ndtr(npy_double);
+npy_double ndtri(npy_double);
+npy_double cdfnor3_wrap(npy_double, npy_double, npy_double);
+npy_double cdfnor4_wrap(npy_double, npy_double, npy_double);
+npy_double oblate_aswfa_nocv_wrap(npy_double, npy_double, npy_double, npy_double, npy_double *);
+npy_int oblate_aswfa_wrap(npy_double, npy_double, npy_double, npy_double, npy_double, npy_double *, npy_double *);
+npy_double oblate_segv_wrap(npy_double, npy_double, npy_double);
+npy_double oblate_radial1_nocv_wrap(npy_double, npy_double, npy_double, npy_double, npy_double *);
+npy_int oblate_radial1_wrap(npy_double, npy_double, npy_double, npy_double, npy_double, npy_double *, npy_double *);
+npy_double oblate_radial2_nocv_wrap(npy_double, npy_double, npy_double, npy_double, npy_double *);
+npy_int oblate_radial2_wrap(npy_double, npy_double, npy_double, npy_double, npy_double, npy_double *, npy_double *);
+npy_double owens_t(npy_double, npy_double);
+npy_int pbdv_wrap(npy_double, npy_double, npy_double *, npy_double *);
+npy_int pbvv_wrap(npy_double, npy_double, npy_double *, npy_double *);
+npy_int pbwa_wrap(npy_double, npy_double, npy_double *, npy_double *);
+npy_double pdtr(npy_double, npy_double);
+npy_double pdtrc(npy_double, npy_double);
+npy_double pdtri(npy_int, npy_double);
+npy_double cdfpoi2_wrap(npy_double, npy_double);
+npy_double poch(npy_double, npy_double);
+npy_double prolate_aswfa_nocv_wrap(npy_double, npy_double, npy_double, npy_double, npy_double *);
+npy_int prolate_aswfa_wrap(npy_double, npy_double, npy_double, npy_double, npy_double, npy_double *, npy_double *);
+npy_double prolate_segv_wrap(npy_double, npy_double, npy_double);
+npy_double prolate_radial1_nocv_wrap(npy_double, npy_double, npy_double, npy_double, npy_double *);
+npy_int prolate_radial1_wrap(npy_double, npy_double, npy_double, npy_double, npy_double, npy_double *, npy_double *);
+npy_double prolate_radial2_nocv_wrap(npy_double, npy_double, npy_double, npy_double, npy_double *);
+npy_int prolate_radial2_wrap(npy_double, npy_double, npy_double, npy_double, npy_double, npy_double *, npy_double *);
+npy_double radian(npy_double, npy_double, npy_double);
+npy_double rgamma(npy_double);
+npy_double round(npy_double);
+npy_int shichi(npy_double, npy_double *, npy_double *);
+npy_int sici(npy_double, npy_double *, npy_double *);
+npy_double sindg(npy_double);
+npy_double smirnov(npy_int, npy_double);
+npy_double smirnovi(npy_int, npy_double);
+npy_double spence(npy_double);
+npy_double cdft1_wrap(npy_double, npy_double);
+npy_double cdft3_wrap(npy_double, npy_double);
+npy_double cdft2_wrap(npy_double, npy_double);
+npy_double struve_h(npy_double, npy_double);
+npy_double tandg(npy_double);
+npy_double tukeylambdacdf(npy_double, npy_double);
+npy_double y0(npy_double);
+npy_double y1(npy_double);
+npy_double yn(npy_int, npy_double);
+npy_cdouble cbesy_wrap(npy_double, npy_cdouble);
+npy_double cbesy_wrap_real(npy_double, npy_double);
+npy_cdouble cbesy_wrap_e(npy_double, npy_cdouble);
+npy_double cbesy_wrap_e_real(npy_double, npy_double);
+npy_double zetac(npy_double);
+#endif

