using for loop to install conda package

.CondaPkg/env/Lib/site-packages/numpy/lib/__init__.py

@@ -0,0 +1,79 @@
+"""
+**Note:** almost all functions in the ``numpy.lib`` namespace
+are also present in the main ``numpy`` namespace.  Please use the
+functions as ``np.<funcname>`` where possible.
+
+``numpy.lib`` is mostly a space for implementing functions that don't
+belong in core or in another NumPy submodule with a clear purpose
+(e.g. ``random``, ``fft``, ``linalg``, ``ma``).
+
+Most contains basic functions that are used by several submodules and are
+useful to have in the main name-space.
+
+"""
+import math
+
+from numpy.version import version as __version__
+
+# Public submodules
+# Note: recfunctions and (maybe) format are public too, but not imported
+from . import mixins
+from . import scimath as emath
+
+# Private submodules
+# load module names. See https://github.com/networkx/networkx/issues/5838
+from . import type_check
+from . import index_tricks
+from . import function_base
+from . import nanfunctions
+from . import shape_base
+from . import stride_tricks
+from . import twodim_base
+from . import ufunclike
+from . import histograms
+from . import polynomial
+from . import utils
+from . import arraysetops
+from . import npyio
+from . import arrayterator
+from . import arraypad
+from . import _version
+
+from .type_check import *
+from .index_tricks import *
+from .function_base import *
+from .nanfunctions import *
+from .shape_base import *
+from .stride_tricks import *
+from .twodim_base import *
+from .ufunclike import *
+from .histograms import *
+
+from .polynomial import *
+from .utils import *
+from .arraysetops import *
+from .npyio import *
+from .arrayterator import Arrayterator
+from .arraypad import *
+from ._version import *
+from numpy.core._multiarray_umath import tracemalloc_domain
+
+__all__ = ['emath', 'math', 'tracemalloc_domain', 'Arrayterator']
+__all__ += type_check.__all__
+__all__ += index_tricks.__all__
+__all__ += function_base.__all__
+__all__ += shape_base.__all__
+__all__ += stride_tricks.__all__
+__all__ += twodim_base.__all__
+__all__ += ufunclike.__all__
+__all__ += arraypad.__all__
+__all__ += polynomial.__all__
+__all__ += utils.__all__
+__all__ += arraysetops.__all__
+__all__ += npyio.__all__
+__all__ += nanfunctions.__all__
+__all__ += histograms.__all__
+
+from numpy._pytesttester import PytestTester
+test = PytestTester(__name__)
+del PytestTester

.CondaPkg/env/Lib/site-packages/numpy/lib/__init__.pyi

@@ -0,0 +1,246 @@
+import math as math
+from typing import Any
+
+from numpy._pytesttester import PytestTester
+
+from numpy import (
+    ndenumerate as ndenumerate,
+    ndindex as ndindex,
+)
+
+from numpy.version import version
+
+from numpy.lib import (
+    format as format,
+    mixins as mixins,
+    scimath as scimath,
+    stride_tricks as stride_tricks,
+)
+
+from numpy.lib._version import (
+    NumpyVersion as NumpyVersion,
+)
+
+from numpy.lib.arraypad import (
+    pad as pad,
+)
+
+from numpy.lib.arraysetops import (
+    ediff1d as ediff1d,
+    intersect1d as intersect1d,
+    setxor1d as setxor1d,
+    union1d as union1d,
+    setdiff1d as setdiff1d,
+    unique as unique,
+    in1d as in1d,
+    isin as isin,
+)
+
+from numpy.lib.arrayterator import (
+    Arrayterator as Arrayterator,
+)
+
+from numpy.lib.function_base import (
+    select as select,
+    piecewise as piecewise,
+    trim_zeros as trim_zeros,
+    copy as copy,
+    iterable as iterable,
+    percentile as percentile,
+    diff as diff,
+    gradient as gradient,
+    angle as angle,
+    unwrap as unwrap,
+    sort_complex as sort_complex,
+    disp as disp,
+    flip as flip,
+    rot90 as rot90,
+    extract as extract,
+    place as place,
+    vectorize as vectorize,
+    asarray_chkfinite as asarray_chkfinite,
+    average as average,
+    bincount as bincount,
+    digitize as digitize,
+    cov as cov,
+    corrcoef as corrcoef,
+    msort as msort,
+    median as median,
+    sinc as sinc,
+    hamming as hamming,
+    hanning as hanning,
+    bartlett as bartlett,
+    blackman as blackman,
+    kaiser as kaiser,
+    trapz as trapz,
+    i0 as i0,
+    add_newdoc as add_newdoc,
+    add_docstring as add_docstring,
+    meshgrid as meshgrid,
+    delete as delete,
+    insert as insert,
+    append as append,
+    interp as interp,
+    add_newdoc_ufunc as add_newdoc_ufunc,
+    quantile as quantile,
+)
+
+from numpy.lib.histograms import (
+    histogram_bin_edges as histogram_bin_edges,
+    histogram as histogram,
+    histogramdd as histogramdd,
+)
+
+from numpy.lib.index_tricks import (
+    ravel_multi_index as ravel_multi_index,
+    unravel_index as unravel_index,
+    mgrid as mgrid,
+    ogrid as ogrid,
+    r_ as r_,
+    c_ as c_,
+    s_ as s_,
+    index_exp as index_exp,
+    ix_ as ix_,
+    fill_diagonal as fill_diagonal,
+    diag_indices as diag_indices,
+    diag_indices_from as diag_indices_from,
+)
+
+from numpy.lib.nanfunctions import (
+    nansum as nansum,
+    nanmax as nanmax,
+    nanmin as nanmin,
+    nanargmax as nanargmax,
+    nanargmin as nanargmin,
+    nanmean as nanmean,
+    nanmedian as nanmedian,
+    nanpercentile as nanpercentile,
+    nanvar as nanvar,
+    nanstd as nanstd,
+    nanprod as nanprod,
+    nancumsum as nancumsum,
+    nancumprod as nancumprod,
+    nanquantile as nanquantile,
+)
+
+from numpy.lib.npyio import (
+    savetxt as savetxt,
+    loadtxt as loadtxt,
+    genfromtxt as genfromtxt,
+    recfromtxt as recfromtxt,
+    recfromcsv as recfromcsv,
+    load as load,
+    save as save,
+    savez as savez,
+    savez_compressed as savez_compressed,
+    packbits as packbits,
+    unpackbits as unpackbits,
+    fromregex as fromregex,
+    DataSource as DataSource,
+)
+
+from numpy.lib.polynomial import (
+    poly as poly,
+    roots as roots,
+    polyint as polyint,
+    polyder as polyder,
+    polyadd as polyadd,
+    polysub as polysub,
+    polymul as polymul,
+    polydiv as polydiv,
+    polyval as polyval,
+    polyfit as polyfit,
+    RankWarning as RankWarning,
+    poly1d as poly1d,
+)
+
+from numpy.lib.shape_base import (
+    column_stack as column_stack,
+    row_stack as row_stack,
+    dstack as dstack,
+    array_split as array_split,
+    split as split,
+    hsplit as hsplit,
+    vsplit as vsplit,
+    dsplit as dsplit,
+    apply_over_axes as apply_over_axes,
+    expand_dims as expand_dims,
+    apply_along_axis as apply_along_axis,
+    kron as kron,
+    tile as tile,
+    get_array_wrap as get_array_wrap,
+    take_along_axis as take_along_axis,
+    put_along_axis as put_along_axis,
+)
+
+from numpy.lib.stride_tricks import (
+    broadcast_to as broadcast_to,
+    broadcast_arrays as broadcast_arrays,
+    broadcast_shapes as broadcast_shapes,
+)
+
+from numpy.lib.twodim_base import (
+    diag as diag,
+    diagflat as diagflat,
+    eye as eye,
+    fliplr as fliplr,
+    flipud as flipud,
+    tri as tri,
+    triu as triu,
+    tril as tril,
+    vander as vander,
+    histogram2d as histogram2d,
+    mask_indices as mask_indices,
+    tril_indices as tril_indices,
+    tril_indices_from as tril_indices_from,
+    triu_indices as triu_indices,
+    triu_indices_from as triu_indices_from,
+)
+
+from numpy.lib.type_check import (
+    mintypecode as mintypecode,
+    asfarray as asfarray,
+    real as real,
+    imag as imag,
+    iscomplex as iscomplex,
+    isreal as isreal,
+    iscomplexobj as iscomplexobj,
+    isrealobj as isrealobj,
+    nan_to_num as nan_to_num,
+    real_if_close as real_if_close,
+    typename as typename,
+    common_type as common_type,
+)
+
+from numpy.lib.ufunclike import (
+    fix as fix,
+    isposinf as isposinf,
+    isneginf as isneginf,
+)
+
+from numpy.lib.utils import (
+    issubclass_ as issubclass_,
+    issubsctype as issubsctype,
+    issubdtype as issubdtype,
+    deprecate as deprecate,
+    deprecate_with_doc as deprecate_with_doc,
+    get_include as get_include,
+    info as info,
+    source as source,
+    who as who,
+    lookfor as lookfor,
+    byte_bounds as byte_bounds,
+    safe_eval as safe_eval,
+    show_runtime as show_runtime,
+)
+
+from numpy.core.multiarray import (
+    tracemalloc_domain as tracemalloc_domain,
+)
+
+__all__: list[str]
+__path__: list[str]
+test: PytestTester
+
+__version__ = version
+emath = scimath

.CondaPkg/env/Lib/site-packages/numpy/lib/_datasource.py

@@ -0,0 +1,704 @@
+"""A file interface for handling local and remote data files.
+
+The goal of datasource is to abstract some of the file system operations
+when dealing with data files so the researcher doesn't have to know all the
+low-level details.  Through datasource, a researcher can obtain and use a
+file with one function call, regardless of location of the file.
+
+DataSource is meant to augment standard python libraries, not replace them.
+It should work seamlessly with standard file IO operations and the os
+module.
+
+DataSource files can originate locally or remotely:
+
+- local files : '/home/guido/src/local/data.txt'
+- URLs (http, ftp, ...) : 'http://www.scipy.org/not/real/data.txt'
+
+DataSource files can also be compressed or uncompressed.  Currently only
+gzip, bz2 and xz are supported.
+
+Example::
+
+    >>> # Create a DataSource, use os.curdir (default) for local storage.
+    >>> from numpy import DataSource
+    >>> ds = DataSource()
+    >>>
+    >>> # Open a remote file.
+    >>> # DataSource downloads the file, stores it locally in:
+    >>> #     './www.google.com/index.html'
+    >>> # opens the file and returns a file object.
+    >>> fp = ds.open('http://www.google.com/') # doctest: +SKIP
+    >>>
+    >>> # Use the file as you normally would
+    >>> fp.read() # doctest: +SKIP
+    >>> fp.close() # doctest: +SKIP
+
+"""
+import os
+import io
+
+from numpy.core.overrides import set_module
+
+
+_open = open
+
+
+def _check_mode(mode, encoding, newline):
+    """Check mode and that encoding and newline are compatible.
+
+    Parameters
+    ----------
+    mode : str
+        File open mode.
+    encoding : str
+        File encoding.
+    newline : str
+        Newline for text files.
+
+    """
+    if "t" in mode:
+        if "b" in mode:
+            raise ValueError("Invalid mode: %r" % (mode,))
+    else:
+        if encoding is not None:
+            raise ValueError("Argument 'encoding' not supported in binary mode")
+        if newline is not None:
+            raise ValueError("Argument 'newline' not supported in binary mode")
+
+
+# Using a class instead of a module-level dictionary
+# to reduce the initial 'import numpy' overhead by
+# deferring the import of lzma, bz2 and gzip until needed
+
+# TODO: .zip support, .tar support?
+class _FileOpeners:
+    """
+    Container for different methods to open (un-)compressed files.
+
+    `_FileOpeners` contains a dictionary that holds one method for each
+    supported file format. Attribute lookup is implemented in such a way
+    that an instance of `_FileOpeners` itself can be indexed with the keys
+    of that dictionary. Currently uncompressed files as well as files
+    compressed with ``gzip``, ``bz2`` or ``xz`` compression are supported.
+
+    Notes
+    -----
+    `_file_openers`, an instance of `_FileOpeners`, is made available for
+    use in the `_datasource` module.
+
+    Examples
+    --------
+    >>> import gzip
+    >>> np.lib._datasource._file_openers.keys()
+    [None, '.bz2', '.gz', '.xz', '.lzma']
+    >>> np.lib._datasource._file_openers['.gz'] is gzip.open
+    True
+
+    """
+
+    def __init__(self):
+        self._loaded = False
+        self._file_openers = {None: io.open}
+
+    def _load(self):
+        if self._loaded:
+            return
+
+        try:
+            import bz2
+            self._file_openers[".bz2"] = bz2.open
+        except ImportError:
+            pass
+
+        try:
+            import gzip
+            self._file_openers[".gz"] = gzip.open
+        except ImportError:
+            pass
+
+        try:
+            import lzma
+            self._file_openers[".xz"] = lzma.open
+            self._file_openers[".lzma"] = lzma.open
+        except (ImportError, AttributeError):
+            # There are incompatible backports of lzma that do not have the
+            # lzma.open attribute, so catch that as well as ImportError.
+            pass
+
+        self._loaded = True
+
+    def keys(self):
+        """
+        Return the keys of currently supported file openers.
+
+        Parameters
+        ----------
+        None
+
+        Returns
+        -------
+        keys : list
+            The keys are None for uncompressed files and the file extension
+            strings (i.e. ``'.gz'``, ``'.xz'``) for supported compression
+            methods.
+
+        """
+        self._load()
+        return list(self._file_openers.keys())
+
+    def __getitem__(self, key):
+        self._load()
+        return self._file_openers[key]
+
+_file_openers = _FileOpeners()
+
+def open(path, mode='r', destpath=os.curdir, encoding=None, newline=None):
+    """
+    Open `path` with `mode` and return the file object.
+
+    If ``path`` is an URL, it will be downloaded, stored in the
+    `DataSource` `destpath` directory and opened from there.
+
+    Parameters
+    ----------
+    path : str
+        Local file path or URL to open.
+    mode : str, optional
+        Mode to open `path`. Mode 'r' for reading, 'w' for writing, 'a' to
+        append. Available modes depend on the type of object specified by
+        path.  Default is 'r'.
+    destpath : str, optional
+        Path to the directory where the source file gets downloaded to for
+        use.  If `destpath` is None, a temporary directory will be created.
+        The default path is the current directory.
+    encoding : {None, str}, optional
+        Open text file with given encoding. The default encoding will be
+        what `io.open` uses.
+    newline : {None, str}, optional
+        Newline to use when reading text file.
+
+    Returns
+    -------
+    out : file object
+        The opened file.
+
+    Notes
+    -----
+    This is a convenience function that instantiates a `DataSource` and
+    returns the file object from ``DataSource.open(path)``.
+
+    """
+
+    ds = DataSource(destpath)
+    return ds.open(path, mode, encoding=encoding, newline=newline)
+
+
+@set_module('numpy')
+class DataSource:
+    """
+    DataSource(destpath='.')
+
+    A generic data source file (file, http, ftp, ...).
+
+    DataSources can be local files or remote files/URLs.  The files may
+    also be compressed or uncompressed. DataSource hides some of the
+    low-level details of downloading the file, allowing you to simply pass
+    in a valid file path (or URL) and obtain a file object.
+
+    Parameters
+    ----------
+    destpath : str or None, optional
+        Path to the directory where the source file gets downloaded to for
+        use.  If `destpath` is None, a temporary directory will be created.
+        The default path is the current directory.
+
+    Notes
+    -----
+    URLs require a scheme string (``http://``) to be used, without it they
+    will fail::
+
+        >>> repos = np.DataSource()
+        >>> repos.exists('www.google.com/index.html')
+        False
+        >>> repos.exists('http://www.google.com/index.html')
+        True
+
+    Temporary directories are deleted when the DataSource is deleted.
+
+    Examples
+    --------
+    ::
+
+        >>> ds = np.DataSource('/home/guido')
+        >>> urlname = 'http://www.google.com/'
+        >>> gfile = ds.open('http://www.google.com/')
+        >>> ds.abspath(urlname)
+        '/home/guido/www.google.com/index.html'
+
+        >>> ds = np.DataSource(None)  # use with temporary file
+        >>> ds.open('/home/guido/foobar.txt')
+        <open file '/home/guido.foobar.txt', mode 'r' at 0x91d4430>
+        >>> ds.abspath('/home/guido/foobar.txt')
+        '/tmp/.../home/guido/foobar.txt'
+
+    """
+
+    def __init__(self, destpath=os.curdir):
+        """Create a DataSource with a local path at destpath."""
+        if destpath:
+            self._destpath = os.path.abspath(destpath)
+            self._istmpdest = False
+        else:
+            import tempfile  # deferring import to improve startup time
+            self._destpath = tempfile.mkdtemp()
+            self._istmpdest = True
+
+    def __del__(self):
+        # Remove temp directories
+        if hasattr(self, '_istmpdest') and self._istmpdest:
+            import shutil
+
+            shutil.rmtree(self._destpath)
+
+    def _iszip(self, filename):
+        """Test if the filename is a zip file by looking at the file extension.
+
+        """
+        fname, ext = os.path.splitext(filename)
+        return ext in _file_openers.keys()
+
+    def _iswritemode(self, mode):
+        """Test if the given mode will open a file for writing."""
+
+        # Currently only used to test the bz2 files.
+        _writemodes = ("w", "+")
+        for c in mode:
+            if c in _writemodes:
+                return True
+        return False
+
+    def _splitzipext(self, filename):
+        """Split zip extension from filename and return filename.
+
+        Returns
+        -------
+        base, zip_ext : {tuple}
+
+        """
+
+        if self._iszip(filename):
+            return os.path.splitext(filename)
+        else:
+            return filename, None
+
+    def _possible_names(self, filename):
+        """Return a tuple containing compressed filename variations."""
+        names = [filename]
+        if not self._iszip(filename):
+            for zipext in _file_openers.keys():
+                if zipext:
+                    names.append(filename+zipext)
+        return names
+
+    def _isurl(self, path):
+        """Test if path is a net location.  Tests the scheme and netloc."""
+
+        # We do this here to reduce the 'import numpy' initial import time.
+        from urllib.parse import urlparse
+
+        # BUG : URLs require a scheme string ('http://') to be used.
+        #       www.google.com will fail.
+        #       Should we prepend the scheme for those that don't have it and
+        #       test that also?  Similar to the way we append .gz and test for
+        #       for compressed versions of files.
+
+        scheme, netloc, upath, uparams, uquery, ufrag = urlparse(path)
+        return bool(scheme and netloc)
+
+    def _cache(self, path):
+        """Cache the file specified by path.
+
+        Creates a copy of the file in the datasource cache.
+
+        """
+        # We import these here because importing them is slow and
+        # a significant fraction of numpy's total import time.
+        import shutil
+        from urllib.request import urlopen
+
+        upath = self.abspath(path)
+
+        # ensure directory exists
+        if not os.path.exists(os.path.dirname(upath)):
+            os.makedirs(os.path.dirname(upath))
+
+        # TODO: Doesn't handle compressed files!
+        if self._isurl(path):
+            with urlopen(path) as openedurl:
+                with _open(upath, 'wb') as f:
+                    shutil.copyfileobj(openedurl, f)
+        else:
+            shutil.copyfile(path, upath)
+        return upath
+
+    def _findfile(self, path):
+        """Searches for ``path`` and returns full path if found.
+
+        If path is an URL, _findfile will cache a local copy and return the
+        path to the cached file.  If path is a local file, _findfile will
+        return a path to that local file.
+
+        The search will include possible compressed versions of the file
+        and return the first occurrence found.
+
+        """
+
+        # Build list of possible local file paths
+        if not self._isurl(path):
+            # Valid local paths
+            filelist = self._possible_names(path)
+            # Paths in self._destpath
+            filelist += self._possible_names(self.abspath(path))
+        else:
+            # Cached URLs in self._destpath
+            filelist = self._possible_names(self.abspath(path))
+            # Remote URLs
+            filelist = filelist + self._possible_names(path)
+
+        for name in filelist:
+            if self.exists(name):
+                if self._isurl(name):
+                    name = self._cache(name)
+                return name
+        return None
+
+    def abspath(self, path):
+        """
+        Return absolute path of file in the DataSource directory.
+
+        If `path` is an URL, then `abspath` will return either the location
+        the file exists locally or the location it would exist when opened
+        using the `open` method.
+
+        Parameters
+        ----------
+        path : str
+            Can be a local file or a remote URL.
+
+        Returns
+        -------
+        out : str
+            Complete path, including the `DataSource` destination directory.
+
+        Notes
+        -----
+        The functionality is based on `os.path.abspath`.
+
+        """
+        # We do this here to reduce the 'import numpy' initial import time.
+        from urllib.parse import urlparse
+
+        # TODO:  This should be more robust.  Handles case where path includes
+        #        the destpath, but not other sub-paths. Failing case:
+        #        path = /home/guido/datafile.txt
+        #        destpath = /home/alex/
+        #        upath = self.abspath(path)
+        #        upath == '/home/alex/home/guido/datafile.txt'
+
+        # handle case where path includes self._destpath
+        splitpath = path.split(self._destpath, 2)
+        if len(splitpath) > 1:
+            path = splitpath[1]
+        scheme, netloc, upath, uparams, uquery, ufrag = urlparse(path)
+        netloc = self._sanitize_relative_path(netloc)
+        upath = self._sanitize_relative_path(upath)
+        return os.path.join(self._destpath, netloc, upath)
+
+    def _sanitize_relative_path(self, path):
+        """Return a sanitised relative path for which
+        os.path.abspath(os.path.join(base, path)).startswith(base)
+        """
+        last = None
+        path = os.path.normpath(path)
+        while path != last:
+            last = path
+            # Note: os.path.join treats '/' as os.sep on Windows
+            path = path.lstrip(os.sep).lstrip('/')
+            path = path.lstrip(os.pardir).lstrip('..')
+            drive, path = os.path.splitdrive(path)  # for Windows
+        return path
+
+    def exists(self, path):
+        """
+        Test if path exists.
+
+        Test if `path` exists as (and in this order):
+
+        - a local file.
+        - a remote URL that has been downloaded and stored locally in the
+          `DataSource` directory.
+        - a remote URL that has not been downloaded, but is valid and
+          accessible.
+
+        Parameters
+        ----------
+        path : str
+            Can be a local file or a remote URL.
+
+        Returns
+        -------
+        out : bool
+            True if `path` exists.
+
+        Notes
+        -----
+        When `path` is an URL, `exists` will return True if it's either
+        stored locally in the `DataSource` directory, or is a valid remote
+        URL.  `DataSource` does not discriminate between the two, the file
+        is accessible if it exists in either location.
+
+        """
+
+        # First test for local path
+        if os.path.exists(path):
+            return True
+
+        # We import this here because importing urllib is slow and
+        # a significant fraction of numpy's total import time.
+        from urllib.request import urlopen
+        from urllib.error import URLError
+
+        # Test cached url
+        upath = self.abspath(path)
+        if os.path.exists(upath):
+            return True
+
+        # Test remote url
+        if self._isurl(path):
+            try:
+                netfile = urlopen(path)
+                netfile.close()
+                del(netfile)
+                return True
+            except URLError:
+                return False
+        return False
+
+    def open(self, path, mode='r', encoding=None, newline=None):
+        """
+        Open and return file-like object.
+
+        If `path` is an URL, it will be downloaded, stored in the
+        `DataSource` directory and opened from there.
+
+        Parameters
+        ----------
+        path : str
+            Local file path or URL to open.
+        mode : {'r', 'w', 'a'}, optional
+            Mode to open `path`.  Mode 'r' for reading, 'w' for writing,
+            'a' to append. Available modes depend on the type of object
+            specified by `path`. Default is 'r'.
+        encoding : {None, str}, optional
+            Open text file with given encoding. The default encoding will be
+            what `io.open` uses.
+        newline : {None, str}, optional
+            Newline to use when reading text file.
+
+        Returns
+        -------
+        out : file object
+            File object.
+
+        """
+
+        # TODO: There is no support for opening a file for writing which
+        #       doesn't exist yet (creating a file).  Should there be?
+
+        # TODO: Add a ``subdir`` parameter for specifying the subdirectory
+        #       used to store URLs in self._destpath.
+
+        if self._isurl(path) and self._iswritemode(mode):
+            raise ValueError("URLs are not writeable")
+
+        # NOTE: _findfile will fail on a new file opened for writing.
+        found = self._findfile(path)
+        if found:
+            _fname, ext = self._splitzipext(found)
+            if ext == 'bz2':
+                mode.replace("+", "")
+            return _file_openers[ext](found, mode=mode,
+                                      encoding=encoding, newline=newline)
+        else:
+            raise FileNotFoundError(f"{path} not found.")
+
+
+class Repository (DataSource):
+    """
+    Repository(baseurl, destpath='.')
+
+    A data repository where multiple DataSource's share a base
+    URL/directory.
+
+    `Repository` extends `DataSource` by prepending a base URL (or
+    directory) to all the files it handles. Use `Repository` when you will
+    be working with multiple files from one base URL.  Initialize
+    `Repository` with the base URL, then refer to each file by its filename
+    only.
+
+    Parameters
+    ----------
+    baseurl : str
+        Path to the local directory or remote location that contains the
+        data files.
+    destpath : str or None, optional
+        Path to the directory where the source file gets downloaded to for
+        use.  If `destpath` is None, a temporary directory will be created.
+        The default path is the current directory.
+
+    Examples
+    --------
+    To analyze all files in the repository, do something like this
+    (note: this is not self-contained code)::
+
+        >>> repos = np.lib._datasource.Repository('/home/user/data/dir/')
+        >>> for filename in filelist:
+        ...     fp = repos.open(filename)
+        ...     fp.analyze()
+        ...     fp.close()
+
+    Similarly you could use a URL for a repository::
+
+        >>> repos = np.lib._datasource.Repository('http://www.xyz.edu/data')
+
+    """
+
+    def __init__(self, baseurl, destpath=os.curdir):
+        """Create a Repository with a shared url or directory of baseurl."""
+        DataSource.__init__(self, destpath=destpath)
+        self._baseurl = baseurl
+
+    def __del__(self):
+        DataSource.__del__(self)
+
+    def _fullpath(self, path):
+        """Return complete path for path.  Prepends baseurl if necessary."""
+        splitpath = path.split(self._baseurl, 2)
+        if len(splitpath) == 1:
+            result = os.path.join(self._baseurl, path)
+        else:
+            result = path    # path contains baseurl already
+        return result
+
+    def _findfile(self, path):
+        """Extend DataSource method to prepend baseurl to ``path``."""
+        return DataSource._findfile(self, self._fullpath(path))
+
+    def abspath(self, path):
+        """
+        Return absolute path of file in the Repository directory.
+
+        If `path` is an URL, then `abspath` will return either the location
+        the file exists locally or the location it would exist when opened
+        using the `open` method.
+
+        Parameters
+        ----------
+        path : str
+            Can be a local file or a remote URL. This may, but does not
+            have to, include the `baseurl` with which the `Repository` was
+            initialized.
+
+        Returns
+        -------
+        out : str
+            Complete path, including the `DataSource` destination directory.
+
+        """
+        return DataSource.abspath(self, self._fullpath(path))
+
+    def exists(self, path):
+        """
+        Test if path exists prepending Repository base URL to path.
+
+        Test if `path` exists as (and in this order):
+
+        - a local file.
+        - a remote URL that has been downloaded and stored locally in the
+          `DataSource` directory.
+        - a remote URL that has not been downloaded, but is valid and
+          accessible.
+
+        Parameters
+        ----------
+        path : str
+            Can be a local file or a remote URL. This may, but does not
+            have to, include the `baseurl` with which the `Repository` was
+            initialized.
+
+        Returns
+        -------
+        out : bool
+            True if `path` exists.
+
+        Notes
+        -----
+        When `path` is an URL, `exists` will return True if it's either
+        stored locally in the `DataSource` directory, or is a valid remote
+        URL.  `DataSource` does not discriminate between the two, the file
+        is accessible if it exists in either location.
+
+        """
+        return DataSource.exists(self, self._fullpath(path))
+
+    def open(self, path, mode='r', encoding=None, newline=None):
+        """
+        Open and return file-like object prepending Repository base URL.
+
+        If `path` is an URL, it will be downloaded, stored in the
+        DataSource directory and opened from there.
+
+        Parameters
+        ----------
+        path : str
+            Local file path or URL to open. This may, but does not have to,
+            include the `baseurl` with which the `Repository` was
+            initialized.
+        mode : {'r', 'w', 'a'}, optional
+            Mode to open `path`.  Mode 'r' for reading, 'w' for writing,
+            'a' to append. Available modes depend on the type of object
+            specified by `path`. Default is 'r'.
+        encoding : {None, str}, optional
+            Open text file with given encoding. The default encoding will be
+            what `io.open` uses.
+        newline : {None, str}, optional
+            Newline to use when reading text file.
+
+        Returns
+        -------
+        out : file object
+            File object.
+
+        """
+        return DataSource.open(self, self._fullpath(path), mode,
+                               encoding=encoding, newline=newline)
+
+    def listdir(self):
+        """
+        List files in the source Repository.
+
+        Returns
+        -------
+        files : list of str
+            List of file names (not containing a directory part).
+
+        Notes
+        -----
+        Does not currently work for remote repositories.
+
+        """
+        if self._isurl(self._baseurl):
+            raise NotImplementedError(
+                  "Directory listing of URLs, not supported yet.")
+        else:
+            return os.listdir(self._baseurl)

.CondaPkg/env/Lib/site-packages/numpy/lib/_iotools.py

@@ -0,0 +1,897 @@
+"""A collection of functions designed to help I/O with ascii files.
+
+"""
+__docformat__ = "restructuredtext en"
+
+import numpy as np
+import numpy.core.numeric as nx
+from numpy.compat import asbytes, asunicode
+
+
+def _decode_line(line, encoding=None):
+    """Decode bytes from binary input streams.
+
+    Defaults to decoding from 'latin1'. That differs from the behavior of
+    np.compat.asunicode that decodes from 'ascii'.
+
+    Parameters
+    ----------
+    line : str or bytes
+         Line to be decoded.
+    encoding : str
+         Encoding used to decode `line`.
+
+    Returns
+    -------
+    decoded_line : str
+
+    """
+    if type(line) is bytes:
+        if encoding is None:
+            encoding = "latin1"
+        line = line.decode(encoding)
+
+    return line
+
+
+def _is_string_like(obj):
+    """
+    Check whether obj behaves like a string.
+    """
+    try:
+        obj + ''
+    except (TypeError, ValueError):
+        return False
+    return True
+
+
+def _is_bytes_like(obj):
+    """
+    Check whether obj behaves like a bytes object.
+    """
+    try:
+        obj + b''
+    except (TypeError, ValueError):
+        return False
+    return True
+
+
+def has_nested_fields(ndtype):
+    """
+    Returns whether one or several fields of a dtype are nested.
+
+    Parameters
+    ----------
+    ndtype : dtype
+        Data-type of a structured array.
+
+    Raises
+    ------
+    AttributeError
+        If `ndtype` does not have a `names` attribute.
+
+    Examples
+    --------
+    >>> dt = np.dtype([('name', 'S4'), ('x', float), ('y', float)])
+    >>> np.lib._iotools.has_nested_fields(dt)
+    False
+
+    """
+    for name in ndtype.names or ():
+        if ndtype[name].names is not None:
+            return True
+    return False
+
+
+def flatten_dtype(ndtype, flatten_base=False):
+    """
+    Unpack a structured data-type by collapsing nested fields and/or fields
+    with a shape.
+
+    Note that the field names are lost.
+
+    Parameters
+    ----------
+    ndtype : dtype
+        The datatype to collapse
+    flatten_base : bool, optional
+       If True, transform a field with a shape into several fields. Default is
+       False.
+
+    Examples
+    --------
+    >>> dt = np.dtype([('name', 'S4'), ('x', float), ('y', float),
+    ...                ('block', int, (2, 3))])
+    >>> np.lib._iotools.flatten_dtype(dt)
+    [dtype('S4'), dtype('float64'), dtype('float64'), dtype('int64')]
+    >>> np.lib._iotools.flatten_dtype(dt, flatten_base=True)
+    [dtype('S4'),
+     dtype('float64'),
+     dtype('float64'),
+     dtype('int64'),
+     dtype('int64'),
+     dtype('int64'),
+     dtype('int64'),
+     dtype('int64'),
+     dtype('int64')]
+
+    """
+    names = ndtype.names
+    if names is None:
+        if flatten_base:
+            return [ndtype.base] * int(np.prod(ndtype.shape))
+        return [ndtype.base]
+    else:
+        types = []
+        for field in names:
+            info = ndtype.fields[field]
+            flat_dt = flatten_dtype(info[0], flatten_base)
+            types.extend(flat_dt)
+        return types
+
+
+class LineSplitter:
+    """
+    Object to split a string at a given delimiter or at given places.
+
+    Parameters
+    ----------
+    delimiter : str, int, or sequence of ints, optional
+        If a string, character used to delimit consecutive fields.
+        If an integer or a sequence of integers, width(s) of each field.
+    comments : str, optional
+        Character used to mark the beginning of a comment. Default is '#'.
+    autostrip : bool, optional
+        Whether to strip each individual field. Default is True.
+
+    """
+
+    def autostrip(self, method):
+        """
+        Wrapper to strip each member of the output of `method`.
+
+        Parameters
+        ----------
+        method : function
+            Function that takes a single argument and returns a sequence of
+            strings.
+
+        Returns
+        -------
+        wrapped : function
+            The result of wrapping `method`. `wrapped` takes a single input
+            argument and returns a list of strings that are stripped of
+            white-space.
+
+        """
+        return lambda input: [_.strip() for _ in method(input)]
+
+    def __init__(self, delimiter=None, comments='#', autostrip=True,
+                 encoding=None):
+        delimiter = _decode_line(delimiter)
+        comments = _decode_line(comments)
+
+        self.comments = comments
+
+        # Delimiter is a character
+        if (delimiter is None) or isinstance(delimiter, str):
+            delimiter = delimiter or None
+            _handyman = self._delimited_splitter
+        # Delimiter is a list of field widths
+        elif hasattr(delimiter, '__iter__'):
+            _handyman = self._variablewidth_splitter
+            idx = np.cumsum([0] + list(delimiter))
+            delimiter = [slice(i, j) for (i, j) in zip(idx[:-1], idx[1:])]
+        # Delimiter is a single integer
+        elif int(delimiter):
+            (_handyman, delimiter) = (
+                    self._fixedwidth_splitter, int(delimiter))
+        else:
+            (_handyman, delimiter) = (self._delimited_splitter, None)
+        self.delimiter = delimiter
+        if autostrip:
+            self._handyman = self.autostrip(_handyman)
+        else:
+            self._handyman = _handyman
+        self.encoding = encoding
+
+    def _delimited_splitter(self, line):
+        """Chop off comments, strip, and split at delimiter. """
+        if self.comments is not None:
+            line = line.split(self.comments)[0]
+        line = line.strip(" \r\n")
+        if not line:
+            return []
+        return line.split(self.delimiter)
+
+    def _fixedwidth_splitter(self, line):
+        if self.comments is not None:
+            line = line.split(self.comments)[0]
+        line = line.strip("\r\n")
+        if not line:
+            return []
+        fixed = self.delimiter
+        slices = [slice(i, i + fixed) for i in range(0, len(line), fixed)]
+        return [line[s] for s in slices]
+
+    def _variablewidth_splitter(self, line):
+        if self.comments is not None:
+            line = line.split(self.comments)[0]
+        if not line:
+            return []
+        slices = self.delimiter
+        return [line[s] for s in slices]
+
+    def __call__(self, line):
+        return self._handyman(_decode_line(line, self.encoding))
+
+
+class NameValidator:
+    """
+    Object to validate a list of strings to use as field names.
+
+    The strings are stripped of any non alphanumeric character, and spaces
+    are replaced by '_'. During instantiation, the user can define a list
+    of names to exclude, as well as a list of invalid characters. Names in
+    the exclusion list are appended a '_' character.
+
+    Once an instance has been created, it can be called with a list of
+    names, and a list of valid names will be created.  The `__call__`
+    method accepts an optional keyword "default" that sets the default name
+    in case of ambiguity. By default this is 'f', so that names will
+    default to `f0`, `f1`, etc.
+
+    Parameters
+    ----------
+    excludelist : sequence, optional
+        A list of names to exclude. This list is appended to the default
+        list ['return', 'file', 'print']. Excluded names are appended an
+        underscore: for example, `file` becomes `file_` if supplied.
+    deletechars : str, optional
+        A string combining invalid characters that must be deleted from the
+        names.
+    case_sensitive : {True, False, 'upper', 'lower'}, optional
+        * If True, field names are case-sensitive.
+        * If False or 'upper', field names are converted to upper case.
+        * If 'lower', field names are converted to lower case.
+
+        The default value is True.
+    replace_space : '_', optional
+        Character(s) used in replacement of white spaces.
+
+    Notes
+    -----
+    Calling an instance of `NameValidator` is the same as calling its
+    method `validate`.
+
+    Examples
+    --------
+    >>> validator = np.lib._iotools.NameValidator()
+    >>> validator(['file', 'field2', 'with space', 'CaSe'])
+    ('file_', 'field2', 'with_space', 'CaSe')
+
+    >>> validator = np.lib._iotools.NameValidator(excludelist=['excl'],
+    ...                                           deletechars='q',
+    ...                                           case_sensitive=False)
+    >>> validator(['excl', 'field2', 'no_q', 'with space', 'CaSe'])
+    ('EXCL', 'FIELD2', 'NO_Q', 'WITH_SPACE', 'CASE')
+
+    """
+
+    defaultexcludelist = ['return', 'file', 'print']
+    defaultdeletechars = set(r"""~!@#$%^&*()-=+~\|]}[{';: /?.>,<""")
+
+    def __init__(self, excludelist=None, deletechars=None,
+                 case_sensitive=None, replace_space='_'):
+        # Process the exclusion list ..
+        if excludelist is None:
+            excludelist = []
+        excludelist.extend(self.defaultexcludelist)
+        self.excludelist = excludelist
+        # Process the list of characters to delete
+        if deletechars is None:
+            delete = self.defaultdeletechars
+        else:
+            delete = set(deletechars)
+        delete.add('"')
+        self.deletechars = delete
+        # Process the case option .....
+        if (case_sensitive is None) or (case_sensitive is True):
+            self.case_converter = lambda x: x
+        elif (case_sensitive is False) or case_sensitive.startswith('u'):
+            self.case_converter = lambda x: x.upper()
+        elif case_sensitive.startswith('l'):
+            self.case_converter = lambda x: x.lower()
+        else:
+            msg = 'unrecognized case_sensitive value %s.' % case_sensitive
+            raise ValueError(msg)
+
+        self.replace_space = replace_space
+
+    def validate(self, names, defaultfmt="f%i", nbfields=None):
+        """
+        Validate a list of strings as field names for a structured array.
+
+        Parameters
+        ----------
+        names : sequence of str
+            Strings to be validated.
+        defaultfmt : str, optional
+            Default format string, used if validating a given string
+            reduces its length to zero.
+        nbfields : integer, optional
+            Final number of validated names, used to expand or shrink the
+            initial list of names.
+
+        Returns
+        -------
+        validatednames : list of str
+            The list of validated field names.
+
+        Notes
+        -----
+        A `NameValidator` instance can be called directly, which is the
+        same as calling `validate`. For examples, see `NameValidator`.
+
+        """
+        # Initial checks ..............
+        if (names is None):
+            if (nbfields is None):
+                return None
+            names = []
+        if isinstance(names, str):
+            names = [names, ]
+        if nbfields is not None:
+            nbnames = len(names)
+            if (nbnames < nbfields):
+                names = list(names) + [''] * (nbfields - nbnames)
+            elif (nbnames > nbfields):
+                names = names[:nbfields]
+        # Set some shortcuts ...........
+        deletechars = self.deletechars
+        excludelist = self.excludelist
+        case_converter = self.case_converter
+        replace_space = self.replace_space
+        # Initializes some variables ...
+        validatednames = []
+        seen = dict()
+        nbempty = 0
+
+        for item in names:
+            item = case_converter(item).strip()
+            if replace_space:
+                item = item.replace(' ', replace_space)
+            item = ''.join([c for c in item if c not in deletechars])
+            if item == '':
+                item = defaultfmt % nbempty
+                while item in names:
+                    nbempty += 1
+                    item = defaultfmt % nbempty
+                nbempty += 1
+            elif item in excludelist:
+                item += '_'
+            cnt = seen.get(item, 0)
+            if cnt > 0:
+                validatednames.append(item + '_%d' % cnt)
+            else:
+                validatednames.append(item)
+            seen[item] = cnt + 1
+        return tuple(validatednames)
+
+    def __call__(self, names, defaultfmt="f%i", nbfields=None):
+        return self.validate(names, defaultfmt=defaultfmt, nbfields=nbfields)
+
+
+def str2bool(value):
+    """
+    Tries to transform a string supposed to represent a boolean to a boolean.
+
+    Parameters
+    ----------
+    value : str
+        The string that is transformed to a boolean.
+
+    Returns
+    -------
+    boolval : bool
+        The boolean representation of `value`.
+
+    Raises
+    ------
+    ValueError
+        If the string is not 'True' or 'False' (case independent)
+
+    Examples
+    --------
+    >>> np.lib._iotools.str2bool('TRUE')
+    True
+    >>> np.lib._iotools.str2bool('false')
+    False
+
+    """
+    value = value.upper()
+    if value == 'TRUE':
+        return True
+    elif value == 'FALSE':
+        return False
+    else:
+        raise ValueError("Invalid boolean")
+
+
+class ConverterError(Exception):
+    """
+    Exception raised when an error occurs in a converter for string values.
+
+    """
+    pass
+
+
+class ConverterLockError(ConverterError):
+    """
+    Exception raised when an attempt is made to upgrade a locked converter.
+
+    """
+    pass
+
+
+class ConversionWarning(UserWarning):
+    """
+    Warning issued when a string converter has a problem.
+
+    Notes
+    -----
+    In `genfromtxt` a `ConversionWarning` is issued if raising exceptions
+    is explicitly suppressed with the "invalid_raise" keyword.
+
+    """
+    pass
+
+
+class StringConverter:
+    """
+    Factory class for function transforming a string into another object
+    (int, float).
+
+    After initialization, an instance can be called to transform a string
+    into another object. If the string is recognized as representing a
+    missing value, a default value is returned.
+
+    Attributes
+    ----------
+    func : function
+        Function used for the conversion.
+    default : any
+        Default value to return when the input corresponds to a missing
+        value.
+    type : type
+        Type of the output.
+    _status : int
+        Integer representing the order of the conversion.
+    _mapper : sequence of tuples
+        Sequence of tuples (dtype, function, default value) to evaluate in
+        order.
+    _locked : bool
+        Holds `locked` parameter.
+
+    Parameters
+    ----------
+    dtype_or_func : {None, dtype, function}, optional
+        If a `dtype`, specifies the input data type, used to define a basic
+        function and a default value for missing data. For example, when
+        `dtype` is float, the `func` attribute is set to `float` and the
+        default value to `np.nan`.  If a function, this function is used to
+        convert a string to another object. In this case, it is recommended
+        to give an associated default value as input.
+    default : any, optional
+        Value to return by default, that is, when the string to be
+        converted is flagged as missing. If not given, `StringConverter`
+        tries to supply a reasonable default value.
+    missing_values : {None, sequence of str}, optional
+        ``None`` or sequence of strings indicating a missing value. If ``None``
+        then missing values are indicated by empty entries. The default is
+        ``None``.
+    locked : bool, optional
+        Whether the StringConverter should be locked to prevent automatic
+        upgrade or not. Default is False.
+
+    """
+    _mapper = [(nx.bool_, str2bool, False),
+               (nx.int_, int, -1),]
+
+    # On 32-bit systems, we need to make sure that we explicitly include
+    # nx.int64 since ns.int_ is nx.int32.
+    if nx.dtype(nx.int_).itemsize < nx.dtype(nx.int64).itemsize:
+        _mapper.append((nx.int64, int, -1))
+
+    _mapper.extend([(nx.float64, float, nx.nan),
+                    (nx.complex128, complex, nx.nan + 0j),
+                    (nx.longdouble, nx.longdouble, nx.nan),
+                    # If a non-default dtype is passed, fall back to generic
+                    # ones (should only be used for the converter)
+                    (nx.integer, int, -1),
+                    (nx.floating, float, nx.nan),
+                    (nx.complexfloating, complex, nx.nan + 0j),
+                    # Last, try with the string types (must be last, because
+                    # `_mapper[-1]` is used as default in some cases)
+                    (nx.unicode_, asunicode, '???'),
+                    (nx.string_, asbytes, '???'),
+                    ])
+
+    @classmethod
+    def _getdtype(cls, val):
+        """Returns the dtype of the input variable."""
+        return np.array(val).dtype
+
+    @classmethod
+    def _getsubdtype(cls, val):
+        """Returns the type of the dtype of the input variable."""
+        return np.array(val).dtype.type
+
+    @classmethod
+    def _dtypeortype(cls, dtype):
+        """Returns dtype for datetime64 and type of dtype otherwise."""
+
+        # This is a bit annoying. We want to return the "general" type in most
+        # cases (ie. "string" rather than "S10"), but we want to return the
+        # specific type for datetime64 (ie. "datetime64[us]" rather than
+        # "datetime64").
+        if dtype.type == np.datetime64:
+            return dtype
+        return dtype.type
+
+    @classmethod
+    def upgrade_mapper(cls, func, default=None):
+        """
+        Upgrade the mapper of a StringConverter by adding a new function and
+        its corresponding default.
+
+        The input function (or sequence of functions) and its associated
+        default value (if any) is inserted in penultimate position of the
+        mapper.  The corresponding type is estimated from the dtype of the
+        default value.
+
+        Parameters
+        ----------
+        func : var
+            Function, or sequence of functions
+
+        Examples
+        --------
+        >>> import dateutil.parser
+        >>> import datetime
+        >>> dateparser = dateutil.parser.parse
+        >>> defaultdate = datetime.date(2000, 1, 1)
+        >>> StringConverter.upgrade_mapper(dateparser, default=defaultdate)
+        """
+        # Func is a single functions
+        if hasattr(func, '__call__'):
+            cls._mapper.insert(-1, (cls._getsubdtype(default), func, default))
+            return
+        elif hasattr(func, '__iter__'):
+            if isinstance(func[0], (tuple, list)):
+                for _ in func:
+                    cls._mapper.insert(-1, _)
+                return
+            if default is None:
+                default = [None] * len(func)
+            else:
+                default = list(default)
+                default.append([None] * (len(func) - len(default)))
+            for fct, dft in zip(func, default):
+                cls._mapper.insert(-1, (cls._getsubdtype(dft), fct, dft))
+
+    @classmethod
+    def _find_map_entry(cls, dtype):
+        # if a converter for the specific dtype is available use that
+        for i, (deftype, func, default_def) in enumerate(cls._mapper):
+            if dtype.type == deftype:
+                return i, (deftype, func, default_def)
+
+        # otherwise find an inexact match
+        for i, (deftype, func, default_def) in enumerate(cls._mapper):
+            if np.issubdtype(dtype.type, deftype):
+                return i, (deftype, func, default_def)
+
+        raise LookupError
+
+    def __init__(self, dtype_or_func=None, default=None, missing_values=None,
+                 locked=False):
+        # Defines a lock for upgrade
+        self._locked = bool(locked)
+        # No input dtype: minimal initialization
+        if dtype_or_func is None:
+            self.func = str2bool
+            self._status = 0
+            self.default = default or False
+            dtype = np.dtype('bool')
+        else:
+            # Is the input a np.dtype ?
+            try:
+                self.func = None
+                dtype = np.dtype(dtype_or_func)
+            except TypeError:
+                # dtype_or_func must be a function, then
+                if not hasattr(dtype_or_func, '__call__'):
+                    errmsg = ("The input argument `dtype` is neither a"
+                              " function nor a dtype (got '%s' instead)")
+                    raise TypeError(errmsg % type(dtype_or_func))
+                # Set the function
+                self.func = dtype_or_func
+                # If we don't have a default, try to guess it or set it to
+                # None
+                if default is None:
+                    try:
+                        default = self.func('0')
+                    except ValueError:
+                        default = None
+                dtype = self._getdtype(default)
+
+            # find the best match in our mapper
+            try:
+                self._status, (_, func, default_def) = self._find_map_entry(dtype)
+            except LookupError:
+                # no match
+                self.default = default
+                _, func, _ = self._mapper[-1]
+                self._status = 0
+            else:
+                # use the found default only if we did not already have one
+                if default is None:
+                    self.default = default_def
+                else:
+                    self.default = default
+
+            # If the input was a dtype, set the function to the last we saw
+            if self.func is None:
+                self.func = func
+
+            # If the status is 1 (int), change the function to
+            # something more robust.
+            if self.func == self._mapper[1][1]:
+                if issubclass(dtype.type, np.uint64):
+                    self.func = np.uint64
+                elif issubclass(dtype.type, np.int64):
+                    self.func = np.int64
+                else:
+                    self.func = lambda x: int(float(x))
+        # Store the list of strings corresponding to missing values.
+        if missing_values is None:
+            self.missing_values = {''}
+        else:
+            if isinstance(missing_values, str):
+                missing_values = missing_values.split(",")
+            self.missing_values = set(list(missing_values) + [''])
+
+        self._callingfunction = self._strict_call
+        self.type = self._dtypeortype(dtype)
+        self._checked = False
+        self._initial_default = default
+
+    def _loose_call(self, value):
+        try:
+            return self.func(value)
+        except ValueError:
+            return self.default
+
+    def _strict_call(self, value):
+        try:
+
+            # We check if we can convert the value using the current function
+            new_value = self.func(value)
+
+            # In addition to having to check whether func can convert the
+            # value, we also have to make sure that we don't get overflow
+            # errors for integers.
+            if self.func is int:
+                try:
+                    np.array(value, dtype=self.type)
+                except OverflowError:
+                    raise ValueError
+
+            # We're still here so we can now return the new value
+            return new_value
+
+        except ValueError:
+            if value.strip() in self.missing_values:
+                if not self._status:
+                    self._checked = False
+                return self.default
+            raise ValueError("Cannot convert string '%s'" % value)
+
+    def __call__(self, value):
+        return self._callingfunction(value)
+
+    def _do_upgrade(self):
+        # Raise an exception if we locked the converter...
+        if self._locked:
+            errmsg = "Converter is locked and cannot be upgraded"
+            raise ConverterLockError(errmsg)
+        _statusmax = len(self._mapper)
+        # Complains if we try to upgrade by the maximum
+        _status = self._status
+        if _status == _statusmax:
+            errmsg = "Could not find a valid conversion function"
+            raise ConverterError(errmsg)
+        elif _status < _statusmax - 1:
+            _status += 1
+        self.type, self.func, default = self._mapper[_status]
+        self._status = _status
+        if self._initial_default is not None:
+            self.default = self._initial_default
+        else:
+            self.default = default
+
+    def upgrade(self, value):
+        """
+        Find the best converter for a given string, and return the result.
+
+        The supplied string `value` is converted by testing different
+        converters in order. First the `func` method of the
+        `StringConverter` instance is tried, if this fails other available
+        converters are tried.  The order in which these other converters
+        are tried is determined by the `_status` attribute of the instance.
+
+        Parameters
+        ----------
+        value : str
+            The string to convert.
+
+        Returns
+        -------
+        out : any
+            The result of converting `value` with the appropriate converter.
+
+        """
+        self._checked = True
+        try:
+            return self._strict_call(value)
+        except ValueError:
+            self._do_upgrade()
+            return self.upgrade(value)
+
+    def iterupgrade(self, value):
+        self._checked = True
+        if not hasattr(value, '__iter__'):
+            value = (value,)
+        _strict_call = self._strict_call
+        try:
+            for _m in value:
+                _strict_call(_m)
+        except ValueError:
+            self._do_upgrade()
+            self.iterupgrade(value)
+
+    def update(self, func, default=None, testing_value=None,
+               missing_values='', locked=False):
+        """
+        Set StringConverter attributes directly.
+
+        Parameters
+        ----------
+        func : function
+            Conversion function.
+        default : any, optional
+            Value to return by default, that is, when the string to be
+            converted is flagged as missing. If not given,
+            `StringConverter` tries to supply a reasonable default value.
+        testing_value : str, optional
+            A string representing a standard input value of the converter.
+            This string is used to help defining a reasonable default
+            value.
+        missing_values : {sequence of str, None}, optional
+            Sequence of strings indicating a missing value. If ``None``, then
+            the existing `missing_values` are cleared. The default is `''`.
+        locked : bool, optional
+            Whether the StringConverter should be locked to prevent
+            automatic upgrade or not. Default is False.
+
+        Notes
+        -----
+        `update` takes the same parameters as the constructor of
+        `StringConverter`, except that `func` does not accept a `dtype`
+        whereas `dtype_or_func` in the constructor does.
+
+        """
+        self.func = func
+        self._locked = locked
+
+        # Don't reset the default to None if we can avoid it
+        if default is not None:
+            self.default = default
+            self.type = self._dtypeortype(self._getdtype(default))
+        else:
+            try:
+                tester = func(testing_value or '1')
+            except (TypeError, ValueError):
+                tester = None
+            self.type = self._dtypeortype(self._getdtype(tester))
+
+        # Add the missing values to the existing set or clear it.
+        if missing_values is None:
+            # Clear all missing values even though the ctor initializes it to
+            # set(['']) when the argument is None.
+            self.missing_values = set()
+        else:
+            if not np.iterable(missing_values):
+                missing_values = [missing_values]
+            if not all(isinstance(v, str) for v in missing_values):
+                raise TypeError("missing_values must be strings or unicode")
+            self.missing_values.update(missing_values)
+
+
+def easy_dtype(ndtype, names=None, defaultfmt="f%i", **validationargs):
+    """
+    Convenience function to create a `np.dtype` object.
+
+    The function processes the input `dtype` and matches it with the given
+    names.
+
+    Parameters
+    ----------
+    ndtype : var
+        Definition of the dtype. Can be any string or dictionary recognized
+        by the `np.dtype` function, or a sequence of types.
+    names : str or sequence, optional
+        Sequence of strings to use as field names for a structured dtype.
+        For convenience, `names` can be a string of a comma-separated list
+        of names.
+    defaultfmt : str, optional
+        Format string used to define missing names, such as ``"f%i"``
+        (default) or ``"fields_%02i"``.
+    validationargs : optional
+        A series of optional arguments used to initialize a
+        `NameValidator`.
+
+    Examples
+    --------
+    >>> np.lib._iotools.easy_dtype(float)
+    dtype('float64')
+    >>> np.lib._iotools.easy_dtype("i4, f8")
+    dtype([('f0', '<i4'), ('f1', '<f8')])
+    >>> np.lib._iotools.easy_dtype("i4, f8", defaultfmt="field_%03i")
+    dtype([('field_000', '<i4'), ('field_001', '<f8')])
+
+    >>> np.lib._iotools.easy_dtype((int, float, float), names="a,b,c")
+    dtype([('a', '<i8'), ('b', '<f8'), ('c', '<f8')])
+    >>> np.lib._iotools.easy_dtype(float, names="a,b,c")
+    dtype([('a', '<f8'), ('b', '<f8'), ('c', '<f8')])
+
+    """
+    try:
+        ndtype = np.dtype(ndtype)
+    except TypeError:
+        validate = NameValidator(**validationargs)
+        nbfields = len(ndtype)
+        if names is None:
+            names = [''] * len(ndtype)
+        elif isinstance(names, str):
+            names = names.split(",")
+        names = validate(names, nbfields=nbfields, defaultfmt=defaultfmt)
+        ndtype = np.dtype(dict(formats=ndtype, names=names))
+    else:
+        # Explicit names
+        if names is not None:
+            validate = NameValidator(**validationargs)
+            if isinstance(names, str):
+                names = names.split(",")
+            # Simple dtype: repeat to match the nb of names
+            if ndtype.names is None:
+                formats = tuple([ndtype.type] * len(names))
+                names = validate(names, defaultfmt=defaultfmt)
+                ndtype = np.dtype(list(zip(names, formats)))
+            # Structured dtype: just validate the names as needed
+            else:
+                ndtype.names = validate(names, nbfields=len(ndtype.names),
+                                        defaultfmt=defaultfmt)
+        # No implicit names
+        elif ndtype.names is not None:
+            validate = NameValidator(**validationargs)
+            # Default initial names : should we change the format ?
+            numbered_names = tuple("f%i" % i for i in range(len(ndtype.names)))
+            if ((ndtype.names == numbered_names) and (defaultfmt != "f%i")):
+                ndtype.names = validate([''] * len(ndtype.names),
+                                        defaultfmt=defaultfmt)
+            # Explicit initial names : just validate
+            else:
+                ndtype.names = validate(ndtype.names, defaultfmt=defaultfmt)
+    return ndtype