.CondaPkg/env/Lib/site-packages/scipy/special/add_newdocs.py

@@ -0,0 +1,23 @@
+# This file is not meant for public use and will be removed in SciPy v2.0.0.
+
+import warnings
+from . import _add_newdocs
+
+__all__ = ['get', 'add_newdoc', 'Dict', 'docdict']  # noqa: F822
+
+
+def __dir__():
+    return __all__
+
+
+def __getattr__(name):
+    if name not in __all__:
+        raise AttributeError(
+            "scipy.special.add_newdocs is deprecated and has no attribute "
+            f"{name}.")
+
+    warnings.warn("The `scipy.special.add_newdocs` namespace is deprecated."
+                  " and will be removed in SciPy v2.0.0.",
+                  category=DeprecationWarning, stacklevel=2)
+
+    return getattr(_add_newdocs, name)

.CondaPkg/env/Lib/site-packages/scipy/special/basic.py

@@ -0,0 +1,97 @@
+# This file is not meant for public use and will be removed in SciPy v2.0.0.
+# Use the `scipy.special` namespace for importing the functions
+# included below.
+
+import warnings
+from . import _basic
+from ._ufuncs import (mathieu_a, mathieu_b, iv, jv, gamma,
+                      psi, hankel1, hankel2, yv, kv)
+
+
+__all__ = [  # noqa: F822
+    'ai_zeros',
+    'assoc_laguerre',
+    'bei_zeros',
+    'beip_zeros',
+    'ber_zeros',
+    'bernoulli',
+    'berp_zeros',
+    'bi_zeros',
+    'clpmn',
+    'comb',
+    'digamma',
+    'diric',
+    'erf_zeros',
+    'euler',
+    'factorial',
+    'factorial2',
+    'factorialk',
+    'fresnel_zeros',
+    'fresnelc_zeros',
+    'fresnels_zeros',
+    'gamma',
+    'h1vp',
+    'h2vp',
+    'hankel1',
+    'hankel2',
+    'iv',
+    'ivp',
+    'jn_zeros',
+    'jnjnp_zeros',
+    'jnp_zeros',
+    'jnyn_zeros',
+    'jv',
+    'jvp',
+    'kei_zeros',
+    'keip_zeros',
+    'kelvin_zeros',
+    'ker_zeros',
+    'kerp_zeros',
+    'kv',
+    'kvp',
+    'lmbda',
+    'lpmn',
+    'lpn',
+    'lqmn',
+    'lqn',
+    'mathieu_a',
+    'mathieu_b',
+    'mathieu_even_coef',
+    'mathieu_odd_coef',
+    'obl_cv_seq',
+    'pbdn_seq',
+    'pbdv_seq',
+    'pbvv_seq',
+    'perm',
+    'polygamma',
+    'pro_cv_seq',
+    'psi',
+    'riccati_jn',
+    'riccati_yn',
+    'sinc',
+    'y0_zeros',
+    'y1_zeros',
+    'y1p_zeros',
+    'yn_zeros',
+    'ynp_zeros',
+    'yv',
+    'yvp',
+    'zeta'
+]
+
+
+def __dir__():
+    return __all__
+
+
+def __getattr__(name):
+    if name not in __all__:
+        raise AttributeError(
+            "scipy.special.basic is deprecated and has no attribute "
+            f"{name}. Try looking in scipy.special instead.")
+
+    warnings.warn(f"Please use `{name}` from the `scipy.special` namespace, "
+                  "the `scipy.special.basic` namespace is deprecated.",
+                  category=DeprecationWarning, stacklevel=2)
+
+    return getattr(_basic, name)

.CondaPkg/env/Lib/site-packages/scipy/special/cython_special.pxd

@@ -0,0 +1,259 @@
+# This file is automatically generated by _generate_pyx.py.
+# Do not edit manually!
+
+ctypedef fused number_t:
+    double complex
+    double
+
+cpdef number_t spherical_jn(long n, number_t z, bint derivative=*) nogil
+cpdef number_t spherical_yn(long n, number_t z, bint derivative=*) nogil
+cpdef number_t spherical_in(long n, number_t z, bint derivative=*) nogil
+cpdef number_t spherical_kn(long n, number_t z, bint derivative=*) nogil
+
+ctypedef fused Dd_number_t:
+    double complex
+    double
+
+ctypedef fused df_number_t:
+    double
+    float
+
+ctypedef fused dfg_number_t:
+    double
+    float
+    long double
+
+ctypedef fused dl_number_t:
+    double
+    long
+
+cpdef double voigt_profile(double x0, double x1, double x2) nogil
+cpdef double agm(double x0, double x1) nogil
+cdef void airy(Dd_number_t x0, Dd_number_t *y0, Dd_number_t *y1, Dd_number_t *y2, Dd_number_t *y3) nogil
+cdef void airye(Dd_number_t x0, Dd_number_t *y0, Dd_number_t *y1, Dd_number_t *y2, Dd_number_t *y3) nogil
+cpdef double bdtr(double x0, dl_number_t x1, double x2) nogil
+cpdef double bdtrc(double x0, dl_number_t x1, double x2) nogil
+cpdef double bdtri(double x0, dl_number_t x1, double x2) nogil
+cpdef double bdtrik(double x0, double x1, double x2) nogil
+cpdef double bdtrin(double x0, double x1, double x2) nogil
+cpdef double bei(double x0) nogil
+cpdef double beip(double x0) nogil
+cpdef double ber(double x0) nogil
+cpdef double berp(double x0) nogil
+cpdef double besselpoly(double x0, double x1, double x2) nogil
+cpdef double beta(double x0, double x1) nogil
+cpdef double betainc(double x0, double x1, double x2) nogil
+cpdef double betaincinv(double x0, double x1, double x2) nogil
+cpdef double betaln(double x0, double x1) nogil
+cpdef double binom(double x0, double x1) nogil
+cpdef double boxcox(double x0, double x1) nogil
+cpdef double boxcox1p(double x0, double x1) nogil
+cpdef double btdtr(double x0, double x1, double x2) nogil
+cpdef double btdtri(double x0, double x1, double x2) nogil
+cpdef double btdtria(double x0, double x1, double x2) nogil
+cpdef double btdtrib(double x0, double x1, double x2) nogil
+cpdef double cbrt(double x0) nogil
+cpdef double chdtr(double x0, double x1) nogil
+cpdef double chdtrc(double x0, double x1) nogil
+cpdef double chdtri(double x0, double x1) nogil
+cpdef double chdtriv(double x0, double x1) nogil
+cpdef double chndtr(double x0, double x1, double x2) nogil
+cpdef double chndtridf(double x0, double x1, double x2) nogil
+cpdef double chndtrinc(double x0, double x1, double x2) nogil
+cpdef double chndtrix(double x0, double x1, double x2) nogil
+cpdef double cosdg(double x0) nogil
+cpdef double cosm1(double x0) nogil
+cpdef double cotdg(double x0) nogil
+cpdef Dd_number_t dawsn(Dd_number_t x0) nogil
+cpdef double ellipe(double x0) nogil
+cpdef double ellipeinc(double x0, double x1) nogil
+cdef void ellipj(double x0, double x1, double *y0, double *y1, double *y2, double *y3) nogil
+cpdef double ellipkinc(double x0, double x1) nogil
+cpdef double ellipkm1(double x0) nogil
+cpdef double ellipk(double x0) nogil
+cpdef Dd_number_t elliprc(Dd_number_t x0, Dd_number_t x1) nogil
+cpdef Dd_number_t elliprd(Dd_number_t x0, Dd_number_t x1, Dd_number_t x2) nogil
+cpdef Dd_number_t elliprf(Dd_number_t x0, Dd_number_t x1, Dd_number_t x2) nogil
+cpdef Dd_number_t elliprg(Dd_number_t x0, Dd_number_t x1, Dd_number_t x2) nogil
+cpdef Dd_number_t elliprj(Dd_number_t x0, Dd_number_t x1, Dd_number_t x2, Dd_number_t x3) nogil