.CondaPkg/env/Lib/site-packages/numpy/lib/_version.py

@@ -0,0 +1,155 @@
+"""Utility to compare (NumPy) version strings.
+
+The NumpyVersion class allows properly comparing numpy version strings.
+The LooseVersion and StrictVersion classes that distutils provides don't
+work; they don't recognize anything like alpha/beta/rc/dev versions.
+
+"""
+import re
+
+
+__all__ = ['NumpyVersion']
+
+
+class NumpyVersion():
+    """Parse and compare numpy version strings.
+
+    NumPy has the following versioning scheme (numbers given are examples; they
+    can be > 9 in principle):
+
+    - Released version: '1.8.0', '1.8.1', etc.
+    - Alpha: '1.8.0a1', '1.8.0a2', etc.
+    - Beta: '1.8.0b1', '1.8.0b2', etc.
+    - Release candidates: '1.8.0rc1', '1.8.0rc2', etc.
+    - Development versions: '1.8.0.dev-f1234afa' (git commit hash appended)
+    - Development versions after a1: '1.8.0a1.dev-f1234afa',
+                                     '1.8.0b2.dev-f1234afa',
+                                     '1.8.1rc1.dev-f1234afa', etc.
+    - Development versions (no git hash available): '1.8.0.dev-Unknown'
+
+    Comparing needs to be done against a valid version string or other
+    `NumpyVersion` instance. Note that all development versions of the same
+    (pre-)release compare equal.
+
+    .. versionadded:: 1.9.0
+
+    Parameters
+    ----------
+    vstring : str
+        NumPy version string (``np.__version__``).
+
+    Examples
+    --------
+    >>> from numpy.lib import NumpyVersion
+    >>> if NumpyVersion(np.__version__) < '1.7.0':
+    ...     print('skip')
+    >>> # skip
+
+    >>> NumpyVersion('1.7')  # raises ValueError, add ".0"
+    Traceback (most recent call last):
+        ...
+    ValueError: Not a valid numpy version string
+
+    """
+
+    def __init__(self, vstring):
+        self.vstring = vstring
+        ver_main = re.match(r'\d+\.\d+\.\d+', vstring)
+        if not ver_main:
+            raise ValueError("Not a valid numpy version string")
+
+        self.version = ver_main.group()
+        self.major, self.minor, self.bugfix = [int(x) for x in
+            self.version.split('.')]
+        if len(vstring) == ver_main.end():
+            self.pre_release = 'final'
+        else:
+            alpha = re.match(r'a\d', vstring[ver_main.end():])
+            beta = re.match(r'b\d', vstring[ver_main.end():])
+            rc = re.match(r'rc\d', vstring[ver_main.end():])
+            pre_rel = [m for m in [alpha, beta, rc] if m is not None]
+            if pre_rel:
+                self.pre_release = pre_rel[0].group()
+            else:
+                self.pre_release = ''
+
+        self.is_devversion = bool(re.search(r'.dev', vstring))
+
+    def _compare_version(self, other):
+        """Compare major.minor.bugfix"""
+        if self.major == other.major:
+            if self.minor == other.minor:
+                if self.bugfix == other.bugfix:
+                    vercmp = 0
+                elif self.bugfix > other.bugfix:
+                    vercmp = 1
+                else:
+                    vercmp = -1
+            elif self.minor > other.minor:
+                vercmp = 1
+            else:
+                vercmp = -1
+        elif self.major > other.major:
+            vercmp = 1
+        else:
+            vercmp = -1
+
+        return vercmp
+
+    def _compare_pre_release(self, other):
+        """Compare alpha/beta/rc/final."""
+        if self.pre_release == other.pre_release:
+            vercmp = 0
+        elif self.pre_release == 'final':
+            vercmp = 1
+        elif other.pre_release == 'final':
+            vercmp = -1
+        elif self.pre_release > other.pre_release:
+            vercmp = 1
+        else:
+            vercmp = -1
+
+        return vercmp
+
+    def _compare(self, other):
+        if not isinstance(other, (str, NumpyVersion)):
+            raise ValueError("Invalid object to compare with NumpyVersion.")
+
+        if isinstance(other, str):
+            other = NumpyVersion(other)
+
+        vercmp = self._compare_version(other)
+        if vercmp == 0:
+            # Same x.y.z version, check for alpha/beta/rc
+            vercmp = self._compare_pre_release(other)
+            if vercmp == 0:
+                # Same version and same pre-release, check if dev version
+                if self.is_devversion is other.is_devversion:
+                    vercmp = 0
+                elif self.is_devversion:
+                    vercmp = -1
+                else:
+                    vercmp = 1
+
+        return vercmp
+
+    def __lt__(self, other):
+        return self._compare(other) < 0
+
+    def __le__(self, other):
+        return self._compare(other) <= 0
+
+    def __eq__(self, other):
+        return self._compare(other) == 0
+
+    def __ne__(self, other):
+        return self._compare(other) != 0
+
+    def __gt__(self, other):
+        return self._compare(other) > 0
+
+    def __ge__(self, other):
+        return self._compare(other) >= 0
+
+    def __repr__(self):
+        return "NumpyVersion(%s)" % self.vstring

.CondaPkg/env/Lib/site-packages/numpy/lib/_version.pyi

@@ -0,0 +1,17 @@
+__all__: list[str]
+
+class NumpyVersion:
+    vstring: str
+    version: str
+    major: int
+    minor: int
+    bugfix: int
+    pre_release: str
+    is_devversion: bool
+    def __init__(self, vstring: str) -> None: ...
+    def __lt__(self, other: str | NumpyVersion) -> bool: ...
+    def __le__(self, other: str | NumpyVersion) -> bool: ...
+    def __eq__(self, other: str | NumpyVersion) -> bool: ...  # type: ignore[override]
+    def __ne__(self, other: str | NumpyVersion) -> bool: ...  # type: ignore[override]
+    def __gt__(self, other: str | NumpyVersion) -> bool: ...
+    def __ge__(self, other: str | NumpyVersion) -> bool: ...

.CondaPkg/env/Lib/site-packages/numpy/lib/arraypad.py

@@ -0,0 +1,877 @@
+"""
+The arraypad module contains a group of functions to pad values onto the edges
+of an n-dimensional array.
+
+"""
+import numpy as np
+from numpy.core.overrides import array_function_dispatch
+from numpy.lib.index_tricks import ndindex
+
+
+__all__ = ['pad']
+
+
+###############################################################################
+# Private utility functions.
+
+
+def _round_if_needed(arr, dtype):
+    """
+    Rounds arr inplace if destination dtype is integer.
+
+    Parameters
+    ----------
+    arr : ndarray
+        Input array.
+    dtype : dtype
+        The dtype of the destination array.
+    """
+    if np.issubdtype(dtype, np.integer):
+        arr.round(out=arr)
+
+
+def _slice_at_axis(sl, axis):
+    """
+    Construct tuple of slices to slice an array in the given dimension.
+
+    Parameters
+    ----------
+    sl : slice
+        The slice for the given dimension.
+    axis : int
+        The axis to which `sl` is applied. All other dimensions are left
+        "unsliced".
+
+    Returns
+    -------
+    sl : tuple of slices
+        A tuple with slices matching `shape` in length.
+
+    Examples
+    --------
+    >>> _slice_at_axis(slice(None, 3, -1), 1)
+    (slice(None, None, None), slice(None, 3, -1), (...,))
+    """
+    return (slice(None),) * axis + (sl,) + (...,)
+
+
+def _view_roi(array, original_area_slice, axis):
+    """
+    Get a view of the current region of interest during iterative padding.
+
+    When padding multiple dimensions iteratively corner values are
+    unnecessarily overwritten multiple times. This function reduces the
+    working area for the first dimensions so that corners are excluded.
+
+    Parameters
+    ----------
+    array : ndarray
+        The array with the region of interest.
+    original_area_slice : tuple of slices
+        Denotes the area with original values of the unpadded array.
+    axis : int
+        The currently padded dimension assuming that `axis` is padded before
+        `axis` + 1.
+
+    Returns
+    -------
+    roi : ndarray
+        The region of interest of the original `array`.
+    """
+    axis += 1
+    sl = (slice(None),) * axis + original_area_slice[axis:]
+    return array[sl]
+
+
+def _pad_simple(array, pad_width, fill_value=None):
+    """
+    Pad array on all sides with either a single value or undefined values.
+
+    Parameters
+    ----------
+    array : ndarray
+        Array to grow.
+    pad_width : sequence of tuple[int, int]
+        Pad width on both sides for each dimension in `arr`.
+    fill_value : scalar, optional
+        If provided the padded area is filled with this value, otherwise
+        the pad area left undefined.
+
+    Returns
+    -------
+    padded : ndarray
+        The padded array with the same dtype as`array`. Its order will default
+        to C-style if `array` is not F-contiguous.
+    original_area_slice : tuple
+        A tuple of slices pointing to the area of the original array.
+    """
+    # Allocate grown array
+    new_shape = tuple(
+        left + size + right
+        for size, (left, right) in zip(array.shape, pad_width)
+    )
+    order = 'F' if array.flags.fnc else 'C'  # Fortran and not also C-order
+    padded = np.empty(new_shape, dtype=array.dtype, order=order)
+
+    if fill_value is not None:
+        padded.fill(fill_value)
+
+    # Copy old array into correct space
+    original_area_slice = tuple(
+        slice(left, left + size)
+        for size, (left, right) in zip(array.shape, pad_width)
+    )
+    padded[original_area_slice] = array
+
+    return padded, original_area_slice
+
+
+def _set_pad_area(padded, axis, width_pair, value_pair):
+    """
+    Set empty-padded area in given dimension.
+
+    Parameters
+    ----------
+    padded : ndarray
+        Array with the pad area which is modified inplace.
+    axis : int
+        Dimension with the pad area to set.
+    width_pair : (int, int)
+        Pair of widths that mark the pad area on both sides in the given
+        dimension.
+    value_pair : tuple of scalars or ndarrays
+        Values inserted into the pad area on each side. It must match or be
+        broadcastable to the shape of `arr`.
+    """
+    left_slice = _slice_at_axis(slice(None, width_pair[0]), axis)
+    padded[left_slice] = value_pair[0]
+
+    right_slice = _slice_at_axis(
+        slice(padded.shape[axis] - width_pair[1], None), axis)
+    padded[right_slice] = value_pair[1]
+
+
+def _get_edges(padded, axis, width_pair):
+    """
+    Retrieve edge values from empty-padded array in given dimension.
+
+    Parameters
+    ----------
+    padded : ndarray
+        Empty-padded array.
+    axis : int
+        Dimension in which the edges are considered.
+    width_pair : (int, int)
+        Pair of widths that mark the pad area on both sides in the given
+        dimension.
+
+    Returns
+    -------
+    left_edge, right_edge : ndarray
+        Edge values of the valid area in `padded` in the given dimension. Its
+        shape will always match `padded` except for the dimension given by
+        `axis` which will have a length of 1.
+    """
+    left_index = width_pair[0]
+    left_slice = _slice_at_axis(slice(left_index, left_index + 1), axis)
+    left_edge = padded[left_slice]
+
+    right_index = padded.shape[axis] - width_pair[1]
+    right_slice = _slice_at_axis(slice(right_index - 1, right_index), axis)
+    right_edge = padded[right_slice]
+
+    return left_edge, right_edge
+
+
+def _get_linear_ramps(padded, axis, width_pair, end_value_pair):
+    """
+    Construct linear ramps for empty-padded array in given dimension.
+
+    Parameters
+    ----------
+    padded : ndarray
+        Empty-padded array.
+    axis : int
+        Dimension in which the ramps are constructed.
+    width_pair : (int, int)
+        Pair of widths that mark the pad area on both sides in the given
+        dimension.
+    end_value_pair : (scalar, scalar)
+        End values for the linear ramps which form the edge of the fully padded
+        array. These values are included in the linear ramps.
+
+    Returns
+    -------
+    left_ramp, right_ramp : ndarray
+        Linear ramps to set on both sides of `padded`.
+    """
+    edge_pair = _get_edges(padded, axis, width_pair)
+
+    left_ramp, right_ramp = (
+        np.linspace(
+            start=end_value,
+            stop=edge.squeeze(axis), # Dimension is replaced by linspace
+            num=width,
+            endpoint=False,
+            dtype=padded.dtype,
+            axis=axis
+        )
+        for end_value, edge, width in zip(
+            end_value_pair, edge_pair, width_pair
+        )
+    )
+        
+    # Reverse linear space in appropriate dimension
+    right_ramp = right_ramp[_slice_at_axis(slice(None, None, -1), axis)]
+
+    return left_ramp, right_ramp
+
+
+def _get_stats(padded, axis, width_pair, length_pair, stat_func):
+    """
+    Calculate statistic for the empty-padded array in given dimension.
+
+    Parameters
+    ----------
+    padded : ndarray
+        Empty-padded array.
+    axis : int
+        Dimension in which the statistic is calculated.
+    width_pair : (int, int)
+        Pair of widths that mark the pad area on both sides in the given
+        dimension.
+    length_pair : 2-element sequence of None or int
+        Gives the number of values in valid area from each side that is
+        taken into account when calculating the statistic. If None the entire
+        valid area in `padded` is considered.
+    stat_func : function
+        Function to compute statistic. The expected signature is
+        ``stat_func(x: ndarray, axis: int, keepdims: bool) -> ndarray``.
+
+    Returns
+    -------
+    left_stat, right_stat : ndarray
+        Calculated statistic for both sides of `padded`.
+    """
+    # Calculate indices of the edges of the area with original values
+    left_index = width_pair[0]
+    right_index = padded.shape[axis] - width_pair[1]
+    # as well as its length
+    max_length = right_index - left_index
+
+    # Limit stat_lengths to max_length
+    left_length, right_length = length_pair
+    if left_length is None or max_length < left_length:
+        left_length = max_length
+    if right_length is None or max_length < right_length:
+        right_length = max_length
+
+    if (left_length == 0 or right_length == 0) \
+            and stat_func in {np.amax, np.amin}:
+        # amax and amin can't operate on an empty array,
+        # raise a more descriptive warning here instead of the default one
+        raise ValueError("stat_length of 0 yields no value for padding")
+
+    # Calculate statistic for the left side
+    left_slice = _slice_at_axis(
+        slice(left_index, left_index + left_length), axis)
+    left_chunk = padded[left_slice]
+    left_stat = stat_func(left_chunk, axis=axis, keepdims=True)
+    _round_if_needed(left_stat, padded.dtype)
+
+    if left_length == right_length == max_length:
+        # return early as right_stat must be identical to left_stat
+        return left_stat, left_stat
+
+    # Calculate statistic for the right side
+    right_slice = _slice_at_axis(
+        slice(right_index - right_length, right_index), axis)
+    right_chunk = padded[right_slice]
+    right_stat = stat_func(right_chunk, axis=axis, keepdims=True)
+    _round_if_needed(right_stat, padded.dtype)
+
+    return left_stat, right_stat
+
+
+def _set_reflect_both(padded, axis, width_pair, method, include_edge=False):
+    """
+    Pad `axis` of `arr` with reflection.
+
+    Parameters
+    ----------
+    padded : ndarray
+        Input array of arbitrary shape.
+    axis : int
+        Axis along which to pad `arr`.
+    width_pair : (int, int)
+        Pair of widths that mark the pad area on both sides in the given
+        dimension.
+    method : str
+        Controls method of reflection; options are 'even' or 'odd'.
+    include_edge : bool
+        If true, edge value is included in reflection, otherwise the edge
+        value forms the symmetric axis to the reflection.
+
+    Returns
+    -------
+    pad_amt : tuple of ints, length 2
+        New index positions of padding to do along the `axis`. If these are
+        both 0, padding is done in this dimension.
+    """
+    left_pad, right_pad = width_pair
+    old_length = padded.shape[axis] - right_pad - left_pad
+
+    if include_edge:
+        # Edge is included, we need to offset the pad amount by 1
+        edge_offset = 1
+    else:
+        edge_offset = 0  # Edge is not included, no need to offset pad amount
+        old_length -= 1  # but must be omitted from the chunk
+
+    if left_pad > 0:
+        # Pad with reflected values on left side:
+        # First limit chunk size which can't be larger than pad area
+        chunk_length = min(old_length, left_pad)
+        # Slice right to left, stop on or next to edge, start relative to stop
+        stop = left_pad - edge_offset
+        start = stop + chunk_length
+        left_slice = _slice_at_axis(slice(start, stop, -1), axis)
+        left_chunk = padded[left_slice]
+
+        if method == "odd":
+            # Negate chunk and align with edge
+            edge_slice = _slice_at_axis(slice(left_pad, left_pad + 1), axis)
+            left_chunk = 2 * padded[edge_slice] - left_chunk
+
+        # Insert chunk into padded area
+        start = left_pad - chunk_length
+        stop = left_pad
+        pad_area = _slice_at_axis(slice(start, stop), axis)
+        padded[pad_area] = left_chunk
+        # Adjust pointer to left edge for next iteration
+        left_pad -= chunk_length
+
+    if right_pad > 0:
+        # Pad with reflected values on right side:
+        # First limit chunk size which can't be larger than pad area
+        chunk_length = min(old_length, right_pad)
+        # Slice right to left, start on or next to edge, stop relative to start
+        start = -right_pad + edge_offset - 2
+        stop = start - chunk_length
+        right_slice = _slice_at_axis(slice(start, stop, -1), axis)
+        right_chunk = padded[right_slice]
+
+        if method == "odd":
+            # Negate chunk and align with edge
+            edge_slice = _slice_at_axis(
+                slice(-right_pad - 1, -right_pad), axis)
+            right_chunk = 2 * padded[edge_slice] - right_chunk
+
+        # Insert chunk into padded area
+        start = padded.shape[axis] - right_pad
+        stop = start + chunk_length
+        pad_area = _slice_at_axis(slice(start, stop), axis)
+        padded[pad_area] = right_chunk
+        # Adjust pointer to right edge for next iteration
+        right_pad -= chunk_length
+
+    return left_pad, right_pad
+
+
+def _set_wrap_both(padded, axis, width_pair):
+    """
+    Pad `axis` of `arr` with wrapped values.
+
+    Parameters
+    ----------
+    padded : ndarray
+        Input array of arbitrary shape.
+    axis : int
+        Axis along which to pad `arr`.
+    width_pair : (int, int)
+        Pair of widths that mark the pad area on both sides in the given
+        dimension.
+
+    Returns
+    -------
+    pad_amt : tuple of ints, length 2
+        New index positions of padding to do along the `axis`. If these are
+        both 0, padding is done in this dimension.
+    """
+    left_pad, right_pad = width_pair
+    period = padded.shape[axis] - right_pad - left_pad
+
+    # If the current dimension of `arr` doesn't contain enough valid values
+    # (not part of the undefined pad area) we need to pad multiple times.
+    # Each time the pad area shrinks on both sides which is communicated with
+    # these variables.
+    new_left_pad = 0
+    new_right_pad = 0
+
+    if left_pad > 0:
+        # Pad with wrapped values on left side
+        # First slice chunk from right side of the non-pad area.
+        # Use min(period, left_pad) to ensure that chunk is not larger than
+        # pad area
+        right_slice = _slice_at_axis(
+            slice(-right_pad - min(period, left_pad),
+                  -right_pad if right_pad != 0 else None),
+            axis
+        )
+        right_chunk = padded[right_slice]
+
+        if left_pad > period:
+            # Chunk is smaller than pad area
+            pad_area = _slice_at_axis(slice(left_pad - period, left_pad), axis)
+            new_left_pad = left_pad - period
+        else:
+            # Chunk matches pad area
+            pad_area = _slice_at_axis(slice(None, left_pad), axis)
+        padded[pad_area] = right_chunk
+
+    if right_pad > 0:
+        # Pad with wrapped values on right side
+        # First slice chunk from left side of the non-pad area.
+        # Use min(period, right_pad) to ensure that chunk is not larger than
+        # pad area
+        left_slice = _slice_at_axis(
+            slice(left_pad, left_pad + min(period, right_pad),), axis)
+        left_chunk = padded[left_slice]
+
+        if right_pad > period:
+            # Chunk is smaller than pad area
+            pad_area = _slice_at_axis(
+                slice(-right_pad, -right_pad + period), axis)
+            new_right_pad = right_pad - period
+        else:
+            # Chunk matches pad area
+            pad_area = _slice_at_axis(slice(-right_pad, None), axis)
+        padded[pad_area] = left_chunk
+
+    return new_left_pad, new_right_pad
+
+
+def _as_pairs(x, ndim, as_index=False):
+    """
+    Broadcast `x` to an array with the shape (`ndim`, 2).
+
+    A helper function for `pad` that prepares and validates arguments like
+    `pad_width` for iteration in pairs.
+
+    Parameters
+    ----------
+    x : {None, scalar, array-like}
+        The object to broadcast to the shape (`ndim`, 2).
+    ndim : int
+        Number of pairs the broadcasted `x` will have.
+    as_index : bool, optional
+        If `x` is not None, try to round each element of `x` to an integer
+        (dtype `np.intp`) and ensure every element is positive.
+
+    Returns
+    -------
+    pairs : nested iterables, shape (`ndim`, 2)
+        The broadcasted version of `x`.
+
+    Raises
+    ------
+    ValueError
+        If `as_index` is True and `x` contains negative elements.
+        Or if `x` is not broadcastable to the shape (`ndim`, 2).
+    """
+    if x is None:
+        # Pass through None as a special case, otherwise np.round(x) fails
+        # with an AttributeError
+        return ((None, None),) * ndim
+
+    x = np.array(x)
+    if as_index:
+        x = np.round(x).astype(np.intp, copy=False)
+
+    if x.ndim < 3:
+        # Optimization: Possibly use faster paths for cases where `x` has
+        # only 1 or 2 elements. `np.broadcast_to` could handle these as well
+        # but is currently slower
+
+        if x.size == 1:
+            # x was supplied as a single value
+            x = x.ravel()  # Ensure x[0] works for x.ndim == 0, 1, 2
+            if as_index and x < 0:
+                raise ValueError("index can't contain negative values")
+            return ((x[0], x[0]),) * ndim
+
+        if x.size == 2 and x.shape != (2, 1):
+            # x was supplied with a single value for each side
+            # but except case when each dimension has a single value
+            # which should be broadcasted to a pair,
+            # e.g. [[1], [2]] -> [[1, 1], [2, 2]] not [[1, 2], [1, 2]]
+            x = x.ravel()  # Ensure x[0], x[1] works
+            if as_index and (x[0] < 0 or x[1] < 0):
+                raise ValueError("index can't contain negative values")
+            return ((x[0], x[1]),) * ndim
+
+    if as_index and x.min() < 0:
+        raise ValueError("index can't contain negative values")
+
+    # Converting the array with `tolist` seems to improve performance
+    # when iterating and indexing the result (see usage in `pad`)
+    return np.broadcast_to(x, (ndim, 2)).tolist()
+
+
+def _pad_dispatcher(array, pad_width, mode=None, **kwargs):
+    return (array,)
+
+
+###############################################################################
+# Public functions
+
+
+@array_function_dispatch(_pad_dispatcher, module='numpy')
+def pad(array, pad_width, mode='constant', **kwargs):
+    """
+    Pad an array.
+
+    Parameters
+    ----------
+    array : array_like of rank N
+        The array to pad.
+    pad_width : {sequence, array_like, int}
+        Number of values padded to the edges of each axis.
+        ``((before_1, after_1), ... (before_N, after_N))`` unique pad widths
+        for each axis.
+        ``(before, after)`` or ``((before, after),)`` yields same before
+        and after pad for each axis.
+        ``(pad,)`` or ``int`` is a shortcut for before = after = pad width
+        for all axes.
+    mode : str or function, optional
+        One of the following string values or a user supplied function.
+
+        'constant' (default)
+            Pads with a constant value.
+        'edge'
+            Pads with the edge values of array.
+        'linear_ramp'
+            Pads with the linear ramp between end_value and the
+            array edge value.
+        'maximum'
+            Pads with the maximum value of all or part of the
+            vector along each axis.
+        'mean'
+            Pads with the mean value of all or part of the
+            vector along each axis.
+        'median'
+            Pads with the median value of all or part of the
+            vector along each axis.
+        'minimum'
+            Pads with the minimum value of all or part of the
+            vector along each axis.
+        'reflect'
+            Pads with the reflection of the vector mirrored on
+            the first and last values of the vector along each
+            axis.
+        'symmetric'
+            Pads with the reflection of the vector mirrored
+            along the edge of the array.
+        'wrap'
+            Pads with the wrap of the vector along the axis.
+            The first values are used to pad the end and the
+            end values are used to pad the beginning.
+        'empty'
+            Pads with undefined values.
+
+            .. versionadded:: 1.17
+
+        <function>
+            Padding function, see Notes.
+    stat_length : sequence or int, optional
+        Used in 'maximum', 'mean', 'median', and 'minimum'.  Number of
+        values at edge of each axis used to calculate the statistic value.
+
+        ``((before_1, after_1), ... (before_N, after_N))`` unique statistic
+        lengths for each axis.
+
+        ``(before, after)`` or ``((before, after),)`` yields same before
+        and after statistic lengths for each axis.
+
+        ``(stat_length,)`` or ``int`` is a shortcut for
+        ``before = after = statistic`` length for all axes.
+
+        Default is ``None``, to use the entire axis.
+    constant_values : sequence or scalar, optional
+        Used in 'constant'.  The values to set the padded values for each
+        axis.
+
+        ``((before_1, after_1), ... (before_N, after_N))`` unique pad constants
+        for each axis.
+
+        ``(before, after)`` or ``((before, after),)`` yields same before
+        and after constants for each axis.
+
+        ``(constant,)`` or ``constant`` is a shortcut for
+        ``before = after = constant`` for all axes.
+
+        Default is 0.
+    end_values : sequence or scalar, optional
+        Used in 'linear_ramp'.  The values used for the ending value of the
+        linear_ramp and that will form the edge of the padded array.
+
+        ``((before_1, after_1), ... (before_N, after_N))`` unique end values
+        for each axis.
+
+        ``(before, after)`` or ``((before, after),)`` yields same before
+        and after end values for each axis.
+
+        ``(constant,)`` or ``constant`` is a shortcut for
+        ``before = after = constant`` for all axes.
+
+        Default is 0.
+    reflect_type : {'even', 'odd'}, optional
+        Used in 'reflect', and 'symmetric'.  The 'even' style is the
+        default with an unaltered reflection around the edge value.  For
+        the 'odd' style, the extended part of the array is created by
+        subtracting the reflected values from two times the edge value.
+
+    Returns
+    -------
+    pad : ndarray
+        Padded array of rank equal to `array` with shape increased
+        according to `pad_width`.
+
+    Notes
+    -----
+    .. versionadded:: 1.7.0
+
+    For an array with rank greater than 1, some of the padding of later
+    axes is calculated from padding of previous axes.  This is easiest to
+    think about with a rank 2 array where the corners of the padded array
+    are calculated by using padded values from the first axis.
+
+    The padding function, if used, should modify a rank 1 array in-place. It
+    has the following signature::
+
+        padding_func(vector, iaxis_pad_width, iaxis, kwargs)
+
+    where
+
+        vector : ndarray
+            A rank 1 array already padded with zeros.  Padded values are
+            vector[:iaxis_pad_width[0]] and vector[-iaxis_pad_width[1]:].
+        iaxis_pad_width : tuple
+            A 2-tuple of ints, iaxis_pad_width[0] represents the number of
+            values padded at the beginning of vector where
+            iaxis_pad_width[1] represents the number of values padded at
+            the end of vector.
+        iaxis : int
+            The axis currently being calculated.
+        kwargs : dict
+            Any keyword arguments the function requires.
+
+    Examples
+    --------
+    >>> a = [1, 2, 3, 4, 5]
+    >>> np.pad(a, (2, 3), 'constant', constant_values=(4, 6))
+    array([4, 4, 1, ..., 6, 6, 6])
+
+    >>> np.pad(a, (2, 3), 'edge')
+    array([1, 1, 1, ..., 5, 5, 5])
+
+    >>> np.pad(a, (2, 3), 'linear_ramp', end_values=(5, -4))
+    array([ 5,  3,  1,  2,  3,  4,  5,  2, -1, -4])
+
+    >>> np.pad(a, (2,), 'maximum')
+    array([5, 5, 1, 2, 3, 4, 5, 5, 5])
+
+    >>> np.pad(a, (2,), 'mean')
+    array([3, 3, 1, 2, 3, 4, 5, 3, 3])
+
+    >>> np.pad(a, (2,), 'median')
+    array([3, 3, 1, 2, 3, 4, 5, 3, 3])
+
+    >>> a = [[1, 2], [3, 4]]
+    >>> np.pad(a, ((3, 2), (2, 3)), 'minimum')
+    array([[1, 1, 1, 2, 1, 1, 1],
+           [1, 1, 1, 2, 1, 1, 1],
+           [1, 1, 1, 2, 1, 1, 1],
+           [1, 1, 1, 2, 1, 1, 1],
+           [3, 3, 3, 4, 3, 3, 3],
+           [1, 1, 1, 2, 1, 1, 1],
+           [1, 1, 1, 2, 1, 1, 1]])
+
+    >>> a = [1, 2, 3, 4, 5]
+    >>> np.pad(a, (2, 3), 'reflect')
+    array([3, 2, 1, 2, 3, 4, 5, 4, 3, 2])
+
+    >>> np.pad(a, (2, 3), 'reflect', reflect_type='odd')
+    array([-1,  0,  1,  2,  3,  4,  5,  6,  7,  8])
+
+    >>> np.pad(a, (2, 3), 'symmetric')
+    array([2, 1, 1, 2, 3, 4, 5, 5, 4, 3])
+
+    >>> np.pad(a, (2, 3), 'symmetric', reflect_type='odd')
+    array([0, 1, 1, 2, 3, 4, 5, 5, 6, 7])
+
+    >>> np.pad(a, (2, 3), 'wrap')
+    array([4, 5, 1, 2, 3, 4, 5, 1, 2, 3])
+
+    >>> def pad_with(vector, pad_width, iaxis, kwargs):
+    ...     pad_value = kwargs.get('padder', 10)
+    ...     vector[:pad_width[0]] = pad_value
+    ...     vector[-pad_width[1]:] = pad_value
+    >>> a = np.arange(6)
+    >>> a = a.reshape((2, 3))
+    >>> np.pad(a, 2, pad_with)
+    array([[10, 10, 10, 10, 10, 10, 10],
+           [10, 10, 10, 10, 10, 10, 10],
+           [10, 10,  0,  1,  2, 10, 10],
+           [10, 10,  3,  4,  5, 10, 10],
+           [10, 10, 10, 10, 10, 10, 10],
+           [10, 10, 10, 10, 10, 10, 10]])
+    >>> np.pad(a, 2, pad_with, padder=100)
+    array([[100, 100, 100, 100, 100, 100, 100],
+           [100, 100, 100, 100, 100, 100, 100],
+           [100, 100,   0,   1,   2, 100, 100],
+           [100, 100,   3,   4,   5, 100, 100],
+           [100, 100, 100, 100, 100, 100, 100],
+           [100, 100, 100, 100, 100, 100, 100]])
+    """
+    array = np.asarray(array)
+    pad_width = np.asarray(pad_width)
+
+    if not pad_width.dtype.kind == 'i':
+        raise TypeError('`pad_width` must be of integral type.')
+
+    # Broadcast to shape (array.ndim, 2)
+    pad_width = _as_pairs(pad_width, array.ndim, as_index=True)
+
+    if callable(mode):
+        # Old behavior: Use user-supplied function with np.apply_along_axis
+        function = mode
+        # Create a new zero padded array
+        padded, _ = _pad_simple(array, pad_width, fill_value=0)
+        # And apply along each axis
+
+        for axis in range(padded.ndim):
+            # Iterate using ndindex as in apply_along_axis, but assuming that
+            # function operates inplace on the padded array.
+
+            # view with the iteration axis at the end
+            view = np.moveaxis(padded, axis, -1)
+
+            # compute indices for the iteration axes, and append a trailing
+            # ellipsis to prevent 0d arrays decaying to scalars (gh-8642)
+            inds = ndindex(view.shape[:-1])
+            inds = (ind + (Ellipsis,) for ind in inds)
+            for ind in inds:
+                function(view[ind], pad_width[axis], axis, kwargs)
+
+        return padded
+
+    # Make sure that no unsupported keywords were passed for the current mode
+    allowed_kwargs = {
+        'empty': [], 'edge': [], 'wrap': [],
+        'constant': ['constant_values'],
+        'linear_ramp': ['end_values'],
+        'maximum': ['stat_length'],
+        'mean': ['stat_length'],
+        'median': ['stat_length'],
+        'minimum': ['stat_length'],
+        'reflect': ['reflect_type'],
+        'symmetric': ['reflect_type'],
+    }
+    try:
+        unsupported_kwargs = set(kwargs) - set(allowed_kwargs[mode])
+    except KeyError:
+        raise ValueError("mode '{}' is not supported".format(mode)) from None
+    if unsupported_kwargs:
+        raise ValueError("unsupported keyword arguments for mode '{}': {}"
+                         .format(mode, unsupported_kwargs))
+
+    stat_functions = {"maximum": np.amax, "minimum": np.amin,
+                      "mean": np.mean, "median": np.median}
+
+    # Create array with final shape and original values
+    # (padded area is undefined)
+    padded, original_area_slice = _pad_simple(array, pad_width)
+    # And prepare iteration over all dimensions
+    # (zipping may be more readable than using enumerate)
+    axes = range(padded.ndim)
+
+    if mode == "constant":
+        values = kwargs.get("constant_values", 0)
+        values = _as_pairs(values, padded.ndim)
+        for axis, width_pair, value_pair in zip(axes, pad_width, values):
+            roi = _view_roi(padded, original_area_slice, axis)
+            _set_pad_area(roi, axis, width_pair, value_pair)
+
+    elif mode == "empty":
+        pass  # Do nothing as _pad_simple already returned the correct result
+
+    elif array.size == 0:
+        # Only modes "constant" and "empty" can extend empty axes, all other
+        # modes depend on `array` not being empty
+        # -> ensure every empty axis is only "padded with 0"
+        for axis, width_pair in zip(axes, pad_width):
+            if array.shape[axis] == 0 and any(width_pair):
+                raise ValueError(
+                    "can't extend empty axis {} using modes other than "
+                    "'constant' or 'empty'".format(axis)
+                )
+        # passed, don't need to do anything more as _pad_simple already
+        # returned the correct result
+
+    elif mode == "edge":
+        for axis, width_pair in zip(axes, pad_width):
+            roi = _view_roi(padded, original_area_slice, axis)
+            edge_pair = _get_edges(roi, axis, width_pair)
+            _set_pad_area(roi, axis, width_pair, edge_pair)
+
+    elif mode == "linear_ramp":
+        end_values = kwargs.get("end_values", 0)
+        end_values = _as_pairs(end_values, padded.ndim)
+        for axis, width_pair, value_pair in zip(axes, pad_width, end_values):
+            roi = _view_roi(padded, original_area_slice, axis)
+            ramp_pair = _get_linear_ramps(roi, axis, width_pair, value_pair)
+            _set_pad_area(roi, axis, width_pair, ramp_pair)
+
+    elif mode in stat_functions:
+        func = stat_functions[mode]
+        length = kwargs.get("stat_length", None)
+        length = _as_pairs(length, padded.ndim, as_index=True)
+        for axis, width_pair, length_pair in zip(axes, pad_width, length):
+            roi = _view_roi(padded, original_area_slice, axis)
+            stat_pair = _get_stats(roi, axis, width_pair, length_pair, func)
+            _set_pad_area(roi, axis, width_pair, stat_pair)
+
+    elif mode in {"reflect", "symmetric"}:
+        method = kwargs.get("reflect_type", "even")
+        include_edge = True if mode == "symmetric" else False
+        for axis, (left_index, right_index) in zip(axes, pad_width):
+            if array.shape[axis] == 1 and (left_index > 0 or right_index > 0):
+                # Extending singleton dimension for 'reflect' is legacy
+                # behavior; it really should raise an error.
+                edge_pair = _get_edges(padded, axis, (left_index, right_index))
+                _set_pad_area(
+                    padded, axis, (left_index, right_index), edge_pair)
+                continue
+
+            roi = _view_roi(padded, original_area_slice, axis)
+            while left_index > 0 or right_index > 0:
+                # Iteratively pad until dimension is filled with reflected
+                # values. This is necessary if the pad area is larger than
+                # the length of the original values in the current dimension.
+                left_index, right_index = _set_reflect_both(
+                    roi, axis, (left_index, right_index),
+                    method, include_edge
+                )
+
+    elif mode == "wrap":
+        for axis, (left_index, right_index) in zip(axes, pad_width):
+            roi = _view_roi(padded, original_area_slice, axis)
+            while left_index > 0 or right_index > 0:
+                # Iteratively pad until dimension is filled with wrapped
+                # values. This is necessary if the pad area is larger than
+                # the length of the original values in the current dimension.
+                left_index, right_index = _set_wrap_both(
+                    roi, axis, (left_index, right_index))
+
+    return padded

.CondaPkg/env/Lib/site-packages/numpy/lib/arraypad.pyi

@@ -0,0 +1,85 @@
+from typing import (
+    Literal as L,
+    Any,
+    overload,
+    TypeVar,
+    Protocol,
+)
+
+from numpy import generic
+
+from numpy._typing import (
+    ArrayLike,
+    NDArray,
+    _ArrayLikeInt,
+    _ArrayLike,
+)
+
+_SCT = TypeVar("_SCT", bound=generic)
+
+class _ModeFunc(Protocol):
+    def __call__(
+        self,
+        vector: NDArray[Any],
+        iaxis_pad_width: tuple[int, int],
+        iaxis: int,
+        kwargs: dict[str, Any],
+        /,
+    ) -> None: ...
+
+_ModeKind = L[
+    "constant",
+    "edge",
+    "linear_ramp",
+    "maximum",
+    "mean",
+    "median",
+    "minimum",
+    "reflect",
+    "symmetric",
+    "wrap",
+    "empty",
+]
+
+__all__: list[str]
+
+# TODO: In practice each keyword argument is exclusive to one or more
+# specific modes. Consider adding more overloads to express this in the future.
+
+# Expand `**kwargs` into explicit keyword-only arguments
+@overload
+def pad(
+    array: _ArrayLike[_SCT],
+    pad_width: _ArrayLikeInt,
+    mode: _ModeKind = ...,
+    *,
+    stat_length: None | _ArrayLikeInt = ...,
+    constant_values: ArrayLike = ...,
+    end_values: ArrayLike = ...,
+    reflect_type: L["odd", "even"] = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def pad(
+    array: ArrayLike,
+    pad_width: _ArrayLikeInt,
+    mode: _ModeKind = ...,
+    *,
+    stat_length: None | _ArrayLikeInt = ...,
+    constant_values: ArrayLike = ...,
+    end_values: ArrayLike = ...,
+    reflect_type: L["odd", "even"] = ...,
+) -> NDArray[Any]: ...
+@overload
+def pad(
+    array: _ArrayLike[_SCT],
+    pad_width: _ArrayLikeInt,
+    mode: _ModeFunc,
+    **kwargs: Any,
+) -> NDArray[_SCT]: ...
+@overload
+def pad(
+    array: ArrayLike,
+    pad_width: _ArrayLikeInt,
+    mode: _ModeFunc,
+    **kwargs: Any,
+) -> NDArray[Any]: ...

.CondaPkg/env/Lib/site-packages/numpy/lib/arraysetops.py

@@ -0,0 +1,981 @@
+"""
+Set operations for arrays based on sorting.
+
+Notes
+-----
+
+For floating point arrays, inaccurate results may appear due to usual round-off
+and floating point comparison issues.
+
+Speed could be gained in some operations by an implementation of
+`numpy.sort`, that can provide directly the permutation vectors, thus avoiding
+calls to `numpy.argsort`.
+
+Original author: Robert Cimrman
+
+"""
+import functools
+
+import numpy as np
+from numpy.core import overrides
+
+
+array_function_dispatch = functools.partial(
+    overrides.array_function_dispatch, module='numpy')
+
+
+__all__ = [
+    'ediff1d', 'intersect1d', 'setxor1d', 'union1d', 'setdiff1d', 'unique',
+    'in1d', 'isin'
+    ]
+
+
+def _ediff1d_dispatcher(ary, to_end=None, to_begin=None):
+    return (ary, to_end, to_begin)
+
+
+@array_function_dispatch(_ediff1d_dispatcher)
+def ediff1d(ary, to_end=None, to_begin=None):
+    """
+    The differences between consecutive elements of an array.
+
+    Parameters
+    ----------
+    ary : array_like
+        If necessary, will be flattened before the differences are taken.
+    to_end : array_like, optional
+        Number(s) to append at the end of the returned differences.
+    to_begin : array_like, optional
+        Number(s) to prepend at the beginning of the returned differences.
+
+    Returns
+    -------
+    ediff1d : ndarray
+        The differences. Loosely, this is ``ary.flat[1:] - ary.flat[:-1]``.
+
+    See Also
+    --------
+    diff, gradient
+
+    Notes
+    -----
+    When applied to masked arrays, this function drops the mask information
+    if the `to_begin` and/or `to_end` parameters are used.
+
+    Examples
+    --------
+    >>> x = np.array([1, 2, 4, 7, 0])
+    >>> np.ediff1d(x)
+    array([ 1,  2,  3, -7])
+
+    >>> np.ediff1d(x, to_begin=-99, to_end=np.array([88, 99]))
+    array([-99,   1,   2, ...,  -7,  88,  99])
+
+    The returned array is always 1D.
+
+    >>> y = [[1, 2, 4], [1, 6, 24]]
+    >>> np.ediff1d(y)
+    array([ 1,  2, -3,  5, 18])
+
+    """
+    # force a 1d array
+    ary = np.asanyarray(ary).ravel()
+
+    # enforce that the dtype of `ary` is used for the output
+    dtype_req = ary.dtype
+
+    # fast track default case
+    if to_begin is None and to_end is None:
+        return ary[1:] - ary[:-1]
+
+    if to_begin is None:
+        l_begin = 0
+    else:
+        to_begin = np.asanyarray(to_begin)
+        if not np.can_cast(to_begin, dtype_req, casting="same_kind"):
+            raise TypeError("dtype of `to_begin` must be compatible "
+                            "with input `ary` under the `same_kind` rule.")
+
+        to_begin = to_begin.ravel()
+        l_begin = len(to_begin)
+
+    if to_end is None:
+        l_end = 0
+    else:
+        to_end = np.asanyarray(to_end)
+        if not np.can_cast(to_end, dtype_req, casting="same_kind"):
+            raise TypeError("dtype of `to_end` must be compatible "
+                            "with input `ary` under the `same_kind` rule.")
+
+        to_end = to_end.ravel()
+        l_end = len(to_end)
+
+    # do the calculation in place and copy to_begin and to_end
+    l_diff = max(len(ary) - 1, 0)
+    result = np.empty(l_diff + l_begin + l_end, dtype=ary.dtype)
+    result = ary.__array_wrap__(result)
+    if l_begin > 0:
+        result[:l_begin] = to_begin
+    if l_end > 0:
+        result[l_begin + l_diff:] = to_end
+    np.subtract(ary[1:], ary[:-1], result[l_begin:l_begin + l_diff])
+    return result
+
+
+def _unpack_tuple(x):
+    """ Unpacks one-element tuples for use as return values """
+    if len(x) == 1:
+        return x[0]
+    else:
+        return x
+
+
+def _unique_dispatcher(ar, return_index=None, return_inverse=None,
+                       return_counts=None, axis=None, *, equal_nan=None):
+    return (ar,)
+
+
+@array_function_dispatch(_unique_dispatcher)
+def unique(ar, return_index=False, return_inverse=False,
+           return_counts=False, axis=None, *, equal_nan=True):
+    """
+    Find the unique elements of an array.
+
+    Returns the sorted unique elements of an array. There are three optional
+    outputs in addition to the unique elements:
+
+    * the indices of the input array that give the unique values
+    * the indices of the unique array that reconstruct the input array
+    * the number of times each unique value comes up in the input array
+
+    Parameters
+    ----------
+    ar : array_like
+        Input array. Unless `axis` is specified, this will be flattened if it
+        is not already 1-D.
+    return_index : bool, optional
+        If True, also return the indices of `ar` (along the specified axis,
+        if provided, or in the flattened array) that result in the unique array.
+    return_inverse : bool, optional
+        If True, also return the indices of the unique array (for the specified
+        axis, if provided) that can be used to reconstruct `ar`.
+    return_counts : bool, optional
+        If True, also return the number of times each unique item appears
+        in `ar`.
+    axis : int or None, optional
+        The axis to operate on. If None, `ar` will be flattened. If an integer,
+        the subarrays indexed by the given axis will be flattened and treated
+        as the elements of a 1-D array with the dimension of the given axis,
+        see the notes for more details.  Object arrays or structured arrays
+        that contain objects are not supported if the `axis` kwarg is used. The
+        default is None.
+
+        .. versionadded:: 1.13.0
+
+    equal_nan : bool, optional
+        If True, collapses multiple NaN values in the return array into one.
+
+        .. versionadded:: 1.24
+
+    Returns
+    -------
+    unique : ndarray
+        The sorted unique values.
+    unique_indices : ndarray, optional
+        The indices of the first occurrences of the unique values in the
+        original array. Only provided if `return_index` is True.
+    unique_inverse : ndarray, optional
+        The indices to reconstruct the original array from the
+        unique array. Only provided if `return_inverse` is True.
+    unique_counts : ndarray, optional
+        The number of times each of the unique values comes up in the
+        original array. Only provided if `return_counts` is True.
+
+        .. versionadded:: 1.9.0
+
+    See Also
+    --------
+    numpy.lib.arraysetops : Module with a number of other functions for
+                            performing set operations on arrays.
+    repeat : Repeat elements of an array.
+
+    Notes
+    -----
+    When an axis is specified the subarrays indexed by the axis are sorted.
+    This is done by making the specified axis the first dimension of the array
+    (move the axis to the first dimension to keep the order of the other axes)
+    and then flattening the subarrays in C order. The flattened subarrays are
+    then viewed as a structured type with each element given a label, with the
+    effect that we end up with a 1-D array of structured types that can be
+    treated in the same way as any other 1-D array. The result is that the
+    flattened subarrays are sorted in lexicographic order starting with the
+    first element.
+
+    .. versionchanged: NumPy 1.21
+        If nan values are in the input array, a single nan is put
+        to the end of the sorted unique values.
+
+        Also for complex arrays all NaN values are considered equivalent
+        (no matter whether the NaN is in the real or imaginary part).
+        As the representant for the returned array the smallest one in the
+        lexicographical order is chosen - see np.sort for how the lexicographical
+        order is defined for complex arrays.
+
+    Examples
+    --------
+    >>> np.unique([1, 1, 2, 2, 3, 3])
+    array([1, 2, 3])
+    >>> a = np.array([[1, 1], [2, 3]])
+    >>> np.unique(a)
+    array([1, 2, 3])
+
+    Return the unique rows of a 2D array
+
+    >>> a = np.array([[1, 0, 0], [1, 0, 0], [2, 3, 4]])
+    >>> np.unique(a, axis=0)
+    array([[1, 0, 0], [2, 3, 4]])
+
+    Return the indices of the original array that give the unique values:
+
+    >>> a = np.array(['a', 'b', 'b', 'c', 'a'])
+    >>> u, indices = np.unique(a, return_index=True)
+    >>> u
+    array(['a', 'b', 'c'], dtype='<U1')
+    >>> indices
+    array([0, 1, 3])
+    >>> a[indices]
+    array(['a', 'b', 'c'], dtype='<U1')
+
+    Reconstruct the input array from the unique values and inverse:
+
+    >>> a = np.array([1, 2, 6, 4, 2, 3, 2])
+    >>> u, indices = np.unique(a, return_inverse=True)
+    >>> u
+    array([1, 2, 3, 4, 6])
+    >>> indices
+    array([0, 1, 4, 3, 1, 2, 1])
+    >>> u[indices]
+    array([1, 2, 6, 4, 2, 3, 2])
+
+    Reconstruct the input values from the unique values and counts:
+
+    >>> a = np.array([1, 2, 6, 4, 2, 3, 2])
+    >>> values, counts = np.unique(a, return_counts=True)
+    >>> values
+    array([1, 2, 3, 4, 6])
+    >>> counts
+    array([1, 3, 1, 1, 1])
+    >>> np.repeat(values, counts)
+    array([1, 2, 2, 2, 3, 4, 6])    # original order not preserved
+
+    """
+    ar = np.asanyarray(ar)
+    if axis is None:
+        ret = _unique1d(ar, return_index, return_inverse, return_counts, 
+                        equal_nan=equal_nan)
+        return _unpack_tuple(ret)
+
+    # axis was specified and not None
+    try:
+        ar = np.moveaxis(ar, axis, 0)
+    except np.AxisError:
+        # this removes the "axis1" or "axis2" prefix from the error message
+        raise np.AxisError(axis, ar.ndim) from None
+
+    # Must reshape to a contiguous 2D array for this to work...
+    orig_shape, orig_dtype = ar.shape, ar.dtype
+    ar = ar.reshape(orig_shape[0], np.prod(orig_shape[1:], dtype=np.intp))
+    ar = np.ascontiguousarray(ar)
+    dtype = [('f{i}'.format(i=i), ar.dtype) for i in range(ar.shape[1])]
+
+    # At this point, `ar` has shape `(n, m)`, and `dtype` is a structured
+    # data type with `m` fields where each field has the data type of `ar`.
+    # In the following, we create the array `consolidated`, which has
+    # shape `(n,)` with data type `dtype`.
+    try:
+        if ar.shape[1] > 0:
+            consolidated = ar.view(dtype)
+        else:
+            # If ar.shape[1] == 0, then dtype will be `np.dtype([])`, which is
+            # a data type with itemsize 0, and the call `ar.view(dtype)` will
+            # fail.  Instead, we'll use `np.empty` to explicitly create the
+            # array with shape `(len(ar),)`.  Because `dtype` in this case has
+            # itemsize 0, the total size of the result is still 0 bytes.
+            consolidated = np.empty(len(ar), dtype=dtype)
+    except TypeError as e:
+        # There's no good way to do this for object arrays, etc...
+        msg = 'The axis argument to unique is not supported for dtype {dt}'
+        raise TypeError(msg.format(dt=ar.dtype)) from e
+
+    def reshape_uniq(uniq):
+        n = len(uniq)
+        uniq = uniq.view(orig_dtype)
+        uniq = uniq.reshape(n, *orig_shape[1:])
+        uniq = np.moveaxis(uniq, 0, axis)
+        return uniq
+
+    output = _unique1d(consolidated, return_index,
+                       return_inverse, return_counts, equal_nan=equal_nan)
+    output = (reshape_uniq(output[0]),) + output[1:]
+    return _unpack_tuple(output)
+
+
+def _unique1d(ar, return_index=False, return_inverse=False,
+              return_counts=False, *, equal_nan=True):
+    """
+    Find the unique elements of an array, ignoring shape.
+    """
+    ar = np.asanyarray(ar).flatten()
+
+    optional_indices = return_index or return_inverse
+
+    if optional_indices:
+        perm = ar.argsort(kind='mergesort' if return_index else 'quicksort')
+        aux = ar[perm]
+    else:
+        ar.sort()
+        aux = ar
+    mask = np.empty(aux.shape, dtype=np.bool_)
+    mask[:1] = True
+    if (equal_nan and aux.shape[0] > 0 and aux.dtype.kind in "cfmM" and
+            np.isnan(aux[-1])):
+        if aux.dtype.kind == "c":  # for complex all NaNs are considered equivalent
+            aux_firstnan = np.searchsorted(np.isnan(aux), True, side='left')
+        else:
+            aux_firstnan = np.searchsorted(aux, aux[-1], side='left')
+        if aux_firstnan > 0:
+            mask[1:aux_firstnan] = (
+                aux[1:aux_firstnan] != aux[:aux_firstnan - 1])
+        mask[aux_firstnan] = True
+        mask[aux_firstnan + 1:] = False
+    else:
+        mask[1:] = aux[1:] != aux[:-1]
+
+    ret = (aux[mask],)
+    if return_index:
+        ret += (perm[mask],)
+    if return_inverse:
+        imask = np.cumsum(mask) - 1
+        inv_idx = np.empty(mask.shape, dtype=np.intp)
+        inv_idx[perm] = imask
+        ret += (inv_idx,)
+    if return_counts:
+        idx = np.concatenate(np.nonzero(mask) + ([mask.size],))
+        ret += (np.diff(idx),)
+    return ret
+
+
+def _intersect1d_dispatcher(
+        ar1, ar2, assume_unique=None, return_indices=None):
+    return (ar1, ar2)
+
+
+@array_function_dispatch(_intersect1d_dispatcher)
+def intersect1d(ar1, ar2, assume_unique=False, return_indices=False):
+    """
+    Find the intersection of two arrays.
+
+    Return the sorted, unique values that are in both of the input arrays.
+
+    Parameters
+    ----------
+    ar1, ar2 : array_like
+        Input arrays. Will be flattened if not already 1D.
+    assume_unique : bool
+        If True, the input arrays are both assumed to be unique, which
+        can speed up the calculation.  If True but ``ar1`` or ``ar2`` are not
+        unique, incorrect results and out-of-bounds indices could result.
+        Default is False.
+    return_indices : bool
+        If True, the indices which correspond to the intersection of the two
+        arrays are returned. The first instance of a value is used if there are
+        multiple. Default is False.
+
+        .. versionadded:: 1.15.0
+
+    Returns
+    -------
+    intersect1d : ndarray
+        Sorted 1D array of common and unique elements.
+    comm1 : ndarray
+        The indices of the first occurrences of the common values in `ar1`.
+        Only provided if `return_indices` is True.
+    comm2 : ndarray
+        The indices of the first occurrences of the common values in `ar2`.
+        Only provided if `return_indices` is True.
+
+
+    See Also
+    --------
+    numpy.lib.arraysetops : Module with a number of other functions for
+                            performing set operations on arrays.
+
+    Examples
+    --------
+    >>> np.intersect1d([1, 3, 4, 3], [3, 1, 2, 1])
+    array([1, 3])
+
+    To intersect more than two arrays, use functools.reduce:
+
+    >>> from functools import reduce
+    >>> reduce(np.intersect1d, ([1, 3, 4, 3], [3, 1, 2, 1], [6, 3, 4, 2]))
+    array([3])
+
+    To return the indices of the values common to the input arrays
+    along with the intersected values:
+
+    >>> x = np.array([1, 1, 2, 3, 4])
+    >>> y = np.array([2, 1, 4, 6])
+    >>> xy, x_ind, y_ind = np.intersect1d(x, y, return_indices=True)
+    >>> x_ind, y_ind
+    (array([0, 2, 4]), array([1, 0, 2]))
+    >>> xy, x[x_ind], y[y_ind]
+    (array([1, 2, 4]), array([1, 2, 4]), array([1, 2, 4]))
+
+    """
+    ar1 = np.asanyarray(ar1)
+    ar2 = np.asanyarray(ar2)
+
+    if not assume_unique:
+        if return_indices:
+            ar1, ind1 = unique(ar1, return_index=True)
+            ar2, ind2 = unique(ar2, return_index=True)
+        else:
+            ar1 = unique(ar1)
+            ar2 = unique(ar2)
+    else:
+        ar1 = ar1.ravel()
+        ar2 = ar2.ravel()
+
+    aux = np.concatenate((ar1, ar2))
+    if return_indices:
+        aux_sort_indices = np.argsort(aux, kind='mergesort')
+        aux = aux[aux_sort_indices]
+    else:
+        aux.sort()
+
+    mask = aux[1:] == aux[:-1]
+    int1d = aux[:-1][mask]
+
+    if return_indices:
+        ar1_indices = aux_sort_indices[:-1][mask]
+        ar2_indices = aux_sort_indices[1:][mask] - ar1.size
+        if not assume_unique:
+            ar1_indices = ind1[ar1_indices]
+            ar2_indices = ind2[ar2_indices]
+
+        return int1d, ar1_indices, ar2_indices
+    else:
+        return int1d
+
+
+def _setxor1d_dispatcher(ar1, ar2, assume_unique=None):
+    return (ar1, ar2)
+
+
+@array_function_dispatch(_setxor1d_dispatcher)
+def setxor1d(ar1, ar2, assume_unique=False):
+    """
+    Find the set exclusive-or of two arrays.
+
+    Return the sorted, unique values that are in only one (not both) of the
+    input arrays.
+
+    Parameters
+    ----------
+    ar1, ar2 : array_like
+        Input arrays.
+    assume_unique : bool
+        If True, the input arrays are both assumed to be unique, which
+        can speed up the calculation.  Default is False.
+
+    Returns
+    -------
+    setxor1d : ndarray
+        Sorted 1D array of unique values that are in only one of the input
+        arrays.
+
+    Examples
+    --------
+    >>> a = np.array([1, 2, 3, 2, 4])
+    >>> b = np.array([2, 3, 5, 7, 5])
+    >>> np.setxor1d(a,b)
+    array([1, 4, 5, 7])
+
+    """
+    if not assume_unique:
+        ar1 = unique(ar1)
+        ar2 = unique(ar2)
+
+    aux = np.concatenate((ar1, ar2))
+    if aux.size == 0:
+        return aux
+
+    aux.sort()
+    flag = np.concatenate(([True], aux[1:] != aux[:-1], [True]))
+    return aux[flag[1:] & flag[:-1]]
+
+
+def _in1d_dispatcher(ar1, ar2, assume_unique=None, invert=None, *,
+                     kind=None):
+    return (ar1, ar2)
+
+
+@array_function_dispatch(_in1d_dispatcher)
+def in1d(ar1, ar2, assume_unique=False, invert=False, *, kind=None):
+    """
+    Test whether each element of a 1-D array is also present in a second array.
+
+    Returns a boolean array the same length as `ar1` that is True
+    where an element of `ar1` is in `ar2` and False otherwise.
+
+    We recommend using :func:`isin` instead of `in1d` for new code.
+
+    Parameters
+    ----------
+    ar1 : (M,) array_like
+        Input array.
+    ar2 : array_like
+        The values against which to test each value of `ar1`.
+    assume_unique : bool, optional
+        If True, the input arrays are both assumed to be unique, which
+        can speed up the calculation.  Default is False.
+    invert : bool, optional
+        If True, the values in the returned array are inverted (that is,
+        False where an element of `ar1` is in `ar2` and True otherwise).
+        Default is False. ``np.in1d(a, b, invert=True)`` is equivalent
+        to (but is faster than) ``np.invert(in1d(a, b))``.
+    kind : {None, 'sort', 'table'}, optional
+        The algorithm to use. This will not affect the final result,
+        but will affect the speed and memory use. The default, None,
+        will select automatically based on memory considerations.
+
+        * If 'sort', will use a mergesort-based approach. This will have
+          a memory usage of roughly 6 times the sum of the sizes of
+          `ar1` and `ar2`, not accounting for size of dtypes.
+        * If 'table', will use a lookup table approach similar
+          to a counting sort. This is only available for boolean and
+          integer arrays. This will have a memory usage of the
+          size of `ar1` plus the max-min value of `ar2`. `assume_unique`
+          has no effect when the 'table' option is used.
+        * If None, will automatically choose 'table' if
+          the required memory allocation is less than or equal to
+          6 times the sum of the sizes of `ar1` and `ar2`,
+          otherwise will use 'sort'. This is done to not use
+          a large amount of memory by default, even though
+          'table' may be faster in most cases. If 'table' is chosen,
+          `assume_unique` will have no effect.
+
+        .. versionadded:: 1.8.0
+
+    Returns
+    -------
+    in1d : (M,) ndarray, bool
+        The values `ar1[in1d]` are in `ar2`.
+
+    See Also
+    --------
+    isin                  : Version of this function that preserves the
+                            shape of ar1.
+    numpy.lib.arraysetops : Module with a number of other functions for
+                            performing set operations on arrays.
+
+    Notes
+    -----
+    `in1d` can be considered as an element-wise function version of the
+    python keyword `in`, for 1-D sequences. ``in1d(a, b)`` is roughly
+    equivalent to ``np.array([item in b for item in a])``.
+    However, this idea fails if `ar2` is a set, or similar (non-sequence)
+    container:  As ``ar2`` is converted to an array, in those cases
+    ``asarray(ar2)`` is an object array rather than the expected array of
+    contained values.
+
+    Using ``kind='table'`` tends to be faster than `kind='sort'` if the
+    following relationship is true:
+    ``log10(len(ar2)) > (log10(max(ar2)-min(ar2)) - 2.27) / 0.927``,
+    but may use greater memory. The default value for `kind` will
+    be automatically selected based only on memory usage, so one may
+    manually set ``kind='table'`` if memory constraints can be relaxed.
+
+    .. versionadded:: 1.4.0
+
+    Examples
+    --------
+    >>> test = np.array([0, 1, 2, 5, 0])
+    >>> states = [0, 2]
+    >>> mask = np.in1d(test, states)
+    >>> mask
+    array([ True, False,  True, False,  True])
+    >>> test[mask]
+    array([0, 2, 0])
+    >>> mask = np.in1d(test, states, invert=True)
+    >>> mask
+    array([False,  True, False,  True, False])
+    >>> test[mask]
+    array([1, 5])
+    """
+    # Ravel both arrays, behavior for the first array could be different
+    ar1 = np.asarray(ar1).ravel()
+    ar2 = np.asarray(ar2).ravel()
+
+    # Ensure that iteration through object arrays yields size-1 arrays
+    if ar2.dtype == object:
+        ar2 = ar2.reshape(-1, 1)
+
+    if kind not in {None, 'sort', 'table'}:
+        raise ValueError(
+            f"Invalid kind: '{kind}'. Please use None, 'sort' or 'table'.")
+
+    # Can use the table method if all arrays are integers or boolean:
+    is_int_arrays = all(ar.dtype.kind in ("u", "i", "b") for ar in (ar1, ar2))
+    use_table_method = is_int_arrays and kind in {None, 'table'}
+
+    if use_table_method:
+        if ar2.size == 0:
+            if invert:
+                return np.ones_like(ar1, dtype=bool)
+            else:
+                return np.zeros_like(ar1, dtype=bool)
+
+        # Convert booleans to uint8 so we can use the fast integer algorithm
+        if ar1.dtype == bool:
+            ar1 = ar1.astype(np.uint8)
+        if ar2.dtype == bool:
+            ar2 = ar2.astype(np.uint8)
+
+        ar2_min = np.min(ar2)
+        ar2_max = np.max(ar2)
+
+        ar2_range = int(ar2_max) - int(ar2_min)
+
+        # Constraints on whether we can actually use the table method:
+        #  1. Assert memory usage is not too large
+        below_memory_constraint = ar2_range <= 6 * (ar1.size + ar2.size)
+        #  2. Check overflows for (ar2 - ar2_min); dtype=ar2.dtype
+        range_safe_from_overflow = ar2_range <= np.iinfo(ar2.dtype).max
+        #  3. Check overflows for (ar1 - ar2_min); dtype=ar1.dtype
+        if ar1.size > 0:
+            ar1_min = np.min(ar1)
+            ar1_max = np.max(ar1)
+
+            # After masking, the range of ar1 is guaranteed to be
+            # within the range of ar2:
+            ar1_upper = min(int(ar1_max), int(ar2_max))
+            ar1_lower = max(int(ar1_min), int(ar2_min))
+
+            range_safe_from_overflow &= all((
+                ar1_upper - int(ar2_min) <= np.iinfo(ar1.dtype).max,
+                ar1_lower - int(ar2_min) >= np.iinfo(ar1.dtype).min
+            ))
+
+        # Optimal performance is for approximately
+        # log10(size) > (log10(range) - 2.27) / 0.927.
+        # However, here we set the requirement that by default
+        # the intermediate array can only be 6x
+        # the combined memory allocation of the original
+        # arrays. See discussion on 
+        # https://github.com/numpy/numpy/pull/12065.
+
+        if (
+            range_safe_from_overflow and 
+            (below_memory_constraint or kind == 'table')
+        ):
+
+            if invert:
+                outgoing_array = np.ones_like(ar1, dtype=bool)
+            else:
+                outgoing_array = np.zeros_like(ar1, dtype=bool)
+
+            # Make elements 1 where the integer exists in ar2
+            if invert:
+                isin_helper_ar = np.ones(ar2_range + 1, dtype=bool)
+                isin_helper_ar[ar2 - ar2_min] = 0
+            else:
+                isin_helper_ar = np.zeros(ar2_range + 1, dtype=bool)
+                isin_helper_ar[ar2 - ar2_min] = 1
+
+            # Mask out elements we know won't work
+            basic_mask = (ar1 <= ar2_max) & (ar1 >= ar2_min)
+            outgoing_array[basic_mask] = isin_helper_ar[ar1[basic_mask] -
+                                                        ar2_min]
+
+            return outgoing_array
+        elif kind == 'table':  # not range_safe_from_overflow
+            raise RuntimeError(
+                "You have specified kind='table', "
+                "but the range of values in `ar2` or `ar1` exceed the "
+                "maximum integer of the datatype. "
+                "Please set `kind` to None or 'sort'."
+            )
+    elif kind == 'table':
+        raise ValueError(
+            "The 'table' method is only "
+            "supported for boolean or integer arrays. "
+            "Please select 'sort' or None for kind."
+        )
+
+
+    # Check if one of the arrays may contain arbitrary objects
+    contains_object = ar1.dtype.hasobject or ar2.dtype.hasobject
+
+    # This code is run when
+    # a) the first condition is true, making the code significantly faster
+    # b) the second condition is true (i.e. `ar1` or `ar2` may contain
+    #    arbitrary objects), since then sorting is not guaranteed to work
+    if len(ar2) < 10 * len(ar1) ** 0.145 or contains_object:
+        if invert:
+            mask = np.ones(len(ar1), dtype=bool)
+            for a in ar2:
+                mask &= (ar1 != a)
+        else:
+            mask = np.zeros(len(ar1), dtype=bool)
+            for a in ar2:
+                mask |= (ar1 == a)
+        return mask
+
+    # Otherwise use sorting
+    if not assume_unique:
+        ar1, rev_idx = np.unique(ar1, return_inverse=True)
+        ar2 = np.unique(ar2)
+
+    ar = np.concatenate((ar1, ar2))
+    # We need this to be a stable sort, so always use 'mergesort'
+    # here. The values from the first array should always come before
+    # the values from the second array.
+    order = ar.argsort(kind='mergesort')
+    sar = ar[order]
+    if invert:
+        bool_ar = (sar[1:] != sar[:-1])
+    else:
+        bool_ar = (sar[1:] == sar[:-1])
+    flag = np.concatenate((bool_ar, [invert]))
+    ret = np.empty(ar.shape, dtype=bool)
+    ret[order] = flag
+
+    if assume_unique:
+        return ret[:len(ar1)]
+    else:
+        return ret[rev_idx]
+
+
+def _isin_dispatcher(element, test_elements, assume_unique=None, invert=None,
+                     *, kind=None):
+    return (element, test_elements)
+
+
+@array_function_dispatch(_isin_dispatcher)
+def isin(element, test_elements, assume_unique=False, invert=False, *,
+         kind=None):
+    """
+    Calculates ``element in test_elements``, broadcasting over `element` only.
+    Returns a boolean array of the same shape as `element` that is True
+    where an element of `element` is in `test_elements` and False otherwise.
+
+    Parameters
+    ----------
+    element : array_like
+        Input array.
+    test_elements : array_like
+        The values against which to test each value of `element`.
+        This argument is flattened if it is an array or array_like.
+        See notes for behavior with non-array-like parameters.
+    assume_unique : bool, optional
+        If True, the input arrays are both assumed to be unique, which
+        can speed up the calculation.  Default is False.
+    invert : bool, optional
+        If True, the values in the returned array are inverted, as if
+        calculating `element not in test_elements`. Default is False.
+        ``np.isin(a, b, invert=True)`` is equivalent to (but faster
+        than) ``np.invert(np.isin(a, b))``.
+    kind : {None, 'sort', 'table'}, optional
+        The algorithm to use. This will not affect the final result,
+        but will affect the speed and memory use. The default, None,
+        will select automatically based on memory considerations.
+
+        * If 'sort', will use a mergesort-based approach. This will have
+          a memory usage of roughly 6 times the sum of the sizes of
+          `ar1` and `ar2`, not accounting for size of dtypes.
+        * If 'table', will use a lookup table approach similar
+          to a counting sort. This is only available for boolean and
+          integer arrays. This will have a memory usage of the
+          size of `ar1` plus the max-min value of `ar2`. `assume_unique`
+          has no effect when the 'table' option is used.
+        * If None, will automatically choose 'table' if
+          the required memory allocation is less than or equal to
+          6 times the sum of the sizes of `ar1` and `ar2`,
+          otherwise will use 'sort'. This is done to not use
+          a large amount of memory by default, even though
+          'table' may be faster in most cases. If 'table' is chosen,
+          `assume_unique` will have no effect.
+
+
+    Returns
+    -------
+    isin : ndarray, bool
+        Has the same shape as `element`. The values `element[isin]`
+        are in `test_elements`.
+
+    See Also
+    --------
+    in1d                  : Flattened version of this function.
+    numpy.lib.arraysetops : Module with a number of other functions for
+                            performing set operations on arrays.
+
+    Notes
+    -----
+
+    `isin` is an element-wise function version of the python keyword `in`.
+    ``isin(a, b)`` is roughly equivalent to
+    ``np.array([item in b for item in a])`` if `a` and `b` are 1-D sequences.
+
+    `element` and `test_elements` are converted to arrays if they are not
+    already. If `test_elements` is a set (or other non-sequence collection)
+    it will be converted to an object array with one element, rather than an
+    array of the values contained in `test_elements`. This is a consequence
+    of the `array` constructor's way of handling non-sequence collections.
+    Converting the set to a list usually gives the desired behavior.
+
+    Using ``kind='table'`` tends to be faster than `kind='sort'` if the
+    following relationship is true:
+    ``log10(len(ar2)) > (log10(max(ar2)-min(ar2)) - 2.27) / 0.927``,
+    but may use greater memory. The default value for `kind` will
+    be automatically selected based only on memory usage, so one may
+    manually set ``kind='table'`` if memory constraints can be relaxed.
+
+    .. versionadded:: 1.13.0
+
+    Examples
+    --------
+    >>> element = 2*np.arange(4).reshape((2, 2))
+    >>> element
+    array([[0, 2],
+           [4, 6]])
+    >>> test_elements = [1, 2, 4, 8]
+    >>> mask = np.isin(element, test_elements)
+    >>> mask
+    array([[False,  True],
+           [ True, False]])
+    >>> element[mask]
+    array([2, 4])
+
+    The indices of the matched values can be obtained with `nonzero`:
+
+    >>> np.nonzero(mask)
+    (array([0, 1]), array([1, 0]))
+
+    The test can also be inverted:
+
+    >>> mask = np.isin(element, test_elements, invert=True)
+    >>> mask
+    array([[ True, False],
+           [False,  True]])
+    >>> element[mask]
+    array([0, 6])
+
+    Because of how `array` handles sets, the following does not
+    work as expected:
+
+    >>> test_set = {1, 2, 4, 8}
+    >>> np.isin(element, test_set)
+    array([[False, False],
+           [False, False]])
+
+    Casting the set to a list gives the expected result:
+
+    >>> np.isin(element, list(test_set))
+    array([[False,  True],
+           [ True, False]])
+    """
+    element = np.asarray(element)
+    return in1d(element, test_elements, assume_unique=assume_unique,
+                invert=invert, kind=kind).reshape(element.shape)
+
+
+def _union1d_dispatcher(ar1, ar2):
+    return (ar1, ar2)
+
+
+@array_function_dispatch(_union1d_dispatcher)
+def union1d(ar1, ar2):
+    """
+    Find the union of two arrays.
+
+    Return the unique, sorted array of values that are in either of the two
+    input arrays.
+
+    Parameters
+    ----------
+    ar1, ar2 : array_like
+        Input arrays. They are flattened if they are not already 1D.
+
+    Returns
+    -------
+    union1d : ndarray
+        Unique, sorted union of the input arrays.
+
+    See Also
+    --------
+    numpy.lib.arraysetops : Module with a number of other functions for
+                            performing set operations on arrays.
+
+    Examples
+    --------
+    >>> np.union1d([-1, 0, 1], [-2, 0, 2])
+    array([-2, -1,  0,  1,  2])
+
+    To find the union of more than two arrays, use functools.reduce:
+
+    >>> from functools import reduce
+    >>> reduce(np.union1d, ([1, 3, 4, 3], [3, 1, 2, 1], [6, 3, 4, 2]))
+    array([1, 2, 3, 4, 6])
+    """
+    return unique(np.concatenate((ar1, ar2), axis=None))
+
+
+def _setdiff1d_dispatcher(ar1, ar2, assume_unique=None):
+    return (ar1, ar2)
+
+
+@array_function_dispatch(_setdiff1d_dispatcher)
+def setdiff1d(ar1, ar2, assume_unique=False):
+    """
+    Find the set difference of two arrays.
+
+    Return the unique values in `ar1` that are not in `ar2`.
+
+    Parameters
+    ----------
+    ar1 : array_like
+        Input array.
+    ar2 : array_like
+        Input comparison array.
+    assume_unique : bool
+        If True, the input arrays are both assumed to be unique, which
+        can speed up the calculation.  Default is False.
+
+    Returns
+    -------
+    setdiff1d : ndarray
+        1D array of values in `ar1` that are not in `ar2`. The result
+        is sorted when `assume_unique=False`, but otherwise only sorted
+        if the input is sorted.
+
+    See Also
+    --------
+    numpy.lib.arraysetops : Module with a number of other functions for
+                            performing set operations on arrays.
+
+    Examples
+    --------
+    >>> a = np.array([1, 2, 3, 2, 4, 1])
+    >>> b = np.array([3, 4, 5, 6])
+    >>> np.setdiff1d(a, b)
+    array([1, 2])
+
+    """
+    if assume_unique:
+        ar1 = np.asarray(ar1).ravel()
+    else:
+        ar1 = unique(ar1)
+        ar2 = unique(ar2)
+    return ar1[in1d(ar1, ar2, assume_unique=True, invert=True)]

.CondaPkg/env/Lib/site-packages/numpy/lib/arraysetops.pyi

@@ -0,0 +1,360 @@
+from typing import (
+    Literal as L,
+    Any,
+    TypeVar,
+    overload,
+    SupportsIndex,
+)
+
+from numpy import (
+    generic,
+    number,
+    bool_,
+    ushort,
+    ubyte,
+    uintc,
+    uint,
+    ulonglong,
+    short,
+    int8,
+    byte,
+    intc,
+    int_,
+    intp,
+    longlong,
+    half,
+    single,
+    double,
+    longdouble,
+    csingle,
+    cdouble,
+    clongdouble,
+    timedelta64,
+    datetime64,
+    object_,
+    str_,
+    bytes_,
+    void,
+)
+
+from numpy._typing import (
+    ArrayLike,
+    NDArray,
+    _ArrayLike,
+    _ArrayLikeBool_co,
+    _ArrayLikeDT64_co,
+    _ArrayLikeTD64_co,
+    _ArrayLikeObject_co,
+    _ArrayLikeNumber_co,
+)
+
+_SCT = TypeVar("_SCT", bound=generic)
+_NumberType = TypeVar("_NumberType", bound=number[Any])
+
+# Explicitly set all allowed values to prevent accidental castings to
+# abstract dtypes (their common super-type).
+#
+# Only relevant if two or more arguments are parametrized, (e.g. `setdiff1d`)
+# which could result in, for example, `int64` and `float64`producing a
+# `number[_64Bit]` array
+_SCTNoCast = TypeVar(
+    "_SCTNoCast",
+    bool_,
+    ushort,
+    ubyte,
+    uintc,
+    uint,
+    ulonglong,
+    short,
+    byte,
+    intc,
+    int_,
+    longlong,
+    half,
+    single,
+    double,
+    longdouble,
+    csingle,
+    cdouble,
+    clongdouble,
+    timedelta64,
+    datetime64,
+    object_,
+    str_,
+    bytes_,
+    void,
+)
+
+__all__: list[str]
+
+@overload
+def ediff1d(
+    ary: _ArrayLikeBool_co,
+    to_end: None | ArrayLike = ...,
+    to_begin: None | ArrayLike = ...,
+) -> NDArray[int8]: ...
+@overload
+def ediff1d(
+    ary: _ArrayLike[_NumberType],
+    to_end: None | ArrayLike = ...,
+    to_begin: None | ArrayLike = ...,
+) -> NDArray[_NumberType]: ...
+@overload
+def ediff1d(
+    ary: _ArrayLikeNumber_co,
+    to_end: None | ArrayLike = ...,
+    to_begin: None | ArrayLike = ...,
+) -> NDArray[Any]: ...
+@overload
+def ediff1d(
+    ary: _ArrayLikeDT64_co | _ArrayLikeTD64_co,
+    to_end: None | ArrayLike = ...,
+    to_begin: None | ArrayLike = ...,
+) -> NDArray[timedelta64]: ...
+@overload
+def ediff1d(
+    ary: _ArrayLikeObject_co,
+    to_end: None | ArrayLike = ...,
+    to_begin: None | ArrayLike = ...,
+) -> NDArray[object_]: ...
+
+@overload
+def unique(
+    ar: _ArrayLike[_SCT],
+    return_index: L[False] = ...,
+    return_inverse: L[False] = ...,
+    return_counts: L[False] = ...,
+    axis: None | SupportsIndex = ...,
+    *,
+    equal_nan: bool = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def unique(
+    ar: ArrayLike,
+    return_index: L[False] = ...,
+    return_inverse: L[False] = ...,
+    return_counts: L[False] = ...,
+    axis: None | SupportsIndex = ...,
+    *,
+    equal_nan: bool = ...,
+) -> NDArray[Any]: ...
+@overload
+def unique(
+    ar: _ArrayLike[_SCT],
+    return_index: L[True] = ...,
+    return_inverse: L[False] = ...,
+    return_counts: L[False] = ...,
+    axis: None | SupportsIndex = ...,
+    *,
+    equal_nan: bool = ...,
+) -> tuple[NDArray[_SCT], NDArray[intp]]: ...
+@overload
+def unique(
+    ar: ArrayLike,
+    return_index: L[True] = ...,
+    return_inverse: L[False] = ...,
+    return_counts: L[False] = ...,
+    axis: None | SupportsIndex = ...,
+    *,
+    equal_nan: bool = ...,
+) -> tuple[NDArray[Any], NDArray[intp]]: ...
+@overload
+def unique(
+    ar: _ArrayLike[_SCT],
+    return_index: L[False] = ...,
+    return_inverse: L[True] = ...,
+    return_counts: L[False] = ...,
+    axis: None | SupportsIndex = ...,
+    *,
+    equal_nan: bool = ...,
+) -> tuple[NDArray[_SCT], NDArray[intp]]: ...
+@overload
+def unique(
+    ar: ArrayLike,
+    return_index: L[False] = ...,
+    return_inverse: L[True] = ...,
+    return_counts: L[False] = ...,
+    axis: None | SupportsIndex = ...,
+    *,
+    equal_nan: bool = ...,
+) -> tuple[NDArray[Any], NDArray[intp]]: ...
+@overload
+def unique(
+    ar: _ArrayLike[_SCT],
+    return_index: L[False] = ...,
+    return_inverse: L[False] = ...,
+    return_counts: L[True] = ...,
+    axis: None | SupportsIndex = ...,
+    *,
+    equal_nan: bool = ...,
+) -> tuple[NDArray[_SCT], NDArray[intp]]: ...
+@overload
+def unique(
+    ar: ArrayLike,
+    return_index: L[False] = ...,
+    return_inverse: L[False] = ...,
+    return_counts: L[True] = ...,
+    axis: None | SupportsIndex = ...,
+    *,
+    equal_nan: bool = ...,
+) -> tuple[NDArray[Any], NDArray[intp]]: ...
+@overload
+def unique(
+    ar: _ArrayLike[_SCT],
+    return_index: L[True] = ...,
+    return_inverse: L[True] = ...,
+    return_counts: L[False] = ...,
+    axis: None | SupportsIndex = ...,
+    *,
+    equal_nan: bool = ...,
+) -> tuple[NDArray[_SCT], NDArray[intp], NDArray[intp]]: ...
+@overload
+def unique(
+    ar: ArrayLike,
+    return_index: L[True] = ...,
+    return_inverse: L[True] = ...,
+    return_counts: L[False] = ...,
+    axis: None | SupportsIndex = ...,
+    *,
+    equal_nan: bool = ...,
+) -> tuple[NDArray[Any], NDArray[intp], NDArray[intp]]: ...
+@overload
+def unique(
+    ar: _ArrayLike[_SCT],
+    return_index: L[True] = ...,
+    return_inverse: L[False] = ...,
+    return_counts: L[True] = ...,
+    axis: None | SupportsIndex = ...,
+    *,
+    equal_nan: bool = ...,
+) -> tuple[NDArray[_SCT], NDArray[intp], NDArray[intp]]: ...
+@overload
+def unique(
+    ar: ArrayLike,
+    return_index: L[True] = ...,
+    return_inverse: L[False] = ...,
+    return_counts: L[True] = ...,
+    axis: None | SupportsIndex = ...,
+    *,
+    equal_nan: bool = ...,
+) -> tuple[NDArray[Any], NDArray[intp], NDArray[intp]]: ...
+@overload
+def unique(
+    ar: _ArrayLike[_SCT],
+    return_index: L[False] = ...,
+    return_inverse: L[True] = ...,
+    return_counts: L[True] = ...,
+    axis: None | SupportsIndex = ...,
+    *,
+    equal_nan: bool = ...,
+) -> tuple[NDArray[_SCT], NDArray[intp], NDArray[intp]]: ...
+@overload
+def unique(
+    ar: ArrayLike,
+    return_index: L[False] = ...,
+    return_inverse: L[True] = ...,
+    return_counts: L[True] = ...,
+    axis: None | SupportsIndex = ...,
+    *,
+    equal_nan: bool = ...,
+) -> tuple[NDArray[Any], NDArray[intp], NDArray[intp]]: ...
+@overload
+def unique(
+    ar: _ArrayLike[_SCT],
+    return_index: L[True] = ...,
+    return_inverse: L[True] = ...,
+    return_counts: L[True] = ...,
+    axis: None | SupportsIndex = ...,
+    *,
+    equal_nan: bool = ...,
+) -> tuple[NDArray[_SCT], NDArray[intp], NDArray[intp], NDArray[intp]]: ...
+@overload
+def unique(
+    ar: ArrayLike,
+    return_index: L[True] = ...,
+    return_inverse: L[True] = ...,
+    return_counts: L[True] = ...,
+    axis: None | SupportsIndex = ...,
+    *,
+    equal_nan: bool = ...,
+) -> tuple[NDArray[Any], NDArray[intp], NDArray[intp], NDArray[intp]]: ...
+
+@overload
+def intersect1d(
+    ar1: _ArrayLike[_SCTNoCast],
+    ar2: _ArrayLike[_SCTNoCast],
+    assume_unique: bool = ...,
+    return_indices: L[False] = ...,
+) -> NDArray[_SCTNoCast]: ...
+@overload
+def intersect1d(
+    ar1: ArrayLike,
+    ar2: ArrayLike,
+    assume_unique: bool = ...,
+    return_indices: L[False] = ...,
+) -> NDArray[Any]: ...
+@overload
+def intersect1d(
+    ar1: _ArrayLike[_SCTNoCast],
+    ar2: _ArrayLike[_SCTNoCast],
+    assume_unique: bool = ...,
+    return_indices: L[True] = ...,
+) -> tuple[NDArray[_SCTNoCast], NDArray[intp], NDArray[intp]]: ...
+@overload
+def intersect1d(
+    ar1: ArrayLike,
+    ar2: ArrayLike,
+    assume_unique: bool = ...,
+    return_indices: L[True] = ...,
+) -> tuple[NDArray[Any], NDArray[intp], NDArray[intp]]: ...
+
+@overload
+def setxor1d(
+    ar1: _ArrayLike[_SCTNoCast],
+    ar2: _ArrayLike[_SCTNoCast],
+    assume_unique: bool = ...,
+) -> NDArray[_SCTNoCast]: ...
+@overload
+def setxor1d(
+    ar1: ArrayLike,
+    ar2: ArrayLike,
+    assume_unique: bool = ...,
+) -> NDArray[Any]: ...
+
+def in1d(
+    ar1: ArrayLike,
+    ar2: ArrayLike,
+    assume_unique: bool = ...,
+    invert: bool = ...,
+) -> NDArray[bool_]: ...
+
+def isin(
+    element: ArrayLike,
+    test_elements: ArrayLike,
+    assume_unique: bool = ...,
+    invert: bool = ...,
+) -> NDArray[bool_]: ...
+
+@overload
+def union1d(
+    ar1: _ArrayLike[_SCTNoCast],
+    ar2: _ArrayLike[_SCTNoCast],
+) -> NDArray[_SCTNoCast]: ...
+@overload
+def union1d(
+    ar1: ArrayLike,
+    ar2: ArrayLike,
+) -> NDArray[Any]: ...
+
+@overload
+def setdiff1d(
+    ar1: _ArrayLike[_SCTNoCast],
+    ar2: _ArrayLike[_SCTNoCast],
+    assume_unique: bool = ...,
+) -> NDArray[_SCTNoCast]: ...
+@overload
+def setdiff1d(
+    ar1: ArrayLike,
+    ar2: ArrayLike,
+    assume_unique: bool = ...,
+) -> NDArray[Any]: ...