+cpdef double entr(double x0) nogil
+cpdef Dd_number_t erf(Dd_number_t x0) nogil
+cpdef Dd_number_t erfc(Dd_number_t x0) nogil
+cpdef Dd_number_t erfcx(Dd_number_t x0) nogil
+cpdef Dd_number_t erfi(Dd_number_t x0) nogil
+cpdef df_number_t erfinv(df_number_t x0) nogil
+cpdef double erfcinv(double x0) nogil
+cpdef Dd_number_t eval_chebyc(dl_number_t x0, Dd_number_t x1) nogil
+cpdef Dd_number_t eval_chebys(dl_number_t x0, Dd_number_t x1) nogil
+cpdef Dd_number_t eval_chebyt(dl_number_t x0, Dd_number_t x1) nogil
+cpdef Dd_number_t eval_chebyu(dl_number_t x0, Dd_number_t x1) nogil
+cpdef Dd_number_t eval_gegenbauer(dl_number_t x0, double x1, Dd_number_t x2) nogil
+cpdef Dd_number_t eval_genlaguerre(dl_number_t x0, double x1, Dd_number_t x2) nogil
+cpdef double eval_hermite(long x0, double x1) nogil
+cpdef double eval_hermitenorm(long x0, double x1) nogil
+cpdef Dd_number_t eval_jacobi(dl_number_t x0, double x1, double x2, Dd_number_t x3) nogil
+cpdef Dd_number_t eval_laguerre(dl_number_t x0, Dd_number_t x1) nogil
+cpdef Dd_number_t eval_legendre(dl_number_t x0, Dd_number_t x1) nogil
+cpdef Dd_number_t eval_sh_chebyt(dl_number_t x0, Dd_number_t x1) nogil
+cpdef Dd_number_t eval_sh_chebyu(dl_number_t x0, Dd_number_t x1) nogil
+cpdef Dd_number_t eval_sh_jacobi(dl_number_t x0, double x1, double x2, Dd_number_t x3) nogil
+cpdef Dd_number_t eval_sh_legendre(dl_number_t x0, Dd_number_t x1) nogil
+cpdef Dd_number_t exp1(Dd_number_t x0) nogil
+cpdef double exp10(double x0) nogil
+cpdef double exp2(double x0) nogil
+cpdef Dd_number_t expi(Dd_number_t x0) nogil
+cpdef dfg_number_t expit(dfg_number_t x0) nogil
+cpdef Dd_number_t expm1(Dd_number_t x0) nogil
+cpdef double expn(dl_number_t x0, double x1) nogil
+cpdef double exprel(double x0) nogil
+cpdef double fdtr(double x0, double x1, double x2) nogil
+cpdef double fdtrc(double x0, double x1, double x2) nogil
+cpdef double fdtri(double x0, double x1, double x2) nogil
+cpdef double fdtridfd(double x0, double x1, double x2) nogil
+cdef void fresnel(Dd_number_t x0, Dd_number_t *y0, Dd_number_t *y1) nogil
+cpdef Dd_number_t gamma(Dd_number_t x0) nogil
+cpdef double gammainc(double x0, double x1) nogil
+cpdef double gammaincc(double x0, double x1) nogil
+cpdef double gammainccinv(double x0, double x1) nogil
+cpdef double gammaincinv(double x0, double x1) nogil
+cpdef double gammaln(double x0) nogil
+cpdef double gammasgn(double x0) nogil
+cpdef double gdtr(double x0, double x1, double x2) nogil
+cpdef double gdtrc(double x0, double x1, double x2) nogil
+cpdef double gdtria(double x0, double x1, double x2) nogil
+cpdef double gdtrib(double x0, double x1, double x2) nogil
+cpdef double gdtrix(double x0, double x1, double x2) nogil
+cpdef double complex hankel1(double x0, double complex x1) nogil
+cpdef double complex hankel1e(double x0, double complex x1) nogil
+cpdef double complex hankel2(double x0, double complex x1) nogil
+cpdef double complex hankel2e(double x0, double complex x1) nogil
+cpdef double huber(double x0, double x1) nogil
+cpdef Dd_number_t hyp0f1(double x0, Dd_number_t x1) nogil
+cpdef Dd_number_t hyp1f1(double x0, double x1, Dd_number_t x2) nogil
+cpdef Dd_number_t hyp2f1(double x0, double x1, double x2, Dd_number_t x3) nogil
+cpdef double hyperu(double x0, double x1, double x2) nogil
+cpdef double i0(double x0) nogil
+cpdef double i0e(double x0) nogil
+cpdef double i1(double x0) nogil
+cpdef double i1e(double x0) nogil
+cpdef double inv_boxcox(double x0, double x1) nogil
+cpdef double inv_boxcox1p(double x0, double x1) nogil
+cdef void it2i0k0(double x0, double *y0, double *y1) nogil
+cdef void it2j0y0(double x0, double *y0, double *y1) nogil
+cpdef double it2struve0(double x0) nogil
+cdef void itairy(double x0, double *y0, double *y1, double *y2, double *y3) nogil
+cdef void iti0k0(double x0, double *y0, double *y1) nogil
+cdef void itj0y0(double x0, double *y0, double *y1) nogil
+cpdef double itmodstruve0(double x0) nogil
+cpdef double itstruve0(double x0) nogil
+cpdef Dd_number_t iv(double x0, Dd_number_t x1) nogil
+cpdef Dd_number_t ive(double x0, Dd_number_t x1) nogil
+cpdef double j0(double x0) nogil
+cpdef double j1(double x0) nogil
+cpdef Dd_number_t jv(double x0, Dd_number_t x1) nogil
+cpdef Dd_number_t jve(double x0, Dd_number_t x1) nogil
+cpdef double k0(double x0) nogil
+cpdef double k0e(double x0) nogil
+cpdef double k1(double x0) nogil
+cpdef double k1e(double x0) nogil
+cpdef double kei(double x0) nogil
+cpdef double keip(double x0) nogil
+cdef void kelvin(double x0, double complex *y0, double complex *y1, double complex *y2, double complex *y3) nogil
+cpdef double ker(double x0) nogil
+cpdef double kerp(double x0) nogil
+cpdef double kl_div(double x0, double x1) nogil
+cpdef double kn(dl_number_t x0, double x1) nogil
+cpdef double kolmogi(double x0) nogil
+cpdef double kolmogorov(double x0) nogil
+cpdef Dd_number_t kv(double x0, Dd_number_t x1) nogil
+cpdef Dd_number_t kve(double x0, Dd_number_t x1) nogil
+cpdef Dd_number_t log1p(Dd_number_t x0) nogil
+cpdef dfg_number_t log_expit(dfg_number_t x0) nogil
+cpdef Dd_number_t log_ndtr(Dd_number_t x0) nogil
+cpdef Dd_number_t loggamma(Dd_number_t x0) nogil
+cpdef dfg_number_t logit(dfg_number_t x0) nogil
+cpdef double lpmv(double x0, double x1, double x2) nogil
+cpdef double mathieu_a(double x0, double x1) nogil
+cpdef double mathieu_b(double x0, double x1) nogil
+cdef void mathieu_cem(double x0, double x1, double x2, double *y0, double *y1) nogil
+cdef void mathieu_modcem1(double x0, double x1, double x2, double *y0, double *y1) nogil
+cdef void mathieu_modcem2(double x0, double x1, double x2, double *y0, double *y1) nogil
+cdef void mathieu_modsem1(double x0, double x1, double x2, double *y0, double *y1) nogil
+cdef void mathieu_modsem2(double x0, double x1, double x2, double *y0, double *y1) nogil
+cdef void mathieu_sem(double x0, double x1, double x2, double *y0, double *y1) nogil
+cdef void modfresnelm(double x0, double complex *y0, double complex *y1) nogil
+cdef void modfresnelp(double x0, double complex *y0, double complex *y1) nogil
+cpdef double modstruve(double x0, double x1) nogil
+cpdef double nbdtr(dl_number_t x0, dl_number_t x1, double x2) nogil
+cpdef double nbdtrc(dl_number_t x0, dl_number_t x1, double x2) nogil
+cpdef double nbdtri(dl_number_t x0, dl_number_t x1, double x2) nogil
+cpdef double nbdtrik(double x0, double x1, double x2) nogil
+cpdef double nbdtrin(double x0, double x1, double x2) nogil
+cpdef double ncfdtr(double x0, double x1, double x2, double x3) nogil
+cpdef double ncfdtri(double x0, double x1, double x2, double x3) nogil
+cpdef double ncfdtridfd(double x0, double x1, double x2, double x3) nogil
+cpdef double ncfdtridfn(double x0, double x1, double x2, double x3) nogil
+cpdef double ncfdtrinc(double x0, double x1, double x2, double x3) nogil
+cpdef double nctdtr(double x0, double x1, double x2) nogil
+cpdef double nctdtridf(double x0, double x1, double x2) nogil
+cpdef double nctdtrinc(double x0, double x1, double x2) nogil
+cpdef double nctdtrit(double x0, double x1, double x2) nogil
+cpdef Dd_number_t ndtr(Dd_number_t x0) nogil
+cpdef double ndtri(double x0) nogil
+cpdef double nrdtrimn(double x0, double x1, double x2) nogil