.CondaPkg/env/Lib/site-packages/numpy/lib/arrayterator.py

@@ -0,0 +1,219 @@
+"""
+A buffered iterator for big arrays.
+
+This module solves the problem of iterating over a big file-based array
+without having to read it into memory. The `Arrayterator` class wraps
+an array object, and when iterated it will return sub-arrays with at most
+a user-specified number of elements.
+
+"""
+from operator import mul
+from functools import reduce
+
+__all__ = ['Arrayterator']
+
+
+class Arrayterator:
+    """
+    Buffered iterator for big arrays.
+
+    `Arrayterator` creates a buffered iterator for reading big arrays in small
+    contiguous blocks. The class is useful for objects stored in the
+    file system. It allows iteration over the object *without* reading
+    everything in memory; instead, small blocks are read and iterated over.
+
+    `Arrayterator` can be used with any object that supports multidimensional
+    slices. This includes NumPy arrays, but also variables from
+    Scientific.IO.NetCDF or pynetcdf for example.
+
+    Parameters
+    ----------
+    var : array_like
+        The object to iterate over.
+    buf_size : int, optional
+        The buffer size. If `buf_size` is supplied, the maximum amount of
+        data that will be read into memory is `buf_size` elements.
+        Default is None, which will read as many element as possible
+        into memory.
+
+    Attributes
+    ----------
+    var
+    buf_size
+    start
+    stop
+    step
+    shape
+    flat
+
+    See Also
+    --------
+    ndenumerate : Multidimensional array iterator.
+    flatiter : Flat array iterator.
+    memmap : Create a memory-map to an array stored in a binary file on disk.
+
+    Notes
+    -----
+    The algorithm works by first finding a "running dimension", along which
+    the blocks will be extracted. Given an array of dimensions
+    ``(d1, d2, ..., dn)``, e.g. if `buf_size` is smaller than ``d1``, the
+    first dimension will be used. If, on the other hand,
+    ``d1 < buf_size < d1*d2`` the second dimension will be used, and so on.
+    Blocks are extracted along this dimension, and when the last block is
+    returned the process continues from the next dimension, until all
+    elements have been read.
+
+    Examples
+    --------
+    >>> a = np.arange(3 * 4 * 5 * 6).reshape(3, 4, 5, 6)
+    >>> a_itor = np.lib.Arrayterator(a, 2)
+    >>> a_itor.shape
+    (3, 4, 5, 6)
+
+    Now we can iterate over ``a_itor``, and it will return arrays of size
+    two. Since `buf_size` was smaller than any dimension, the first
+    dimension will be iterated over first:
+
+    >>> for subarr in a_itor:
+    ...     if not subarr.all():
+    ...         print(subarr, subarr.shape) # doctest: +SKIP
+    >>> # [[[[0 1]]]] (1, 1, 1, 2)
+
+    """
+
+    def __init__(self, var, buf_size=None):
+        self.var = var
+        self.buf_size = buf_size
+
+        self.start = [0 for dim in var.shape]
+        self.stop = [dim for dim in var.shape]
+        self.step = [1 for dim in var.shape]
+
+    def __getattr__(self, attr):
+        return getattr(self.var, attr)
+
+    def __getitem__(self, index):
+        """
+        Return a new arrayterator.
+
+        """
+        # Fix index, handling ellipsis and incomplete slices.
+        if not isinstance(index, tuple):
+            index = (index,)
+        fixed = []
+        length, dims = len(index), self.ndim
+        for slice_ in index:
+            if slice_ is Ellipsis:
+                fixed.extend([slice(None)] * (dims-length+1))
+                length = len(fixed)
+            elif isinstance(slice_, int):
+                fixed.append(slice(slice_, slice_+1, 1))
+            else:
+                fixed.append(slice_)
+        index = tuple(fixed)
+        if len(index) < dims:
+            index += (slice(None),) * (dims-len(index))
+
+        # Return a new arrayterator object.
+        out = self.__class__(self.var, self.buf_size)
+        for i, (start, stop, step, slice_) in enumerate(
+                zip(self.start, self.stop, self.step, index)):
+            out.start[i] = start + (slice_.start or 0)
+            out.step[i] = step * (slice_.step or 1)
+            out.stop[i] = start + (slice_.stop or stop-start)
+            out.stop[i] = min(stop, out.stop[i])
+        return out
+
+    def __array__(self):
+        """
+        Return corresponding data.
+
+        """
+        slice_ = tuple(slice(*t) for t in zip(
+                self.start, self.stop, self.step))
+        return self.var[slice_]
+
+    @property
+    def flat(self):
+        """
+        A 1-D flat iterator for Arrayterator objects.
+
+        This iterator returns elements of the array to be iterated over in
+        `Arrayterator` one by one. It is similar to `flatiter`.
+
+        See Also
+        --------
+        Arrayterator
+        flatiter
+
+        Examples
+        --------
+        >>> a = np.arange(3 * 4 * 5 * 6).reshape(3, 4, 5, 6)
+        >>> a_itor = np.lib.Arrayterator(a, 2)
+
+        >>> for subarr in a_itor.flat:
+        ...     if not subarr:
+        ...         print(subarr, type(subarr))
+        ...
+        0 <class 'numpy.int64'>
+
+        """
+        for block in self:
+            yield from block.flat
+
+    @property
+    def shape(self):
+        """
+        The shape of the array to be iterated over.
+
+        For an example, see `Arrayterator`.
+
+        """
+        return tuple(((stop-start-1)//step+1) for start, stop, step in
+                zip(self.start, self.stop, self.step))
+
+    def __iter__(self):
+        # Skip arrays with degenerate dimensions
+        if [dim for dim in self.shape if dim <= 0]:
+            return
+
+        start = self.start[:]
+        stop = self.stop[:]
+        step = self.step[:]
+        ndims = self.var.ndim
+
+        while True:
+            count = self.buf_size or reduce(mul, self.shape)
+
+            # iterate over each dimension, looking for the
+            # running dimension (ie, the dimension along which
+            # the blocks will be built from)
+            rundim = 0
+            for i in range(ndims-1, -1, -1):
+                # if count is zero we ran out of elements to read
+                # along higher dimensions, so we read only a single position
+                if count == 0:
+                    stop[i] = start[i]+1
+                elif count <= self.shape[i]:
+                    # limit along this dimension
+                    stop[i] = start[i] + count*step[i]
+                    rundim = i
+                else:
+                    # read everything along this dimension
+                    stop[i] = self.stop[i]
+                stop[i] = min(self.stop[i], stop[i])
+                count = count//self.shape[i]
+
+            # yield a block
+            slice_ = tuple(slice(*t) for t in zip(start, stop, step))
+            yield self.var[slice_]
+
+            # Update start position, taking care of overflow to
+            # other dimensions
+            start[rundim] = stop[rundim]  # start where we stopped
+            for i in range(ndims-1, 0, -1):
+                if start[i] >= self.stop[i]:
+                    start[i] = self.start[i]
+                    start[i-1] += self.step[i-1]
+            if start[0] >= self.stop[0]:
+                return

.CondaPkg/env/Lib/site-packages/numpy/lib/arrayterator.pyi

@@ -0,0 +1,49 @@
+from collections.abc import Generator
+from typing import (
+    Any,
+    TypeVar,
+    Union,
+    overload,
+)
+
+from numpy import ndarray, dtype, generic
+from numpy._typing import DTypeLike
+
+# TODO: Set a shape bound once we've got proper shape support
+_Shape = TypeVar("_Shape", bound=Any)
+_DType = TypeVar("_DType", bound=dtype[Any])
+_ScalarType = TypeVar("_ScalarType", bound=generic)
+
+_Index = Union[
+    Union[ellipsis, int, slice],
+    tuple[Union[ellipsis, int, slice], ...],
+]
+
+__all__: list[str]
+
+# NOTE: In reality `Arrayterator` does not actually inherit from `ndarray`,
+# but its ``__getattr__` method does wrap around the former and thus has
+# access to all its methods
+
+class Arrayterator(ndarray[_Shape, _DType]):
+    var: ndarray[_Shape, _DType]  # type: ignore[assignment]
+    buf_size: None | int
+    start: list[int]
+    stop: list[int]
+    step: list[int]
+
+    @property  # type: ignore[misc]
+    def shape(self) -> tuple[int, ...]: ...
+    @property
+    def flat(  # type: ignore[override]
+        self: ndarray[Any, dtype[_ScalarType]]
+    ) -> Generator[_ScalarType, None, None]: ...
+    def __init__(
+        self, var: ndarray[_Shape, _DType], buf_size: None | int = ...
+    ) -> None: ...
+    @overload
+    def __array__(self, dtype: None = ...) -> ndarray[Any, _DType]: ...
+    @overload
+    def __array__(self, dtype: DTypeLike) -> ndarray[Any, dtype[Any]]: ...
+    def __getitem__(self, index: _Index) -> Arrayterator[Any, _DType]: ...
+    def __iter__(self) -> Generator[ndarray[Any, _DType], None, None]: ...

.CondaPkg/env/Lib/site-packages/numpy/lib/format.py

@@ -0,0 +1,968 @@
+"""
+Binary serialization
+
+NPY format
+==========
+
+A simple format for saving numpy arrays to disk with the full
+information about them.
+
+The ``.npy`` format is the standard binary file format in NumPy for
+persisting a *single* arbitrary NumPy array on disk. The format stores all
+of the shape and dtype information necessary to reconstruct the array
+correctly even on another machine with a different architecture.
+The format is designed to be as simple as possible while achieving
+its limited goals.
+
+The ``.npz`` format is the standard format for persisting *multiple* NumPy
+arrays on disk. A ``.npz`` file is a zip file containing multiple ``.npy``
+files, one for each array.
+
+Capabilities
+------------
+
+- Can represent all NumPy arrays including nested record arrays and
+  object arrays.
+
+- Represents the data in its native binary form.
+
+- Supports Fortran-contiguous arrays directly.
+
+- Stores all of the necessary information to reconstruct the array
+  including shape and dtype on a machine of a different
+  architecture.  Both little-endian and big-endian arrays are
+  supported, and a file with little-endian numbers will yield
+  a little-endian array on any machine reading the file. The
+  types are described in terms of their actual sizes. For example,
+  if a machine with a 64-bit C "long int" writes out an array with
+  "long ints", a reading machine with 32-bit C "long ints" will yield
+  an array with 64-bit integers.
+
+- Is straightforward to reverse engineer. Datasets often live longer than
+  the programs that created them. A competent developer should be
+  able to create a solution in their preferred programming language to
+  read most ``.npy`` files that they have been given without much
+  documentation.
+
+- Allows memory-mapping of the data. See `open_memmap`.
+
+- Can be read from a filelike stream object instead of an actual file.
+
+- Stores object arrays, i.e. arrays containing elements that are arbitrary
+  Python objects. Files with object arrays are not to be mmapable, but
+  can be read and written to disk.
+
+Limitations
+-----------
+
+- Arbitrary subclasses of numpy.ndarray are not completely preserved.
+  Subclasses will be accepted for writing, but only the array data will
+  be written out. A regular numpy.ndarray object will be created
+  upon reading the file.
+
+.. warning::
+
+  Due to limitations in the interpretation of structured dtypes, dtypes
+  with fields with empty names will have the names replaced by 'f0', 'f1',
+  etc. Such arrays will not round-trip through the format entirely
+  accurately. The data is intact; only the field names will differ. We are
+  working on a fix for this. This fix will not require a change in the
+  file format. The arrays with such structures can still be saved and
+  restored, and the correct dtype may be restored by using the
+  ``loadedarray.view(correct_dtype)`` method.
+
+File extensions
+---------------
+
+We recommend using the ``.npy`` and ``.npz`` extensions for files saved
+in this format. This is by no means a requirement; applications may wish
+to use these file formats but use an extension specific to the
+application. In the absence of an obvious alternative, however,
+we suggest using ``.npy`` and ``.npz``.
+
+Version numbering
+-----------------
+
+The version numbering of these formats is independent of NumPy version
+numbering. If the format is upgraded, the code in `numpy.io` will still
+be able to read and write Version 1.0 files.
+
+Format Version 1.0
+------------------
+
+The first 6 bytes are a magic string: exactly ``\\x93NUMPY``.
+
+The next 1 byte is an unsigned byte: the major version number of the file
+format, e.g. ``\\x01``.
+
+The next 1 byte is an unsigned byte: the minor version number of the file
+format, e.g. ``\\x00``. Note: the version of the file format is not tied
+to the version of the numpy package.
+
+The next 2 bytes form a little-endian unsigned short int: the length of
+the header data HEADER_LEN.
+
+The next HEADER_LEN bytes form the header data describing the array's
+format. It is an ASCII string which contains a Python literal expression
+of a dictionary. It is terminated by a newline (``\\n``) and padded with
+spaces (``\\x20``) to make the total of
+``len(magic string) + 2 + len(length) + HEADER_LEN`` be evenly divisible
+by 64 for alignment purposes.
+
+The dictionary contains three keys:
+
+    "descr" : dtype.descr
+      An object that can be passed as an argument to the `numpy.dtype`
+      constructor to create the array's dtype.
+    "fortran_order" : bool
+      Whether the array data is Fortran-contiguous or not. Since
+      Fortran-contiguous arrays are a common form of non-C-contiguity,
+      we allow them to be written directly to disk for efficiency.
+    "shape" : tuple of int
+      The shape of the array.
+
+For repeatability and readability, the dictionary keys are sorted in
+alphabetic order. This is for convenience only. A writer SHOULD implement
+this if possible. A reader MUST NOT depend on this.
+
+Following the header comes the array data. If the dtype contains Python
+objects (i.e. ``dtype.hasobject is True``), then the data is a Python
+pickle of the array. Otherwise the data is the contiguous (either C-
+or Fortran-, depending on ``fortran_order``) bytes of the array.
+Consumers can figure out the number of bytes by multiplying the number
+of elements given by the shape (noting that ``shape=()`` means there is
+1 element) by ``dtype.itemsize``.
+
+Format Version 2.0
+------------------
+
+The version 1.0 format only allowed the array header to have a total size of
+65535 bytes.  This can be exceeded by structured arrays with a large number of
+columns.  The version 2.0 format extends the header size to 4 GiB.
+`numpy.save` will automatically save in 2.0 format if the data requires it,
+else it will always use the more compatible 1.0 format.
+
+The description of the fourth element of the header therefore has become:
+"The next 4 bytes form a little-endian unsigned int: the length of the header
+data HEADER_LEN."
+
+Format Version 3.0
+------------------
+
+This version replaces the ASCII string (which in practice was latin1) with
+a utf8-encoded string, so supports structured types with any unicode field
+names.
+
+Notes
+-----
+The ``.npy`` format, including motivation for creating it and a comparison of
+alternatives, is described in the
+:doc:`"npy-format" NEP <neps:nep-0001-npy-format>`, however details have
+evolved with time and this document is more current.
+
+"""
+import numpy
+import warnings
+from numpy.lib.utils import safe_eval
+from numpy.compat import (
+    isfileobj, os_fspath, pickle
+    )
+
+
+__all__ = []
+
+
+EXPECTED_KEYS = {'descr', 'fortran_order', 'shape'}
+MAGIC_PREFIX = b'\x93NUMPY'
+MAGIC_LEN = len(MAGIC_PREFIX) + 2
+ARRAY_ALIGN = 64 # plausible values are powers of 2 between 16 and 4096
+BUFFER_SIZE = 2**18  # size of buffer for reading npz files in bytes
+# allow growth within the address space of a 64 bit machine along one axis
+GROWTH_AXIS_MAX_DIGITS = 21  # = len(str(8*2**64-1)) hypothetical int1 dtype
+
+# difference between version 1.0 and 2.0 is a 4 byte (I) header length
+# instead of 2 bytes (H) allowing storage of large structured arrays
+_header_size_info = {
+    (1, 0): ('<H', 'latin1'),
+    (2, 0): ('<I', 'latin1'),
+    (3, 0): ('<I', 'utf8'),
+}
+
+# Python's literal_eval is not actually safe for large inputs, since parsing
+# may become slow or even cause interpreter crashes.
+# This is an arbitrary, low limit which should make it safe in practice.
+_MAX_HEADER_SIZE = 10000
+
+def _check_version(version):
+    if version not in [(1, 0), (2, 0), (3, 0), None]:
+        msg = "we only support format version (1,0), (2,0), and (3,0), not %s"
+        raise ValueError(msg % (version,))
+
+def magic(major, minor):
+    """ Return the magic string for the given file format version.
+
+    Parameters
+    ----------
+    major : int in [0, 255]
+    minor : int in [0, 255]
+
+    Returns
+    -------
+    magic : str
+
+    Raises
+    ------
+    ValueError if the version cannot be formatted.
+    """
+    if major < 0 or major > 255:
+        raise ValueError("major version must be 0 <= major < 256")
+    if minor < 0 or minor > 255:
+        raise ValueError("minor version must be 0 <= minor < 256")
+    return MAGIC_PREFIX + bytes([major, minor])
+
+def read_magic(fp):
+    """ Read the magic string to get the version of the file format.
+
+    Parameters
+    ----------
+    fp : filelike object
+
+    Returns
+    -------
+    major : int
+    minor : int
+    """
+    magic_str = _read_bytes(fp, MAGIC_LEN, "magic string")
+    if magic_str[:-2] != MAGIC_PREFIX:
+        msg = "the magic string is not correct; expected %r, got %r"
+        raise ValueError(msg % (MAGIC_PREFIX, magic_str[:-2]))
+    major, minor = magic_str[-2:]
+    return major, minor
+
+def _has_metadata(dt):
+    if dt.metadata is not None:
+        return True
+    elif dt.names is not None:
+        return any(_has_metadata(dt[k]) for k in dt.names)
+    elif dt.subdtype is not None:
+        return _has_metadata(dt.base)
+    else:
+        return False
+
+def dtype_to_descr(dtype):
+    """
+    Get a serializable descriptor from the dtype.
+
+    The .descr attribute of a dtype object cannot be round-tripped through
+    the dtype() constructor. Simple types, like dtype('float32'), have
+    a descr which looks like a record array with one field with '' as
+    a name. The dtype() constructor interprets this as a request to give
+    a default name.  Instead, we construct descriptor that can be passed to
+    dtype().
+
+    Parameters
+    ----------
+    dtype : dtype
+        The dtype of the array that will be written to disk.
+
+    Returns
+    -------
+    descr : object
+        An object that can be passed to `numpy.dtype()` in order to
+        replicate the input dtype.
+
+    """
+    if _has_metadata(dtype):
+        warnings.warn("metadata on a dtype may be saved or ignored, but will "
+                      "raise if saved when read. Use another form of storage.",
+                      UserWarning, stacklevel=2)
+    if dtype.names is not None:
+        # This is a record array. The .descr is fine.  XXX: parts of the
+        # record array with an empty name, like padding bytes, still get
+        # fiddled with. This needs to be fixed in the C implementation of
+        # dtype().
+        return dtype.descr
+    else:
+        return dtype.str
+
+def descr_to_dtype(descr):
+    """
+    Returns a dtype based off the given description.
+
+    This is essentially the reverse of `dtype_to_descr()`. It will remove
+    the valueless padding fields created by, i.e. simple fields like
+    dtype('float32'), and then convert the description to its corresponding
+    dtype.
+
+    Parameters
+    ----------
+    descr : object
+        The object retrieved by dtype.descr. Can be passed to
+        `numpy.dtype()` in order to replicate the input dtype.
+
+    Returns
+    -------
+    dtype : dtype
+        The dtype constructed by the description.
+
+    """
+    if isinstance(descr, str):
+        # No padding removal needed
+        return numpy.dtype(descr)
+    elif isinstance(descr, tuple):
+        # subtype, will always have a shape descr[1]
+        dt = descr_to_dtype(descr[0])
+        return numpy.dtype((dt, descr[1]))
+
+    titles = []
+    names = []
+    formats = []
+    offsets = []
+    offset = 0
+    for field in descr:
+        if len(field) == 2:
+            name, descr_str = field
+            dt = descr_to_dtype(descr_str)
+        else:
+            name, descr_str, shape = field
+            dt = numpy.dtype((descr_to_dtype(descr_str), shape))
+
+        # Ignore padding bytes, which will be void bytes with '' as name
+        # Once support for blank names is removed, only "if name == ''" needed)
+        is_pad = (name == '' and dt.type is numpy.void and dt.names is None)
+        if not is_pad:
+            title, name = name if isinstance(name, tuple) else (None, name)
+            titles.append(title)
+            names.append(name)
+            formats.append(dt)
+            offsets.append(offset)
+        offset += dt.itemsize
+
+    return numpy.dtype({'names': names, 'formats': formats, 'titles': titles,
+                        'offsets': offsets, 'itemsize': offset})
+
+def header_data_from_array_1_0(array):
+    """ Get the dictionary of header metadata from a numpy.ndarray.
+
+    Parameters
+    ----------
+    array : numpy.ndarray
+
+    Returns
+    -------
+    d : dict
+        This has the appropriate entries for writing its string representation
+        to the header of the file.
+    """
+    d = {'shape': array.shape}
+    if array.flags.c_contiguous:
+        d['fortran_order'] = False
+    elif array.flags.f_contiguous:
+        d['fortran_order'] = True
+    else:
+        # Totally non-contiguous data. We will have to make it C-contiguous
+        # before writing. Note that we need to test for C_CONTIGUOUS first
+        # because a 1-D array is both C_CONTIGUOUS and F_CONTIGUOUS.
+        d['fortran_order'] = False
+
+    d['descr'] = dtype_to_descr(array.dtype)
+    return d
+
+
+def _wrap_header(header, version):
+    """
+    Takes a stringified header, and attaches the prefix and padding to it
+    """
+    import struct
+    assert version is not None
+    fmt, encoding = _header_size_info[version]
+    header = header.encode(encoding)
+    hlen = len(header) + 1
+    padlen = ARRAY_ALIGN - ((MAGIC_LEN + struct.calcsize(fmt) + hlen) % ARRAY_ALIGN)
+    try:
+        header_prefix = magic(*version) + struct.pack(fmt, hlen + padlen)
+    except struct.error:
+        msg = "Header length {} too big for version={}".format(hlen, version)
+        raise ValueError(msg) from None
+
+    # Pad the header with spaces and a final newline such that the magic
+    # string, the header-length short and the header are aligned on a
+    # ARRAY_ALIGN byte boundary.  This supports memory mapping of dtypes
+    # aligned up to ARRAY_ALIGN on systems like Linux where mmap()
+    # offset must be page-aligned (i.e. the beginning of the file).
+    return header_prefix + header + b' '*padlen + b'\n'
+
+
+def _wrap_header_guess_version(header):
+    """
+    Like `_wrap_header`, but chooses an appropriate version given the contents
+    """
+    try:
+        return _wrap_header(header, (1, 0))
+    except ValueError:
+        pass
+
+    try:
+        ret = _wrap_header(header, (2, 0))
+    except UnicodeEncodeError:
+        pass
+    else:
+        warnings.warn("Stored array in format 2.0. It can only be"
+                      "read by NumPy >= 1.9", UserWarning, stacklevel=2)
+        return ret
+
+    header = _wrap_header(header, (3, 0))
+    warnings.warn("Stored array in format 3.0. It can only be "
+                  "read by NumPy >= 1.17", UserWarning, stacklevel=2)
+    return header
+
+
+def _write_array_header(fp, d, version=None):
+    """ Write the header for an array and returns the version used
+
+    Parameters
+    ----------
+    fp : filelike object
+    d : dict
+        This has the appropriate entries for writing its string representation
+        to the header of the file.
+    version : tuple or None
+        None means use oldest that works. Providing an explicit version will
+        raise a ValueError if the format does not allow saving this data.
+        Default: None
+    """
+    header = ["{"]
+    for key, value in sorted(d.items()):
+        # Need to use repr here, since we eval these when reading
+        header.append("'%s': %s, " % (key, repr(value)))
+    header.append("}")
+    header = "".join(header)
+    
+    # Add some spare space so that the array header can be modified in-place
+    # when changing the array size, e.g. when growing it by appending data at
+    # the end. 
+    shape = d['shape']
+    header += " " * ((GROWTH_AXIS_MAX_DIGITS - len(repr(
+        shape[-1 if d['fortran_order'] else 0]
+    ))) if len(shape) > 0 else 0)
+    
+    if version is None:
+        header = _wrap_header_guess_version(header)
+    else:
+        header = _wrap_header(header, version)
+    fp.write(header)
+
+def write_array_header_1_0(fp, d):
+    """ Write the header for an array using the 1.0 format.
+
+    Parameters
+    ----------
+    fp : filelike object
+    d : dict
+        This has the appropriate entries for writing its string
+        representation to the header of the file.
+    """
+    _write_array_header(fp, d, (1, 0))
+
+
+def write_array_header_2_0(fp, d):
+    """ Write the header for an array using the 2.0 format.
+        The 2.0 format allows storing very large structured arrays.
+
+    .. versionadded:: 1.9.0
+
+    Parameters
+    ----------
+    fp : filelike object
+    d : dict
+        This has the appropriate entries for writing its string
+        representation to the header of the file.
+    """
+    _write_array_header(fp, d, (2, 0))
+
+def read_array_header_1_0(fp, max_header_size=_MAX_HEADER_SIZE):
+    """
+    Read an array header from a filelike object using the 1.0 file format
+    version.
+
+    This will leave the file object located just after the header.
+
+    Parameters
+    ----------
+    fp : filelike object
+        A file object or something with a `.read()` method like a file.
+
+    Returns
+    -------
+    shape : tuple of int
+        The shape of the array.
+    fortran_order : bool
+        The array data will be written out directly if it is either
+        C-contiguous or Fortran-contiguous. Otherwise, it will be made
+        contiguous before writing it out.
+    dtype : dtype
+        The dtype of the file's data.
+    max_header_size : int, optional
+        Maximum allowed size of the header.  Large headers may not be safe
+        to load securely and thus require explicitly passing a larger value.
+        See :py:meth:`ast.literal_eval()` for details.
+
+    Raises
+    ------
+    ValueError
+        If the data is invalid.
+
+    """
+    return _read_array_header(
+            fp, version=(1, 0), max_header_size=max_header_size)
+
+def read_array_header_2_0(fp, max_header_size=_MAX_HEADER_SIZE):
+    """
+    Read an array header from a filelike object using the 2.0 file format
+    version.
+
+    This will leave the file object located just after the header.
+
+    .. versionadded:: 1.9.0
+
+    Parameters
+    ----------
+    fp : filelike object
+        A file object or something with a `.read()` method like a file.
+    max_header_size : int, optional
+        Maximum allowed size of the header.  Large headers may not be safe
+        to load securely and thus require explicitly passing a larger value.
+        See :py:meth:`ast.literal_eval()` for details.
+
+    Returns
+    -------
+    shape : tuple of int
+        The shape of the array.
+    fortran_order : bool
+        The array data will be written out directly if it is either
+        C-contiguous or Fortran-contiguous. Otherwise, it will be made
+        contiguous before writing it out.
+    dtype : dtype
+        The dtype of the file's data.
+
+    Raises
+    ------
+    ValueError
+        If the data is invalid.
+
+    """
+    return _read_array_header(
+            fp, version=(2, 0), max_header_size=max_header_size)
+
+
+def _filter_header(s):
+    """Clean up 'L' in npz header ints.
+
+    Cleans up the 'L' in strings representing integers. Needed to allow npz
+    headers produced in Python2 to be read in Python3.
+
+    Parameters
+    ----------
+    s : string
+        Npy file header.
+
+    Returns
+    -------
+    header : str
+        Cleaned up header.
+
+    """
+    import tokenize
+    from io import StringIO
+
+    tokens = []
+    last_token_was_number = False
+    for token in tokenize.generate_tokens(StringIO(s).readline):
+        token_type = token[0]
+        token_string = token[1]
+        if (last_token_was_number and
+                token_type == tokenize.NAME and
+                token_string == "L"):
+            continue
+        else:
+            tokens.append(token)
+        last_token_was_number = (token_type == tokenize.NUMBER)
+    return tokenize.untokenize(tokens)
+
+
+def _read_array_header(fp, version, max_header_size=_MAX_HEADER_SIZE):
+    """
+    see read_array_header_1_0
+    """
+    # Read an unsigned, little-endian short int which has the length of the
+    # header.
+    import struct
+    hinfo = _header_size_info.get(version)
+    if hinfo is None:
+        raise ValueError("Invalid version {!r}".format(version))
+    hlength_type, encoding = hinfo
+
+    hlength_str = _read_bytes(fp, struct.calcsize(hlength_type), "array header length")
+    header_length = struct.unpack(hlength_type, hlength_str)[0]
+    header = _read_bytes(fp, header_length, "array header")
+    header = header.decode(encoding)
+    if len(header) > max_header_size:
+        raise ValueError(
+            f"Header info length ({len(header)}) is large and may not be safe "
+            "to load securely.\n"
+            "To allow loading, adjust `max_header_size` or fully trust "
+            "the `.npy` file using `allow_pickle=True`.\n"
+            "For safety against large resource use or crashes, sandboxing "
+            "may be necessary.")
+
+    # The header is a pretty-printed string representation of a literal
+    # Python dictionary with trailing newlines padded to a ARRAY_ALIGN byte
+    # boundary. The keys are strings.
+    #   "shape" : tuple of int
+    #   "fortran_order" : bool
+    #   "descr" : dtype.descr
+    # Versions (2, 0) and (1, 0) could have been created by a Python 2
+    # implementation before header filtering was implemented.
+    if version <= (2, 0):
+        header = _filter_header(header)
+    try:
+        d = safe_eval(header)
+    except SyntaxError as e:
+        msg = "Cannot parse header: {!r}"
+        raise ValueError(msg.format(header)) from e
+    if not isinstance(d, dict):
+        msg = "Header is not a dictionary: {!r}"
+        raise ValueError(msg.format(d))
+
+    if EXPECTED_KEYS != d.keys():
+        keys = sorted(d.keys())
+        msg = "Header does not contain the correct keys: {!r}"
+        raise ValueError(msg.format(keys))
+
+    # Sanity-check the values.
+    if (not isinstance(d['shape'], tuple) or
+            not all(isinstance(x, int) for x in d['shape'])):
+        msg = "shape is not valid: {!r}"
+        raise ValueError(msg.format(d['shape']))
+    if not isinstance(d['fortran_order'], bool):
+        msg = "fortran_order is not a valid bool: {!r}"
+        raise ValueError(msg.format(d['fortran_order']))
+    try:
+        dtype = descr_to_dtype(d['descr'])
+    except TypeError as e:
+        msg = "descr is not a valid dtype descriptor: {!r}"
+        raise ValueError(msg.format(d['descr'])) from e
+
+    return d['shape'], d['fortran_order'], dtype
+
+def write_array(fp, array, version=None, allow_pickle=True, pickle_kwargs=None):
+    """
+    Write an array to an NPY file, including a header.
+
+    If the array is neither C-contiguous nor Fortran-contiguous AND the
+    file_like object is not a real file object, this function will have to
+    copy data in memory.
+
+    Parameters
+    ----------
+    fp : file_like object
+        An open, writable file object, or similar object with a
+        ``.write()`` method.
+    array : ndarray
+        The array to write to disk.
+    version : (int, int) or None, optional
+        The version number of the format. None means use the oldest
+        supported version that is able to store the data.  Default: None
+    allow_pickle : bool, optional
+        Whether to allow writing pickled data. Default: True
+    pickle_kwargs : dict, optional
+        Additional keyword arguments to pass to pickle.dump, excluding
+        'protocol'. These are only useful when pickling objects in object
+        arrays on Python 3 to Python 2 compatible format.
+
+    Raises
+    ------
+    ValueError
+        If the array cannot be persisted. This includes the case of
+        allow_pickle=False and array being an object array.
+    Various other errors
+        If the array contains Python objects as part of its dtype, the
+        process of pickling them may raise various errors if the objects
+        are not picklable.
+
+    """
+    _check_version(version)
+    _write_array_header(fp, header_data_from_array_1_0(array), version)
+
+    if array.itemsize == 0:
+        buffersize = 0
+    else:
+        # Set buffer size to 16 MiB to hide the Python loop overhead.
+        buffersize = max(16 * 1024 ** 2 // array.itemsize, 1)
+
+    if array.dtype.hasobject:
+        # We contain Python objects so we cannot write out the data
+        # directly.  Instead, we will pickle it out
+        if not allow_pickle:
+            raise ValueError("Object arrays cannot be saved when "
+                             "allow_pickle=False")
+        if pickle_kwargs is None:
+            pickle_kwargs = {}
+        pickle.dump(array, fp, protocol=3, **pickle_kwargs)
+    elif array.flags.f_contiguous and not array.flags.c_contiguous:
+        if isfileobj(fp):
+            array.T.tofile(fp)
+        else:
+            for chunk in numpy.nditer(
+                    array, flags=['external_loop', 'buffered', 'zerosize_ok'],
+                    buffersize=buffersize, order='F'):
+                fp.write(chunk.tobytes('C'))
+    else:
+        if isfileobj(fp):
+            array.tofile(fp)
+        else:
+            for chunk in numpy.nditer(
+                    array, flags=['external_loop', 'buffered', 'zerosize_ok'],
+                    buffersize=buffersize, order='C'):
+                fp.write(chunk.tobytes('C'))
+
+
+def read_array(fp, allow_pickle=False, pickle_kwargs=None, *,
+               max_header_size=_MAX_HEADER_SIZE):
+    """
+    Read an array from an NPY file.
+
+    Parameters
+    ----------
+    fp : file_like object
+        If this is not a real file object, then this may take extra memory
+        and time.
+    allow_pickle : bool, optional
+        Whether to allow writing pickled data. Default: False
+
+        .. versionchanged:: 1.16.3
+            Made default False in response to CVE-2019-6446.
+
+    pickle_kwargs : dict
+        Additional keyword arguments to pass to pickle.load. These are only
+        useful when loading object arrays saved on Python 2 when using
+        Python 3.
+    max_header_size : int, optional
+        Maximum allowed size of the header.  Large headers may not be safe
+        to load securely and thus require explicitly passing a larger value.
+        See :py:meth:`ast.literal_eval()` for details.
+        This option is ignored when `allow_pickle` is passed.  In that case
+        the file is by definition trusted and the limit is unnecessary.
+
+    Returns
+    -------
+    array : ndarray
+        The array from the data on disk.
+
+    Raises
+    ------
+    ValueError
+        If the data is invalid, or allow_pickle=False and the file contains
+        an object array.
+
+    """
+    if allow_pickle:
+        # Effectively ignore max_header_size, since `allow_pickle` indicates
+        # that the input is fully trusted.
+        max_header_size = 2**64
+
+    version = read_magic(fp)
+    _check_version(version)
+    shape, fortran_order, dtype = _read_array_header(
+            fp, version, max_header_size=max_header_size)
+    if len(shape) == 0:
+        count = 1
+    else:
+        count = numpy.multiply.reduce(shape, dtype=numpy.int64)
+
+    # Now read the actual data.
+    if dtype.hasobject:
+        # The array contained Python objects. We need to unpickle the data.
+        if not allow_pickle:
+            raise ValueError("Object arrays cannot be loaded when "
+                             "allow_pickle=False")
+        if pickle_kwargs is None:
+            pickle_kwargs = {}
+        try:
+            array = pickle.load(fp, **pickle_kwargs)
+        except UnicodeError as err:
+            # Friendlier error message
+            raise UnicodeError("Unpickling a python object failed: %r\n"
+                               "You may need to pass the encoding= option "
+                               "to numpy.load" % (err,)) from err
+    else:
+        if isfileobj(fp):
+            # We can use the fast fromfile() function.
+            array = numpy.fromfile(fp, dtype=dtype, count=count)
+        else:
+            # This is not a real file. We have to read it the
+            # memory-intensive way.
+            # crc32 module fails on reads greater than 2 ** 32 bytes,
+            # breaking large reads from gzip streams. Chunk reads to
+            # BUFFER_SIZE bytes to avoid issue and reduce memory overhead
+            # of the read. In non-chunked case count < max_read_count, so
+            # only one read is performed.
+
+            # Use np.ndarray instead of np.empty since the latter does
+            # not correctly instantiate zero-width string dtypes; see
+            # https://github.com/numpy/numpy/pull/6430
+            array = numpy.ndarray(count, dtype=dtype)
+
+            if dtype.itemsize > 0:
+                # If dtype.itemsize == 0 then there's nothing more to read
+                max_read_count = BUFFER_SIZE // min(BUFFER_SIZE, dtype.itemsize)
+
+                for i in range(0, count, max_read_count):
+                    read_count = min(max_read_count, count - i)
+                    read_size = int(read_count * dtype.itemsize)
+                    data = _read_bytes(fp, read_size, "array data")
+                    array[i:i+read_count] = numpy.frombuffer(data, dtype=dtype,
+                                                             count=read_count)
+
+        if fortran_order:
+            array.shape = shape[::-1]
+            array = array.transpose()
+        else:
+            array.shape = shape
+
+    return array
+
+
+def open_memmap(filename, mode='r+', dtype=None, shape=None,
+                fortran_order=False, version=None, *,
+                max_header_size=_MAX_HEADER_SIZE):
+    """
+    Open a .npy file as a memory-mapped array.
+
+    This may be used to read an existing file or create a new one.
+
+    Parameters
+    ----------
+    filename : str or path-like
+        The name of the file on disk.  This may *not* be a file-like
+        object.
+    mode : str, optional
+        The mode in which to open the file; the default is 'r+'.  In
+        addition to the standard file modes, 'c' is also accepted to mean
+        "copy on write."  See `memmap` for the available mode strings.
+    dtype : data-type, optional
+        The data type of the array if we are creating a new file in "write"
+        mode, if not, `dtype` is ignored.  The default value is None, which
+        results in a data-type of `float64`.
+    shape : tuple of int
+        The shape of the array if we are creating a new file in "write"
+        mode, in which case this parameter is required.  Otherwise, this
+        parameter is ignored and is thus optional.
+    fortran_order : bool, optional
+        Whether the array should be Fortran-contiguous (True) or
+        C-contiguous (False, the default) if we are creating a new file in
+        "write" mode.
+    version : tuple of int (major, minor) or None
+        If the mode is a "write" mode, then this is the version of the file
+        format used to create the file.  None means use the oldest
+        supported version that is able to store the data.  Default: None
+    max_header_size : int, optional
+        Maximum allowed size of the header.  Large headers may not be safe
+        to load securely and thus require explicitly passing a larger value.
+        See :py:meth:`ast.literal_eval()` for details.
+
+    Returns
+    -------
+    marray : memmap
+        The memory-mapped array.
+
+    Raises
+    ------
+    ValueError
+        If the data or the mode is invalid.
+    OSError
+        If the file is not found or cannot be opened correctly.
+
+    See Also
+    --------
+    numpy.memmap
+
+    """
+    if isfileobj(filename):
+        raise ValueError("Filename must be a string or a path-like object."
+                         "  Memmap cannot use existing file handles.")
+
+    if 'w' in mode:
+        # We are creating the file, not reading it.
+        # Check if we ought to create the file.
+        _check_version(version)
+        # Ensure that the given dtype is an authentic dtype object rather
+        # than just something that can be interpreted as a dtype object.
+        dtype = numpy.dtype(dtype)
+        if dtype.hasobject:
+            msg = "Array can't be memory-mapped: Python objects in dtype."
+            raise ValueError(msg)
+        d = dict(
+            descr=dtype_to_descr(dtype),
+            fortran_order=fortran_order,
+            shape=shape,
+        )
+        # If we got here, then it should be safe to create the file.
+        with open(os_fspath(filename), mode+'b') as fp:
+            _write_array_header(fp, d, version)
+            offset = fp.tell()
+    else:
+        # Read the header of the file first.
+        with open(os_fspath(filename), 'rb') as fp:
+            version = read_magic(fp)
+            _check_version(version)
+
+            shape, fortran_order, dtype = _read_array_header(
+                    fp, version, max_header_size=max_header_size)
+            if dtype.hasobject:
+                msg = "Array can't be memory-mapped: Python objects in dtype."
+                raise ValueError(msg)
+            offset = fp.tell()
+
+    if fortran_order:
+        order = 'F'
+    else:
+        order = 'C'
+
+    # We need to change a write-only mode to a read-write mode since we've
+    # already written data to the file.
+    if mode == 'w+':
+        mode = 'r+'
+
+    marray = numpy.memmap(filename, dtype=dtype, shape=shape, order=order,
+        mode=mode, offset=offset)
+
+    return marray
+
+
+def _read_bytes(fp, size, error_template="ran out of data"):
+    """
+    Read from file-like object until size bytes are read.
+    Raises ValueError if not EOF is encountered before size bytes are read.
+    Non-blocking objects only supported if they derive from io objects.
+
+    Required as e.g. ZipExtFile in python 2.6 can return less data than
+    requested.
+    """
+    data = bytes()
+    while True:
+        # io files (default in python3) return None or raise on
+        # would-block, python2 file will truncate, probably nothing can be
+        # done about that.  note that regular files can't be non-blocking
+        try:
+            r = fp.read(size - len(data))
+            data += r
+            if len(r) == 0 or len(data) == size:
+                break
+        except BlockingIOError:
+            pass
+    if len(data) != size:
+        msg = "EOF: reading %s, expected %d bytes got %d"
+        raise ValueError(msg % (error_template, size, len(data)))
+    else:
+        return data

.CondaPkg/env/Lib/site-packages/numpy/lib/format.pyi

@@ -0,0 +1,22 @@
+from typing import Any, Literal, Final
+
+__all__: list[str]
+
+EXPECTED_KEYS: Final[set[str]]
+MAGIC_PREFIX: Final[bytes]
+MAGIC_LEN: Literal[8]
+ARRAY_ALIGN: Literal[64]
+BUFFER_SIZE: Literal[262144]  # 2**18
+
+def magic(major, minor): ...
+def read_magic(fp): ...
+def dtype_to_descr(dtype): ...
+def descr_to_dtype(descr): ...
+def header_data_from_array_1_0(array): ...
+def write_array_header_1_0(fp, d): ...
+def write_array_header_2_0(fp, d): ...
+def read_array_header_1_0(fp): ...
+def read_array_header_2_0(fp): ...
+def write_array(fp, array, version=..., allow_pickle=..., pickle_kwargs=...): ...
+def read_array(fp, allow_pickle=..., pickle_kwargs=...): ...
+def open_memmap(filename, mode=..., dtype=..., shape=..., fortran_order=..., version=...): ...

.CondaPkg/env/Lib/site-packages/numpy/lib/function_base.pyi

@@ -0,0 +1,697 @@
+import sys
+from collections.abc import Sequence, Iterator, Callable, Iterable
+from typing import (
+    Literal as L,
+    Any,
+    TypeVar,
+    overload,
+    Protocol,
+    SupportsIndex,
+    SupportsInt,
+)
+
+if sys.version_info >= (3, 10):
+    from typing import TypeGuard
+else:
+    from typing_extensions import TypeGuard
+
+from numpy import (
+    vectorize as vectorize,
+    ufunc,
+    generic,
+    floating,
+    complexfloating,
+    intp,
+    float64,
+    complex128,
+    timedelta64,
+    datetime64,
+    object_,
+    _OrderKACF,
+)
+
+from numpy._typing import (
+    NDArray,
+    ArrayLike,
+    DTypeLike,
+    _ShapeLike,
+    _ScalarLike_co,
+    _DTypeLike,
+    _ArrayLike,
+    _ArrayLikeInt_co,
+    _ArrayLikeFloat_co,
+    _ArrayLikeComplex_co,
+    _ArrayLikeTD64_co,
+    _ArrayLikeDT64_co,
+    _ArrayLikeObject_co,
+    _FloatLike_co,
+    _ComplexLike_co,
+)
+
+from numpy.core.function_base import (
+    add_newdoc as add_newdoc,
+)
+
+from numpy.core.multiarray import (
+    add_docstring as add_docstring,
+    bincount as bincount,
+)
+
+from numpy.core.umath import _add_newdoc_ufunc
+
+_T = TypeVar("_T")
+_T_co = TypeVar("_T_co", covariant=True)
+_SCT = TypeVar("_SCT", bound=generic)
+_ArrayType = TypeVar("_ArrayType", bound=NDArray[Any])
+
+_2Tuple = tuple[_T, _T]
+
+class _TrimZerosSequence(Protocol[_T_co]):
+    def __len__(self) -> int: ...
+    def __getitem__(self, key: slice, /) -> _T_co: ...
+    def __iter__(self) -> Iterator[Any]: ...
+
+class _SupportsWriteFlush(Protocol):
+    def write(self, s: str, /) -> object: ...
+    def flush(self) -> object: ...
+
+__all__: list[str]
+
+# NOTE: This is in reality a re-export of `np.core.umath._add_newdoc_ufunc`
+def add_newdoc_ufunc(ufunc: ufunc, new_docstring: str, /) -> None: ...
+
+@overload
+def rot90(
+    m: _ArrayLike[_SCT],
+    k: int = ...,
+    axes: tuple[int, int] = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def rot90(
+    m: ArrayLike,
+    k: int = ...,
+    axes: tuple[int, int] = ...,
+) -> NDArray[Any]: ...
+
+@overload
+def flip(m: _SCT, axis: None = ...) -> _SCT: ...
+@overload
+def flip(m: _ScalarLike_co, axis: None = ...) -> Any: ...
+@overload
+def flip(m: _ArrayLike[_SCT], axis: None | _ShapeLike = ...) -> NDArray[_SCT]: ...
+@overload
+def flip(m: ArrayLike, axis: None | _ShapeLike = ...) -> NDArray[Any]: ...
+
+def iterable(y: object) -> TypeGuard[Iterable[Any]]: ...
+
+@overload
+def average(
+    a: _ArrayLikeFloat_co,
+    axis: None = ...,
+    weights: None | _ArrayLikeFloat_co= ...,
+    returned: L[False] = ...,
+    keepdims: L[False] = ...,
+) -> floating[Any]: ...
+@overload
+def average(
+    a: _ArrayLikeComplex_co,
+    axis: None = ...,
+    weights: None | _ArrayLikeComplex_co = ...,
+    returned: L[False] = ...,
+    keepdims: L[False] = ...,
+) -> complexfloating[Any, Any]: ...
+@overload
+def average(
+    a: _ArrayLikeObject_co,
+    axis: None = ...,
+    weights: None | Any = ...,
+    returned: L[False] = ...,
+    keepdims: L[False] = ...,
+) -> Any: ...
+@overload
+def average(
+    a: _ArrayLikeFloat_co,
+    axis: None = ...,
+    weights: None | _ArrayLikeFloat_co= ...,
+    returned: L[True] = ...,
+    keepdims: L[False] = ...,
+) -> _2Tuple[floating[Any]]: ...
+@overload
+def average(
+    a: _ArrayLikeComplex_co,
+    axis: None = ...,
+    weights: None | _ArrayLikeComplex_co = ...,
+    returned: L[True] = ...,
+    keepdims: L[False] = ...,
+) -> _2Tuple[complexfloating[Any, Any]]: ...
+@overload
+def average(
+    a: _ArrayLikeObject_co,
+    axis: None = ...,
+    weights: None | Any = ...,
+    returned: L[True] = ...,
+    keepdims: L[False] = ...,
+) -> _2Tuple[Any]: ...
+@overload
+def average(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | _ShapeLike = ...,
+    weights: None | Any = ...,
+    returned: L[False] = ...,
+    keepdims: bool = ...,
+) -> Any: ...
+@overload
+def average(
+    a: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    axis: None | _ShapeLike = ...,
+    weights: None | Any = ...,
+    returned: L[True] = ...,
+    keepdims: bool = ...,
+) -> _2Tuple[Any]: ...
+
+@overload
+def asarray_chkfinite(
+    a: _ArrayLike[_SCT],
+    dtype: None = ...,
+    order: _OrderKACF = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def asarray_chkfinite(
+    a: object,
+    dtype: None = ...,
+    order: _OrderKACF = ...,
+) -> NDArray[Any]: ...
+@overload
+def asarray_chkfinite(
+    a: Any,
+    dtype: _DTypeLike[_SCT],
+    order: _OrderKACF = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def asarray_chkfinite(
+    a: Any,
+    dtype: DTypeLike,
+    order: _OrderKACF = ...,
+) -> NDArray[Any]: ...
+
+# TODO: Use PEP 612 `ParamSpec` once mypy supports `Concatenate`
+# xref python/mypy#8645
+@overload
+def piecewise(
+    x: _ArrayLike[_SCT],
+    condlist: ArrayLike,
+    funclist: Sequence[Any | Callable[..., Any]],
+    *args: Any,
+    **kw: Any,
+) -> NDArray[_SCT]: ...
+@overload
+def piecewise(
+    x: ArrayLike,
+    condlist: ArrayLike,
+    funclist: Sequence[Any | Callable[..., Any]],
+    *args: Any,
+    **kw: Any,
+) -> NDArray[Any]: ...
+
+def select(
+    condlist: Sequence[ArrayLike],
+    choicelist: Sequence[ArrayLike],
+    default: ArrayLike = ...,
+) -> NDArray[Any]: ...
+
+@overload
+def copy(
+    a: _ArrayType,
+    order: _OrderKACF,
+    subok: L[True],
+) -> _ArrayType: ...
+@overload
+def copy(
+    a: _ArrayType,
+    order: _OrderKACF = ...,
+    *,
+    subok: L[True],
+) -> _ArrayType: ...
+@overload
+def copy(
+    a: _ArrayLike[_SCT],
+    order: _OrderKACF = ...,
+    subok: L[False] = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def copy(
+    a: ArrayLike,
+    order: _OrderKACF = ...,
+    subok: L[False] = ...,
+) -> NDArray[Any]: ...
+
+def gradient(
+    f: ArrayLike,
+    *varargs: ArrayLike,
+    axis: None | _ShapeLike = ...,
+    edge_order: L[1, 2] = ...,
+) -> Any: ...
+
+@overload
+def diff(
+    a: _T,
+    n: L[0],
+    axis: SupportsIndex = ...,
+    prepend: ArrayLike = ...,
+    append: ArrayLike = ...,
+) -> _T: ...
+@overload
+def diff(
+    a: ArrayLike,
+    n: int = ...,
+    axis: SupportsIndex = ...,
+    prepend: ArrayLike = ...,
+    append: ArrayLike = ...,
+) -> NDArray[Any]: ...
+
+@overload
+def interp(
+    x: _ArrayLikeFloat_co,
+    xp: _ArrayLikeFloat_co,
+    fp: _ArrayLikeFloat_co,
+    left: None | _FloatLike_co = ...,
+    right: None | _FloatLike_co = ...,
+    period: None | _FloatLike_co = ...,
+) -> NDArray[float64]: ...
+@overload
+def interp(
+    x: _ArrayLikeFloat_co,
+    xp: _ArrayLikeFloat_co,
+    fp: _ArrayLikeComplex_co,
+    left: None | _ComplexLike_co = ...,
+    right: None | _ComplexLike_co = ...,
+    period: None | _FloatLike_co = ...,
+) -> NDArray[complex128]: ...
+
+@overload
+def angle(z: _ComplexLike_co, deg: bool = ...) -> floating[Any]: ...
+@overload
+def angle(z: object_, deg: bool = ...) -> Any: ...
+@overload
+def angle(z: _ArrayLikeComplex_co, deg: bool = ...) -> NDArray[floating[Any]]: ...
+@overload
+def angle(z: _ArrayLikeObject_co, deg: bool = ...) -> NDArray[object_]: ...
+
+@overload
+def unwrap(
+    p: _ArrayLikeFloat_co,
+    discont: None | float = ...,
+    axis: int = ...,
+    *,
+    period: float = ...,
+) -> NDArray[floating[Any]]: ...
+@overload
+def unwrap(
+    p: _ArrayLikeObject_co,
+    discont: None | float = ...,
+    axis: int = ...,
+    *,
+    period: float = ...,
+) -> NDArray[object_]: ...
+
+def sort_complex(a: ArrayLike) -> NDArray[complexfloating[Any, Any]]: ...
+
+def trim_zeros(
+    filt: _TrimZerosSequence[_T],
+    trim: L["f", "b", "fb", "bf"] = ...,
+) -> _T: ...
+
+@overload
+def extract(condition: ArrayLike, arr: _ArrayLike[_SCT]) -> NDArray[_SCT]: ...
+@overload
+def extract(condition: ArrayLike, arr: ArrayLike) -> NDArray[Any]: ...
+
+def place(arr: NDArray[Any], mask: ArrayLike, vals: Any) -> None: ...
+
+def disp(
+    mesg: object,
+    device: None | _SupportsWriteFlush = ...,
+    linefeed: bool = ...,
+) -> None: ...
+
+@overload
+def cov(
+    m: _ArrayLikeFloat_co,
+    y: None | _ArrayLikeFloat_co = ...,
+    rowvar: bool = ...,
+    bias: bool = ...,
+    ddof: None | SupportsIndex | SupportsInt = ...,
+    fweights: None | ArrayLike = ...,
+    aweights: None | ArrayLike = ...,
+    *,
+    dtype: None = ...,
+) -> NDArray[floating[Any]]: ...
+@overload
+def cov(
+    m: _ArrayLikeComplex_co,
+    y: None | _ArrayLikeComplex_co = ...,
+    rowvar: bool = ...,
+    bias: bool = ...,
+    ddof: None | SupportsIndex | SupportsInt = ...,
+    fweights: None | ArrayLike = ...,
+    aweights: None | ArrayLike = ...,
+    *,
+    dtype: None = ...,
+) -> NDArray[complexfloating[Any, Any]]: ...
+@overload
+def cov(
+    m: _ArrayLikeComplex_co,
+    y: None | _ArrayLikeComplex_co = ...,
+    rowvar: bool = ...,
+    bias: bool = ...,
+    ddof: None | SupportsIndex | SupportsInt = ...,
+    fweights: None | ArrayLike = ...,
+    aweights: None | ArrayLike = ...,
+    *,
+    dtype: _DTypeLike[_SCT],
+) -> NDArray[_SCT]: ...
+@overload
+def cov(
+    m: _ArrayLikeComplex_co,
+    y: None | _ArrayLikeComplex_co = ...,
+    rowvar: bool = ...,
+    bias: bool = ...,
+    ddof: None | SupportsIndex | SupportsInt = ...,
+    fweights: None | ArrayLike = ...,
+    aweights: None | ArrayLike = ...,
+    *,
+    dtype: DTypeLike,
+) -> NDArray[Any]: ...
+
+# NOTE `bias` and `ddof` have been deprecated
+@overload
+def corrcoef(
+    m: _ArrayLikeFloat_co,
+    y: None | _ArrayLikeFloat_co = ...,
+    rowvar: bool = ...,
+    *,
+    dtype: None = ...,
+) -> NDArray[floating[Any]]: ...
+@overload
+def corrcoef(
+    m: _ArrayLikeComplex_co,
+    y: None | _ArrayLikeComplex_co = ...,
+    rowvar: bool = ...,
+    *,
+    dtype: None = ...,
+) -> NDArray[complexfloating[Any, Any]]: ...
+@overload
+def corrcoef(
+    m: _ArrayLikeComplex_co,
+    y: None | _ArrayLikeComplex_co = ...,
+    rowvar: bool = ...,
+    *,
+    dtype: _DTypeLike[_SCT],
+) -> NDArray[_SCT]: ...
+@overload
+def corrcoef(
+    m: _ArrayLikeComplex_co,
+    y: None | _ArrayLikeComplex_co = ...,
+    rowvar: bool = ...,
+    *,
+    dtype: DTypeLike,
+) -> NDArray[Any]: ...
+
+def blackman(M: _FloatLike_co) -> NDArray[floating[Any]]: ...
+
+def bartlett(M: _FloatLike_co) -> NDArray[floating[Any]]: ...
+
+def hanning(M: _FloatLike_co) -> NDArray[floating[Any]]: ...
+
+def hamming(M: _FloatLike_co) -> NDArray[floating[Any]]: ...
+
+def i0(x: _ArrayLikeFloat_co) -> NDArray[floating[Any]]: ...
+
+def kaiser(
+    M: _FloatLike_co,
+    beta: _FloatLike_co,
+) -> NDArray[floating[Any]]: ...
+
+@overload
+def sinc(x: _FloatLike_co) -> floating[Any]: ...
+@overload
+def sinc(x: _ComplexLike_co) -> complexfloating[Any, Any]: ...
+@overload
+def sinc(x: _ArrayLikeFloat_co) -> NDArray[floating[Any]]: ...
+@overload
+def sinc(x: _ArrayLikeComplex_co) -> NDArray[complexfloating[Any, Any]]: ...
+
+# NOTE: Deprecated
+# def msort(a: ArrayLike) -> NDArray[Any]: ...
+
+@overload
+def median(
+    a: _ArrayLikeFloat_co,
+    axis: None = ...,
+    out: None = ...,
+    overwrite_input: bool = ...,
+    keepdims: L[False] = ...,
+) -> floating[Any]: ...
+@overload
+def median(
+    a: _ArrayLikeComplex_co,
+    axis: None = ...,
+    out: None = ...,
+    overwrite_input: bool = ...,
+    keepdims: L[False] = ...,
+) -> complexfloating[Any, Any]: ...
+@overload
+def median(
+    a: _ArrayLikeTD64_co,
+    axis: None = ...,
+    out: None = ...,
+    overwrite_input: bool = ...,
+    keepdims: L[False] = ...,
+) -> timedelta64: ...
+@overload
+def median(
+    a: _ArrayLikeObject_co,
+    axis: None = ...,
+    out: None = ...,
+    overwrite_input: bool = ...,
+    keepdims: L[False] = ...,
+) -> Any: ...
+@overload
+def median(
+    a: _ArrayLikeFloat_co | _ArrayLikeComplex_co | _ArrayLikeTD64_co | _ArrayLikeObject_co,
+    axis: None | _ShapeLike = ...,
+    out: None = ...,
+    overwrite_input: bool = ...,
+    keepdims: bool = ...,
+) -> Any: ...
+@overload
+def median(
+    a: _ArrayLikeFloat_co | _ArrayLikeComplex_co | _ArrayLikeTD64_co | _ArrayLikeObject_co,
+    axis: None | _ShapeLike = ...,
+    out: _ArrayType = ...,
+    overwrite_input: bool = ...,
+    keepdims: bool = ...,
+) -> _ArrayType: ...
+
+_MethodKind = L[
+    "inverted_cdf",
+    "averaged_inverted_cdf",
+    "closest_observation",
+    "interpolated_inverted_cdf",
+    "hazen",
+    "weibull",
+    "linear",
+    "median_unbiased",
+    "normal_unbiased",
+    "lower",
+    "higher",
+    "midpoint",
+    "nearest",
+]
+
+@overload
+def percentile(
+    a: _ArrayLikeFloat_co,
+    q: _FloatLike_co,
+    axis: None = ...,
+    out: None = ...,
+    overwrite_input: bool = ...,
+    method: _MethodKind = ...,
+    keepdims: L[False] = ...,
+) -> floating[Any]: ...
+@overload
+def percentile(
+    a: _ArrayLikeComplex_co,
+    q: _FloatLike_co,
+    axis: None = ...,
+    out: None = ...,
+    overwrite_input: bool = ...,
+    method: _MethodKind = ...,
+    keepdims: L[False] = ...,
+) -> complexfloating[Any, Any]: ...
+@overload
+def percentile(
+    a: _ArrayLikeTD64_co,
+    q: _FloatLike_co,
+    axis: None = ...,
+    out: None = ...,
+    overwrite_input: bool = ...,
+    method: _MethodKind = ...,
+    keepdims: L[False] = ...,
+) -> timedelta64: ...
+@overload
+def percentile(
+    a: _ArrayLikeDT64_co,
+    q: _FloatLike_co,
+    axis: None = ...,
+    out: None = ...,
+    overwrite_input: bool = ...,
+    method: _MethodKind = ...,
+    keepdims: L[False] = ...,
+) -> datetime64: ...
+@overload
+def percentile(
+    a: _ArrayLikeObject_co,
+    q: _FloatLike_co,
+    axis: None = ...,
+    out: None = ...,
+    overwrite_input: bool = ...,
+    method: _MethodKind = ...,
+    keepdims: L[False] = ...,
+) -> Any: ...
+@overload
+def percentile(
+    a: _ArrayLikeFloat_co,
+    q: _ArrayLikeFloat_co,
+    axis: None = ...,
+    out: None = ...,
+    overwrite_input: bool = ...,
+    method: _MethodKind = ...,
+    keepdims: L[False] = ...,
+) -> NDArray[floating[Any]]: ...
+@overload
+def percentile(
+    a: _ArrayLikeComplex_co,
+    q: _ArrayLikeFloat_co,
+    axis: None = ...,
+    out: None = ...,
+    overwrite_input: bool = ...,
+    method: _MethodKind = ...,
+    keepdims: L[False] = ...,
+) -> NDArray[complexfloating[Any, Any]]: ...
+@overload
+def percentile(
+    a: _ArrayLikeTD64_co,
+    q: _ArrayLikeFloat_co,
+    axis: None = ...,
+    out: None = ...,
+    overwrite_input: bool = ...,
+    method: _MethodKind = ...,
+    keepdims: L[False] = ...,
+) -> NDArray[timedelta64]: ...
+@overload
+def percentile(
+    a: _ArrayLikeDT64_co,
+    q: _ArrayLikeFloat_co,
+    axis: None = ...,
+    out: None = ...,
+    overwrite_input: bool = ...,
+    method: _MethodKind = ...,
+    keepdims: L[False] = ...,
+) -> NDArray[datetime64]: ...
+@overload
+def percentile(
+    a: _ArrayLikeObject_co,
+    q: _ArrayLikeFloat_co,
+    axis: None = ...,
+    out: None = ...,
+    overwrite_input: bool = ...,
+    method: _MethodKind = ...,
+    keepdims: L[False] = ...,
+) -> NDArray[object_]: ...
+@overload
+def percentile(
+    a: _ArrayLikeComplex_co | _ArrayLikeTD64_co | _ArrayLikeTD64_co | _ArrayLikeObject_co,
+    q: _ArrayLikeFloat_co,
+    axis: None | _ShapeLike = ...,
+    out: None = ...,
+    overwrite_input: bool = ...,
+    method: _MethodKind = ...,
+    keepdims: bool = ...,
+) -> Any: ...
+@overload
+def percentile(
+    a: _ArrayLikeComplex_co | _ArrayLikeTD64_co | _ArrayLikeTD64_co | _ArrayLikeObject_co,
+    q: _ArrayLikeFloat_co,
+    axis: None | _ShapeLike = ...,
+    out: _ArrayType = ...,
+    overwrite_input: bool = ...,
+    method: _MethodKind = ...,
+    keepdims: bool = ...,
+) -> _ArrayType: ...
+
+# NOTE: Not an alias, but they do have identical signatures
+# (that we can reuse)
+quantile = percentile
+
+# TODO: Returns a scalar for <= 1D array-likes; returns an ndarray otherwise
+def trapz(
+    y: _ArrayLikeComplex_co | _ArrayLikeTD64_co | _ArrayLikeObject_co,
+    x: None | _ArrayLikeComplex_co | _ArrayLikeTD64_co | _ArrayLikeObject_co = ...,
+    dx: float = ...,
+    axis: SupportsIndex = ...,
+) -> Any: ...
+
+def meshgrid(
+    *xi: ArrayLike,
+    copy: bool = ...,
+    sparse: bool = ...,
+    indexing: L["xy", "ij"] = ...,
+) -> list[NDArray[Any]]: ...
+
+@overload
+def delete(
+    arr: _ArrayLike[_SCT],
+    obj: slice | _ArrayLikeInt_co,
+    axis: None | SupportsIndex = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def delete(
+    arr: ArrayLike,
+    obj: slice | _ArrayLikeInt_co,
+    axis: None | SupportsIndex = ...,
+) -> NDArray[Any]: ...
+
+@overload
+def insert(
+    arr: _ArrayLike[_SCT],
+    obj: slice | _ArrayLikeInt_co,
+    values: ArrayLike,
+    axis: None | SupportsIndex = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def insert(
+    arr: ArrayLike,
+    obj: slice | _ArrayLikeInt_co,
+    values: ArrayLike,
+    axis: None | SupportsIndex = ...,
+) -> NDArray[Any]: ...
+
+def append(
+    arr: ArrayLike,
+    values: ArrayLike,
+    axis: None | SupportsIndex = ...,
+) -> NDArray[Any]: ...
+
+@overload
+def digitize(
+    x: _FloatLike_co,
+    bins: _ArrayLikeFloat_co,
+    right: bool = ...,
+) -> intp: ...
+@overload
+def digitize(
+    x: _ArrayLikeFloat_co,
+    bins: _ArrayLikeFloat_co,
+    right: bool = ...,
+) -> NDArray[intp]: ...

.CondaPkg/env/Lib/site-packages/numpy/lib/histograms.pyi

@@ -0,0 +1,47 @@
+from collections.abc import Sequence
+from typing import (
+    Literal as L,
+    Any,
+    SupportsIndex,
+)
+
+from numpy._typing import (
+    NDArray,
+    ArrayLike,
+)
+
+_BinKind = L[
+    "stone",
+    "auto",
+    "doane",
+    "fd",
+    "rice",
+    "scott",
+    "sqrt",
+    "sturges",
+]
+
+__all__: list[str]
+
+def histogram_bin_edges(
+    a: ArrayLike,
+    bins: _BinKind | SupportsIndex | ArrayLike = ...,
+    range: None | tuple[float, float] = ...,
+    weights: None | ArrayLike = ...,
+) -> NDArray[Any]: ...
+
+def histogram(
+    a: ArrayLike,
+    bins: _BinKind | SupportsIndex | ArrayLike = ...,
+    range: None | tuple[float, float] = ...,
+    density: bool = ...,
+    weights: None | ArrayLike = ...,
+) -> tuple[NDArray[Any], NDArray[Any]]: ...
+
+def histogramdd(
+    sample: ArrayLike,
+    bins: SupportsIndex | ArrayLike = ...,
+    range: Sequence[tuple[float, float]] = ...,
+    density: None | bool = ...,
+    weights: None | ArrayLike = ...,
+) -> tuple[NDArray[Any], list[NDArray[Any]]]: ...

.CondaPkg/env/Lib/site-packages/numpy/lib/index_tricks.pyi

@@ -0,0 +1,162 @@
+from collections.abc import Sequence
+from typing import (
+    Any,
+    TypeVar,
+    Generic,
+    overload,
+    Literal,
+    SupportsIndex,
+)
+
+from numpy import (
+    # Circumvent a naming conflict with `AxisConcatenator.matrix`
+    matrix as _Matrix,
+    ndenumerate as ndenumerate,
+    ndindex as ndindex,
+    ndarray,
+    dtype,
+    integer,
+    str_,
+    bytes_,
+    bool_,
+    int_,
+    float_,
+    complex_,
+    intp,
+    _OrderCF,
+    _ModeKind,
+)
+from numpy._typing import (
+    # Arrays
+    ArrayLike,
+    _NestedSequence,
+    _FiniteNestedSequence,
+    NDArray,
+    _ArrayLikeInt,
+
+    # DTypes
+    DTypeLike,
+    _SupportsDType,
+
+    # Shapes
+    _ShapeLike,
+)
+
+from numpy.core.multiarray import (
+    unravel_index as unravel_index,
+    ravel_multi_index as ravel_multi_index,
+)
+
+_T = TypeVar("_T")
+_DType = TypeVar("_DType", bound=dtype[Any])
+_BoolType = TypeVar("_BoolType", Literal[True], Literal[False])
+_TupType = TypeVar("_TupType", bound=tuple[Any, ...])
+_ArrayType = TypeVar("_ArrayType", bound=ndarray[Any, Any])
+
+__all__: list[str]
+
+@overload
+def ix_(*args: _FiniteNestedSequence[_SupportsDType[_DType]]) -> tuple[ndarray[Any, _DType], ...]: ...
+@overload
+def ix_(*args: str | _NestedSequence[str]) -> tuple[NDArray[str_], ...]: ...
+@overload
+def ix_(*args: bytes | _NestedSequence[bytes]) -> tuple[NDArray[bytes_], ...]: ...
+@overload
+def ix_(*args: bool | _NestedSequence[bool]) -> tuple[NDArray[bool_], ...]: ...
+@overload
+def ix_(*args: int | _NestedSequence[int]) -> tuple[NDArray[int_], ...]: ...
+@overload
+def ix_(*args: float | _NestedSequence[float]) -> tuple[NDArray[float_], ...]: ...
+@overload
+def ix_(*args: complex | _NestedSequence[complex]) -> tuple[NDArray[complex_], ...]: ...
+
+class nd_grid(Generic[_BoolType]):
+    sparse: _BoolType
+    def __init__(self, sparse: _BoolType = ...) -> None: ...
+    @overload
+    def __getitem__(
+        self: nd_grid[Literal[False]],
+        key: slice | Sequence[slice],
+    ) -> NDArray[Any]: ...
+    @overload
+    def __getitem__(
+        self: nd_grid[Literal[True]],
+        key: slice | Sequence[slice],
+    ) -> list[NDArray[Any]]: ...
+
+class MGridClass(nd_grid[Literal[False]]):
+    def __init__(self) -> None: ...
+
+mgrid: MGridClass
+
+class OGridClass(nd_grid[Literal[True]]):
+    def __init__(self) -> None: ...
+
+ogrid: OGridClass
+
+class AxisConcatenator:
+    axis: int
+    matrix: bool
+    ndmin: int
+    trans1d: int
+    def __init__(
+        self,
+        axis: int = ...,
+        matrix: bool = ...,
+        ndmin: int = ...,
+        trans1d: int = ...,
+    ) -> None: ...
+    @staticmethod
+    @overload
+    def concatenate(  # type: ignore[misc]
+        *a: ArrayLike, axis: SupportsIndex = ..., out: None = ...
+    ) -> NDArray[Any]: ...
+    @staticmethod
+    @overload
+    def concatenate(
+        *a: ArrayLike, axis: SupportsIndex = ..., out: _ArrayType = ...
+    ) -> _ArrayType: ...
+    @staticmethod
+    def makemat(
+        data: ArrayLike, dtype: DTypeLike = ..., copy: bool = ...
+    ) -> _Matrix: ...
+
+    # TODO: Sort out this `__getitem__` method
+    def __getitem__(self, key: Any) -> Any: ...
+
+class RClass(AxisConcatenator):
+    axis: Literal[0]
+    matrix: Literal[False]
+    ndmin: Literal[1]
+    trans1d: Literal[-1]
+    def __init__(self) -> None: ...
+
+r_: RClass
+
+class CClass(AxisConcatenator):
+    axis: Literal[-1]
+    matrix: Literal[False]
+    ndmin: Literal[2]
+    trans1d: Literal[0]
+    def __init__(self) -> None: ...
+
+c_: CClass
+
+class IndexExpression(Generic[_BoolType]):
+    maketuple: _BoolType
+    def __init__(self, maketuple: _BoolType) -> None: ...
+    @overload
+    def __getitem__(self, item: _TupType) -> _TupType: ...  # type: ignore[misc]
+    @overload
+    def __getitem__(self: IndexExpression[Literal[True]], item: _T) -> tuple[_T]: ...
+    @overload
+    def __getitem__(self: IndexExpression[Literal[False]], item: _T) -> _T: ...
+
+index_exp: IndexExpression[Literal[True]]
+s_: IndexExpression[Literal[False]]
+
+def fill_diagonal(a: ndarray[Any, Any], val: Any, wrap: bool = ...) -> None: ...
+def diag_indices(n: int, ndim: int = ...) -> tuple[NDArray[int_], ...]: ...
+def diag_indices_from(arr: ArrayLike) -> tuple[NDArray[int_], ...]: ...
+
+# NOTE: see `numpy/__init__.pyi` for `ndenumerate` and `ndindex`

.CondaPkg/env/Lib/site-packages/numpy/lib/mixins.py

@@ -0,0 +1,176 @@
+"""Mixin classes for custom array types that don't inherit from ndarray."""
+from numpy.core import umath as um
+
+
+__all__ = ['NDArrayOperatorsMixin']
+
+
+def _disables_array_ufunc(obj):
+    """True when __array_ufunc__ is set to None."""
+    try:
+        return obj.__array_ufunc__ is None
+    except AttributeError:
+        return False
+
+
+def _binary_method(ufunc, name):
+    """Implement a forward binary method with a ufunc, e.g., __add__."""
+    def func(self, other):
+        if _disables_array_ufunc(other):
+            return NotImplemented
+        return ufunc(self, other)
+    func.__name__ = '__{}__'.format(name)
+    return func
+
+
+def _reflected_binary_method(ufunc, name):
+    """Implement a reflected binary method with a ufunc, e.g., __radd__."""
+    def func(self, other):
+        if _disables_array_ufunc(other):
+            return NotImplemented
+        return ufunc(other, self)
+    func.__name__ = '__r{}__'.format(name)
+    return func
+
+
+def _inplace_binary_method(ufunc, name):
+    """Implement an in-place binary method with a ufunc, e.g., __iadd__."""
+    def func(self, other):
+        return ufunc(self, other, out=(self,))
+    func.__name__ = '__i{}__'.format(name)
+    return func
+
+
+def _numeric_methods(ufunc, name):
+    """Implement forward, reflected and inplace binary methods with a ufunc."""
+    return (_binary_method(ufunc, name),
+            _reflected_binary_method(ufunc, name),
+            _inplace_binary_method(ufunc, name))
+
+
+def _unary_method(ufunc, name):
+    """Implement a unary special method with a ufunc."""
+    def func(self):
+        return ufunc(self)
+    func.__name__ = '__{}__'.format(name)
+    return func
+
+
+class NDArrayOperatorsMixin:
+    """Mixin defining all operator special methods using __array_ufunc__.
+
+    This class implements the special methods for almost all of Python's
+    builtin operators defined in the `operator` module, including comparisons
+    (``==``, ``>``, etc.) and arithmetic (``+``, ``*``, ``-``, etc.), by
+    deferring to the ``__array_ufunc__`` method, which subclasses must
+    implement.
+
+    It is useful for writing classes that do not inherit from `numpy.ndarray`,
+    but that should support arithmetic and numpy universal functions like
+    arrays as described in `A Mechanism for Overriding Ufuncs
+    <https://numpy.org/neps/nep-0013-ufunc-overrides.html>`_.
+
+    As an trivial example, consider this implementation of an ``ArrayLike``
+    class that simply wraps a NumPy array and ensures that the result of any
+    arithmetic operation is also an ``ArrayLike`` object::
+
+        class ArrayLike(np.lib.mixins.NDArrayOperatorsMixin):
+            def __init__(self, value):
+                self.value = np.asarray(value)
+
+            # One might also consider adding the built-in list type to this
+            # list, to support operations like np.add(array_like, list)
+            _HANDLED_TYPES = (np.ndarray, numbers.Number)
+
+            def __array_ufunc__(self, ufunc, method, *inputs, **kwargs):
+                out = kwargs.get('out', ())
+                for x in inputs + out:
+                    # Only support operations with instances of _HANDLED_TYPES.
+                    # Use ArrayLike instead of type(self) for isinstance to
+                    # allow subclasses that don't override __array_ufunc__ to
+                    # handle ArrayLike objects.
+                    if not isinstance(x, self._HANDLED_TYPES + (ArrayLike,)):
+                        return NotImplemented
+
+                # Defer to the implementation of the ufunc on unwrapped values.
+                inputs = tuple(x.value if isinstance(x, ArrayLike) else x
+                               for x in inputs)
+                if out:
+                    kwargs['out'] = tuple(
+                        x.value if isinstance(x, ArrayLike) else x
+                        for x in out)
+                result = getattr(ufunc, method)(*inputs, **kwargs)
+
+                if type(result) is tuple:
+                    # multiple return values
+                    return tuple(type(self)(x) for x in result)
+                elif method == 'at':
+                    # no return value
+                    return None
+                else:
+                    # one return value
+                    return type(self)(result)
+
+            def __repr__(self):
+                return '%s(%r)' % (type(self).__name__, self.value)
+
+    In interactions between ``ArrayLike`` objects and numbers or numpy arrays,
+    the result is always another ``ArrayLike``:
+
+        >>> x = ArrayLike([1, 2, 3])
+        >>> x - 1
+        ArrayLike(array([0, 1, 2]))
+        >>> 1 - x
+        ArrayLike(array([ 0, -1, -2]))
+        >>> np.arange(3) - x
+        ArrayLike(array([-1, -1, -1]))
+        >>> x - np.arange(3)
+        ArrayLike(array([1, 1, 1]))
+
+    Note that unlike ``numpy.ndarray``, ``ArrayLike`` does not allow operations
+    with arbitrary, unrecognized types. This ensures that interactions with
+    ArrayLike preserve a well-defined casting hierarchy.
+
+    .. versionadded:: 1.13
+    """
+    # Like np.ndarray, this mixin class implements "Option 1" from the ufunc
+    # overrides NEP.
+
+    # comparisons don't have reflected and in-place versions
+    __lt__ = _binary_method(um.less, 'lt')
+    __le__ = _binary_method(um.less_equal, 'le')
+    __eq__ = _binary_method(um.equal, 'eq')
+    __ne__ = _binary_method(um.not_equal, 'ne')
+    __gt__ = _binary_method(um.greater, 'gt')
+    __ge__ = _binary_method(um.greater_equal, 'ge')
+
+    # numeric methods
+    __add__, __radd__, __iadd__ = _numeric_methods(um.add, 'add')
+    __sub__, __rsub__, __isub__ = _numeric_methods(um.subtract, 'sub')
+    __mul__, __rmul__, __imul__ = _numeric_methods(um.multiply, 'mul')
+    __matmul__, __rmatmul__, __imatmul__ = _numeric_methods(
+        um.matmul, 'matmul')
+    # Python 3 does not use __div__, __rdiv__, or __idiv__
+    __truediv__, __rtruediv__, __itruediv__ = _numeric_methods(
+        um.true_divide, 'truediv')
+    __floordiv__, __rfloordiv__, __ifloordiv__ = _numeric_methods(
+        um.floor_divide, 'floordiv')
+    __mod__, __rmod__, __imod__ = _numeric_methods(um.remainder, 'mod')
+    __divmod__ = _binary_method(um.divmod, 'divmod')
+    __rdivmod__ = _reflected_binary_method(um.divmod, 'divmod')
+    # __idivmod__ does not exist
+    # TODO: handle the optional third argument for __pow__?
+    __pow__, __rpow__, __ipow__ = _numeric_methods(um.power, 'pow')
+    __lshift__, __rlshift__, __ilshift__ = _numeric_methods(
+        um.left_shift, 'lshift')
+    __rshift__, __rrshift__, __irshift__ = _numeric_methods(
+        um.right_shift, 'rshift')
+    __and__, __rand__, __iand__ = _numeric_methods(um.bitwise_and, 'and')
+    __xor__, __rxor__, __ixor__ = _numeric_methods(um.bitwise_xor, 'xor')
+    __or__, __ror__, __ior__ = _numeric_methods(um.bitwise_or, 'or')
+
+    # unary methods
+    __neg__ = _unary_method(um.negative, 'neg')
+    __pos__ = _unary_method(um.positive, 'pos')
+    __abs__ = _unary_method(um.absolute, 'abs')
+    __invert__ = _unary_method(um.invert, 'invert')

.CondaPkg/env/Lib/site-packages/numpy/lib/mixins.pyi

@@ -0,0 +1,74 @@
+from abc import ABCMeta, abstractmethod
+from typing import Literal as L, Any
+
+from numpy import ufunc
+
+__all__: list[str]
+
+# NOTE: `NDArrayOperatorsMixin` is not formally an abstract baseclass,
+# even though it's reliant on subclasses implementing `__array_ufunc__`
+
+# NOTE: The accepted input- and output-types of the various dunders are
+# completely dependent on how `__array_ufunc__` is implemented.
+# As such, only little type safety can be provided here.
+
+class NDArrayOperatorsMixin(metaclass=ABCMeta):
+    @abstractmethod
+    def __array_ufunc__(
+        self,
+        ufunc: ufunc,
+        method: L["__call__", "reduce", "reduceat", "accumulate", "outer", "inner"],
+        *inputs: Any,
+        **kwargs: Any,
+    ) -> Any: ...
+    def __lt__(self, other: Any) -> Any: ...
+    def __le__(self, other: Any) -> Any: ...
+    def __eq__(self, other: Any) -> Any: ...
+    def __ne__(self, other: Any) -> Any: ...
+    def __gt__(self, other: Any) -> Any: ...
+    def __ge__(self, other: Any) -> Any: ...
+    def __add__(self, other: Any) -> Any: ...
+    def __radd__(self, other: Any) -> Any: ...
+    def __iadd__(self, other: Any) -> Any: ...
+    def __sub__(self, other: Any) -> Any: ...
+    def __rsub__(self, other: Any) -> Any: ...
+    def __isub__(self, other: Any) -> Any: ...
+    def __mul__(self, other: Any) -> Any: ...
+    def __rmul__(self, other: Any) -> Any: ...
+    def __imul__(self, other: Any) -> Any: ...
+    def __matmul__(self, other: Any) -> Any: ...
+    def __rmatmul__(self, other: Any) -> Any: ...
+    def __imatmul__(self, other: Any) -> Any: ...
+    def __truediv__(self, other: Any) -> Any: ...
+    def __rtruediv__(self, other: Any) -> Any: ...
+    def __itruediv__(self, other: Any) -> Any: ...
+    def __floordiv__(self, other: Any) -> Any: ...
+    def __rfloordiv__(self, other: Any) -> Any: ...
+    def __ifloordiv__(self, other: Any) -> Any: ...
+    def __mod__(self, other: Any) -> Any: ...
+    def __rmod__(self, other: Any) -> Any: ...
+    def __imod__(self, other: Any) -> Any: ...
+    def __divmod__(self, other: Any) -> Any: ...
+    def __rdivmod__(self, other: Any) -> Any: ...
+    def __pow__(self, other: Any) -> Any: ...
+    def __rpow__(self, other: Any) -> Any: ...
+    def __ipow__(self, other: Any) -> Any: ...
+    def __lshift__(self, other: Any) -> Any: ...
+    def __rlshift__(self, other: Any) -> Any: ...
+    def __ilshift__(self, other: Any) -> Any: ...
+    def __rshift__(self, other: Any) -> Any: ...
+    def __rrshift__(self, other: Any) -> Any: ...
+    def __irshift__(self, other: Any) -> Any: ...
+    def __and__(self, other: Any) -> Any: ...
+    def __rand__(self, other: Any) -> Any: ...
+    def __iand__(self, other: Any) -> Any: ...
+    def __xor__(self, other: Any) -> Any: ...
+    def __rxor__(self, other: Any) -> Any: ...
+    def __ixor__(self, other: Any) -> Any: ...
+    def __or__(self, other: Any) -> Any: ...
+    def __ror__(self, other: Any) -> Any: ...
+    def __ior__(self, other: Any) -> Any: ...
+    def __neg__(self) -> Any: ...
+    def __pos__(self) -> Any: ...
+    def __abs__(self) -> Any: ...
+    def __invert__(self) -> Any: ...