+cpdef double nrdtrisd(double x0, double x1, double x2) nogil
+cdef void obl_ang1(double x0, double x1, double x2, double x3, double *y0, double *y1) nogil
+cdef void obl_ang1_cv(double x0, double x1, double x2, double x3, double x4, double *y0, double *y1) nogil
+cpdef double obl_cv(double x0, double x1, double x2) nogil
+cdef void obl_rad1(double x0, double x1, double x2, double x3, double *y0, double *y1) nogil
+cdef void obl_rad1_cv(double x0, double x1, double x2, double x3, double x4, double *y0, double *y1) nogil
+cdef void obl_rad2(double x0, double x1, double x2, double x3, double *y0, double *y1) nogil
+cdef void obl_rad2_cv(double x0, double x1, double x2, double x3, double x4, double *y0, double *y1) nogil
+cpdef double owens_t(double x0, double x1) nogil
+cdef void pbdv(double x0, double x1, double *y0, double *y1) nogil
+cdef void pbvv(double x0, double x1, double *y0, double *y1) nogil
+cdef void pbwa(double x0, double x1, double *y0, double *y1) nogil
+cpdef double pdtr(double x0, double x1) nogil
+cpdef double pdtrc(double x0, double x1) nogil
+cpdef double pdtri(dl_number_t x0, double x1) nogil
+cpdef double pdtrik(double x0, double x1) nogil
+cpdef double poch(double x0, double x1) nogil
+cpdef df_number_t powm1(df_number_t x0, df_number_t x1) nogil
+cdef void pro_ang1(double x0, double x1, double x2, double x3, double *y0, double *y1) nogil
+cdef void pro_ang1_cv(double x0, double x1, double x2, double x3, double x4, double *y0, double *y1) nogil
+cpdef double pro_cv(double x0, double x1, double x2) nogil
+cdef void pro_rad1(double x0, double x1, double x2, double x3, double *y0, double *y1) nogil
+cdef void pro_rad1_cv(double x0, double x1, double x2, double x3, double x4, double *y0, double *y1) nogil
+cdef void pro_rad2(double x0, double x1, double x2, double x3, double *y0, double *y1) nogil
+cdef void pro_rad2_cv(double x0, double x1, double x2, double x3, double x4, double *y0, double *y1) nogil
+cpdef double pseudo_huber(double x0, double x1) nogil
+cpdef Dd_number_t psi(Dd_number_t x0) nogil
+cpdef double radian(double x0, double x1, double x2) nogil
+cpdef double rel_entr(double x0, double x1) nogil
+cpdef Dd_number_t rgamma(Dd_number_t x0) nogil
+cpdef double round(double x0) nogil
+cdef void shichi(Dd_number_t x0, Dd_number_t *y0, Dd_number_t *y1) nogil
+cdef void sici(Dd_number_t x0, Dd_number_t *y0, Dd_number_t *y1) nogil
+cpdef double sindg(double x0) nogil
+cpdef double smirnov(dl_number_t x0, double x1) nogil
+cpdef double smirnovi(dl_number_t x0, double x1) nogil
+cpdef Dd_number_t spence(Dd_number_t x0) nogil
+cpdef double complex sph_harm(dl_number_t x0, dl_number_t x1, double x2, double x3) nogil
+cpdef double stdtr(double x0, double x1) nogil
+cpdef double stdtridf(double x0, double x1) nogil
+cpdef double stdtrit(double x0, double x1) nogil
+cpdef double struve(double x0, double x1) nogil
+cpdef double tandg(double x0) nogil
+cpdef double tklmbda(double x0, double x1) nogil
+cpdef double complex wofz(double complex x0) nogil
+cpdef Dd_number_t wrightomega(Dd_number_t x0) nogil
+cpdef Dd_number_t xlog1py(Dd_number_t x0, Dd_number_t x1) nogil
+cpdef Dd_number_t xlogy(Dd_number_t x0, Dd_number_t x1) nogil
+cpdef double y0(double x0) nogil
+cpdef double y1(double x0) nogil
+cpdef double yn(dl_number_t x0, double x1) nogil
+cpdef Dd_number_t yv(double x0, Dd_number_t x1) nogil
+cpdef Dd_number_t yve(double x0, Dd_number_t x1) nogil
+cpdef double zetac(double x0) nogil
+cpdef double wright_bessel(double x0, double x1, double x2) nogil
+cpdef double ndtri_exp(double x0) nogil