.CondaPkg/env/Lib/site-packages/numpy/lib/nanfunctions.pyi

@@ -0,0 +1,38 @@
+from numpy.core.fromnumeric import (
+    amin,
+    amax,
+    argmin,
+    argmax,
+    sum,
+    prod,
+    cumsum,
+    cumprod,
+    mean,
+    var,
+    std
+)
+
+from numpy.lib.function_base import (
+    median,
+    percentile,
+    quantile,
+)
+
+__all__: list[str]
+
+# NOTE: In reaility these functions are not aliases but distinct functions
+# with identical signatures.
+nanmin = amin
+nanmax = amax
+nanargmin = argmin
+nanargmax = argmax
+nansum = sum
+nanprod = prod
+nancumsum = cumsum
+nancumprod = cumprod
+nanmean = mean
+nanvar = var
+nanstd = std
+nanmedian = median
+nanpercentile = percentile
+nanquantile = quantile

.CondaPkg/env/Lib/site-packages/numpy/lib/npyio.pyi

@@ -0,0 +1,327 @@
+import os
+import sys
+import zipfile
+import types
+from re import Pattern
+from collections.abc import Collection, Mapping, Iterator, Sequence, Callable, Iterable
+from typing import (
+    Literal as L,
+    Any,
+    TypeVar,
+    Generic,
+    IO,
+    overload,
+    Protocol,
+)
+
+from numpy import (
+    DataSource as DataSource,
+    ndarray,
+    recarray,
+    dtype,
+    generic,
+    float64,
+    void,
+    record,
+)
+
+from numpy.ma.mrecords import MaskedRecords
+from numpy._typing import (
+    ArrayLike,
+    DTypeLike,
+    NDArray,
+    _DTypeLike,
+    _SupportsArrayFunc,
+)
+
+from numpy.core.multiarray import (
+    packbits as packbits,
+    unpackbits as unpackbits,
+)
+
+_T = TypeVar("_T")
+_T_contra = TypeVar("_T_contra", contravariant=True)
+_T_co = TypeVar("_T_co", covariant=True)
+_SCT = TypeVar("_SCT", bound=generic)
+_CharType_co = TypeVar("_CharType_co", str, bytes, covariant=True)
+_CharType_contra = TypeVar("_CharType_contra", str, bytes, contravariant=True)
+
+class _SupportsGetItem(Protocol[_T_contra, _T_co]):
+    def __getitem__(self, key: _T_contra, /) -> _T_co: ...
+
+class _SupportsRead(Protocol[_CharType_co]):
+    def read(self) -> _CharType_co: ...
+
+class _SupportsReadSeek(Protocol[_CharType_co]):
+    def read(self, n: int, /) -> _CharType_co: ...
+    def seek(self, offset: int, whence: int, /) -> object: ...
+
+class _SupportsWrite(Protocol[_CharType_contra]):
+    def write(self, s: _CharType_contra, /) -> object: ...
+
+__all__: list[str]
+
+class BagObj(Generic[_T_co]):
+    def __init__(self, obj: _SupportsGetItem[str, _T_co]) -> None: ...
+    def __getattribute__(self, key: str) -> _T_co: ...
+    def __dir__(self) -> list[str]: ...
+
+class NpzFile(Mapping[str, NDArray[Any]]):
+    zip: zipfile.ZipFile
+    fid: None | IO[str]
+    files: list[str]
+    allow_pickle: bool
+    pickle_kwargs: None | Mapping[str, Any]
+    # Represent `f` as a mutable property so we can access the type of `self`
+    @property
+    def f(self: _T) -> BagObj[_T]: ...
+    @f.setter
+    def f(self: _T, value: BagObj[_T]) -> None: ...
+    def __init__(
+        self,
+        fid: IO[str],
+        own_fid: bool = ...,
+        allow_pickle: bool = ...,
+        pickle_kwargs: None | Mapping[str, Any] = ...,
+    ) -> None: ...
+    def __enter__(self: _T) -> _T: ...
+    def __exit__(
+        self,
+        exc_type: None | type[BaseException],
+        exc_value: None | BaseException,
+        traceback: None | types.TracebackType,
+        /,
+    ) -> None: ...
+    def close(self) -> None: ...
+    def __del__(self) -> None: ...
+    def __iter__(self) -> Iterator[str]: ...
+    def __len__(self) -> int: ...
+    def __getitem__(self, key: str) -> NDArray[Any]: ...
+
+# NOTE: Returns a `NpzFile` if file is a zip file;
+# returns an `ndarray`/`memmap` otherwise
+def load(
+    file: str | bytes | os.PathLike[Any] | _SupportsReadSeek[bytes],
+    mmap_mode: L[None, "r+", "r", "w+", "c"] = ...,
+    allow_pickle: bool = ...,
+    fix_imports: bool = ...,
+    encoding: L["ASCII", "latin1", "bytes"] = ...,
+) -> Any: ...
+
+def save(
+    file: str | os.PathLike[str] | _SupportsWrite[bytes],
+    arr: ArrayLike,
+    allow_pickle: bool = ...,
+    fix_imports: bool = ...,
+) -> None: ...
+
+def savez(
+    file: str | os.PathLike[str] | _SupportsWrite[bytes],
+    *args: ArrayLike,
+    **kwds: ArrayLike,
+) -> None: ...
+
+def savez_compressed(
+    file: str | os.PathLike[str] | _SupportsWrite[bytes],
+    *args: ArrayLike,
+    **kwds: ArrayLike,
+) -> None: ...
+
+# File-like objects only have to implement `__iter__` and,
+# optionally, `encoding`
+@overload
+def loadtxt(
+    fname: str | os.PathLike[str] | Iterable[str] | Iterable[bytes],
+    dtype: None = ...,
+    comments: None | str | Sequence[str] = ...,
+    delimiter: None | str = ...,
+    converters: None | Mapping[int | str, Callable[[str], Any]] = ...,
+    skiprows: int = ...,
+    usecols: int | Sequence[int] = ...,
+    unpack: bool = ...,
+    ndmin: L[0, 1, 2] = ...,
+    encoding: None | str = ...,
+    max_rows: None | int = ...,
+    *,
+    quotechar: None | str = ...,
+    like: None | _SupportsArrayFunc = ...
+) -> NDArray[float64]: ...
+@overload
+def loadtxt(
+    fname: str | os.PathLike[str] | Iterable[str] | Iterable[bytes],
+    dtype: _DTypeLike[_SCT],
+    comments: None | str | Sequence[str] = ...,
+    delimiter: None | str = ...,
+    converters: None | Mapping[int | str, Callable[[str], Any]] = ...,
+    skiprows: int = ...,
+    usecols: int | Sequence[int] = ...,
+    unpack: bool = ...,
+    ndmin: L[0, 1, 2] = ...,
+    encoding: None | str = ...,
+    max_rows: None | int = ...,
+    *,
+    quotechar: None | str = ...,
+    like: None | _SupportsArrayFunc = ...
+) -> NDArray[_SCT]: ...
+@overload
+def loadtxt(
+    fname: str | os.PathLike[str] | Iterable[str] | Iterable[bytes],
+    dtype: DTypeLike,
+    comments: None | str | Sequence[str] = ...,
+    delimiter: None | str = ...,
+    converters: None | Mapping[int | str, Callable[[str], Any]] = ...,
+    skiprows: int = ...,
+    usecols: int | Sequence[int] = ...,
+    unpack: bool = ...,
+    ndmin: L[0, 1, 2] = ...,
+    encoding: None | str = ...,
+    max_rows: None | int = ...,
+    *,
+    quotechar: None | str = ...,
+    like: None | _SupportsArrayFunc = ...
+) -> NDArray[Any]: ...
+
+def savetxt(
+    fname: str | os.PathLike[str] | _SupportsWrite[str] | _SupportsWrite[bytes],
+    X: ArrayLike,
+    fmt: str | Sequence[str] = ...,
+    delimiter: str = ...,
+    newline: str = ...,
+    header: str = ...,
+    footer: str = ...,
+    comments: str = ...,
+    encoding: None | str = ...,
+) -> None: ...
+
+@overload
+def fromregex(
+    file: str | os.PathLike[str] | _SupportsRead[str] | _SupportsRead[bytes],
+    regexp: str | bytes | Pattern[Any],
+    dtype: _DTypeLike[_SCT],
+    encoding: None | str = ...
+) -> NDArray[_SCT]: ...
+@overload
+def fromregex(
+    file: str | os.PathLike[str] | _SupportsRead[str] | _SupportsRead[bytes],
+    regexp: str | bytes | Pattern[Any],
+    dtype: DTypeLike,
+    encoding: None | str = ...
+) -> NDArray[Any]: ...
+
+@overload
+def genfromtxt(
+    fname: str | os.PathLike[str] | Iterable[str] | Iterable[bytes],
+    dtype: None = ...,
+    comments: str = ...,
+    delimiter: None | str | int | Iterable[int] = ...,
+    skip_header: int = ...,
+    skip_footer: int = ...,
+    converters: None | Mapping[int | str, Callable[[str], Any]] = ...,
+    missing_values: Any = ...,
+    filling_values: Any = ...,
+    usecols: None | Sequence[int] = ...,
+    names: L[None, True] | str | Collection[str] = ...,
+    excludelist: None | Sequence[str] = ...,
+    deletechars: str = ...,
+    replace_space: str = ...,
+    autostrip: bool = ...,
+    case_sensitive: bool | L['upper', 'lower'] = ...,
+    defaultfmt: str = ...,
+    unpack: None | bool = ...,
+    usemask: bool = ...,
+    loose: bool = ...,
+    invalid_raise: bool = ...,
+    max_rows: None | int = ...,
+    encoding: str = ...,
+    *,
+    ndmin: L[0, 1, 2] = ...,
+    like: None | _SupportsArrayFunc = ...,
+) -> NDArray[float64]: ...
+@overload
+def genfromtxt(
+    fname: str | os.PathLike[str] | Iterable[str] | Iterable[bytes],
+    dtype: _DTypeLike[_SCT],
+    comments: str = ...,
+    delimiter: None | str | int | Iterable[int] = ...,
+    skip_header: int = ...,
+    skip_footer: int = ...,
+    converters: None | Mapping[int | str, Callable[[str], Any]] = ...,
+    missing_values: Any = ...,
+    filling_values: Any = ...,
+    usecols: None | Sequence[int] = ...,
+    names: L[None, True] | str | Collection[str] = ...,
+    excludelist: None | Sequence[str] = ...,
+    deletechars: str = ...,
+    replace_space: str = ...,
+    autostrip: bool = ...,
+    case_sensitive: bool | L['upper', 'lower'] = ...,
+    defaultfmt: str = ...,
+    unpack: None | bool = ...,
+    usemask: bool = ...,
+    loose: bool = ...,
+    invalid_raise: bool = ...,
+    max_rows: None | int = ...,
+    encoding: str = ...,
+    *,
+    ndmin: L[0, 1, 2] = ...,
+    like: None | _SupportsArrayFunc = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def genfromtxt(
+    fname: str | os.PathLike[str] | Iterable[str] | Iterable[bytes],
+    dtype: DTypeLike,
+    comments: str = ...,
+    delimiter: None | str | int | Iterable[int] = ...,
+    skip_header: int = ...,
+    skip_footer: int = ...,
+    converters: None | Mapping[int | str, Callable[[str], Any]] = ...,
+    missing_values: Any = ...,
+    filling_values: Any = ...,
+    usecols: None | Sequence[int] = ...,
+    names: L[None, True] | str | Collection[str] = ...,
+    excludelist: None | Sequence[str] = ...,
+    deletechars: str = ...,
+    replace_space: str = ...,
+    autostrip: bool = ...,
+    case_sensitive: bool | L['upper', 'lower'] = ...,
+    defaultfmt: str = ...,
+    unpack: None | bool = ...,
+    usemask: bool = ...,
+    loose: bool = ...,
+    invalid_raise: bool = ...,
+    max_rows: None | int = ...,
+    encoding: str = ...,
+    *,
+    ndmin: L[0, 1, 2] = ...,
+    like: None | _SupportsArrayFunc = ...,
+) -> NDArray[Any]: ...
+
+@overload
+def recfromtxt(
+    fname: str | os.PathLike[str] | Iterable[str] | Iterable[bytes],
+    *,
+    usemask: L[False] = ...,
+    **kwargs: Any,
+) -> recarray[Any, dtype[record]]: ...
+@overload
+def recfromtxt(
+    fname: str | os.PathLike[str] | Iterable[str] | Iterable[bytes],
+    *,
+    usemask: L[True],
+    **kwargs: Any,
+) -> MaskedRecords[Any, dtype[void]]: ...
+
+@overload
+def recfromcsv(
+    fname: str | os.PathLike[str] | Iterable[str] | Iterable[bytes],
+    *,
+    usemask: L[False] = ...,
+    **kwargs: Any,
+) -> recarray[Any, dtype[record]]: ...
+@overload
+def recfromcsv(
+    fname: str | os.PathLike[str] | Iterable[str] | Iterable[bytes],
+    *,
+    usemask: L[True],
+    **kwargs: Any,
+) -> MaskedRecords[Any, dtype[void]]: ...

.CondaPkg/env/Lib/site-packages/numpy/lib/polynomial.pyi

@@ -0,0 +1,303 @@
+from typing import (
+    Literal as L,
+    overload,
+    Any,
+    SupportsInt,
+    SupportsIndex,
+    TypeVar,
+    NoReturn,
+)
+
+from numpy import (
+    RankWarning as RankWarning,
+    poly1d as poly1d,
+    unsignedinteger,
+    signedinteger,
+    floating,
+    complexfloating,
+    bool_,
+    int32,
+    int64,
+    float64,
+    complex128,
+    object_,
+)
+
+from numpy._typing import (
+    NDArray,
+    ArrayLike,
+    _ArrayLikeBool_co,
+    _ArrayLikeUInt_co,
+    _ArrayLikeInt_co,
+    _ArrayLikeFloat_co,
+    _ArrayLikeComplex_co,
+    _ArrayLikeObject_co,
+)
+
+_T = TypeVar("_T")
+
+_2Tup = tuple[_T, _T]
+_5Tup = tuple[
+    _T,
+    NDArray[float64],
+    NDArray[int32],
+    NDArray[float64],
+    NDArray[float64],
+]
+
+__all__: list[str]
+
+def poly(seq_of_zeros: ArrayLike) -> NDArray[floating[Any]]: ...
+
+# Returns either a float or complex array depending on the input values.
+# See `np.linalg.eigvals`.
+def roots(p: ArrayLike) -> NDArray[complexfloating[Any, Any]] | NDArray[floating[Any]]: ...
+
+@overload
+def polyint(
+    p: poly1d,
+    m: SupportsInt | SupportsIndex = ...,
+    k: None | _ArrayLikeComplex_co | _ArrayLikeObject_co = ...,
+) -> poly1d: ...
+@overload
+def polyint(
+    p: _ArrayLikeFloat_co,
+    m: SupportsInt | SupportsIndex = ...,
+    k: None | _ArrayLikeFloat_co = ...,
+) -> NDArray[floating[Any]]: ...
+@overload
+def polyint(
+    p: _ArrayLikeComplex_co,
+    m: SupportsInt | SupportsIndex = ...,
+    k: None | _ArrayLikeComplex_co = ...,
+) -> NDArray[complexfloating[Any, Any]]: ...
+@overload
+def polyint(
+    p: _ArrayLikeObject_co,
+    m: SupportsInt | SupportsIndex = ...,
+    k: None | _ArrayLikeObject_co = ...,
+) -> NDArray[object_]: ...
+
+@overload
+def polyder(
+    p: poly1d,
+    m: SupportsInt | SupportsIndex = ...,
+) -> poly1d: ...
+@overload
+def polyder(
+    p: _ArrayLikeFloat_co,
+    m: SupportsInt | SupportsIndex = ...,
+) -> NDArray[floating[Any]]: ...
+@overload
+def polyder(
+    p: _ArrayLikeComplex_co,
+    m: SupportsInt | SupportsIndex = ...,
+) -> NDArray[complexfloating[Any, Any]]: ...
+@overload
+def polyder(
+    p: _ArrayLikeObject_co,
+    m: SupportsInt | SupportsIndex = ...,
+) -> NDArray[object_]: ...
+
+@overload
+def polyfit(
+    x: _ArrayLikeFloat_co,
+    y: _ArrayLikeFloat_co,
+    deg: SupportsIndex | SupportsInt,
+    rcond: None | float = ...,
+    full: L[False] = ...,
+    w: None | _ArrayLikeFloat_co = ...,
+    cov: L[False] = ...,
+) -> NDArray[float64]: ...
+@overload
+def polyfit(
+    x: _ArrayLikeComplex_co,
+    y: _ArrayLikeComplex_co,
+    deg: SupportsIndex | SupportsInt,
+    rcond: None | float = ...,
+    full: L[False] = ...,
+    w: None | _ArrayLikeFloat_co = ...,
+    cov: L[False] = ...,
+) -> NDArray[complex128]: ...
+@overload
+def polyfit(
+    x: _ArrayLikeFloat_co,
+    y: _ArrayLikeFloat_co,
+    deg: SupportsIndex | SupportsInt,
+    rcond: None | float = ...,
+    full: L[False] = ...,
+    w: None | _ArrayLikeFloat_co = ...,
+    cov: L[True, "unscaled"] = ...,
+) -> _2Tup[NDArray[float64]]: ...
+@overload
+def polyfit(
+    x: _ArrayLikeComplex_co,
+    y: _ArrayLikeComplex_co,
+    deg: SupportsIndex | SupportsInt,
+    rcond: None | float = ...,
+    full: L[False] = ...,
+    w: None | _ArrayLikeFloat_co = ...,
+    cov: L[True, "unscaled"] = ...,
+) -> _2Tup[NDArray[complex128]]: ...
+@overload
+def polyfit(
+    x: _ArrayLikeFloat_co,
+    y: _ArrayLikeFloat_co,
+    deg: SupportsIndex | SupportsInt,
+    rcond: None | float = ...,
+    full: L[True] = ...,
+    w: None | _ArrayLikeFloat_co = ...,
+    cov: bool | L["unscaled"] = ...,
+) -> _5Tup[NDArray[float64]]: ...
+@overload
+def polyfit(
+    x: _ArrayLikeComplex_co,
+    y: _ArrayLikeComplex_co,
+    deg: SupportsIndex | SupportsInt,
+    rcond: None | float = ...,
+    full: L[True] = ...,
+    w: None | _ArrayLikeFloat_co = ...,
+    cov: bool | L["unscaled"] = ...,
+) -> _5Tup[NDArray[complex128]]: ...
+
+@overload
+def polyval(
+    p: _ArrayLikeBool_co,
+    x: _ArrayLikeBool_co,
+) -> NDArray[int64]: ...
+@overload
+def polyval(
+    p: _ArrayLikeUInt_co,
+    x: _ArrayLikeUInt_co,
+) -> NDArray[unsignedinteger[Any]]: ...
+@overload
+def polyval(
+    p: _ArrayLikeInt_co,
+    x: _ArrayLikeInt_co,
+) -> NDArray[signedinteger[Any]]: ...
+@overload
+def polyval(
+    p: _ArrayLikeFloat_co,
+    x: _ArrayLikeFloat_co,
+) -> NDArray[floating[Any]]: ...
+@overload
+def polyval(
+    p: _ArrayLikeComplex_co,
+    x: _ArrayLikeComplex_co,
+) -> NDArray[complexfloating[Any, Any]]: ...
+@overload
+def polyval(
+    p: _ArrayLikeObject_co,
+    x: _ArrayLikeObject_co,
+) -> NDArray[object_]: ...
+
+@overload
+def polyadd(
+    a1: poly1d,
+    a2: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+) -> poly1d: ...
+@overload
+def polyadd(
+    a1: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    a2: poly1d,
+) -> poly1d: ...
+@overload
+def polyadd(
+    a1: _ArrayLikeBool_co,
+    a2: _ArrayLikeBool_co,
+) -> NDArray[bool_]: ...
+@overload
+def polyadd(
+    a1: _ArrayLikeUInt_co,
+    a2: _ArrayLikeUInt_co,
+) -> NDArray[unsignedinteger[Any]]: ...
+@overload
+def polyadd(
+    a1: _ArrayLikeInt_co,
+    a2: _ArrayLikeInt_co,
+) -> NDArray[signedinteger[Any]]: ...
+@overload
+def polyadd(
+    a1: _ArrayLikeFloat_co,
+    a2: _ArrayLikeFloat_co,
+) -> NDArray[floating[Any]]: ...
+@overload
+def polyadd(
+    a1: _ArrayLikeComplex_co,
+    a2: _ArrayLikeComplex_co,
+) -> NDArray[complexfloating[Any, Any]]: ...
+@overload
+def polyadd(
+    a1: _ArrayLikeObject_co,
+    a2: _ArrayLikeObject_co,
+) -> NDArray[object_]: ...
+
+@overload
+def polysub(
+    a1: poly1d,
+    a2: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+) -> poly1d: ...
+@overload
+def polysub(
+    a1: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    a2: poly1d,
+) -> poly1d: ...
+@overload
+def polysub(
+    a1: _ArrayLikeBool_co,
+    a2: _ArrayLikeBool_co,
+) -> NoReturn: ...
+@overload
+def polysub(
+    a1: _ArrayLikeUInt_co,
+    a2: _ArrayLikeUInt_co,
+) -> NDArray[unsignedinteger[Any]]: ...
+@overload
+def polysub(
+    a1: _ArrayLikeInt_co,
+    a2: _ArrayLikeInt_co,
+) -> NDArray[signedinteger[Any]]: ...
+@overload
+def polysub(
+    a1: _ArrayLikeFloat_co,
+    a2: _ArrayLikeFloat_co,
+) -> NDArray[floating[Any]]: ...
+@overload
+def polysub(
+    a1: _ArrayLikeComplex_co,
+    a2: _ArrayLikeComplex_co,
+) -> NDArray[complexfloating[Any, Any]]: ...
+@overload
+def polysub(
+    a1: _ArrayLikeObject_co,
+    a2: _ArrayLikeObject_co,
+) -> NDArray[object_]: ...
+
+# NOTE: Not an alias, but they do have the same signature (that we can reuse)
+polymul = polyadd
+
+@overload
+def polydiv(
+    u: poly1d,
+    v: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+) -> _2Tup[poly1d]: ...
+@overload
+def polydiv(
+    u: _ArrayLikeComplex_co | _ArrayLikeObject_co,
+    v: poly1d,
+) -> _2Tup[poly1d]: ...
+@overload
+def polydiv(
+    u: _ArrayLikeFloat_co,
+    v: _ArrayLikeFloat_co,
+) -> _2Tup[NDArray[floating[Any]]]: ...
+@overload
+def polydiv(
+    u: _ArrayLikeComplex_co,
+    v: _ArrayLikeComplex_co,
+) -> _2Tup[NDArray[complexfloating[Any, Any]]]: ...
+@overload
+def polydiv(
+    u: _ArrayLikeObject_co,
+    v: _ArrayLikeObject_co,
+) -> _2Tup[NDArray[Any]]: ...

.CondaPkg/env/Lib/site-packages/numpy/lib/scimath.py

@@ -0,0 +1,625 @@
+"""
+Wrapper functions to more user-friendly calling of certain math functions
+whose output data-type is different than the input data-type in certain
+domains of the input.
+
+For example, for functions like `log` with branch cuts, the versions in this
+module provide the mathematically valid answers in the complex plane::
+
+  >>> import math
+  >>> np.emath.log(-math.exp(1)) == (1+1j*math.pi)
+  True
+
+Similarly, `sqrt`, other base logarithms, `power` and trig functions are
+correctly handled.  See their respective docstrings for specific examples.
+
+Functions
+---------
+
+.. autosummary::
+   :toctree: generated/
+
+   sqrt
+   log
+   log2
+   logn
+   log10
+   power
+   arccos
+   arcsin
+   arctanh
+
+"""
+import numpy.core.numeric as nx
+import numpy.core.numerictypes as nt
+from numpy.core.numeric import asarray, any
+from numpy.core.overrides import array_function_dispatch
+from numpy.lib.type_check import isreal
+
+
+__all__ = [
+    'sqrt', 'log', 'log2', 'logn', 'log10', 'power', 'arccos', 'arcsin',
+    'arctanh'
+    ]
+
+
+_ln2 = nx.log(2.0)
+
+
+def _tocomplex(arr):
+    """Convert its input `arr` to a complex array.
+
+    The input is returned as a complex array of the smallest type that will fit
+    the original data: types like single, byte, short, etc. become csingle,
+    while others become cdouble.
+
+    A copy of the input is always made.
+
+    Parameters
+    ----------
+    arr : array
+
+    Returns
+    -------
+    array
+        An array with the same input data as the input but in complex form.
+
+    Examples
+    --------
+
+    First, consider an input of type short:
+
+    >>> a = np.array([1,2,3],np.short)
+
+    >>> ac = np.lib.scimath._tocomplex(a); ac
+    array([1.+0.j, 2.+0.j, 3.+0.j], dtype=complex64)
+
+    >>> ac.dtype
+    dtype('complex64')
+
+    If the input is of type double, the output is correspondingly of the
+    complex double type as well:
+
+    >>> b = np.array([1,2,3],np.double)
+
+    >>> bc = np.lib.scimath._tocomplex(b); bc
+    array([1.+0.j, 2.+0.j, 3.+0.j])
+
+    >>> bc.dtype
+    dtype('complex128')
+
+    Note that even if the input was complex to begin with, a copy is still
+    made, since the astype() method always copies:
+
+    >>> c = np.array([1,2,3],np.csingle)
+
+    >>> cc = np.lib.scimath._tocomplex(c); cc
+    array([1.+0.j,  2.+0.j,  3.+0.j], dtype=complex64)
+
+    >>> c *= 2; c
+    array([2.+0.j,  4.+0.j,  6.+0.j], dtype=complex64)
+
+    >>> cc
+    array([1.+0.j,  2.+0.j,  3.+0.j], dtype=complex64)
+    """
+    if issubclass(arr.dtype.type, (nt.single, nt.byte, nt.short, nt.ubyte,
+                                   nt.ushort, nt.csingle)):
+        return arr.astype(nt.csingle)
+    else:
+        return arr.astype(nt.cdouble)
+
+
+def _fix_real_lt_zero(x):
+    """Convert `x` to complex if it has real, negative components.
+
+    Otherwise, output is just the array version of the input (via asarray).
+
+    Parameters
+    ----------
+    x : array_like
+
+    Returns
+    -------
+    array
+
+    Examples
+    --------
+    >>> np.lib.scimath._fix_real_lt_zero([1,2])
+    array([1, 2])
+
+    >>> np.lib.scimath._fix_real_lt_zero([-1,2])
+    array([-1.+0.j,  2.+0.j])
+
+    """
+    x = asarray(x)
+    if any(isreal(x) & (x < 0)):
+        x = _tocomplex(x)
+    return x
+
+
+def _fix_int_lt_zero(x):
+    """Convert `x` to double if it has real, negative components.
+
+    Otherwise, output is just the array version of the input (via asarray).
+
+    Parameters
+    ----------
+    x : array_like
+
+    Returns
+    -------
+    array
+
+    Examples
+    --------
+    >>> np.lib.scimath._fix_int_lt_zero([1,2])
+    array([1, 2])
+
+    >>> np.lib.scimath._fix_int_lt_zero([-1,2])
+    array([-1.,  2.])
+    """
+    x = asarray(x)
+    if any(isreal(x) & (x < 0)):
+        x = x * 1.0
+    return x
+
+
+def _fix_real_abs_gt_1(x):
+    """Convert `x` to complex if it has real components x_i with abs(x_i)>1.
+
+    Otherwise, output is just the array version of the input (via asarray).
+
+    Parameters
+    ----------
+    x : array_like
+
+    Returns
+    -------
+    array
+
+    Examples
+    --------
+    >>> np.lib.scimath._fix_real_abs_gt_1([0,1])
+    array([0, 1])
+
+    >>> np.lib.scimath._fix_real_abs_gt_1([0,2])
+    array([0.+0.j, 2.+0.j])
+    """
+    x = asarray(x)
+    if any(isreal(x) & (abs(x) > 1)):
+        x = _tocomplex(x)
+    return x
+
+
+def _unary_dispatcher(x):
+    return (x,)
+
+
+@array_function_dispatch(_unary_dispatcher)
+def sqrt(x):
+    """
+    Compute the square root of x.
+
+    For negative input elements, a complex value is returned
+    (unlike `numpy.sqrt` which returns NaN).
+
+    Parameters
+    ----------
+    x : array_like
+       The input value(s).
+
+    Returns
+    -------
+    out : ndarray or scalar
+       The square root of `x`. If `x` was a scalar, so is `out`,
+       otherwise an array is returned.
+
+    See Also
+    --------
+    numpy.sqrt
+
+    Examples
+    --------
+    For real, non-negative inputs this works just like `numpy.sqrt`:
+
+    >>> np.emath.sqrt(1)
+    1.0
+    >>> np.emath.sqrt([1, 4])
+    array([1.,  2.])
+
+    But it automatically handles negative inputs:
+
+    >>> np.emath.sqrt(-1)
+    1j
+    >>> np.emath.sqrt([-1,4])
+    array([0.+1.j, 2.+0.j])
+
+    Different results are expected because:
+    floating point 0.0 and -0.0 are distinct.
+
+    For more control, explicitly use complex() as follows:
+
+    >>> np.emath.sqrt(complex(-4.0, 0.0))
+    2j
+    >>> np.emath.sqrt(complex(-4.0, -0.0))
+    -2j
+    """
+    x = _fix_real_lt_zero(x)
+    return nx.sqrt(x)
+
+
+@array_function_dispatch(_unary_dispatcher)
+def log(x):
+    """
+    Compute the natural logarithm of `x`.
+
+    Return the "principal value" (for a description of this, see `numpy.log`)
+    of :math:`log_e(x)`. For real `x > 0`, this is a real number (``log(0)``
+    returns ``-inf`` and ``log(np.inf)`` returns ``inf``). Otherwise, the
+    complex principle value is returned.
+
+    Parameters
+    ----------
+    x : array_like
+       The value(s) whose log is (are) required.
+
+    Returns
+    -------
+    out : ndarray or scalar
+       The log of the `x` value(s). If `x` was a scalar, so is `out`,
+       otherwise an array is returned.
+
+    See Also
+    --------
+    numpy.log
+
+    Notes
+    -----
+    For a log() that returns ``NAN`` when real `x < 0`, use `numpy.log`
+    (note, however, that otherwise `numpy.log` and this `log` are identical,
+    i.e., both return ``-inf`` for `x = 0`, ``inf`` for `x = inf`, and,
+    notably, the complex principle value if ``x.imag != 0``).
+
+    Examples
+    --------
+    >>> np.emath.log(np.exp(1))
+    1.0
+
+    Negative arguments are handled "correctly" (recall that
+    ``exp(log(x)) == x`` does *not* hold for real ``x < 0``):
+
+    >>> np.emath.log(-np.exp(1)) == (1 + np.pi * 1j)
+    True
+
+    """
+    x = _fix_real_lt_zero(x)
+    return nx.log(x)
+
+
+@array_function_dispatch(_unary_dispatcher)
+def log10(x):
+    """
+    Compute the logarithm base 10 of `x`.
+
+    Return the "principal value" (for a description of this, see
+    `numpy.log10`) of :math:`log_{10}(x)`. For real `x > 0`, this
+    is a real number (``log10(0)`` returns ``-inf`` and ``log10(np.inf)``
+    returns ``inf``). Otherwise, the complex principle value is returned.
+
+    Parameters
+    ----------
+    x : array_like or scalar
+       The value(s) whose log base 10 is (are) required.
+
+    Returns
+    -------
+    out : ndarray or scalar
+       The log base 10 of the `x` value(s). If `x` was a scalar, so is `out`,
+       otherwise an array object is returned.
+
+    See Also
+    --------
+    numpy.log10
+
+    Notes
+    -----
+    For a log10() that returns ``NAN`` when real `x < 0`, use `numpy.log10`
+    (note, however, that otherwise `numpy.log10` and this `log10` are
+    identical, i.e., both return ``-inf`` for `x = 0`, ``inf`` for `x = inf`,
+    and, notably, the complex principle value if ``x.imag != 0``).
+
+    Examples
+    --------
+
+    (We set the printing precision so the example can be auto-tested)
+
+    >>> np.set_printoptions(precision=4)
+
+    >>> np.emath.log10(10**1)
+    1.0
+
+    >>> np.emath.log10([-10**1, -10**2, 10**2])
+    array([1.+1.3644j, 2.+1.3644j, 2.+0.j    ])
+
+    """
+    x = _fix_real_lt_zero(x)
+    return nx.log10(x)
+
+
+def _logn_dispatcher(n, x):
+    return (n, x,)
+
+
+@array_function_dispatch(_logn_dispatcher)
+def logn(n, x):
+    """
+    Take log base n of x.
+
+    If `x` contains negative inputs, the answer is computed and returned in the
+    complex domain.
+
+    Parameters
+    ----------
+    n : array_like
+       The integer base(s) in which the log is taken.
+    x : array_like
+       The value(s) whose log base `n` is (are) required.
+
+    Returns
+    -------
+    out : ndarray or scalar
+       The log base `n` of the `x` value(s). If `x` was a scalar, so is
+       `out`, otherwise an array is returned.
+
+    Examples
+    --------
+    >>> np.set_printoptions(precision=4)
+
+    >>> np.emath.logn(2, [4, 8])
+    array([2., 3.])
+    >>> np.emath.logn(2, [-4, -8, 8])
+    array([2.+4.5324j, 3.+4.5324j, 3.+0.j    ])
+
+    """
+    x = _fix_real_lt_zero(x)
+    n = _fix_real_lt_zero(n)
+    return nx.log(x)/nx.log(n)
+
+
+@array_function_dispatch(_unary_dispatcher)
+def log2(x):
+    """
+    Compute the logarithm base 2 of `x`.
+
+    Return the "principal value" (for a description of this, see
+    `numpy.log2`) of :math:`log_2(x)`. For real `x > 0`, this is
+    a real number (``log2(0)`` returns ``-inf`` and ``log2(np.inf)`` returns
+    ``inf``). Otherwise, the complex principle value is returned.
+
+    Parameters
+    ----------
+    x : array_like
+       The value(s) whose log base 2 is (are) required.
+
+    Returns
+    -------
+    out : ndarray or scalar
+       The log base 2 of the `x` value(s). If `x` was a scalar, so is `out`,
+       otherwise an array is returned.
+
+    See Also
+    --------
+    numpy.log2
+
+    Notes
+    -----
+    For a log2() that returns ``NAN`` when real `x < 0`, use `numpy.log2`
+    (note, however, that otherwise `numpy.log2` and this `log2` are
+    identical, i.e., both return ``-inf`` for `x = 0`, ``inf`` for `x = inf`,
+    and, notably, the complex principle value if ``x.imag != 0``).
+
+    Examples
+    --------
+    We set the printing precision so the example can be auto-tested:
+
+    >>> np.set_printoptions(precision=4)
+
+    >>> np.emath.log2(8)
+    3.0
+    >>> np.emath.log2([-4, -8, 8])
+    array([2.+4.5324j, 3.+4.5324j, 3.+0.j    ])
+
+    """
+    x = _fix_real_lt_zero(x)
+    return nx.log2(x)
+
+
+def _power_dispatcher(x, p):
+    return (x, p)
+
+
+@array_function_dispatch(_power_dispatcher)
+def power(x, p):
+    """
+    Return x to the power p, (x**p).
+
+    If `x` contains negative values, the output is converted to the
+    complex domain.
+
+    Parameters
+    ----------
+    x : array_like
+        The input value(s).
+    p : array_like of ints
+        The power(s) to which `x` is raised. If `x` contains multiple values,
+        `p` has to either be a scalar, or contain the same number of values
+        as `x`. In the latter case, the result is
+        ``x[0]**p[0], x[1]**p[1], ...``.
+
+    Returns
+    -------
+    out : ndarray or scalar
+        The result of ``x**p``. If `x` and `p` are scalars, so is `out`,
+        otherwise an array is returned.
+
+    See Also
+    --------
+    numpy.power
+
+    Examples
+    --------
+    >>> np.set_printoptions(precision=4)
+
+    >>> np.emath.power([2, 4], 2)
+    array([ 4, 16])
+    >>> np.emath.power([2, 4], -2)
+    array([0.25  ,  0.0625])
+    >>> np.emath.power([-2, 4], 2)
+    array([ 4.-0.j, 16.+0.j])
+
+    """
+    x = _fix_real_lt_zero(x)
+    p = _fix_int_lt_zero(p)
+    return nx.power(x, p)
+
+
+@array_function_dispatch(_unary_dispatcher)
+def arccos(x):
+    """
+    Compute the inverse cosine of x.
+
+    Return the "principal value" (for a description of this, see
+    `numpy.arccos`) of the inverse cosine of `x`. For real `x` such that
+    `abs(x) <= 1`, this is a real number in the closed interval
+    :math:`[0, \\pi]`.  Otherwise, the complex principle value is returned.
+
+    Parameters
+    ----------
+    x : array_like or scalar
+       The value(s) whose arccos is (are) required.
+
+    Returns
+    -------
+    out : ndarray or scalar
+       The inverse cosine(s) of the `x` value(s). If `x` was a scalar, so
+       is `out`, otherwise an array object is returned.
+
+    See Also
+    --------
+    numpy.arccos
+
+    Notes
+    -----
+    For an arccos() that returns ``NAN`` when real `x` is not in the
+    interval ``[-1,1]``, use `numpy.arccos`.
+
+    Examples
+    --------
+    >>> np.set_printoptions(precision=4)
+
+    >>> np.emath.arccos(1) # a scalar is returned
+    0.0
+
+    >>> np.emath.arccos([1,2])
+    array([0.-0.j   , 0.-1.317j])
+
+    """
+    x = _fix_real_abs_gt_1(x)
+    return nx.arccos(x)
+
+
+@array_function_dispatch(_unary_dispatcher)
+def arcsin(x):
+    """
+    Compute the inverse sine of x.
+
+    Return the "principal value" (for a description of this, see
+    `numpy.arcsin`) of the inverse sine of `x`. For real `x` such that
+    `abs(x) <= 1`, this is a real number in the closed interval
+    :math:`[-\\pi/2, \\pi/2]`.  Otherwise, the complex principle value is
+    returned.
+
+    Parameters
+    ----------
+    x : array_like or scalar
+       The value(s) whose arcsin is (are) required.
+
+    Returns
+    -------
+    out : ndarray or scalar
+       The inverse sine(s) of the `x` value(s). If `x` was a scalar, so
+       is `out`, otherwise an array object is returned.
+
+    See Also
+    --------
+    numpy.arcsin
+
+    Notes
+    -----
+    For an arcsin() that returns ``NAN`` when real `x` is not in the
+    interval ``[-1,1]``, use `numpy.arcsin`.
+
+    Examples
+    --------
+    >>> np.set_printoptions(precision=4)
+
+    >>> np.emath.arcsin(0)
+    0.0
+
+    >>> np.emath.arcsin([0,1])
+    array([0.    , 1.5708])
+
+    """
+    x = _fix_real_abs_gt_1(x)
+    return nx.arcsin(x)
+
+
+@array_function_dispatch(_unary_dispatcher)
+def arctanh(x):
+    """
+    Compute the inverse hyperbolic tangent of `x`.
+
+    Return the "principal value" (for a description of this, see
+    `numpy.arctanh`) of ``arctanh(x)``. For real `x` such that
+    ``abs(x) < 1``, this is a real number.  If `abs(x) > 1`, or if `x` is
+    complex, the result is complex. Finally, `x = 1` returns``inf`` and
+    ``x=-1`` returns ``-inf``.
+
+    Parameters
+    ----------
+    x : array_like
+       The value(s) whose arctanh is (are) required.
+
+    Returns
+    -------
+    out : ndarray or scalar
+       The inverse hyperbolic tangent(s) of the `x` value(s). If `x` was
+       a scalar so is `out`, otherwise an array is returned.
+
+
+    See Also
+    --------
+    numpy.arctanh
+
+    Notes
+    -----
+    For an arctanh() that returns ``NAN`` when real `x` is not in the
+    interval ``(-1,1)``, use `numpy.arctanh` (this latter, however, does
+    return +/-inf for ``x = +/-1``).
+
+    Examples
+    --------
+    >>> np.set_printoptions(precision=4)
+
+    >>> from numpy.testing import suppress_warnings
+    >>> with suppress_warnings() as sup:
+    ...     sup.filter(RuntimeWarning)
+    ...     np.emath.arctanh(np.eye(2))
+    array([[inf,  0.],
+           [ 0., inf]])
+    >>> np.emath.arctanh([1j])
+    array([0.+0.7854j])
+
+    """
+    x = _fix_real_abs_gt_1(x)
+    return nx.arctanh(x)

.CondaPkg/env/Lib/site-packages/numpy/lib/scimath.pyi

@@ -0,0 +1,94 @@
+from typing import overload, Any
+
+from numpy import complexfloating
+
+from numpy._typing import (
+    NDArray,
+    _ArrayLikeFloat_co,
+    _ArrayLikeComplex_co,
+    _ComplexLike_co,
+    _FloatLike_co,
+)
+
+__all__: list[str]
+
+@overload
+def sqrt(x: _FloatLike_co) -> Any: ...
+@overload
+def sqrt(x: _ComplexLike_co) -> complexfloating[Any, Any]: ...
+@overload
+def sqrt(x: _ArrayLikeFloat_co) -> NDArray[Any]: ...
+@overload
+def sqrt(x: _ArrayLikeComplex_co) -> NDArray[complexfloating[Any, Any]]: ...
+
+@overload
+def log(x: _FloatLike_co) -> Any: ...
+@overload
+def log(x: _ComplexLike_co) -> complexfloating[Any, Any]: ...
+@overload
+def log(x: _ArrayLikeFloat_co) -> NDArray[Any]: ...
+@overload
+def log(x: _ArrayLikeComplex_co) -> NDArray[complexfloating[Any, Any]]: ...
+
+@overload
+def log10(x: _FloatLike_co) -> Any: ...
+@overload
+def log10(x: _ComplexLike_co) -> complexfloating[Any, Any]: ...
+@overload
+def log10(x: _ArrayLikeFloat_co) -> NDArray[Any]: ...
+@overload
+def log10(x: _ArrayLikeComplex_co) -> NDArray[complexfloating[Any, Any]]: ...
+
+@overload
+def log2(x: _FloatLike_co) -> Any: ...
+@overload
+def log2(x: _ComplexLike_co) -> complexfloating[Any, Any]: ...
+@overload
+def log2(x: _ArrayLikeFloat_co) -> NDArray[Any]: ...
+@overload
+def log2(x: _ArrayLikeComplex_co) -> NDArray[complexfloating[Any, Any]]: ...
+
+@overload
+def logn(n: _FloatLike_co, x: _FloatLike_co) -> Any: ...
+@overload
+def logn(n: _ComplexLike_co, x: _ComplexLike_co) -> complexfloating[Any, Any]: ...
+@overload
+def logn(n: _ArrayLikeFloat_co, x: _ArrayLikeFloat_co) -> NDArray[Any]: ...
+@overload
+def logn(n: _ArrayLikeComplex_co, x: _ArrayLikeComplex_co) -> NDArray[complexfloating[Any, Any]]: ...
+
+@overload
+def power(x: _FloatLike_co, p: _FloatLike_co) -> Any: ...
+@overload
+def power(x: _ComplexLike_co, p: _ComplexLike_co) -> complexfloating[Any, Any]: ...
+@overload
+def power(x: _ArrayLikeFloat_co, p: _ArrayLikeFloat_co) -> NDArray[Any]: ...
+@overload
+def power(x: _ArrayLikeComplex_co, p: _ArrayLikeComplex_co) -> NDArray[complexfloating[Any, Any]]: ...
+
+@overload
+def arccos(x: _FloatLike_co) -> Any: ...
+@overload
+def arccos(x: _ComplexLike_co) -> complexfloating[Any, Any]: ...
+@overload
+def arccos(x: _ArrayLikeFloat_co) -> NDArray[Any]: ...
+@overload
+def arccos(x: _ArrayLikeComplex_co) -> NDArray[complexfloating[Any, Any]]: ...
+
+@overload
+def arcsin(x: _FloatLike_co) -> Any: ...
+@overload
+def arcsin(x: _ComplexLike_co) -> complexfloating[Any, Any]: ...
+@overload
+def arcsin(x: _ArrayLikeFloat_co) -> NDArray[Any]: ...
+@overload
+def arcsin(x: _ArrayLikeComplex_co) -> NDArray[complexfloating[Any, Any]]: ...
+
+@overload
+def arctanh(x: _FloatLike_co) -> Any: ...
+@overload
+def arctanh(x: _ComplexLike_co) -> complexfloating[Any, Any]: ...
+@overload
+def arctanh(x: _ArrayLikeFloat_co) -> NDArray[Any]: ...
+@overload
+def arctanh(x: _ArrayLikeComplex_co) -> NDArray[complexfloating[Any, Any]]: ...

.CondaPkg/env/Lib/site-packages/numpy/lib/setup.py

@@ -0,0 +1,12 @@
+def configuration(parent_package='',top_path=None):
+    from numpy.distutils.misc_util import Configuration
+
+    config = Configuration('lib', parent_package, top_path)
+    config.add_subpackage('tests')
+    config.add_data_dir('tests/data')
+    config.add_data_files('*.pyi')
+    return config
+
+if __name__ == '__main__':
+    from numpy.distutils.core import setup
+    setup(configuration=configuration)

.CondaPkg/env/Lib/site-packages/numpy/lib/shape_base.pyi

@@ -0,0 +1,215 @@
+from collections.abc import Callable, Sequence
+from typing import TypeVar, Any, overload, SupportsIndex, Protocol
+
+from numpy import (
+    generic,
+    integer,
+    ufunc,
+    bool_,
+    unsignedinteger,
+    signedinteger,
+    floating,
+    complexfloating,
+    object_,
+)
+
+from numpy._typing import (
+    ArrayLike,
+    NDArray,
+    _ShapeLike,
+    _ArrayLike,
+    _ArrayLikeBool_co,
+    _ArrayLikeUInt_co,
+    _ArrayLikeInt_co,
+    _ArrayLikeFloat_co,
+    _ArrayLikeComplex_co,
+    _ArrayLikeObject_co,
+)
+
+from numpy.core.shape_base import vstack
+
+_SCT = TypeVar("_SCT", bound=generic)
+
+# The signatures of `__array_wrap__` and `__array_prepare__` are the same;
+# give them unique names for the sake of clarity
+class _ArrayWrap(Protocol):
+    def __call__(
+        self,
+        array: NDArray[Any],
+        context: None | tuple[ufunc, tuple[Any, ...], int] = ...,
+        /,
+    ) -> Any: ...
+
+class _ArrayPrepare(Protocol):
+    def __call__(
+        self,
+        array: NDArray[Any],
+        context: None | tuple[ufunc, tuple[Any, ...], int] = ...,
+        /,
+    ) -> Any: ...
+
+class _SupportsArrayWrap(Protocol):
+    @property
+    def __array_wrap__(self) -> _ArrayWrap: ...
+
+class _SupportsArrayPrepare(Protocol):
+    @property
+    def __array_prepare__(self) -> _ArrayPrepare: ...
+
+__all__: list[str]
+
+row_stack = vstack
+
+def take_along_axis(
+    arr: _SCT | NDArray[_SCT],
+    indices: NDArray[integer[Any]],
+    axis: None | int,
+) -> NDArray[_SCT]: ...
+
+def put_along_axis(
+    arr: NDArray[_SCT],
+    indices: NDArray[integer[Any]],
+    values: ArrayLike,
+    axis: None | int,
+) -> None: ...
+
+# TODO: Use PEP 612 `ParamSpec` once mypy supports `Concatenate`
+# xref python/mypy#8645
+@overload
+def apply_along_axis(
+    func1d: Callable[..., _ArrayLike[_SCT]],
+    axis: SupportsIndex,
+    arr: ArrayLike,
+    *args: Any,
+    **kwargs: Any,
+) -> NDArray[_SCT]: ...
+@overload
+def apply_along_axis(
+    func1d: Callable[..., ArrayLike],
+    axis: SupportsIndex,
+    arr: ArrayLike,
+    *args: Any,
+    **kwargs: Any,
+) -> NDArray[Any]: ...
+
+def apply_over_axes(
+    func: Callable[[NDArray[Any], int], NDArray[_SCT]],
+    a: ArrayLike,
+    axes: int | Sequence[int],
+) -> NDArray[_SCT]: ...
+
+@overload
+def expand_dims(
+    a: _ArrayLike[_SCT],
+    axis: _ShapeLike,
+) -> NDArray[_SCT]: ...
+@overload
+def expand_dims(
+    a: ArrayLike,
+    axis: _ShapeLike,
+) -> NDArray[Any]: ...
+
+@overload
+def column_stack(tup: Sequence[_ArrayLike[_SCT]]) -> NDArray[_SCT]: ...
+@overload
+def column_stack(tup: Sequence[ArrayLike]) -> NDArray[Any]: ...
+
+@overload
+def dstack(tup: Sequence[_ArrayLike[_SCT]]) -> NDArray[_SCT]: ...
+@overload
+def dstack(tup: Sequence[ArrayLike]) -> NDArray[Any]: ...
+
+@overload
+def array_split(
+    ary: _ArrayLike[_SCT],
+    indices_or_sections: _ShapeLike,
+    axis: SupportsIndex = ...,
+) -> list[NDArray[_SCT]]: ...
+@overload
+def array_split(
+    ary: ArrayLike,
+    indices_or_sections: _ShapeLike,
+    axis: SupportsIndex = ...,
+) -> list[NDArray[Any]]: ...
+
+@overload
+def split(
+    ary: _ArrayLike[_SCT],
+    indices_or_sections: _ShapeLike,
+    axis: SupportsIndex = ...,
+) -> list[NDArray[_SCT]]: ...
+@overload
+def split(
+    ary: ArrayLike,
+    indices_or_sections: _ShapeLike,
+    axis: SupportsIndex = ...,
+) -> list[NDArray[Any]]: ...
+
+@overload
+def hsplit(
+    ary: _ArrayLike[_SCT],
+    indices_or_sections: _ShapeLike,
+) -> list[NDArray[_SCT]]: ...
+@overload
+def hsplit(
+    ary: ArrayLike,
+    indices_or_sections: _ShapeLike,
+) -> list[NDArray[Any]]: ...
+
+@overload
+def vsplit(
+    ary: _ArrayLike[_SCT],
+    indices_or_sections: _ShapeLike,
+) -> list[NDArray[_SCT]]: ...
+@overload
+def vsplit(
+    ary: ArrayLike,
+    indices_or_sections: _ShapeLike,
+) -> list[NDArray[Any]]: ...
+
+@overload
+def dsplit(
+    ary: _ArrayLike[_SCT],
+    indices_or_sections: _ShapeLike,
+) -> list[NDArray[_SCT]]: ...
+@overload
+def dsplit(
+    ary: ArrayLike,
+    indices_or_sections: _ShapeLike,
+) -> list[NDArray[Any]]: ...
+
+@overload
+def get_array_prepare(*args: _SupportsArrayPrepare) -> _ArrayPrepare: ...
+@overload
+def get_array_prepare(*args: object) -> None | _ArrayPrepare: ...
+
+@overload
+def get_array_wrap(*args: _SupportsArrayWrap) -> _ArrayWrap: ...
+@overload
+def get_array_wrap(*args: object) -> None | _ArrayWrap: ...
+
+@overload
+def kron(a: _ArrayLikeBool_co, b: _ArrayLikeBool_co) -> NDArray[bool_]: ...  # type: ignore[misc]
+@overload
+def kron(a: _ArrayLikeUInt_co, b: _ArrayLikeUInt_co) -> NDArray[unsignedinteger[Any]]: ...  # type: ignore[misc]
+@overload
+def kron(a: _ArrayLikeInt_co, b: _ArrayLikeInt_co) -> NDArray[signedinteger[Any]]: ...  # type: ignore[misc]
+@overload
+def kron(a: _ArrayLikeFloat_co, b: _ArrayLikeFloat_co) -> NDArray[floating[Any]]: ...  # type: ignore[misc]
+@overload
+def kron(a: _ArrayLikeComplex_co, b: _ArrayLikeComplex_co) -> NDArray[complexfloating[Any, Any]]: ...
+@overload
+def kron(a: _ArrayLikeObject_co, b: Any) -> NDArray[object_]: ...
+@overload
+def kron(a: Any, b: _ArrayLikeObject_co) -> NDArray[object_]: ...
+
+@overload
+def tile(
+    A: _ArrayLike[_SCT],
+    reps: int | Sequence[int],
+) -> NDArray[_SCT]: ...
+@overload
+def tile(
+    A: ArrayLike,
+    reps: int | Sequence[int],
+) -> NDArray[Any]: ...

.CondaPkg/env/Lib/site-packages/numpy/lib/stride_tricks.py

@@ -0,0 +1,547 @@
+"""
+Utilities that manipulate strides to achieve desirable effects.
+
+An explanation of strides can be found in the "ndarray.rst" file in the
+NumPy reference guide.
+
+"""
+import numpy as np
+from numpy.core.numeric import normalize_axis_tuple
+from numpy.core.overrides import array_function_dispatch, set_module
+
+__all__ = ['broadcast_to', 'broadcast_arrays', 'broadcast_shapes']
+
+
+class DummyArray:
+    """Dummy object that just exists to hang __array_interface__ dictionaries
+    and possibly keep alive a reference to a base array.
+    """
+
+    def __init__(self, interface, base=None):
+        self.__array_interface__ = interface
+        self.base = base
+
+
+def _maybe_view_as_subclass(original_array, new_array):
+    if type(original_array) is not type(new_array):
+        # if input was an ndarray subclass and subclasses were OK,
+        # then view the result as that subclass.
+        new_array = new_array.view(type=type(original_array))
+        # Since we have done something akin to a view from original_array, we
+        # should let the subclass finalize (if it has it implemented, i.e., is
+        # not None).
+        if new_array.__array_finalize__:
+            new_array.__array_finalize__(original_array)
+    return new_array
+
+
+def as_strided(x, shape=None, strides=None, subok=False, writeable=True):
+    """
+    Create a view into the array with the given shape and strides.
+
+    .. warning:: This function has to be used with extreme care, see notes.
+
+    Parameters
+    ----------
+    x : ndarray
+        Array to create a new.
+    shape : sequence of int, optional
+        The shape of the new array. Defaults to ``x.shape``.
+    strides : sequence of int, optional
+        The strides of the new array. Defaults to ``x.strides``.
+    subok : bool, optional
+        .. versionadded:: 1.10
+
+        If True, subclasses are preserved.
+    writeable : bool, optional
+        .. versionadded:: 1.12
+
+        If set to False, the returned array will always be readonly.
+        Otherwise it will be writable if the original array was. It
+        is advisable to set this to False if possible (see Notes).
+
+    Returns
+    -------
+    view : ndarray
+
+    See also
+    --------
+    broadcast_to : broadcast an array to a given shape.
+    reshape : reshape an array.
+    lib.stride_tricks.sliding_window_view :
+        userfriendly and safe function for the creation of sliding window views.
+
+    Notes
+    -----
+    ``as_strided`` creates a view into the array given the exact strides
+    and shape. This means it manipulates the internal data structure of
+    ndarray and, if done incorrectly, the array elements can point to
+    invalid memory and can corrupt results or crash your program.
+    It is advisable to always use the original ``x.strides`` when
+    calculating new strides to avoid reliance on a contiguous memory
+    layout.
+
+    Furthermore, arrays created with this function often contain self
+    overlapping memory, so that two elements are identical.
+    Vectorized write operations on such arrays will typically be
+    unpredictable. They may even give different results for small, large,
+    or transposed arrays.
+
+    Since writing to these arrays has to be tested and done with great
+    care, you may want to use ``writeable=False`` to avoid accidental write
+    operations.
+
+    For these reasons it is advisable to avoid ``as_strided`` when
+    possible.
+    """
+    # first convert input to array, possibly keeping subclass
+    x = np.array(x, copy=False, subok=subok)
+    interface = dict(x.__array_interface__)
+    if shape is not None:
+        interface['shape'] = tuple(shape)
+    if strides is not None:
+        interface['strides'] = tuple(strides)
+
+    array = np.asarray(DummyArray(interface, base=x))
+    # The route via `__interface__` does not preserve structured
+    # dtypes. Since dtype should remain unchanged, we set it explicitly.
+    array.dtype = x.dtype
+
+    view = _maybe_view_as_subclass(x, array)
+
+    if view.flags.writeable and not writeable:
+        view.flags.writeable = False
+
+    return view
+
+
+def _sliding_window_view_dispatcher(x, window_shape, axis=None, *,
+                                    subok=None, writeable=None):
+    return (x,)
+
+
+@array_function_dispatch(_sliding_window_view_dispatcher)
+def sliding_window_view(x, window_shape, axis=None, *,
+                        subok=False, writeable=False):
+    """
+    Create a sliding window view into the array with the given window shape.
+
+    Also known as rolling or moving window, the window slides across all
+    dimensions of the array and extracts subsets of the array at all window
+    positions.
+    
+    .. versionadded:: 1.20.0
+
+    Parameters
+    ----------
+    x : array_like
+        Array to create the sliding window view from.
+    window_shape : int or tuple of int
+        Size of window over each axis that takes part in the sliding window.
+        If `axis` is not present, must have same length as the number of input
+        array dimensions. Single integers `i` are treated as if they were the
+        tuple `(i,)`.
+    axis : int or tuple of int, optional
+        Axis or axes along which the sliding window is applied.
+        By default, the sliding window is applied to all axes and
+        `window_shape[i]` will refer to axis `i` of `x`.
+        If `axis` is given as a `tuple of int`, `window_shape[i]` will refer to
+        the axis `axis[i]` of `x`.
+        Single integers `i` are treated as if they were the tuple `(i,)`.
+    subok : bool, optional
+        If True, sub-classes will be passed-through, otherwise the returned
+        array will be forced to be a base-class array (default).
+    writeable : bool, optional
+        When true, allow writing to the returned view. The default is false,
+        as this should be used with caution: the returned view contains the
+        same memory location multiple times, so writing to one location will
+        cause others to change.
+
+    Returns
+    -------
+    view : ndarray
+        Sliding window view of the array. The sliding window dimensions are
+        inserted at the end, and the original dimensions are trimmed as
+        required by the size of the sliding window.
+        That is, ``view.shape = x_shape_trimmed + window_shape``, where
+        ``x_shape_trimmed`` is ``x.shape`` with every entry reduced by one less
+        than the corresponding window size.
+
+    See Also
+    --------
+    lib.stride_tricks.as_strided: A lower-level and less safe routine for
+        creating arbitrary views from custom shape and strides.
+    broadcast_to: broadcast an array to a given shape.
+
+    Notes
+    -----
+    For many applications using a sliding window view can be convenient, but
+    potentially very slow. Often specialized solutions exist, for example:
+
+    - `scipy.signal.fftconvolve`
+
+    - filtering functions in `scipy.ndimage`
+
+    - moving window functions provided by
+      `bottleneck <https://github.com/pydata/bottleneck>`_.
+
+    As a rough estimate, a sliding window approach with an input size of `N`
+    and a window size of `W` will scale as `O(N*W)` where frequently a special
+    algorithm can achieve `O(N)`. That means that the sliding window variant
+    for a window size of 100 can be a 100 times slower than a more specialized
+    version.
+
+    Nevertheless, for small window sizes, when no custom algorithm exists, or
+    as a prototyping and developing tool, this function can be a good solution.
+
+    Examples
+    --------
+    >>> x = np.arange(6)
+    >>> x.shape
+    (6,)
+    >>> v = sliding_window_view(x, 3)
+    >>> v.shape
+    (4, 3)
+    >>> v
+    array([[0, 1, 2],
+           [1, 2, 3],
+           [2, 3, 4],
+           [3, 4, 5]])
+
+    This also works in more dimensions, e.g.
+
+    >>> i, j = np.ogrid[:3, :4]
+    >>> x = 10*i + j
+    >>> x.shape
+    (3, 4)
+    >>> x
+    array([[ 0,  1,  2,  3],
+           [10, 11, 12, 13],
+           [20, 21, 22, 23]])
+    >>> shape = (2,2)
+    >>> v = sliding_window_view(x, shape)
+    >>> v.shape
+    (2, 3, 2, 2)
+    >>> v
+    array([[[[ 0,  1],
+             [10, 11]],
+            [[ 1,  2],
+             [11, 12]],
+            [[ 2,  3],
+             [12, 13]]],
+           [[[10, 11],
+             [20, 21]],
+            [[11, 12],
+             [21, 22]],
+            [[12, 13],
+             [22, 23]]]])
+
+    The axis can be specified explicitly:
+
+    >>> v = sliding_window_view(x, 3, 0)
+    >>> v.shape
+    (1, 4, 3)
+    >>> v
+    array([[[ 0, 10, 20],
+            [ 1, 11, 21],
+            [ 2, 12, 22],
+            [ 3, 13, 23]]])
+
+    The same axis can be used several times. In that case, every use reduces
+    the corresponding original dimension:
+
+    >>> v = sliding_window_view(x, (2, 3), (1, 1))
+    >>> v.shape
+    (3, 1, 2, 3)
+    >>> v
+    array([[[[ 0,  1,  2],
+             [ 1,  2,  3]]],
+           [[[10, 11, 12],
+             [11, 12, 13]]],
+           [[[20, 21, 22],
+             [21, 22, 23]]]])
+
+    Combining with stepped slicing (`::step`), this can be used to take sliding
+    views which skip elements:
+
+    >>> x = np.arange(7)
+    >>> sliding_window_view(x, 5)[:, ::2]
+    array([[0, 2, 4],
+           [1, 3, 5],
+           [2, 4, 6]])
+
+    or views which move by multiple elements
+
+    >>> x = np.arange(7)
+    >>> sliding_window_view(x, 3)[::2, :]
+    array([[0, 1, 2],
+           [2, 3, 4],
+           [4, 5, 6]])
+
+    A common application of `sliding_window_view` is the calculation of running
+    statistics. The simplest example is the
+    `moving average <https://en.wikipedia.org/wiki/Moving_average>`_:
+
+    >>> x = np.arange(6)
+    >>> x.shape
+    (6,)
+    >>> v = sliding_window_view(x, 3)
+    >>> v.shape
+    (4, 3)
+    >>> v
+    array([[0, 1, 2],
+           [1, 2, 3],
+           [2, 3, 4],
+           [3, 4, 5]])
+    >>> moving_average = v.mean(axis=-1)
+    >>> moving_average
+    array([1., 2., 3., 4.])
+
+    Note that a sliding window approach is often **not** optimal (see Notes).
+    """
+    window_shape = (tuple(window_shape)
+                    if np.iterable(window_shape)
+                    else (window_shape,))
+    # first convert input to array, possibly keeping subclass
+    x = np.array(x, copy=False, subok=subok)
+
+    window_shape_array = np.array(window_shape)
+    if np.any(window_shape_array < 0):
+        raise ValueError('`window_shape` cannot contain negative values')
+
+    if axis is None:
+        axis = tuple(range(x.ndim))
+        if len(window_shape) != len(axis):
+            raise ValueError(f'Since axis is `None`, must provide '
+                             f'window_shape for all dimensions of `x`; '
+                             f'got {len(window_shape)} window_shape elements '
+                             f'and `x.ndim` is {x.ndim}.')
+    else:
+        axis = normalize_axis_tuple(axis, x.ndim, allow_duplicate=True)
+        if len(window_shape) != len(axis):
+            raise ValueError(f'Must provide matching length window_shape and '
+                             f'axis; got {len(window_shape)} window_shape '
+                             f'elements and {len(axis)} axes elements.')
+
+    out_strides = x.strides + tuple(x.strides[ax] for ax in axis)
+
+    # note: same axis can be windowed repeatedly
+    x_shape_trimmed = list(x.shape)
+    for ax, dim in zip(axis, window_shape):
+        if x_shape_trimmed[ax] < dim:
+            raise ValueError(
+                'window shape cannot be larger than input array shape')
+        x_shape_trimmed[ax] -= dim - 1
+    out_shape = tuple(x_shape_trimmed) + window_shape
+    return as_strided(x, strides=out_strides, shape=out_shape,
+                      subok=subok, writeable=writeable)
+
+
+def _broadcast_to(array, shape, subok, readonly):
+    shape = tuple(shape) if np.iterable(shape) else (shape,)
+    array = np.array(array, copy=False, subok=subok)
+    if not shape and array.shape:
+        raise ValueError('cannot broadcast a non-scalar to a scalar array')
+    if any(size < 0 for size in shape):
+        raise ValueError('all elements of broadcast shape must be non-'
+                         'negative')
+    extras = []
+    it = np.nditer(
+        (array,), flags=['multi_index', 'refs_ok', 'zerosize_ok'] + extras,
+        op_flags=['readonly'], itershape=shape, order='C')
+    with it:
+        # never really has writebackifcopy semantics
+        broadcast = it.itviews[0]
+    result = _maybe_view_as_subclass(array, broadcast)
+    # In a future version this will go away
+    if not readonly and array.flags._writeable_no_warn:
+        result.flags.writeable = True
+        result.flags._warn_on_write = True
+    return result
+
+
+def _broadcast_to_dispatcher(array, shape, subok=None):
+    return (array,)
+
+
+@array_function_dispatch(_broadcast_to_dispatcher, module='numpy')
+def broadcast_to(array, shape, subok=False):
+    """Broadcast an array to a new shape.
+
+    Parameters
+    ----------
+    array : array_like
+        The array to broadcast.
+    shape : tuple or int
+        The shape of the desired array. A single integer ``i`` is interpreted
+        as ``(i,)``.
+    subok : bool, optional
+        If True, then sub-classes will be passed-through, otherwise
+        the returned array will be forced to be a base-class array (default).
+
+    Returns
+    -------
+    broadcast : array
+        A readonly view on the original array with the given shape. It is
+        typically not contiguous. Furthermore, more than one element of a
+        broadcasted array may refer to a single memory location.
+
+    Raises
+    ------
+    ValueError
+        If the array is not compatible with the new shape according to NumPy's
+        broadcasting rules.
+
+    See Also
+    --------
+    broadcast
+    broadcast_arrays
+    broadcast_shapes
+
+    Notes
+    -----
+    .. versionadded:: 1.10.0
+
+    Examples
+    --------
+    >>> x = np.array([1, 2, 3])
+    >>> np.broadcast_to(x, (3, 3))
+    array([[1, 2, 3],
+           [1, 2, 3],
+           [1, 2, 3]])
+    """
+    return _broadcast_to(array, shape, subok=subok, readonly=True)
+
+
+def _broadcast_shape(*args):
+    """Returns the shape of the arrays that would result from broadcasting the
+    supplied arrays against each other.
+    """
+    # use the old-iterator because np.nditer does not handle size 0 arrays
+    # consistently
+    b = np.broadcast(*args[:32])
+    # unfortunately, it cannot handle 32 or more arguments directly
+    for pos in range(32, len(args), 31):
+        # ironically, np.broadcast does not properly handle np.broadcast
+        # objects (it treats them as scalars)
+        # use broadcasting to avoid allocating the full array
+        b = broadcast_to(0, b.shape)
+        b = np.broadcast(b, *args[pos:(pos + 31)])
+    return b.shape
+
+
+@set_module('numpy')
+def broadcast_shapes(*args):
+    """
+    Broadcast the input shapes into a single shape.
+
+    :ref:`Learn more about broadcasting here <basics.broadcasting>`.
+
+    .. versionadded:: 1.20.0
+
+    Parameters
+    ----------
+    `*args` : tuples of ints, or ints
+        The shapes to be broadcast against each other.
+
+    Returns
+    -------
+    tuple
+        Broadcasted shape.
+
+    Raises
+    ------
+    ValueError
+        If the shapes are not compatible and cannot be broadcast according
+        to NumPy's broadcasting rules.
+
+    See Also
+    --------
+    broadcast
+    broadcast_arrays
+    broadcast_to
+
+    Examples
+    --------
+    >>> np.broadcast_shapes((1, 2), (3, 1), (3, 2))
+    (3, 2)
+
+    >>> np.broadcast_shapes((6, 7), (5, 6, 1), (7,), (5, 1, 7))
+    (5, 6, 7)
+    """
+    arrays = [np.empty(x, dtype=[]) for x in args]
+    return _broadcast_shape(*arrays)
+
+
+def _broadcast_arrays_dispatcher(*args, subok=None):
+    return args
+
+
+@array_function_dispatch(_broadcast_arrays_dispatcher, module='numpy')
+def broadcast_arrays(*args, subok=False):
+    """
+    Broadcast any number of arrays against each other.
+
+    Parameters
+    ----------
+    `*args` : array_likes
+        The arrays to broadcast.
+
+    subok : bool, optional
+        If True, then sub-classes will be passed-through, otherwise
+        the returned arrays will be forced to be a base-class array (default).
+
+    Returns
+    -------
+    broadcasted : list of arrays
+        These arrays are views on the original arrays.  They are typically
+        not contiguous.  Furthermore, more than one element of a
+        broadcasted array may refer to a single memory location. If you need
+        to write to the arrays, make copies first. While you can set the
+        ``writable`` flag True, writing to a single output value may end up
+        changing more than one location in the output array.
+
+        .. deprecated:: 1.17
+            The output is currently marked so that if written to, a deprecation
+            warning will be emitted. A future version will set the
+            ``writable`` flag False so writing to it will raise an error.
+
+    See Also
+    --------
+    broadcast
+    broadcast_to
+    broadcast_shapes
+
+    Examples
+    --------
+    >>> x = np.array([[1,2,3]])
+    >>> y = np.array([[4],[5]])
+    >>> np.broadcast_arrays(x, y)
+    [array([[1, 2, 3],
+           [1, 2, 3]]), array([[4, 4, 4],
+           [5, 5, 5]])]
+
+    Here is a useful idiom for getting contiguous copies instead of
+    non-contiguous views.
+
+    >>> [np.array(a) for a in np.broadcast_arrays(x, y)]
+    [array([[1, 2, 3],
+           [1, 2, 3]]), array([[4, 4, 4],
+           [5, 5, 5]])]
+
+    """
+    # nditer is not used here to avoid the limit of 32 arrays.
+    # Otherwise, something like the following one-liner would suffice:
+    # return np.nditer(args, flags=['multi_index', 'zerosize_ok'],
+    #                  order='C').itviews
+
+    args = [np.array(_m, copy=False, subok=subok) for _m in args]
+
+    shape = _broadcast_shape(*args)
+
+    if all(array.shape == shape for array in args):
+        # Common case where nothing needs to be broadcasted.
+        return args
+
+    return [_broadcast_to(array, shape, subok=subok, readonly=False)
+            for array in args]

.CondaPkg/env/Lib/site-packages/numpy/lib/stride_tricks.pyi

@@ -0,0 +1,80 @@
+from collections.abc import Iterable
+from typing import Any, TypeVar, overload, SupportsIndex
+
+from numpy import generic
+from numpy._typing import (
+    NDArray,
+    ArrayLike,
+    _ShapeLike,
+    _Shape,
+    _ArrayLike
+)
+
+_SCT = TypeVar("_SCT", bound=generic)
+
+__all__: list[str]
+
+class DummyArray:
+    __array_interface__: dict[str, Any]
+    base: None | NDArray[Any]
+    def __init__(
+        self,
+        interface: dict[str, Any],
+        base: None | NDArray[Any] = ...,
+    ) -> None: ...
+
+@overload
+def as_strided(
+    x: _ArrayLike[_SCT],
+    shape: None | Iterable[int] = ...,
+    strides: None | Iterable[int] = ...,
+    subok: bool = ...,
+    writeable: bool = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def as_strided(
+    x: ArrayLike,
+    shape: None | Iterable[int] = ...,
+    strides: None | Iterable[int] = ...,
+    subok: bool = ...,
+    writeable: bool = ...,
+) -> NDArray[Any]: ...
+
+@overload
+def sliding_window_view(
+    x: _ArrayLike[_SCT],
+    window_shape: int | Iterable[int],
+    axis: None | SupportsIndex = ...,
+    *,
+    subok: bool = ...,
+    writeable: bool = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def sliding_window_view(
+    x: ArrayLike,
+    window_shape: int | Iterable[int],
+    axis: None | SupportsIndex = ...,
+    *,
+    subok: bool = ...,
+    writeable: bool = ...,
+) -> NDArray[Any]: ...
+
+@overload
+def broadcast_to(
+    array: _ArrayLike[_SCT],
+    shape: int | Iterable[int],
+    subok: bool = ...,
+) -> NDArray[_SCT]: ...
+@overload
+def broadcast_to(
+    array: ArrayLike,
+    shape: int | Iterable[int],
+    subok: bool = ...,
+) -> NDArray[Any]: ...
+
+def broadcast_shapes(*args: _ShapeLike) -> _Shape: ...
+
+def broadcast_arrays(
+    *args: ArrayLike,
+    subok: bool = ...,
+) -> list[NDArray[Any]]: ...

.CondaPkg/env/Lib/site-packages/numpy/lib/tests/test__datasource.py

@@ -0,0 +1,350 @@
+import os
+import pytest
+from tempfile import mkdtemp, mkstemp, NamedTemporaryFile
+from shutil import rmtree
+
+import numpy.lib._datasource as datasource
+from numpy.testing import assert_, assert_equal, assert_raises
+
+import urllib.request as urllib_request
+from urllib.parse import urlparse
+from urllib.error import URLError
+
+
+def urlopen_stub(url, data=None):
+    '''Stub to replace urlopen for testing.'''
+    if url == valid_httpurl():
+        tmpfile = NamedTemporaryFile(prefix='urltmp_')
+        return tmpfile
+    else:
+        raise URLError('Name or service not known')
+
+# setup and teardown
+old_urlopen = None
+
+
+def setup_module():
+    global old_urlopen
+
+    old_urlopen = urllib_request.urlopen
+    urllib_request.urlopen = urlopen_stub
+
+
+def teardown_module():
+    urllib_request.urlopen = old_urlopen
+
+# A valid website for more robust testing
+http_path = 'http://www.google.com/'
+http_file = 'index.html'
+
+http_fakepath = 'http://fake.abc.web/site/'
+http_fakefile = 'fake.txt'
+
+malicious_files = ['/etc/shadow', '../../shadow',
+                   '..\\system.dat', 'c:\\windows\\system.dat']
+
+magic_line = b'three is the magic number'
+
+
+# Utility functions used by many tests
+def valid_textfile(filedir):
+    # Generate and return a valid temporary file.
+    fd, path = mkstemp(suffix='.txt', prefix='dstmp_', dir=filedir, text=True)
+    os.close(fd)
+    return path
+
+
+def invalid_textfile(filedir):
+    # Generate and return an invalid filename.
+    fd, path = mkstemp(suffix='.txt', prefix='dstmp_', dir=filedir)
+    os.close(fd)
+    os.remove(path)
+    return path
+
+
+def valid_httpurl():
+    return http_path+http_file
+
+
+def invalid_httpurl():
+    return http_fakepath+http_fakefile
+
+
+def valid_baseurl():
+    return http_path
+
+
+def invalid_baseurl():
+    return http_fakepath
+
+
+def valid_httpfile():
+    return http_file
+
+
+def invalid_httpfile():
+    return http_fakefile
+
+
+class TestDataSourceOpen:
+    def setup_method(self):
+        self.tmpdir = mkdtemp()
+        self.ds = datasource.DataSource(self.tmpdir)
+
+    def teardown_method(self):
+        rmtree(self.tmpdir)
+        del self.ds
+
+    def test_ValidHTTP(self):
+        fh = self.ds.open(valid_httpurl())
+        assert_(fh)
+        fh.close()
+
+    def test_InvalidHTTP(self):
+        url = invalid_httpurl()
+        assert_raises(OSError, self.ds.open, url)
+        try:
+            self.ds.open(url)
+        except OSError as e:
+            # Regression test for bug fixed in r4342.
+            assert_(e.errno is None)
+
+    def test_InvalidHTTPCacheURLError(self):
+        assert_raises(URLError, self.ds._cache, invalid_httpurl())
+
+    def test_ValidFile(self):
+        local_file = valid_textfile(self.tmpdir)
+        fh = self.ds.open(local_file)
+        assert_(fh)
+        fh.close()
+
+    def test_InvalidFile(self):
+        invalid_file = invalid_textfile(self.tmpdir)
+        assert_raises(OSError, self.ds.open, invalid_file)
+
+    def test_ValidGzipFile(self):
+        try:
+            import gzip
+        except ImportError:
+            # We don't have the gzip capabilities to test.
+            pytest.skip()
+        # Test datasource's internal file_opener for Gzip files.
+        filepath = os.path.join(self.tmpdir, 'foobar.txt.gz')
+        fp = gzip.open(filepath, 'w')
+        fp.write(magic_line)
+        fp.close()
+        fp = self.ds.open(filepath)
+        result = fp.readline()
+        fp.close()
+        assert_equal(magic_line, result)
+
+    def test_ValidBz2File(self):
+        try:
+            import bz2
+        except ImportError:
+            # We don't have the bz2 capabilities to test.
+            pytest.skip()
+        # Test datasource's internal file_opener for BZip2 files.
+        filepath = os.path.join(self.tmpdir, 'foobar.txt.bz2')
+        fp = bz2.BZ2File(filepath, 'w')
+        fp.write(magic_line)
+        fp.close()
+        fp = self.ds.open(filepath)
+        result = fp.readline()
+        fp.close()
+        assert_equal(magic_line, result)
+
+
+class TestDataSourceExists:
+    def setup_method(self):
+        self.tmpdir = mkdtemp()
+        self.ds = datasource.DataSource(self.tmpdir)
+
+    def teardown_method(self):
+        rmtree(self.tmpdir)
+        del self.ds
+
+    def test_ValidHTTP(self):
+        assert_(self.ds.exists(valid_httpurl()))
+
+    def test_InvalidHTTP(self):
+        assert_equal(self.ds.exists(invalid_httpurl()), False)
+
+    def test_ValidFile(self):
+        # Test valid file in destpath
+        tmpfile = valid_textfile(self.tmpdir)
+        assert_(self.ds.exists(tmpfile))
+        # Test valid local file not in destpath
+        localdir = mkdtemp()
+        tmpfile = valid_textfile(localdir)
+        assert_(self.ds.exists(tmpfile))
+        rmtree(localdir)
+
+    def test_InvalidFile(self):
+        tmpfile = invalid_textfile(self.tmpdir)
+        assert_equal(self.ds.exists(tmpfile), False)
+
+
+class TestDataSourceAbspath:
+    def setup_method(self):
+        self.tmpdir = os.path.abspath(mkdtemp())
+        self.ds = datasource.DataSource(self.tmpdir)
+
+    def teardown_method(self):
+        rmtree(self.tmpdir)
+        del self.ds
+
+    def test_ValidHTTP(self):
+        scheme, netloc, upath, pms, qry, frg = urlparse(valid_httpurl())
+        local_path = os.path.join(self.tmpdir, netloc,
+                                  upath.strip(os.sep).strip('/'))
+        assert_equal(local_path, self.ds.abspath(valid_httpurl()))
+
+    def test_ValidFile(self):
+        tmpfile = valid_textfile(self.tmpdir)
+        tmpfilename = os.path.split(tmpfile)[-1]
+        # Test with filename only
+        assert_equal(tmpfile, self.ds.abspath(tmpfilename))
+        # Test filename with complete path
+        assert_equal(tmpfile, self.ds.abspath(tmpfile))
+
+    def test_InvalidHTTP(self):
+        scheme, netloc, upath, pms, qry, frg = urlparse(invalid_httpurl())
+        invalidhttp = os.path.join(self.tmpdir, netloc,
+                                   upath.strip(os.sep).strip('/'))
+        assert_(invalidhttp != self.ds.abspath(valid_httpurl()))
+
+    def test_InvalidFile(self):
+        invalidfile = valid_textfile(self.tmpdir)
+        tmpfile = valid_textfile(self.tmpdir)
+        tmpfilename = os.path.split(tmpfile)[-1]
+        # Test with filename only
+        assert_(invalidfile != self.ds.abspath(tmpfilename))
+        # Test filename with complete path
+        assert_(invalidfile != self.ds.abspath(tmpfile))
+
+    def test_sandboxing(self):
+        tmpfile = valid_textfile(self.tmpdir)
+        tmpfilename = os.path.split(tmpfile)[-1]
+
+        tmp_path = lambda x: os.path.abspath(self.ds.abspath(x))
+
+        assert_(tmp_path(valid_httpurl()).startswith(self.tmpdir))
+        assert_(tmp_path(invalid_httpurl()).startswith(self.tmpdir))
+        assert_(tmp_path(tmpfile).startswith(self.tmpdir))
+        assert_(tmp_path(tmpfilename).startswith(self.tmpdir))
+        for fn in malicious_files:
+            assert_(tmp_path(http_path+fn).startswith(self.tmpdir))
+            assert_(tmp_path(fn).startswith(self.tmpdir))
+
+    def test_windows_os_sep(self):
+        orig_os_sep = os.sep
+        try:
+            os.sep = '\\'
+            self.test_ValidHTTP()
+            self.test_ValidFile()
+            self.test_InvalidHTTP()
+            self.test_InvalidFile()
+            self.test_sandboxing()
+        finally:
+            os.sep = orig_os_sep
+
+
+class TestRepositoryAbspath:
+    def setup_method(self):
+        self.tmpdir = os.path.abspath(mkdtemp())
+        self.repos = datasource.Repository(valid_baseurl(), self.tmpdir)
+
+    def teardown_method(self):
+        rmtree(self.tmpdir)
+        del self.repos
+
+    def test_ValidHTTP(self):
+        scheme, netloc, upath, pms, qry, frg = urlparse(valid_httpurl())
+        local_path = os.path.join(self.repos._destpath, netloc,
+                                  upath.strip(os.sep).strip('/'))
+        filepath = self.repos.abspath(valid_httpfile())
+        assert_equal(local_path, filepath)
+
+    def test_sandboxing(self):
+        tmp_path = lambda x: os.path.abspath(self.repos.abspath(x))
+        assert_(tmp_path(valid_httpfile()).startswith(self.tmpdir))
+        for fn in malicious_files:
+            assert_(tmp_path(http_path+fn).startswith(self.tmpdir))
+            assert_(tmp_path(fn).startswith(self.tmpdir))
+
+    def test_windows_os_sep(self):
+        orig_os_sep = os.sep
+        try:
+            os.sep = '\\'
+            self.test_ValidHTTP()
+            self.test_sandboxing()
+        finally:
+            os.sep = orig_os_sep
+
+
+class TestRepositoryExists:
+    def setup_method(self):
+        self.tmpdir = mkdtemp()
+        self.repos = datasource.Repository(valid_baseurl(), self.tmpdir)
+
+    def teardown_method(self):
+        rmtree(self.tmpdir)
+        del self.repos
+
+    def test_ValidFile(self):
+        # Create local temp file
+        tmpfile = valid_textfile(self.tmpdir)
+        assert_(self.repos.exists(tmpfile))
+
+    def test_InvalidFile(self):
+        tmpfile = invalid_textfile(self.tmpdir)
+        assert_equal(self.repos.exists(tmpfile), False)
+
+    def test_RemoveHTTPFile(self):
+        assert_(self.repos.exists(valid_httpurl()))
+
+    def test_CachedHTTPFile(self):
+        localfile = valid_httpurl()
+        # Create a locally cached temp file with an URL based
+        # directory structure.  This is similar to what Repository.open
+        # would do.
+        scheme, netloc, upath, pms, qry, frg = urlparse(localfile)
+        local_path = os.path.join(self.repos._destpath, netloc)
+        os.mkdir(local_path, 0o0700)
+        tmpfile = valid_textfile(local_path)
+        assert_(self.repos.exists(tmpfile))
+
+
+class TestOpenFunc:
+    def setup_method(self):
+        self.tmpdir = mkdtemp()
+
+    def teardown_method(self):
+        rmtree(self.tmpdir)
+
+    def test_DataSourceOpen(self):
+        local_file = valid_textfile(self.tmpdir)
+        # Test case where destpath is passed in
+        fp = datasource.open(local_file, destpath=self.tmpdir)
+        assert_(fp)
+        fp.close()
+        # Test case where default destpath is used
+        fp = datasource.open(local_file)
+        assert_(fp)
+        fp.close()
+
+def test_del_attr_handling():
+    # DataSource __del__ can be called
+    # even if __init__ fails when the
+    # Exception object is caught by the
+    # caller as happens in refguide_check
+    # is_deprecated() function
+
+    ds = datasource.DataSource()
+    # simulate failed __init__ by removing key attribute
+    # produced within __init__ and expected by __del__
+    del ds._istmpdest
+    # should not raise an AttributeError if __del__
+    # gracefully handles failed __init__:
+    ds.__del__()

.CondaPkg/env/Lib/site-packages/numpy/lib/tests/test__iotools.py

@@ -0,0 +1,353 @@
+import time
+from datetime import date
+
+import numpy as np
+from numpy.testing import (
+    assert_, assert_equal, assert_allclose, assert_raises,
+    )
+from numpy.lib._iotools import (
+    LineSplitter, NameValidator, StringConverter,
+    has_nested_fields, easy_dtype, flatten_dtype
+    )
+
+
+class TestLineSplitter:
+    "Tests the LineSplitter class."
+
+    def test_no_delimiter(self):
+        "Test LineSplitter w/o delimiter"
+        strg = " 1 2 3 4  5 # test"
+        test = LineSplitter()(strg)
+        assert_equal(test, ['1', '2', '3', '4', '5'])
+        test = LineSplitter('')(strg)
+        assert_equal(test, ['1', '2', '3', '4', '5'])
+
+    def test_space_delimiter(self):
+        "Test space delimiter"
+        strg = " 1 2 3 4  5 # test"
+        test = LineSplitter(' ')(strg)
+        assert_equal(test, ['1', '2', '3', '4', '', '5'])
+        test = LineSplitter('  ')(strg)
+        assert_equal(test, ['1 2 3 4', '5'])
+
+    def test_tab_delimiter(self):
+        "Test tab delimiter"
+        strg = " 1\t 2\t 3\t 4\t 5  6"
+        test = LineSplitter('\t')(strg)
+        assert_equal(test, ['1', '2', '3', '4', '5  6'])
+        strg = " 1  2\t 3  4\t 5  6"
+        test = LineSplitter('\t')(strg)
+        assert_equal(test, ['1  2', '3  4', '5  6'])
+
+    def test_other_delimiter(self):
+        "Test LineSplitter on delimiter"
+        strg = "1,2,3,4,,5"
+        test = LineSplitter(',')(strg)
+        assert_equal(test, ['1', '2', '3', '4', '', '5'])
+        #
+        strg = " 1,2,3,4,,5 # test"
+        test = LineSplitter(',')(strg)
+        assert_equal(test, ['1', '2', '3', '4', '', '5'])
+
+        # gh-11028 bytes comment/delimiters should get encoded
+        strg = b" 1,2,3,4,,5 % test"
+        test = LineSplitter(delimiter=b',', comments=b'%')(strg)
+        assert_equal(test, ['1', '2', '3', '4', '', '5'])
+
+    def test_constant_fixed_width(self):
+        "Test LineSplitter w/ fixed-width fields"
+        strg = "  1  2  3  4     5   # test"
+        test = LineSplitter(3)(strg)
+        assert_equal(test, ['1', '2', '3', '4', '', '5', ''])
+        #
+        strg = "  1     3  4  5  6# test"
+        test = LineSplitter(20)(strg)
+        assert_equal(test, ['1     3  4  5  6'])
+        #
+        strg = "  1     3  4  5  6# test"
+        test = LineSplitter(30)(strg)
+        assert_equal(test, ['1     3  4  5  6'])
+
+    def test_variable_fixed_width(self):
+        strg = "  1     3  4  5  6# test"
+        test = LineSplitter((3, 6, 6, 3))(strg)
+        assert_equal(test, ['1', '3', '4  5', '6'])
+        #
+        strg = "  1     3  4  5  6# test"
+        test = LineSplitter((6, 6, 9))(strg)
+        assert_equal(test, ['1', '3  4', '5  6'])
+
+# -----------------------------------------------------------------------------
+
+
+class TestNameValidator:
+
+    def test_case_sensitivity(self):
+        "Test case sensitivity"
+        names = ['A', 'a', 'b', 'c']
+        test = NameValidator().validate(names)
+        assert_equal(test, ['A', 'a', 'b', 'c'])
+        test = NameValidator(case_sensitive=False).validate(names)
+        assert_equal(test, ['A', 'A_1', 'B', 'C'])
+        test = NameValidator(case_sensitive='upper').validate(names)
+        assert_equal(test, ['A', 'A_1', 'B', 'C'])
+        test = NameValidator(case_sensitive='lower').validate(names)
+        assert_equal(test, ['a', 'a_1', 'b', 'c'])
+
+        # check exceptions
+        assert_raises(ValueError, NameValidator, case_sensitive='foobar')
+
+    def test_excludelist(self):
+        "Test excludelist"
+        names = ['dates', 'data', 'Other Data', 'mask']
+        validator = NameValidator(excludelist=['dates', 'data', 'mask'])
+        test = validator.validate(names)
+        assert_equal(test, ['dates_', 'data_', 'Other_Data', 'mask_'])
+
+    def test_missing_names(self):
+        "Test validate missing names"
+        namelist = ('a', 'b', 'c')
+        validator = NameValidator()
+        assert_equal(validator(namelist), ['a', 'b', 'c'])
+        namelist = ('', 'b', 'c')
+        assert_equal(validator(namelist), ['f0', 'b', 'c'])
+        namelist = ('a', 'b', '')
+        assert_equal(validator(namelist), ['a', 'b', 'f0'])
+        namelist = ('', 'f0', '')
+        assert_equal(validator(namelist), ['f1', 'f0', 'f2'])
+
+    def test_validate_nb_names(self):
+        "Test validate nb names"
+        namelist = ('a', 'b', 'c')
+        validator = NameValidator()
+        assert_equal(validator(namelist, nbfields=1), ('a',))
+        assert_equal(validator(namelist, nbfields=5, defaultfmt="g%i"),
+                     ['a', 'b', 'c', 'g0', 'g1'])
+
+    def test_validate_wo_names(self):
+        "Test validate no names"
+        namelist = None
+        validator = NameValidator()
+        assert_(validator(namelist) is None)
+        assert_equal(validator(namelist, nbfields=3), ['f0', 'f1', 'f2'])
+
+# -----------------------------------------------------------------------------
+
+
+def _bytes_to_date(s):
+    return date(*time.strptime(s, "%Y-%m-%d")[:3])
+
+
+class TestStringConverter:
+    "Test StringConverter"
+
+    def test_creation(self):
+        "Test creation of a StringConverter"
+        converter = StringConverter(int, -99999)
+        assert_equal(converter._status, 1)
+        assert_equal(converter.default, -99999)
+
+    def test_upgrade(self):
+        "Tests the upgrade method."
+
+        converter = StringConverter()
+        assert_equal(converter._status, 0)
+
+        # test int
+        assert_equal(converter.upgrade('0'), 0)
+        assert_equal(converter._status, 1)
+
+        # On systems where long defaults to 32-bit, the statuses will be
+        # offset by one, so we check for this here.
+        import numpy.core.numeric as nx
+        status_offset = int(nx.dtype(nx.int_).itemsize < nx.dtype(nx.int64).itemsize)
+
+        # test int > 2**32
+        assert_equal(converter.upgrade('17179869184'), 17179869184)
+        assert_equal(converter._status, 1 + status_offset)
+
+        # test float
+        assert_allclose(converter.upgrade('0.'), 0.0)
+        assert_equal(converter._status, 2 + status_offset)
+
+        # test complex
+        assert_equal(converter.upgrade('0j'), complex('0j'))
+        assert_equal(converter._status, 3 + status_offset)
+
+        # test str
+        # note that the longdouble type has been skipped, so the
+        # _status increases by 2. Everything should succeed with
+        # unicode conversion (8).
+        for s in ['a', b'a']:
+            res = converter.upgrade(s)
+            assert_(type(res) is str)
+            assert_equal(res, 'a')
+            assert_equal(converter._status, 8 + status_offset)
+
+    def test_missing(self):
+        "Tests the use of missing values."
+        converter = StringConverter(missing_values=('missing',
+                                                    'missed'))
+        converter.upgrade('0')
+        assert_equal(converter('0'), 0)
+        assert_equal(converter(''), converter.default)
+        assert_equal(converter('missing'), converter.default)
+        assert_equal(converter('missed'), converter.default)
+        try:
+            converter('miss')
+        except ValueError:
+            pass
+
+    def test_upgrademapper(self):
+        "Tests updatemapper"
+        dateparser = _bytes_to_date
+        _original_mapper = StringConverter._mapper[:]
+        try:
+            StringConverter.upgrade_mapper(dateparser, date(2000, 1, 1))
+            convert = StringConverter(dateparser, date(2000, 1, 1))
+            test = convert('2001-01-01')
+            assert_equal(test, date(2001, 1, 1))
+            test = convert('2009-01-01')
+            assert_equal(test, date(2009, 1, 1))
+            test = convert('')
+            assert_equal(test, date(2000, 1, 1))
+        finally:
+            StringConverter._mapper = _original_mapper
+
+    def test_string_to_object(self):
+        "Make sure that string-to-object functions are properly recognized"
+        old_mapper = StringConverter._mapper[:]  # copy of list
+        conv = StringConverter(_bytes_to_date)
+        assert_equal(conv._mapper, old_mapper)
+        assert_(hasattr(conv, 'default'))
+
+    def test_keep_default(self):
+        "Make sure we don't lose an explicit default"
+        converter = StringConverter(None, missing_values='',
+                                    default=-999)
+        converter.upgrade('3.14159265')
+        assert_equal(converter.default, -999)
+        assert_equal(converter.type, np.dtype(float))
+        #
+        converter = StringConverter(
+            None, missing_values='', default=0)
+        converter.upgrade('3.14159265')
+        assert_equal(converter.default, 0)
+        assert_equal(converter.type, np.dtype(float))
+
+    def test_keep_default_zero(self):
+        "Check that we don't lose a default of 0"
+        converter = StringConverter(int, default=0,
+                                    missing_values="N/A")
+        assert_equal(converter.default, 0)
+
+    def test_keep_missing_values(self):
+        "Check that we're not losing missing values"
+        converter = StringConverter(int, default=0,
+                                    missing_values="N/A")
+        assert_equal(
+            converter.missing_values, {'', 'N/A'})
+
+    def test_int64_dtype(self):
+        "Check that int64 integer types can be specified"
+        converter = StringConverter(np.int64, default=0)
+        val = "-9223372036854775807"
+        assert_(converter(val) == -9223372036854775807)
+        val = "9223372036854775807"
+        assert_(converter(val) == 9223372036854775807)
+
+    def test_uint64_dtype(self):
+        "Check that uint64 integer types can be specified"
+        converter = StringConverter(np.uint64, default=0)
+        val = "9223372043271415339"
+        assert_(converter(val) == 9223372043271415339)
+
+
+class TestMiscFunctions:
+
+    def test_has_nested_dtype(self):
+        "Test has_nested_dtype"
+        ndtype = np.dtype(float)
+        assert_equal(has_nested_fields(ndtype), False)
+        ndtype = np.dtype([('A', '|S3'), ('B', float)])
+        assert_equal(has_nested_fields(ndtype), False)
+        ndtype = np.dtype([('A', int), ('B', [('BA', float), ('BB', '|S1')])])
+        assert_equal(has_nested_fields(ndtype), True)
+
+    def test_easy_dtype(self):
+        "Test ndtype on dtypes"
+        # Simple case
+        ndtype = float
+        assert_equal(easy_dtype(ndtype), np.dtype(float))
+        # As string w/o names
+        ndtype = "i4, f8"
+        assert_equal(easy_dtype(ndtype),
+                     np.dtype([('f0', "i4"), ('f1', "f8")]))
+        # As string w/o names but different default format
+        assert_equal(easy_dtype(ndtype, defaultfmt="field_%03i"),
+                     np.dtype([('field_000', "i4"), ('field_001', "f8")]))
+        # As string w/ names
+        ndtype = "i4, f8"
+        assert_equal(easy_dtype(ndtype, names="a, b"),
+                     np.dtype([('a', "i4"), ('b', "f8")]))
+        # As string w/ names (too many)
+        ndtype = "i4, f8"
+        assert_equal(easy_dtype(ndtype, names="a, b, c"),
+                     np.dtype([('a', "i4"), ('b', "f8")]))
+        # As string w/ names (not enough)
+        ndtype = "i4, f8"
+        assert_equal(easy_dtype(ndtype, names=", b"),
+                     np.dtype([('f0', "i4"), ('b', "f8")]))
+        # ... (with different default format)
+        assert_equal(easy_dtype(ndtype, names="a", defaultfmt="f%02i"),
+                     np.dtype([('a', "i4"), ('f00', "f8")]))
+        # As list of tuples w/o names
+        ndtype = [('A', int), ('B', float)]
+        assert_equal(easy_dtype(ndtype), np.dtype([('A', int), ('B', float)]))
+        # As list of tuples w/ names
+        assert_equal(easy_dtype(ndtype, names="a,b"),
+                     np.dtype([('a', int), ('b', float)]))
+        # As list of tuples w/ not enough names
+        assert_equal(easy_dtype(ndtype, names="a"),
+                     np.dtype([('a', int), ('f0', float)]))
+        # As list of tuples w/ too many names
+        assert_equal(easy_dtype(ndtype, names="a,b,c"),
+                     np.dtype([('a', int), ('b', float)]))
+        # As list of types w/o names
+        ndtype = (int, float, float)
+        assert_equal(easy_dtype(ndtype),
+                     np.dtype([('f0', int), ('f1', float), ('f2', float)]))
+        # As list of types w names
+        ndtype = (int, float, float)
+        assert_equal(easy_dtype(ndtype, names="a, b, c"),
+                     np.dtype([('a', int), ('b', float), ('c', float)]))
+        # As simple dtype w/ names
+        ndtype = np.dtype(float)
+        assert_equal(easy_dtype(ndtype, names="a, b, c"),
+                     np.dtype([(_, float) for _ in ('a', 'b', 'c')]))
+        # As simple dtype w/o names (but multiple fields)
+        ndtype = np.dtype(float)
+        assert_equal(
+            easy_dtype(ndtype, names=['', '', ''], defaultfmt="f%02i"),
+            np.dtype([(_, float) for _ in ('f00', 'f01', 'f02')]))
+
+    def test_flatten_dtype(self):
+        "Testing flatten_dtype"
+        # Standard dtype
+        dt = np.dtype([("a", "f8"), ("b", "f8")])
+        dt_flat = flatten_dtype(dt)
+        assert_equal(dt_flat, [float, float])
+        # Recursive dtype
+        dt = np.dtype([("a", [("aa", '|S1'), ("ab", '|S2')]), ("b", int)])
+        dt_flat = flatten_dtype(dt)
+        assert_equal(dt_flat, [np.dtype('|S1'), np.dtype('|S2'), int])
+        # dtype with shaped fields
+        dt = np.dtype([("a", (float, 2)), ("b", (int, 3))])
+        dt_flat = flatten_dtype(dt)
+        assert_equal(dt_flat, [float, int])
+        dt_flat = flatten_dtype(dt, True)
+        assert_equal(dt_flat, [float] * 2 + [int] * 3)
+        # dtype w/ titles
+        dt = np.dtype([(("a", "A"), "f8"), (("b", "B"), "f8")])
+        dt_flat = flatten_dtype(dt)
+        assert_equal(dt_flat, [float, float])