.CondaPkg/env/Lib/site-packages/scipy/special/cython_special.pyi

@@ -0,0 +1,3 @@
+from typing import Any
+
+def __getattr__(name) -> Any: ...

.CondaPkg/env/Lib/site-packages/scipy/special/orthogonal.py

@@ -0,0 +1,55 @@
+# This file is not meant for public use and will be removed in SciPy v2.0.0.
+# Use the `scipy.special` namespace for importing the functions
+# included below.
+
+import warnings
+from . import _orthogonal
+
+
+_polyfuns = ['legendre', 'chebyt', 'chebyu', 'chebyc', 'chebys',
+             'jacobi', 'laguerre', 'genlaguerre', 'hermite',
+             'hermitenorm', 'gegenbauer', 'sh_legendre', 'sh_chebyt',
+             'sh_chebyu', 'sh_jacobi']
+
+# Correspondence between new and old names of root functions
+_rootfuns_map = {'roots_legendre': 'p_roots',
+               'roots_chebyt': 't_roots',
+               'roots_chebyu': 'u_roots',
+               'roots_chebyc': 'c_roots',
+               'roots_chebys': 's_roots',
+               'roots_jacobi': 'j_roots',
+               'roots_laguerre': 'l_roots',
+               'roots_genlaguerre': 'la_roots',
+               'roots_hermite': 'h_roots',
+               'roots_hermitenorm': 'he_roots',
+               'roots_gegenbauer': 'cg_roots',
+               'roots_sh_legendre': 'ps_roots',
+               'roots_sh_chebyt': 'ts_roots',
+               'roots_sh_chebyu': 'us_roots',
+               'roots_sh_jacobi': 'js_roots'}
+
+
+__all__ = _polyfuns + list(_rootfuns_map.keys()) + [  # noqa: F822
+    'exp', 'inf', 'floor', 'around', 'hstack', 'arange',
+    'linalg', 'airy', 'orthopoly1d', 'newfun',
+    'oldfun', 'p_roots', 't_roots', 'u_roots', 'c_roots', 's_roots',
+    'j_roots', 'l_roots', 'la_roots', 'h_roots', 'he_roots', 'cg_roots',
+    'ps_roots', 'ts_roots', 'us_roots', 'js_roots'
+]
+
+
+def __dir__():
+    return __all__
+
+
+def __getattr__(name):
+    if name not in __all__:
+        raise AttributeError(
+            "scipy.special.orthogonal is deprecated and has no attribute "
+            f"{name}. Try looking in scipy.special instead.")
+
+    warnings.warn(f"Please use `{name}` from the `scipy.special` namespace, "
+                  "the `scipy.special.orthogonal` namespace is deprecated.",
+                  category=DeprecationWarning, stacklevel=2)
+
+    return getattr(_orthogonal, name)

.CondaPkg/env/Lib/site-packages/scipy/special/sf_error.py

@@ -0,0 +1,28 @@
+# This file is not meant for public use and will be removed in SciPy v2.0.0.
+# Use the `scipy.special` namespace for importing the functions
+# included below.
+
+import warnings
+from . import _sf_error
+
+__all__ = [  # noqa: F822
+    'SpecialFunctionWarning',
+    'SpecialFunctionError'
+]
+
+
+def __dir__():
+    return __all__
+
+
+def __getattr__(name):
+    if name not in __all__:
+        raise AttributeError(
+            "scipy.special.sf_error is deprecated and has no attribute "
+            f"{name}. Try looking in scipy.special instead.")
+
+    warnings.warn(f"Please use `{name}` from the `scipy.special` namespace, "
+                  "the `scipy.special.sf_error` namespace is deprecated.",
+                  category=DeprecationWarning, stacklevel=2)
+
+    return getattr(_sf_error, name)

.CondaPkg/env/Lib/site-packages/scipy/special/specfun.py

@@ -0,0 +1,51 @@
+# This file is not meant for public use and will be removed in SciPy v2.0.0.
+# Use the `scipy.special` namespace for importing the functions
+# included below.
+
+import warnings
+from . import _specfun  # type: ignore
+
+__all__ = [  # noqa: F822
+    'airyzo',
+    'bernob',
+    'cerzo',
+    'clpmn',
+    'clpn',
+    'clqmn',
+    'clqn',
+    'cpbdn',
+    'cyzo',
+    'eulerb',
+    'fcoef',
+    'fcszo',
+    'jdzo',
+    'jyzo',
+    'klvnzo',
+    'lamn',
+    'lamv',
+    'lpmn',
+    'lpn',
+    'lqmn',
+    'lqnb',
+    'pbdv',
+    'rctj',
+    'rcty',
+    'segv'
+]
+
+
+def __dir__():
+    return __all__
+
+
+def __getattr__(name):
+    if name not in __all__:
+        raise AttributeError(
+            "scipy.special.specfun is deprecated and has no attribute "
+            f"{name}. Try looking in scipy.special instead.")
+
+    warnings.warn(f"Please use `{name}` from the `scipy.special` namespace, "
+                  "the `scipy.special.specfun` namespace is deprecated.",
+                  category=DeprecationWarning, stacklevel=2)
+
+    return getattr(_specfun, name)

.CondaPkg/env/Lib/site-packages/scipy/special/spfun_stats.py

@@ -0,0 +1,25 @@
+# This file is not meant for public use and will be removed in SciPy v2.0.0.
+# Use the `scipy.special` namespace for importing the functions
+# included below.
+
+import warnings
+from . import _spfun_stats
+
+__all__ = ['multigammaln', 'loggam']  # noqa: F822
+
+
+def __dir__():
+    return __all__
+
+
+def __getattr__(name):
+    if name not in __all__:
+        raise AttributeError(
+            "scipy.special.spfun_stats is deprecated and has no attribute "
+            f"{name}. Try looking in scipy.special instead.")
+
+    warnings.warn(f"Please use `{name}` from the `scipy.special` namespace, "
+                  "the `scipy.special.spfun_stats` namespace is deprecated.",
+                  category=DeprecationWarning, stacklevel=2)
+
+    return getattr(_spfun_stats, name)