.CondaPkg/env/Lib/site-packages/numpy/lib/tests/test__version.py

@@ -0,0 +1,64 @@
+"""Tests for the NumpyVersion class.
+
+"""
+from numpy.testing import assert_, assert_raises
+from numpy.lib import NumpyVersion
+
+
+def test_main_versions():
+    assert_(NumpyVersion('1.8.0') == '1.8.0')
+    for ver in ['1.9.0', '2.0.0', '1.8.1', '10.0.1']:
+        assert_(NumpyVersion('1.8.0') < ver)
+
+    for ver in ['1.7.0', '1.7.1', '0.9.9']:
+        assert_(NumpyVersion('1.8.0') > ver)
+
+
+def test_version_1_point_10():
+    # regression test for gh-2998.
+    assert_(NumpyVersion('1.9.0') < '1.10.0')
+    assert_(NumpyVersion('1.11.0') < '1.11.1')
+    assert_(NumpyVersion('1.11.0') == '1.11.0')
+    assert_(NumpyVersion('1.99.11') < '1.99.12')
+
+
+def test_alpha_beta_rc():
+    assert_(NumpyVersion('1.8.0rc1') == '1.8.0rc1')
+    for ver in ['1.8.0', '1.8.0rc2']:
+        assert_(NumpyVersion('1.8.0rc1') < ver)
+
+    for ver in ['1.8.0a2', '1.8.0b3', '1.7.2rc4']:
+        assert_(NumpyVersion('1.8.0rc1') > ver)
+
+    assert_(NumpyVersion('1.8.0b1') > '1.8.0a2')
+
+
+def test_dev_version():
+    assert_(NumpyVersion('1.9.0.dev-Unknown') < '1.9.0')
+    for ver in ['1.9.0', '1.9.0a1', '1.9.0b2', '1.9.0b2.dev-ffffffff']:
+        assert_(NumpyVersion('1.9.0.dev-f16acvda') < ver)
+
+    assert_(NumpyVersion('1.9.0.dev-f16acvda') == '1.9.0.dev-11111111')
+
+
+def test_dev_a_b_rc_mixed():
+    assert_(NumpyVersion('1.9.0a2.dev-f16acvda') == '1.9.0a2.dev-11111111')
+    assert_(NumpyVersion('1.9.0a2.dev-6acvda54') < '1.9.0a2')
+
+
+def test_dev0_version():
+    assert_(NumpyVersion('1.9.0.dev0+Unknown') < '1.9.0')
+    for ver in ['1.9.0', '1.9.0a1', '1.9.0b2', '1.9.0b2.dev0+ffffffff']:
+        assert_(NumpyVersion('1.9.0.dev0+f16acvda') < ver)
+
+    assert_(NumpyVersion('1.9.0.dev0+f16acvda') == '1.9.0.dev0+11111111')
+
+
+def test_dev0_a_b_rc_mixed():
+    assert_(NumpyVersion('1.9.0a2.dev0+f16acvda') == '1.9.0a2.dev0+11111111')
+    assert_(NumpyVersion('1.9.0a2.dev0+6acvda54') < '1.9.0a2')
+
+
+def test_raises():
+    for ver in ['1.9', '1,9.0', '1.7.x']:
+        assert_raises(ValueError, NumpyVersion, ver)

.CondaPkg/env/Lib/site-packages/numpy/lib/tests/test_arraysetops.py

@@ -0,0 +1,944 @@
+"""Test functions for 1D array set operations.
+
+"""
+import numpy as np
+
+from numpy.testing import (assert_array_equal, assert_equal,
+                           assert_raises, assert_raises_regex)
+from numpy.lib.arraysetops import (
+    ediff1d, intersect1d, setxor1d, union1d, setdiff1d, unique, in1d, isin
+    )
+import pytest
+
+
+class TestSetOps:
+
+    def test_intersect1d(self):
+        # unique inputs
+        a = np.array([5, 7, 1, 2])
+        b = np.array([2, 4, 3, 1, 5])
+
+        ec = np.array([1, 2, 5])
+        c = intersect1d(a, b, assume_unique=True)
+        assert_array_equal(c, ec)
+
+        # non-unique inputs
+        a = np.array([5, 5, 7, 1, 2])
+        b = np.array([2, 1, 4, 3, 3, 1, 5])
+
+        ed = np.array([1, 2, 5])
+        c = intersect1d(a, b)
+        assert_array_equal(c, ed)
+        assert_array_equal([], intersect1d([], []))
+
+    def test_intersect1d_array_like(self):
+        # See gh-11772
+        class Test:
+            def __array__(self):
+                return np.arange(3)
+
+        a = Test()
+        res = intersect1d(a, a)
+        assert_array_equal(res, a)
+        res = intersect1d([1, 2, 3], [1, 2, 3])
+        assert_array_equal(res, [1, 2, 3])
+
+    def test_intersect1d_indices(self):
+        # unique inputs
+        a = np.array([1, 2, 3, 4])
+        b = np.array([2, 1, 4, 6])
+        c, i1, i2 = intersect1d(a, b, assume_unique=True, return_indices=True)
+        ee = np.array([1, 2, 4])
+        assert_array_equal(c, ee)
+        assert_array_equal(a[i1], ee)
+        assert_array_equal(b[i2], ee)
+
+        # non-unique inputs
+        a = np.array([1, 2, 2, 3, 4, 3, 2])
+        b = np.array([1, 8, 4, 2, 2, 3, 2, 3])
+        c, i1, i2 = intersect1d(a, b, return_indices=True)
+        ef = np.array([1, 2, 3, 4])
+        assert_array_equal(c, ef)
+        assert_array_equal(a[i1], ef)
+        assert_array_equal(b[i2], ef)
+
+        # non1d, unique inputs
+        a = np.array([[2, 4, 5, 6], [7, 8, 1, 15]])
+        b = np.array([[3, 2, 7, 6], [10, 12, 8, 9]])
+        c, i1, i2 = intersect1d(a, b, assume_unique=True, return_indices=True)
+        ui1 = np.unravel_index(i1, a.shape)
+        ui2 = np.unravel_index(i2, b.shape)
+        ea = np.array([2, 6, 7, 8])
+        assert_array_equal(ea, a[ui1])
+        assert_array_equal(ea, b[ui2])
+
+        # non1d, not assumed to be uniqueinputs
+        a = np.array([[2, 4, 5, 6, 6], [4, 7, 8, 7, 2]])
+        b = np.array([[3, 2, 7, 7], [10, 12, 8, 7]])
+        c, i1, i2 = intersect1d(a, b, return_indices=True)
+        ui1 = np.unravel_index(i1, a.shape)
+        ui2 = np.unravel_index(i2, b.shape)
+        ea = np.array([2, 7, 8])
+        assert_array_equal(ea, a[ui1])
+        assert_array_equal(ea, b[ui2])
+
+    def test_setxor1d(self):
+        a = np.array([5, 7, 1, 2])
+        b = np.array([2, 4, 3, 1, 5])
+
+        ec = np.array([3, 4, 7])
+        c = setxor1d(a, b)
+        assert_array_equal(c, ec)
+
+        a = np.array([1, 2, 3])
+        b = np.array([6, 5, 4])
+
+        ec = np.array([1, 2, 3, 4, 5, 6])
+        c = setxor1d(a, b)
+        assert_array_equal(c, ec)
+
+        a = np.array([1, 8, 2, 3])
+        b = np.array([6, 5, 4, 8])
+
+        ec = np.array([1, 2, 3, 4, 5, 6])
+        c = setxor1d(a, b)
+        assert_array_equal(c, ec)
+
+        assert_array_equal([], setxor1d([], []))
+
+    def test_ediff1d(self):
+        zero_elem = np.array([])
+        one_elem = np.array([1])
+        two_elem = np.array([1, 2])
+
+        assert_array_equal([], ediff1d(zero_elem))
+        assert_array_equal([0], ediff1d(zero_elem, to_begin=0))
+        assert_array_equal([0], ediff1d(zero_elem, to_end=0))
+        assert_array_equal([-1, 0], ediff1d(zero_elem, to_begin=-1, to_end=0))
+        assert_array_equal([], ediff1d(one_elem))
+        assert_array_equal([1], ediff1d(two_elem))
+        assert_array_equal([7, 1, 9], ediff1d(two_elem, to_begin=7, to_end=9))
+        assert_array_equal([5, 6, 1, 7, 8],
+                           ediff1d(two_elem, to_begin=[5, 6], to_end=[7, 8]))
+        assert_array_equal([1, 9], ediff1d(two_elem, to_end=9))
+        assert_array_equal([1, 7, 8], ediff1d(two_elem, to_end=[7, 8]))
+        assert_array_equal([7, 1], ediff1d(two_elem, to_begin=7))
+        assert_array_equal([5, 6, 1], ediff1d(two_elem, to_begin=[5, 6]))
+
+    @pytest.mark.parametrize("ary, prepend, append, expected", [
+        # should fail because trying to cast
+        # np.nan standard floating point value
+        # into an integer array:
+        (np.array([1, 2, 3], dtype=np.int64),
+         None,
+         np.nan,
+         'to_end'),
+        # should fail because attempting
+        # to downcast to int type:
+        (np.array([1, 2, 3], dtype=np.int64),
+         np.array([5, 7, 2], dtype=np.float32),
+         None,
+         'to_begin'),
+        # should fail because attempting to cast
+        # two special floating point values
+        # to integers (on both sides of ary),
+        # `to_begin` is in the error message as the impl checks this first:
+        (np.array([1., 3., 9.], dtype=np.int8),
+         np.nan,
+         np.nan,
+         'to_begin'),
+         ])
+    def test_ediff1d_forbidden_type_casts(self, ary, prepend, append, expected):
+        # verify resolution of gh-11490
+
+        # specifically, raise an appropriate
+        # Exception when attempting to append or
+        # prepend with an incompatible type
+        msg = 'dtype of `{}` must be compatible'.format(expected)
+        with assert_raises_regex(TypeError, msg):
+            ediff1d(ary=ary,
+                    to_end=append,
+                    to_begin=prepend)
+
+    @pytest.mark.parametrize(
+        "ary,prepend,append,expected",
+        [
+         (np.array([1, 2, 3], dtype=np.int16),
+          2**16,  # will be cast to int16 under same kind rule.
+          2**16 + 4,
+          np.array([0, 1, 1, 4], dtype=np.int16)),
+         (np.array([1, 2, 3], dtype=np.float32),
+          np.array([5], dtype=np.float64),
+          None,
+          np.array([5, 1, 1], dtype=np.float32)),
+         (np.array([1, 2, 3], dtype=np.int32),
+          0,
+          0,
+          np.array([0, 1, 1, 0], dtype=np.int32)),
+         (np.array([1, 2, 3], dtype=np.int64),
+          3,
+          -9,
+          np.array([3, 1, 1, -9], dtype=np.int64)),
+        ]
+    )
+    def test_ediff1d_scalar_handling(self,
+                                     ary,
+                                     prepend,
+                                     append,
+                                     expected):
+        # maintain backwards-compatibility
+        # of scalar prepend / append behavior
+        # in ediff1d following fix for gh-11490
+        actual = np.ediff1d(ary=ary,
+                            to_end=append,
+                            to_begin=prepend)
+        assert_equal(actual, expected)
+        assert actual.dtype == expected.dtype
+
+    @pytest.mark.parametrize("kind", [None, "sort", "table"])
+    def test_isin(self, kind):
+        # the tests for in1d cover most of isin's behavior
+        # if in1d is removed, would need to change those tests to test
+        # isin instead.
+        def _isin_slow(a, b):
+            b = np.asarray(b).flatten().tolist()
+            return a in b
+        isin_slow = np.vectorize(_isin_slow, otypes=[bool], excluded={1})
+
+        def assert_isin_equal(a, b):
+            x = isin(a, b, kind=kind)
+            y = isin_slow(a, b)
+            assert_array_equal(x, y)
+
+        # multidimensional arrays in both arguments
+        a = np.arange(24).reshape([2, 3, 4])
+        b = np.array([[10, 20, 30], [0, 1, 3], [11, 22, 33]])
+        assert_isin_equal(a, b)
+
+        # array-likes as both arguments
+        c = [(9, 8), (7, 6)]
+        d = (9, 7)
+        assert_isin_equal(c, d)
+
+        # zero-d array:
+        f = np.array(3)
+        assert_isin_equal(f, b)
+        assert_isin_equal(a, f)
+        assert_isin_equal(f, f)
+
+        # scalar:
+        assert_isin_equal(5, b)
+        assert_isin_equal(a, 6)
+        assert_isin_equal(5, 6)
+
+        # empty array-like:
+        if kind != "table":
+            # An empty list will become float64,
+            # which is invalid for kind="table"
+            x = []
+            assert_isin_equal(x, b)
+            assert_isin_equal(a, x)
+            assert_isin_equal(x, x)
+
+        # empty array with various types:
+        for dtype in [bool, np.int64, np.float64]:
+            if kind == "table" and dtype == np.float64:
+                continue
+
+            if dtype in {np.int64, np.float64}:
+                ar = np.array([10, 20, 30], dtype=dtype)
+            elif dtype in {bool}:
+                ar = np.array([True, False, False])
+
+            empty_array = np.array([], dtype=dtype)
+
+            assert_isin_equal(empty_array, ar)
+            assert_isin_equal(ar, empty_array)
+            assert_isin_equal(empty_array, empty_array)
+
+    @pytest.mark.parametrize("kind", [None, "sort", "table"])
+    def test_in1d(self, kind):
+        # we use two different sizes for the b array here to test the
+        # two different paths in in1d().
+        for mult in (1, 10):
+            # One check without np.array to make sure lists are handled correct
+            a = [5, 7, 1, 2]
+            b = [2, 4, 3, 1, 5] * mult
+            ec = np.array([True, False, True, True])
+            c = in1d(a, b, assume_unique=True, kind=kind)
+            assert_array_equal(c, ec)
+
+            a[0] = 8
+            ec = np.array([False, False, True, True])
+            c = in1d(a, b, assume_unique=True, kind=kind)
+            assert_array_equal(c, ec)
+
+            a[0], a[3] = 4, 8
+            ec = np.array([True, False, True, False])
+            c = in1d(a, b, assume_unique=True, kind=kind)
+            assert_array_equal(c, ec)
+
+            a = np.array([5, 4, 5, 3, 4, 4, 3, 4, 3, 5, 2, 1, 5, 5])
+            b = [2, 3, 4] * mult
+            ec = [False, True, False, True, True, True, True, True, True,
+                  False, True, False, False, False]
+            c = in1d(a, b, kind=kind)
+            assert_array_equal(c, ec)
+
+            b = b + [5, 5, 4] * mult
+            ec = [True, True, True, True, True, True, True, True, True, True,
+                  True, False, True, True]
+            c = in1d(a, b, kind=kind)
+            assert_array_equal(c, ec)
+
+            a = np.array([5, 7, 1, 2])
+            b = np.array([2, 4, 3, 1, 5] * mult)
+            ec = np.array([True, False, True, True])
+            c = in1d(a, b, kind=kind)
+            assert_array_equal(c, ec)
+
+            a = np.array([5, 7, 1, 1, 2])
+            b = np.array([2, 4, 3, 3, 1, 5] * mult)
+            ec = np.array([True, False, True, True, True])
+            c = in1d(a, b, kind=kind)
+            assert_array_equal(c, ec)
+
+            a = np.array([5, 5])
+            b = np.array([2, 2] * mult)
+            ec = np.array([False, False])
+            c = in1d(a, b, kind=kind)
+            assert_array_equal(c, ec)
+
+        a = np.array([5])
+        b = np.array([2])
+        ec = np.array([False])
+        c = in1d(a, b, kind=kind)
+        assert_array_equal(c, ec)
+
+        if kind in {None, "sort"}:
+            assert_array_equal(in1d([], [], kind=kind), [])
+
+    def test_in1d_char_array(self):
+        a = np.array(['a', 'b', 'c', 'd', 'e', 'c', 'e', 'b'])
+        b = np.array(['a', 'c'])
+
+        ec = np.array([True, False, True, False, False, True, False, False])
+        c = in1d(a, b)
+
+        assert_array_equal(c, ec)
+
+    @pytest.mark.parametrize("kind", [None, "sort", "table"])
+    def test_in1d_invert(self, kind):
+        "Test in1d's invert parameter"
+        # We use two different sizes for the b array here to test the
+        # two different paths in in1d().
+        for mult in (1, 10):
+            a = np.array([5, 4, 5, 3, 4, 4, 3, 4, 3, 5, 2, 1, 5, 5])
+            b = [2, 3, 4] * mult
+            assert_array_equal(np.invert(in1d(a, b, kind=kind)),
+                               in1d(a, b, invert=True, kind=kind))
+
+        # float:
+        if kind in {None, "sort"}:
+            for mult in (1, 10):
+                a = np.array([5, 4, 5, 3, 4, 4, 3, 4, 3, 5, 2, 1, 5, 5],
+                            dtype=np.float32)
+                b = [2, 3, 4] * mult
+                b = np.array(b, dtype=np.float32)
+                assert_array_equal(np.invert(in1d(a, b, kind=kind)),
+                                   in1d(a, b, invert=True, kind=kind))
+
+    @pytest.mark.parametrize("kind", [None, "sort", "table"])
+    def test_in1d_ravel(self, kind):
+        # Test that in1d ravels its input arrays. This is not documented
+        # behavior however. The test is to ensure consistentency.
+        a = np.arange(6).reshape(2, 3)
+        b = np.arange(3, 9).reshape(3, 2)
+        long_b = np.arange(3, 63).reshape(30, 2)
+        ec = np.array([False, False, False, True, True, True])
+
+        assert_array_equal(in1d(a, b, assume_unique=True, kind=kind),
+                           ec)
+        assert_array_equal(in1d(a, b, assume_unique=False,
+                                kind=kind),
+                           ec)
+        assert_array_equal(in1d(a, long_b, assume_unique=True,
+                                kind=kind),
+                           ec)
+        assert_array_equal(in1d(a, long_b, assume_unique=False,
+                                kind=kind),
+                           ec)
+
+    def test_in1d_hit_alternate_algorithm(self):
+        """Hit the standard isin code with integers"""
+        # Need extreme range to hit standard code
+        # This hits it without the use of kind='table'
+        a = np.array([5, 4, 5, 3, 4, 4, 1e9], dtype=np.int64)
+        b = np.array([2, 3, 4, 1e9], dtype=np.int64)
+        expected = np.array([0, 1, 0, 1, 1, 1, 1], dtype=bool)
+        assert_array_equal(expected, in1d(a, b))
+        assert_array_equal(np.invert(expected), in1d(a, b, invert=True))
+
+        a = np.array([5, 7, 1, 2], dtype=np.int64)
+        b = np.array([2, 4, 3, 1, 5, 1e9], dtype=np.int64)
+        ec = np.array([True, False, True, True])
+        c = in1d(a, b, assume_unique=True)
+        assert_array_equal(c, ec)
+
+    @pytest.mark.parametrize("kind", [None, "sort", "table"])
+    def test_in1d_boolean(self, kind):
+        """Test that in1d works for boolean input"""
+        a = np.array([True, False])
+        b = np.array([False, False, False])
+        expected = np.array([False, True])
+        assert_array_equal(expected,
+                           in1d(a, b, kind=kind))
+        assert_array_equal(np.invert(expected),
+                           in1d(a, b, invert=True, kind=kind))
+
+    @pytest.mark.parametrize("kind", [None, "sort"])
+    def test_in1d_timedelta(self, kind):
+        """Test that in1d works for timedelta input"""
+        rstate = np.random.RandomState(0)
+        a = rstate.randint(0, 100, size=10)
+        b = rstate.randint(0, 100, size=10)
+        truth = in1d(a, b)
+        a_timedelta = a.astype("timedelta64[s]")
+        b_timedelta = b.astype("timedelta64[s]")
+        assert_array_equal(truth, in1d(a_timedelta, b_timedelta, kind=kind))
+
+    def test_in1d_table_timedelta_fails(self):
+        a = np.array([0, 1, 2], dtype="timedelta64[s]")
+        b = a
+        # Make sure it raises a value error:
+        with pytest.raises(ValueError):
+            in1d(a, b, kind="table")
+
+    @pytest.mark.parametrize(
+        "dtype1,dtype2",
+        [
+            (np.int8, np.int16),
+            (np.int16, np.int8),
+            (np.uint8, np.uint16),
+            (np.uint16, np.uint8),
+            (np.uint8, np.int16),
+            (np.int16, np.uint8),
+        ]
+    )
+    @pytest.mark.parametrize("kind", [None, "sort", "table"])
+    def test_in1d_mixed_dtype(self, dtype1, dtype2, kind):
+        """Test that in1d works as expected for mixed dtype input."""
+        is_dtype2_signed = np.issubdtype(dtype2, np.signedinteger)
+        ar1 = np.array([0, 0, 1, 1], dtype=dtype1)
+
+        if is_dtype2_signed:
+            ar2 = np.array([-128, 0, 127], dtype=dtype2)
+        else:
+            ar2 = np.array([127, 0, 255], dtype=dtype2)
+
+        expected = np.array([True, True, False, False])
+
+        expect_failure = kind == "table" and any((
+            dtype1 == np.int8 and dtype2 == np.int16,
+            dtype1 == np.int16 and dtype2 == np.int8
+        ))
+
+        if expect_failure:
+            with pytest.raises(RuntimeError, match="exceed the maximum"):
+                in1d(ar1, ar2, kind=kind)
+        else:
+            assert_array_equal(in1d(ar1, ar2, kind=kind), expected)
+
+    @pytest.mark.parametrize("kind", [None, "sort", "table"])
+    def test_in1d_mixed_boolean(self, kind):
+        """Test that in1d works as expected for bool/int input."""
+        for dtype in np.typecodes["AllInteger"]:
+            a = np.array([True, False, False], dtype=bool)
+            b = np.array([0, 0, 0, 0], dtype=dtype)
+            expected = np.array([False, True, True], dtype=bool)
+            assert_array_equal(in1d(a, b, kind=kind), expected)
+
+            a, b = b, a
+            expected = np.array([True, True, True, True], dtype=bool)
+            assert_array_equal(in1d(a, b, kind=kind), expected)
+
+    def test_in1d_first_array_is_object(self):
+        ar1 = [None]
+        ar2 = np.array([1]*10)
+        expected = np.array([False])
+        result = np.in1d(ar1, ar2)
+        assert_array_equal(result, expected)
+
+    def test_in1d_second_array_is_object(self):
+        ar1 = 1
+        ar2 = np.array([None]*10)
+        expected = np.array([False])
+        result = np.in1d(ar1, ar2)
+        assert_array_equal(result, expected)
+
+    def test_in1d_both_arrays_are_object(self):
+        ar1 = [None]
+        ar2 = np.array([None]*10)
+        expected = np.array([True])
+        result = np.in1d(ar1, ar2)
+        assert_array_equal(result, expected)
+
+    def test_in1d_both_arrays_have_structured_dtype(self):
+        # Test arrays of a structured data type containing an integer field
+        # and a field of dtype `object` allowing for arbitrary Python objects
+        dt = np.dtype([('field1', int), ('field2', object)])
+        ar1 = np.array([(1, None)], dtype=dt)
+        ar2 = np.array([(1, None)]*10, dtype=dt)
+        expected = np.array([True])
+        result = np.in1d(ar1, ar2)
+        assert_array_equal(result, expected)
+
+    def test_in1d_with_arrays_containing_tuples(self):
+        ar1 = np.array([(1,), 2], dtype=object)
+        ar2 = np.array([(1,), 2], dtype=object)
+        expected = np.array([True, True])
+        result = np.in1d(ar1, ar2)
+        assert_array_equal(result, expected)
+        result = np.in1d(ar1, ar2, invert=True)
+        assert_array_equal(result, np.invert(expected))
+
+        # An integer is added at the end of the array to make sure
+        # that the array builder will create the array with tuples
+        # and after it's created the integer is removed.
+        # There's a bug in the array constructor that doesn't handle
+        # tuples properly and adding the integer fixes that.
+        ar1 = np.array([(1,), (2, 1), 1], dtype=object)
+        ar1 = ar1[:-1]
+        ar2 = np.array([(1,), (2, 1), 1], dtype=object)
+        ar2 = ar2[:-1]
+        expected = np.array([True, True])
+        result = np.in1d(ar1, ar2)
+        assert_array_equal(result, expected)
+        result = np.in1d(ar1, ar2, invert=True)
+        assert_array_equal(result, np.invert(expected))
+
+        ar1 = np.array([(1,), (2, 3), 1], dtype=object)
+        ar1 = ar1[:-1]
+        ar2 = np.array([(1,), 2], dtype=object)
+        expected = np.array([True, False])
+        result = np.in1d(ar1, ar2)
+        assert_array_equal(result, expected)
+        result = np.in1d(ar1, ar2, invert=True)
+        assert_array_equal(result, np.invert(expected))
+
+    def test_in1d_errors(self):
+        """Test that in1d raises expected errors."""
+
+        # Error 1: `kind` is not one of 'sort' 'table' or None.
+        ar1 = np.array([1, 2, 3, 4, 5])
+        ar2 = np.array([2, 4, 6, 8, 10])
+        assert_raises(ValueError, in1d, ar1, ar2, kind='quicksort')
+
+        # Error 2: `kind="table"` does not work for non-integral arrays.
+        obj_ar1 = np.array([1, 'a', 3, 'b', 5], dtype=object)
+        obj_ar2 = np.array([1, 'a', 3, 'b', 5], dtype=object)
+        assert_raises(ValueError, in1d, obj_ar1, obj_ar2, kind='table')
+
+        for dtype in [np.int32, np.int64]:
+            ar1 = np.array([-1, 2, 3, 4, 5], dtype=dtype)
+            # The range of this array will overflow:
+            overflow_ar2 = np.array([-1, np.iinfo(dtype).max], dtype=dtype)
+
+            # Error 3: `kind="table"` will trigger a runtime error
+            #  if there is an integer overflow expected when computing the
+            #  range of ar2
+            assert_raises(
+                RuntimeError,
+                in1d, ar1, overflow_ar2, kind='table'
+            )
+
+            # Non-error: `kind=None` will *not* trigger a runtime error
+            #  if there is an integer overflow, it will switch to
+            #  the `sort` algorithm.
+            result = np.in1d(ar1, overflow_ar2, kind=None)
+            assert_array_equal(result, [True] + [False] * 4)
+            result = np.in1d(ar1, overflow_ar2, kind='sort')
+            assert_array_equal(result, [True] + [False] * 4)
+
+    def test_union1d(self):
+        a = np.array([5, 4, 7, 1, 2])
+        b = np.array([2, 4, 3, 3, 2, 1, 5])
+
+        ec = np.array([1, 2, 3, 4, 5, 7])
+        c = union1d(a, b)
+        assert_array_equal(c, ec)
+
+        # Tests gh-10340, arguments to union1d should be
+        # flattened if they are not already 1D
+        x = np.array([[0, 1, 2], [3, 4, 5]])
+        y = np.array([0, 1, 2, 3, 4])
+        ez = np.array([0, 1, 2, 3, 4, 5])
+        z = union1d(x, y)
+        assert_array_equal(z, ez)
+
+        assert_array_equal([], union1d([], []))
+
+    def test_setdiff1d(self):
+        a = np.array([6, 5, 4, 7, 1, 2, 7, 4])
+        b = np.array([2, 4, 3, 3, 2, 1, 5])
+
+        ec = np.array([6, 7])
+        c = setdiff1d(a, b)
+        assert_array_equal(c, ec)
+
+        a = np.arange(21)
+        b = np.arange(19)
+        ec = np.array([19, 20])
+        c = setdiff1d(a, b)
+        assert_array_equal(c, ec)
+
+        assert_array_equal([], setdiff1d([], []))
+        a = np.array((), np.uint32)
+        assert_equal(setdiff1d(a, []).dtype, np.uint32)
+
+    def test_setdiff1d_unique(self):
+        a = np.array([3, 2, 1])
+        b = np.array([7, 5, 2])
+        expected = np.array([3, 1])
+        actual = setdiff1d(a, b, assume_unique=True)
+        assert_equal(actual, expected)
+
+    def test_setdiff1d_char_array(self):
+        a = np.array(['a', 'b', 'c'])
+        b = np.array(['a', 'b', 's'])
+        assert_array_equal(setdiff1d(a, b), np.array(['c']))
+
+    def test_manyways(self):
+        a = np.array([5, 7, 1, 2, 8])
+        b = np.array([9, 8, 2, 4, 3, 1, 5])
+
+        c1 = setxor1d(a, b)
+        aux1 = intersect1d(a, b)
+        aux2 = union1d(a, b)
+        c2 = setdiff1d(aux2, aux1)
+        assert_array_equal(c1, c2)
+
+
+class TestUnique:
+
+    def test_unique_1d(self):
+
+        def check_all(a, b, i1, i2, c, dt):
+            base_msg = 'check {0} failed for type {1}'
+
+            msg = base_msg.format('values', dt)
+            v = unique(a)
+            assert_array_equal(v, b, msg)
+
+            msg = base_msg.format('return_index', dt)
+            v, j = unique(a, True, False, False)
+            assert_array_equal(v, b, msg)
+            assert_array_equal(j, i1, msg)
+
+            msg = base_msg.format('return_inverse', dt)
+            v, j = unique(a, False, True, False)
+            assert_array_equal(v, b, msg)
+            assert_array_equal(j, i2, msg)
+
+            msg = base_msg.format('return_counts', dt)
+            v, j = unique(a, False, False, True)
+            assert_array_equal(v, b, msg)
+            assert_array_equal(j, c, msg)
+
+            msg = base_msg.format('return_index and return_inverse', dt)
+            v, j1, j2 = unique(a, True, True, False)
+            assert_array_equal(v, b, msg)
+            assert_array_equal(j1, i1, msg)
+            assert_array_equal(j2, i2, msg)
+
+            msg = base_msg.format('return_index and return_counts', dt)
+            v, j1, j2 = unique(a, True, False, True)
+            assert_array_equal(v, b, msg)
+            assert_array_equal(j1, i1, msg)
+            assert_array_equal(j2, c, msg)
+
+            msg = base_msg.format('return_inverse and return_counts', dt)
+            v, j1, j2 = unique(a, False, True, True)
+            assert_array_equal(v, b, msg)
+            assert_array_equal(j1, i2, msg)
+            assert_array_equal(j2, c, msg)
+
+            msg = base_msg.format(('return_index, return_inverse '
+                                   'and return_counts'), dt)
+            v, j1, j2, j3 = unique(a, True, True, True)
+            assert_array_equal(v, b, msg)
+            assert_array_equal(j1, i1, msg)
+            assert_array_equal(j2, i2, msg)
+            assert_array_equal(j3, c, msg)
+
+        a = [5, 7, 1, 2, 1, 5, 7]*10
+        b = [1, 2, 5, 7]
+        i1 = [2, 3, 0, 1]
+        i2 = [2, 3, 0, 1, 0, 2, 3]*10
+        c = np.multiply([2, 1, 2, 2], 10)
+
+        # test for numeric arrays
+        types = []
+        types.extend(np.typecodes['AllInteger'])
+        types.extend(np.typecodes['AllFloat'])
+        types.append('datetime64[D]')
+        types.append('timedelta64[D]')
+        for dt in types:
+            aa = np.array(a, dt)
+            bb = np.array(b, dt)
+            check_all(aa, bb, i1, i2, c, dt)
+
+        # test for object arrays
+        dt = 'O'
+        aa = np.empty(len(a), dt)
+        aa[:] = a
+        bb = np.empty(len(b), dt)
+        bb[:] = b
+        check_all(aa, bb, i1, i2, c, dt)
+
+        # test for structured arrays
+        dt = [('', 'i'), ('', 'i')]
+        aa = np.array(list(zip(a, a)), dt)
+        bb = np.array(list(zip(b, b)), dt)
+        check_all(aa, bb, i1, i2, c, dt)
+
+        # test for ticket #2799
+        aa = [1. + 0.j, 1 - 1.j, 1]
+        assert_array_equal(np.unique(aa), [1. - 1.j, 1. + 0.j])
+
+        # test for ticket #4785
+        a = [(1, 2), (1, 2), (2, 3)]
+        unq = [1, 2, 3]
+        inv = [0, 1, 0, 1, 1, 2]
+        a1 = unique(a)
+        assert_array_equal(a1, unq)
+        a2, a2_inv = unique(a, return_inverse=True)
+        assert_array_equal(a2, unq)
+        assert_array_equal(a2_inv, inv)
+
+        # test for chararrays with return_inverse (gh-5099)
+        a = np.chararray(5)
+        a[...] = ''
+        a2, a2_inv = np.unique(a, return_inverse=True)
+        assert_array_equal(a2_inv, np.zeros(5))
+
+        # test for ticket #9137
+        a = []
+        a1_idx = np.unique(a, return_index=True)[1]
+        a2_inv = np.unique(a, return_inverse=True)[1]
+        a3_idx, a3_inv = np.unique(a, return_index=True,
+                                   return_inverse=True)[1:]
+        assert_equal(a1_idx.dtype, np.intp)
+        assert_equal(a2_inv.dtype, np.intp)
+        assert_equal(a3_idx.dtype, np.intp)
+        assert_equal(a3_inv.dtype, np.intp)
+
+        # test for ticket 2111 - float
+        a = [2.0, np.nan, 1.0, np.nan]
+        ua = [1.0, 2.0, np.nan]
+        ua_idx = [2, 0, 1]
+        ua_inv = [1, 2, 0, 2]
+        ua_cnt = [1, 1, 2]
+        assert_equal(np.unique(a), ua)
+        assert_equal(np.unique(a, return_index=True), (ua, ua_idx))
+        assert_equal(np.unique(a, return_inverse=True), (ua, ua_inv))
+        assert_equal(np.unique(a, return_counts=True), (ua, ua_cnt))
+
+        # test for ticket 2111 - complex
+        a = [2.0-1j, np.nan, 1.0+1j, complex(0.0, np.nan), complex(1.0, np.nan)]
+        ua = [1.0+1j, 2.0-1j, complex(0.0, np.nan)]
+        ua_idx = [2, 0, 3]
+        ua_inv = [1, 2, 0, 2, 2]
+        ua_cnt = [1, 1, 3]
+        assert_equal(np.unique(a), ua)
+        assert_equal(np.unique(a, return_index=True), (ua, ua_idx))
+        assert_equal(np.unique(a, return_inverse=True), (ua, ua_inv))
+        assert_equal(np.unique(a, return_counts=True), (ua, ua_cnt))
+
+        # test for ticket 2111 - datetime64
+        nat = np.datetime64('nat')
+        a = [np.datetime64('2020-12-26'), nat, np.datetime64('2020-12-24'), nat]
+        ua = [np.datetime64('2020-12-24'), np.datetime64('2020-12-26'), nat]
+        ua_idx = [2, 0, 1]
+        ua_inv = [1, 2, 0, 2]
+        ua_cnt = [1, 1, 2]
+        assert_equal(np.unique(a), ua)
+        assert_equal(np.unique(a, return_index=True), (ua, ua_idx))
+        assert_equal(np.unique(a, return_inverse=True), (ua, ua_inv))
+        assert_equal(np.unique(a, return_counts=True), (ua, ua_cnt))
+
+        # test for ticket 2111 - timedelta
+        nat = np.timedelta64('nat')
+        a = [np.timedelta64(1, 'D'), nat, np.timedelta64(1, 'h'), nat]
+        ua = [np.timedelta64(1, 'h'), np.timedelta64(1, 'D'), nat]
+        ua_idx = [2, 0, 1]
+        ua_inv = [1, 2, 0, 2]
+        ua_cnt = [1, 1, 2]
+        assert_equal(np.unique(a), ua)
+        assert_equal(np.unique(a, return_index=True), (ua, ua_idx))
+        assert_equal(np.unique(a, return_inverse=True), (ua, ua_inv))
+        assert_equal(np.unique(a, return_counts=True), (ua, ua_cnt))
+
+        # test for gh-19300
+        all_nans = [np.nan] * 4
+        ua = [np.nan]
+        ua_idx = [0]
+        ua_inv = [0, 0, 0, 0]
+        ua_cnt = [4]
+        assert_equal(np.unique(all_nans), ua)
+        assert_equal(np.unique(all_nans, return_index=True), (ua, ua_idx))
+        assert_equal(np.unique(all_nans, return_inverse=True), (ua, ua_inv))
+        assert_equal(np.unique(all_nans, return_counts=True), (ua, ua_cnt))
+
+    def test_unique_axis_errors(self):
+        assert_raises(TypeError, self._run_axis_tests, object)
+        assert_raises(TypeError, self._run_axis_tests,
+                      [('a', int), ('b', object)])
+
+        assert_raises(np.AxisError, unique, np.arange(10), axis=2)
+        assert_raises(np.AxisError, unique, np.arange(10), axis=-2)
+
+    def test_unique_axis_list(self):
+        msg = "Unique failed on list of lists"
+        inp = [[0, 1, 0], [0, 1, 0]]
+        inp_arr = np.asarray(inp)
+        assert_array_equal(unique(inp, axis=0), unique(inp_arr, axis=0), msg)
+        assert_array_equal(unique(inp, axis=1), unique(inp_arr, axis=1), msg)
+
+    def test_unique_axis(self):
+        types = []
+        types.extend(np.typecodes['AllInteger'])
+        types.extend(np.typecodes['AllFloat'])
+        types.append('datetime64[D]')
+        types.append('timedelta64[D]')
+        types.append([('a', int), ('b', int)])
+        types.append([('a', int), ('b', float)])
+
+        for dtype in types:
+            self._run_axis_tests(dtype)
+
+        msg = 'Non-bitwise-equal booleans test failed'
+        data = np.arange(10, dtype=np.uint8).reshape(-1, 2).view(bool)
+        result = np.array([[False, True], [True, True]], dtype=bool)
+        assert_array_equal(unique(data, axis=0), result, msg)
+
+        msg = 'Negative zero equality test failed'
+        data = np.array([[-0.0, 0.0], [0.0, -0.0], [-0.0, 0.0], [0.0, -0.0]])
+        result = np.array([[-0.0, 0.0]])
+        assert_array_equal(unique(data, axis=0), result, msg)
+
+    @pytest.mark.parametrize("axis", [0, -1])
+    def test_unique_1d_with_axis(self, axis):
+        x = np.array([4, 3, 2, 3, 2, 1, 2, 2])
+        uniq = unique(x, axis=axis)
+        assert_array_equal(uniq, [1, 2, 3, 4])
+
+    def test_unique_axis_zeros(self):
+        # issue 15559
+        single_zero = np.empty(shape=(2, 0), dtype=np.int8)
+        uniq, idx, inv, cnt = unique(single_zero, axis=0, return_index=True,
+                                     return_inverse=True, return_counts=True)
+
+        # there's 1 element of shape (0,) along axis 0
+        assert_equal(uniq.dtype, single_zero.dtype)
+        assert_array_equal(uniq, np.empty(shape=(1, 0)))
+        assert_array_equal(idx, np.array([0]))
+        assert_array_equal(inv, np.array([0, 0]))
+        assert_array_equal(cnt, np.array([2]))
+
+        # there's 0 elements of shape (2,) along axis 1
+        uniq, idx, inv, cnt = unique(single_zero, axis=1, return_index=True,
+                                     return_inverse=True, return_counts=True)
+
+        assert_equal(uniq.dtype, single_zero.dtype)
+        assert_array_equal(uniq, np.empty(shape=(2, 0)))
+        assert_array_equal(idx, np.array([]))
+        assert_array_equal(inv, np.array([]))
+        assert_array_equal(cnt, np.array([]))
+
+        # test a "complicated" shape
+        shape = (0, 2, 0, 3, 0, 4, 0)
+        multiple_zeros = np.empty(shape=shape)
+        for axis in range(len(shape)):
+            expected_shape = list(shape)
+            if shape[axis] == 0:
+                expected_shape[axis] = 0
+            else:
+                expected_shape[axis] = 1
+
+            assert_array_equal(unique(multiple_zeros, axis=axis),
+                               np.empty(shape=expected_shape))
+
+    def test_unique_masked(self):
+        # issue 8664
+        x = np.array([64, 0, 1, 2, 3, 63, 63, 0, 0, 0, 1, 2, 0, 63, 0],
+                     dtype='uint8')
+        y = np.ma.masked_equal(x, 0)
+
+        v = np.unique(y)
+        v2, i, c = np.unique(y, return_index=True, return_counts=True)
+
+        msg = 'Unique returned different results when asked for index'
+        assert_array_equal(v.data, v2.data, msg)
+        assert_array_equal(v.mask, v2.mask, msg)
+
+    def test_unique_sort_order_with_axis(self):
+        # These tests fail if sorting along axis is done by treating subarrays
+        # as unsigned byte strings.  See gh-10495.
+        fmt = "sort order incorrect for integer type '%s'"
+        for dt in 'bhilq':
+            a = np.array([[-1], [0]], dt)
+            b = np.unique(a, axis=0)
+            assert_array_equal(a, b, fmt % dt)
+
+    def _run_axis_tests(self, dtype):
+        data = np.array([[0, 1, 0, 0],
+                         [1, 0, 0, 0],
+                         [0, 1, 0, 0],
+                         [1, 0, 0, 0]]).astype(dtype)
+
+        msg = 'Unique with 1d array and axis=0 failed'
+        result = np.array([0, 1])
+        assert_array_equal(unique(data), result.astype(dtype), msg)
+
+        msg = 'Unique with 2d array and axis=0 failed'
+        result = np.array([[0, 1, 0, 0], [1, 0, 0, 0]])
+        assert_array_equal(unique(data, axis=0), result.astype(dtype), msg)
+
+        msg = 'Unique with 2d array and axis=1 failed'
+        result = np.array([[0, 0, 1], [0, 1, 0], [0, 0, 1], [0, 1, 0]])
+        assert_array_equal(unique(data, axis=1), result.astype(dtype), msg)
+
+        msg = 'Unique with 3d array and axis=2 failed'
+        data3d = np.array([[[1, 1],
+                            [1, 0]],
+                           [[0, 1],
+                            [0, 0]]]).astype(dtype)
+        result = np.take(data3d, [1, 0], axis=2)
+        assert_array_equal(unique(data3d, axis=2), result, msg)
+
+        uniq, idx, inv, cnt = unique(data, axis=0, return_index=True,
+                                     return_inverse=True, return_counts=True)
+        msg = "Unique's return_index=True failed with axis=0"
+        assert_array_equal(data[idx], uniq, msg)
+        msg = "Unique's return_inverse=True failed with axis=0"
+        assert_array_equal(uniq[inv], data)
+        msg = "Unique's return_counts=True failed with axis=0"
+        assert_array_equal(cnt, np.array([2, 2]), msg)
+
+        uniq, idx, inv, cnt = unique(data, axis=1, return_index=True,
+                                     return_inverse=True, return_counts=True)
+        msg = "Unique's return_index=True failed with axis=1"
+        assert_array_equal(data[:, idx], uniq)
+        msg = "Unique's return_inverse=True failed with axis=1"
+        assert_array_equal(uniq[:, inv], data)
+        msg = "Unique's return_counts=True failed with axis=1"
+        assert_array_equal(cnt, np.array([2, 1, 1]), msg)
+
+    def test_unique_nanequals(self):
+        # issue 20326
+        a = np.array([1, 1, np.nan, np.nan, np.nan])
+        unq = np.unique(a)
+        not_unq = np.unique(a, equal_nan=False)
+        assert_array_equal(unq, np.array([1, np.nan]))
+        assert_array_equal(not_unq, np.array([1, np.nan, np.nan, np.nan]))

.CondaPkg/env/Lib/site-packages/numpy/lib/tests/test_arrayterator.py

@@ -0,0 +1,46 @@
+from operator import mul
+from functools import reduce
+
+import numpy as np
+from numpy.random import randint
+from numpy.lib import Arrayterator
+from numpy.testing import assert_
+
+
+def test():
+    np.random.seed(np.arange(10))
+
+    # Create a random array
+    ndims = randint(5)+1
+    shape = tuple(randint(10)+1 for dim in range(ndims))
+    els = reduce(mul, shape)
+    a = np.arange(els)
+    a.shape = shape
+
+    buf_size = randint(2*els)
+    b = Arrayterator(a, buf_size)
+
+    # Check that each block has at most ``buf_size`` elements
+    for block in b:
+        assert_(len(block.flat) <= (buf_size or els))
+
+    # Check that all elements are iterated correctly
+    assert_(list(b.flat) == list(a.flat))
+
+    # Slice arrayterator
+    start = [randint(dim) for dim in shape]
+    stop = [randint(dim)+1 for dim in shape]
+    step = [randint(dim)+1 for dim in shape]
+    slice_ = tuple(slice(*t) for t in zip(start, stop, step))
+    c = b[slice_]
+    d = a[slice_]
+
+    # Check that each block has at most ``buf_size`` elements
+    for block in c:
+        assert_(len(block.flat) <= (buf_size or els))
+
+    # Check that the arrayterator is sliced correctly
+    assert_(np.all(c.__array__() == d))
+
+    # Check that all elements are iterated correctly
+    assert_(list(c.flat) == list(d.flat))